NPASS Compound

Natural Product: NPC473826

Natural Product ID	NPC473826
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Ciwujianoside C1
IUPAC Name	[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aS,6aS,6bR,8aR,10S,12aR,14bS)-6a,9,9,12a-tetramethyl-2-methylidene-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate
Synonyms	Ciwujianoside C1
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL452890
PubChem CID	44559148
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001755] Diterpene glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 152160 0 0 0 0 0 0 0 0999 V2000 10.4422 1.9227 3.1233 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9623 1.3716 1.9435 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1590 0.1886 1.4875 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8487 0.6521 1.2884 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9712 -0.4101 1.0749 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9541 -0.1037 0.2053 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7035 -0.0773 0.8202 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6819 0.2623 -0.2382 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4007 0.3296 0.2712 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4773 0.1164 -0.7428 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2100 0.4174 -0.1767 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2273 -0.5340 -0.0634 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4258 -1.6930 -0.4549 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0788 -0.1256 0.5433 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7130 0.4028 1.9404 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2974 -0.5583 2.5142 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1720 -1.9542 2.3023 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7098 -2.9702 2.4834 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5740 -2.1876 1.9135 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9531 -1.3085 0.7588 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4191 -0.9766 0.8705 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2936 -1.7419 1.4689 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7368 -1.4800 1.6142 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1685 -0.2216 0.8984 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2952 -0.0305 -0.2791 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8887 0.2930 0.2605 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9921 0.7709 -0.8284 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6118 0.9625 -0.3211 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0019 1.3819 1.3149 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6463 1.0657 -1.2151 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1015 0.8845 -1.5998 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8721 0.9817 -0.2917 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6533 -0.2045 0.5813 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0029 -1.5260 -0.0043 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4321 -0.0230 1.8580 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4450 1.0525 1.8347 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2239 1.1980 0.5662 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2657 1.4028 -0.5796 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1306 2.9207 -0.8825 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7983 0.8469 -1.8890 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2566 0.3399 0.3690 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5231 0.8078 0.3960 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.1247 0.3150 1.5782 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.8760 -1.0355 1.6013 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.5272 -1.7792 0.4768 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.5419 -1.0828 -0.8356 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.4527 0.3872 -0.6988 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.7609 0.8236 -0.3509 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5998 -1.6665 -1.6764 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.8222 -2.9911 0.3312 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7463 1.0548 -1.8810 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7561 2.1273 -1.5881 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0302 1.5356 -0.9981 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9689 1.3234 -1.9988 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2340 3.1422 -0.7906 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0353 0.3740 -3.0671 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6366 -1.6787 0.6750 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8478 -1.5321 -0.1893 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6436 -0.2879 0.1670 C 0 0 2 0 0 0 0 0 0 0 0 0 11.9900 -0.4642 0.0140 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5535 0.2621 -1.0090 C 0 0 2 0 0 0 0 0 0 0 0 0 13.0990 -0.5575 -2.0030 O 0 0 0 0 0 0 0 0 0 0 0 0 14.1630 -1.3176 -1.5896 C 0 0 1 0 0 0 0 0 0 0 0 0 14.7283 -1.9958 -2.8350 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2830 -0.4806 -1.0027 C 0 0 1 0 0 0 0 0 0 0 0 0 14.9490 0.9974 -1.1798 C 0 0 2 0 0 0 0 0 0 0 0 0 13.6079 1.1784 -0.4566 C 0 0 1 0 0 0 0 0 0 0 0 0 13.1894 2.5000 -0.5579 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8333 1.3597 -2.4989 O 0 0 0 0 0 0 0 0 0 0 0 0 15.2527 -0.7227 0.3886 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4804 -1.5071 -1.5317 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8899 -2.5361 1.7740 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1942 1.1661 3.7101 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9961 0.9702 2.1572 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0563 2.0841 1.1249 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0911 -0.5939 2.2666 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4884 -0.5767 2.0838 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4531 -1.1090 1.1693 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6645 0.5774 1.6889 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7056 -0.5496 -0.9894 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5233 -0.9480 -1.0747 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5935 0.3918 2.5800 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2259 1.3947 1.8400 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4499 -0.3499 3.5995 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2537 -0.4643 1.9623 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4452 -4.0055 2.3502 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7281 -2.7451 2.7672 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6824 -3.2674 1.5945 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2110 -1.9968 2.8114 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8438 -1.9388 -0.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9215 -2.6754 1.9093 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2649 -2.3970 1.2179 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0212 -1.3730 2.6958 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0402 0.6157 1.6481 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2100 -0.9727 -0.8421 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3898 1.7483 -1.1884 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9696 0.0128 -1.6391 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4645 1.9223 0.2271 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9651 1.1103 -1.2466 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0826 1.9897 1.4187 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1513 0.9302 2.3326 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8037 2.1203 1.0806 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4411 2.0831 -0.8488 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0227 0.9421 -2.1311 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1623 -0.1359 -2.0319 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3913 1.6875 -2.2725 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3734 1.8295 0.2698 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1719 -1.9951 -0.5737 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9060 -1.3827 -0.6629 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3676 -2.1864 0.8115 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7013 0.2488 2.6817 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8411 -1.0125 2.2268 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1102 0.9372 2.7109 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9140 2.0237 2.0016 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7547 2.1960 0.7068 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8373 3.0851 -1.9228 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4820 3.4020 -0.1434 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1582 3.3154 -0.7496 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4996 0.0311 -1.7516 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0120 0.4943 -2.5739 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3618 1.6254 -2.4848 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5738 1.9311 0.5732 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7914 -1.2705 1.6656 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3073 -1.4214 2.5705 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5487 -2.0957 0.8130 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5404 -1.3626 -1.3202 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2657 0.9222 -1.6552 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1099 0.3114 0.4176 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9508 -1.8793 -2.5787 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1590 -3.5136 -0.4540 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7842 1.6017 -2.0995 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0466 2.5905 -2.5527 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4199 2.2664 -0.2689 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6210 0.6094 -2.5804 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6803 4.0200 -0.9527 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4436 1.0280 -3.6923 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8878 -2.2615 0.0595 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4593 -2.4537 -0.0634 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3289 0.4702 -0.6110 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7638 0.8914 -1.4866 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8582 -2.1507 -0.9056 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8347 -2.1673 -2.6848 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5414 -1.3354 -3.6918 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1867 -2.9415 -3.0006 H 0 0 0 0 0 0 0 0 0 0 0 0 16.2420 -0.7671 -1.4260 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6627 1.6420 -0.6513 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7711 0.9594 0.6210 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3695 3.0002 0.2770 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7132 1.1799 -2.9308 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6178 0.1000 0.8141 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6758 -0.9719 -1.7033 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2048 -3.3818 1.3393 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 14 12 1 6 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 2 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 26 29 1 1 25 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 6 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 37 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 10 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 52 55 1 0 51 56 1 0 5 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 66 69 1 0 65 70 1 0 58 71 1 0 57 72 1 0 59 3 1 0 67 61 1 0 53 8 1 0 28 14 1 0 38 32 1 0 47 42 1 0 20 14 1 0 26 21 1 0 33 24 1 0 1 73 1 0 2 74 1 0 2 75 1 0 3 76 1 1 5 77 1 1 7 78 1 0 7 79 1 0 8 80 1 6 10 81 1 6 15 82 1 0 15 83 1 0 16 84 1 0 16 85 1 0 18 86 1 0 18 87 1 0 19 88 1 0 19 89 1 0 20 90 1 6 22 91 1 0 23 92 1 0 23 93 1 0 24 94 1 1 25 95 1 6 27 96 1 0 27 97 1 0 28 98 1 0 28 99 1 0 29100 1 0 29101 1 0 29102 1 0 30103 1 0 30104 1 0 31105 1 0 31106 1 0 32107 1 1 34108 1 0 34109 1 0 34110 1 0 35111 1 0 35112 1 0 36113 1 0 36114 1 0 37115 1 1 39116 1 0 39117 1 0 39118 1 0 40119 1 0 40120 1 0 40121 1 0 42122 1 1 44123 1 0 44124 1 0 45125 1 1 46126 1 6 47127 1 6 48128 1 0 49129 1 0 50130 1 0 51131 1 6 52132 1 6 53133 1 1 54134 1 0 55135 1 0 56136 1 0 57137 1 6 58138 1 6 59139 1 6 61140 1 6 63141 1 1 64142 1 0 64143 1 0 64144 1 0 65145 1 6 66146 1 1 67147 1 1 68148 1 0 69149 1 0 70150 1 0 71151 1 0 72152 1 0 M END

Standard InCHIKey	LQPWRMRELFRFPB-DWPVWJEWSA-N
Standard InCHI	InChI=1S/C51H80O21/c1-21-11-14-51(16-15-49(5)23-9-10-30-48(3,4)31(70-44-38(60)33(55)27(53)19-65-44)12-13-50(30,6)24(23)7-8-25(49)26(51)17-21)47(64)72-46-40(62)36(58)34(56)29(69-46)20-66-43-41(63)37(59)42(28(18-52)68-43)71-45-39(61)35(57)32(54)22(2)67-45/h8,22-24,26-46,52-63H,1,7,9-20H2,2-6H3/t22-,23+,24-,26-,27-,28+,29+,30-,31-,32-,33-,34+,35+,36-,37+,38+,39+,40+,41+,42+,43+,44-,45-,46-,49-,50+,51-/m0/s1
SMILES	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CCC(=C)C[C@H]4C4=CC[C@H]5[C@H]([C@@]4(CC3)C)CC[C@@H]3[C@]5(C)CC[C@@H](C3(C)C)O[C@@H]3OC[C@@H]([C@@H]([C@H]3O)O)O)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1028.52	Volume:	990.329 ? Van der Waals volume.
Dense:	1.039	LogP:	1.47 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.037 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.814 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	52.0
TPSA:	333.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.069	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.767	Fsp³:	0.902
MCE-18:	185.072 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.822	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.217	Promiscuous compounds:	0.19

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.377	MDCK Permeability:	-4.967
Pgp-inhibitor:	0.0	Pgp-substrate:	0.75
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.065
20% Bioavailability (F20%):	0.221	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.007	MRP1:	0.005
Plasma Protein Binding (PPB):	62.406%	Volume Distribution (VD):	-0.306
Fu:	26.285% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.989
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.948
HLM stability:	0.082 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.266

Half-life (T1/2):

3.926

ADMET: Toxicity

hERG Blockers:	0.007	hERG Blockers (10um):	0.021
Human Hepatotoxicity (H-HT):	0.472	Drug-induced Liver Injury (DILI):	0.873
AMES Toxicity:	0.972	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.014	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.465	Drug-induced Nephrotoxicity:	0.956
Genotoxicity:	0.032	RPMI-8226 Immunitoxicity:	0.296
A549 Cytotoxicity:	0.958	Hek293 Cytotoxicity:	0.536
BCF:	2.098 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.163 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.641 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.923 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	leaf	n.a.	PMID[11816040]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[17125224]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	Barks	Iksan, Chunbuk, Korea	n.a.	PMID[3127544]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[HerDing]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2797	Individual protein	Pancreatic lipase	Homo sapiens	Inhibition	=	46.5	%	PMID[11908979]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC473826 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19992
0.1-0.2	25959
0.2-0.3	2801
0.3-0.4	891
0.4-0.5	159
0.5-0.6	41
0.6-0.7	12
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8641	High Similarity	NPC114287
0.7658	Intermediate Similarity	NPC309907
0.7105	Intermediate Similarity	NPC165204
0.6875	Remote Similarity	NPC295823
0.6875	Remote Similarity	NPC174720
0.6875	Remote Similarity	NPC475467
0.6752	Remote Similarity	NPC475209
0.65	Remote Similarity	NPC488560
0.6293	Remote Similarity	NPC241909
0.614	Remote Similarity	NPC148417
0.6083	Remote Similarity	NPC60557
0.6083	Remote Similarity	NPC67857
0.6048	Remote Similarity	NPC481080
0.6016	Remote Similarity	NPC475160
0.6016	Remote Similarity	NPC473714
0.5938	Remote Similarity	NPC236638
0.5938	Remote Similarity	NPC294453
0.5935	Remote Similarity	NPC135904
0.5827	Remote Similarity	NPC110633
0.5758	Remote Similarity	NPC250247
0.5748	Remote Similarity	NPC476068
0.5692	Remote Similarity	NPC136768
0.563	Remote Similarity	NPC469821
0.5573	Remote Similarity	NPC305981
0.5565	Remote Similarity	NPC76972
0.5565	Remote Similarity	NPC469782
0.5565	Remote Similarity	NPC204414
0.5538	Remote Similarity	NPC258617
0.553	Remote Similarity	NPC261506
0.553	Remote Similarity	NPC4328
0.5455	Remote Similarity	NPC202828
0.5455	Remote Similarity	NPC119592
0.5424	Remote Similarity	NPC104071
0.542	Remote Similarity	NPC41061
0.542	Remote Similarity	NPC227551
0.5397	Remote Similarity	NPC192600
0.5379	Remote Similarity	NPC43550
0.5378	Remote Similarity	NPC102439
0.5294	Remote Similarity	NPC287269
0.5285	Remote Similarity	NPC481079
0.525	Remote Similarity	NPC101744
0.5217	Remote Similarity	NPC48499
0.5194	Remote Similarity	NPC155410
0.5188	Remote Similarity	NPC475514
0.5154	Remote Similarity	NPC100639
0.5122	Remote Similarity	NPC134835
0.5122	Remote Similarity	NPC601659
0.5111	Remote Similarity	NPC481081
0.5109	Remote Similarity	NPC224381
0.5109	Remote Similarity	NPC220160
0.5074	Remote Similarity	NPC298034
0.5074	Remote Similarity	NPC71065
0.5044	Remote Similarity	NPC128925
0.5043	Remote Similarity	NPC90856
0.5042	Remote Similarity	NPC295371
0.5041	Remote Similarity	NPC146563

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC473826 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6952
0.1-0.2	2137
0.2-0.3	59
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data