NPASS Compound

Natural Product: NPC165204

Natural Product ID	NPC165204
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UPROOJBJZLZCGS-CHTHVDMYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	195123
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001755] Diterpene glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 175184 0 0 0 0 0 0 0 0999 V2000 3.3825 -2.0021 -1.1565 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6552 -1.4131 -0.2278 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6078 -2.0120 1.1287 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3146 -1.6993 1.8349 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9705 -0.2427 1.7060 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2238 0.1154 2.5847 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4134 0.6243 1.8672 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7428 -0.2279 0.7030 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1742 -1.5709 1.2649 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5453 -0.4089 -0.2060 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8110 -0.9679 -1.3791 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1448 -1.4105 -1.8575 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2448 -0.8534 -1.0520 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5610 -0.6380 -1.7743 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4696 0.0945 -3.0531 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0522 -2.0520 -2.1321 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4627 -2.1274 -2.5449 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4645 -1.4371 -1.6626 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9621 -0.1483 -1.0810 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4347 1.0005 -1.9233 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6586 0.0071 0.2886 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5222 -0.1344 -0.7640 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1183 1.2079 -0.2233 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8776 0.9533 0.6091 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8043 0.3291 -0.2330 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2304 1.4173 -1.0866 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6512 -1.1754 -2.2899 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7849 -1.7723 -1.7862 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9777 -0.8780 -1.6517 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1622 -1.6541 -2.2785 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.8925 -1.6755 -3.7743 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.4928 -2.2439 -3.9495 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0486 -2.8091 -2.7542 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8709 -0.3585 -4.2117 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3791 -1.1449 -1.9498 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3538 -0.6574 -0.3568 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5129 0.6399 0.0416 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.9056 0.9935 0.5243 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.2597 0.0944 1.7134 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.2428 0.4341 2.7943 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.8681 0.1706 2.2087 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.7784 0.3329 3.2374 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6377 0.9086 1.0688 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5011 -0.4012 3.8778 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.5484 0.4146 2.1077 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.9380 2.2969 1.0348 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7390 0.0925 0.2710 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9243 -0.1828 -0.5922 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1124 0.5494 2.2239 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9641 1.3739 3.1851 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3775 0.4509 1.7164 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4463 1.1992 2.2057 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5047 0.2761 2.7610 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5958 1.1755 3.3144 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3158 2.6239 3.1122 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7794 3.0059 1.7652 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9410 3.4100 0.8832 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8089 2.3512 0.6831 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9059 2.7350 -0.1313 C 0 0 1 0 0 0 0 0 0 0 0 0 10.1125 2.7509 0.7564 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4078 2.6064 0.0378 C 0 0 2 0 0 0 0 0 0 0 0 0 11.2390 1.3972 -0.8956 C 0 0 1 0 0 0 0 0 0 0 0 0 10.1526 1.7563 -1.8701 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0306 0.7963 -3.0178 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1690 1.3589 -3.9735 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9572 2.0146 -1.2729 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4639 1.1306 -1.4583 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9513 -0.1237 -1.0666 C 0 0 1 0 0 0 0 0 0 0 0 0 13.1733 -1.0237 -2.2412 C 0 0 1 0 0 0 0 0 0 0 0 0 14.2558 -2.0388 -1.8563 C 0 0 1 0 0 0 0 0 0 0 0 0 14.0016 -2.3532 -0.3924 C 0 0 2 0 0 0 0 0 0 0 0 0 14.2922 -1.1316 0.4631 C 0 0 2 0 0 0 0 0 0 0 0 0 13.3246 -1.1461 1.6033 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0886 0.0365 -0.2768 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8916 -3.3520 -0.0121 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0978 -3.2187 -2.5630 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9640 -1.7109 -2.4638 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4211 2.3431 0.9167 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1654 3.9457 1.5114 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0071 1.9825 1.2014 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5491 3.1708 4.1715 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8405 0.8292 2.8066 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8860 -0.4785 3.7674 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4615 -1.6192 -2.1639 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9235 -2.9022 -0.9172 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5154 -1.8080 1.7370 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5690 -3.1386 0.9295 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4086 -1.9919 2.9021 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5572 -2.3716 1.3765 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3754 -0.7293 3.2799 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1024 0.9556 3.2766 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2435 1.6912 1.6351 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2689 0.6012 2.5744 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5940 -1.8189 2.2054 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2209 -1.5478 1.6334 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9333 -2.4257 0.6037 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0528 -1.1126 -2.0414 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2554 -1.2493 -2.9578 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1531 -2.5361 -1.7662 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5268 -1.6524 -0.2935 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0714 1.0984 -3.0454 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9785 -0.5752 -3.8100 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5220 0.1794 -3.4569 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4239 -2.3371 -3.0224 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7536 -2.7180 -1.3133 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7390 -3.2022 -2.5868 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5452 -1.7752 -3.6161 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6852 -2.1392 -0.8120 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6661 1.7811 -2.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8355 0.6325 -2.9052 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3087 1.5467 -1.4622 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9890 1.0568 0.4108 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5372 -0.6356 0.3249 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9476 -0.1752 1.1244 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4038 -0.8387 0.1247 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9038 1.6067 0.4682 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9626 1.9693 -0.9842 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5094 1.9136 0.9786 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1842 0.3474 1.4799 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3877 1.9711 -0.6193 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8792 1.1019 -2.0822 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9838 2.2510 -1.2535 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6663 -2.3562 -0.8682 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8101 0.0540 -2.2349 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0419 -2.6947 -1.9156 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6172 -2.2590 -4.3352 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7890 -1.4997 -4.3707 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5675 -3.0716 -4.6777 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7953 -0.0169 -4.3509 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9346 -1.8181 -1.4775 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2981 1.3733 -0.7853 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6950 0.8959 -0.2060 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2345 -0.9617 1.4409 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3783 1.5067 3.0586 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8603 -0.9012 1.9010 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4420 1.3821 3.3640 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9122 -0.2749 2.9113 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1829 -0.0865 4.1903 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8558 0.0949 4.6580 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1708 -0.1822 1.6319 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6588 2.8061 0.6007 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6568 1.2398 0.2686 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6747 0.6550 -0.4339 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6725 -0.0987 -1.6567 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0292 1.8524 3.0308 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8752 -0.3397 1.9264 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6315 1.0073 4.4311 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3116 3.1526 3.2309 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1499 3.9162 1.8984 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5080 3.6851 -0.1039 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5112 4.2329 1.3401 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7043 3.8130 -0.3967 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0770 1.9343 1.5231 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6267 3.4821 -0.6264 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8529 0.5604 -0.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4909 2.7333 -2.3387 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0181 0.6907 -3.4794 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6744 -0.2040 -2.6966 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1279 0.7424 -4.7600 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1690 -0.5625 -0.3845 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5409 -0.5100 -3.1404 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2646 -1.6230 -1.9975 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9787 -2.7252 -0.2423 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3450 -1.1765 0.7776 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9002 -1.1290 2.5639 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6319 -0.2833 1.6268 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6769 -2.0520 1.6029 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4117 -4.1953 0.2048 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9359 -3.6708 -2.7552 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8133 -1.8872 -3.4260 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3633 2.8930 1.7557 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2916 4.7163 0.8853 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9165 2.7418 4.9866 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8864 -0.1350 2.6900 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3262 -1.3718 3.7814 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 1 8 10 1 0 10 11 2 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 6 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 19 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 18 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 30 35 1 0 29 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 40 44 1 0 39 45 1 0 38 46 1 0 10 47 1 0 47 48 1 0 5 49 1 1 49 50 2 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 63 66 1 0 62 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 72 74 1 0 71 75 1 0 70 76 1 0 69 77 1 0 61 78 1 0 60 79 1 0 56 80 1 0 55 81 1 0 54 82 1 0 53 83 1 0 48 2 1 0 80 52 1 0 47 5 1 0 66 59 1 0 74 68 1 0 25 8 1 0 33 28 1 0 43 37 1 0 25 13 1 0 22 14 1 0 1 84 1 0 1 85 1 0 3 86 1 0 3 87 1 0 4 88 1 0 4 89 1 0 6 90 1 0 6 91 1 0 7 92 1 0 7 93 1 0 9 94 1 0 9 95 1 0 9 96 1 0 11 97 1 0 12 98 1 0 12 99 1 0 13100 1 1 15101 1 0 15102 1 0 15103 1 0 16104 1 0 16105 1 0 17106 1 0 17107 1 0 18108 1 1 20109 1 0 20110 1 0 20111 1 0 21112 1 0 21113 1 0 21114 1 0 22115 1 1 23116 1 0 23117 1 0 24118 1 0 24119 1 0 26120 1 0 26121 1 0 26122 1 0 28123 1 1 29124 1 6 30125 1 1 31126 1 6 32127 1 0 32128 1 0 34129 1 0 35130 1 0 37131 1 6 38132 1 6 39133 1 6 40134 1 1 41135 1 6 42136 1 0 42137 1 0 42138 1 0 44139 1 0 45140 1 0 46141 1 0 47142 1 1 48143 1 0 48144 1 0 52145 1 1 53146 1 6 54147 1 1 55148 1 6 56149 1 1 57150 1 0 57151 1 0 59152 1 6 60153 1 1 61154 1 6 62155 1 1 63156 1 6 64157 1 0 64158 1 0 65159 1 0 68160 1 1 69161 1 6 70162 1 1 71163 1 6 72164 1 1 73165 1 0 73166 1 0 73167 1 0 75168 1 0 76169 1 0 77170 1 0 78171 1 0 79172 1 0 81173 1 0 82174 1 0 83175 1 0 M END

Standard InCHIKey	UPROOJBJZLZCGS-CHTHVDMYSA-N
Standard InCHI	InChI=1S/C58H92O25/c1-23-11-16-58(53(73)83-51-44(71)40(67)37(64)30(79-51)22-75-48-45(72)41(68)46(29(20-59)78-48)81-49-42(69)38(65)34(61)24(2)76-49)18-17-56(7)26(27(58)19-23)9-10-32-55(6)14-13-33(54(4,5)31(55)12-15-57(32,56)8)80-52-47(36(63)28(60)21-74-52)82-50-43(70)39(66)35(62)25(3)77-50/h9,24-25,27-52,59-72H,1,10-22H2,2-8H3/t24-,25-,27-,28-,29+,30+,31-,32+,33-,34-,35-,36-,37+,38+,39+,40-,41+,42+,43+,44+,45+,46+,47+,48+,49-,50-,51-,52-,55-,56+,57+,58-/m0/s1
SMILES	C=C1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]34C)O[C@H]3[C@@H]([C@H]([C@H](CO3)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)[C@@H]2C1)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1188.59	Volume:	1138.005 ? Van der Waals volume.
Dense:	1.044	LogP:	0.527 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.263 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.374 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	58.0
TPSA:	392.59 ? Topological Polar Surface Area.	H-Bond Acceptor:	25.0
H-Bond Donor:	14.0	Rings:	10.0
Heavy Atoms:	25.0

MedChem Properties

QED Drug-Likeness Score:	0.057	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.214	Fsp³:	0.914
MCE-18:	212.252 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.808	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.287	Promiscuous compounds:	0.09

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.63	MDCK Permeability:	-4.921
Pgp-inhibitor:	0.0	Pgp-substrate:	0.976
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.524
20% Bioavailability (F20%):	0.698	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.138
Plasma Protein Binding (PPB):	57.683%	Volume Distribution (VD):	-0.321
Fu:	25.744% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.543
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.549

Half-life (T1/2):

4.12

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.009
Human Hepatotoxicity (H-HT):	0.416	Drug-induced Liver Injury (DILI):	0.912
AMES Toxicity:	0.981	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.002	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.503	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.145	RPMI-8226 Immunitoxicity:	0.43
A549 Cytotoxicity:	0.883	Hek293 Cytotoxicity:	0.286
BCF:	1.611 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.623 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.08 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.285 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO26193	Piper methysticum	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11830162]
NPO26193	Piper methysticum	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12809361]
NPO11872	Eleutherococcus senticosus	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[17125224]
NPO26193	Piper methysticum	Species	Piperaceae	Eukaryota	root	n.a.	n.a.	PMID[25597012]
NPO11872	Eleutherococcus senticosus	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[27400231]
NPO26193	Piper methysticum	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11872	Eleutherococcus senticosus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26193	Piper methysticum	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO11872	Eleutherococcus senticosus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO26193	Piper methysticum	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO26193	Piper methysticum	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO11872	Eleutherococcus senticosus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO26193	Piper methysticum	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO11872	Eleutherococcus senticosus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT967	Individual protein	Xanthine dehydrogenase	Homo sapiens	IC50	=	97300.0	nM	PMID[28511908]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC165204 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22686
0.1-0.2	23271
0.2-0.3	2704
0.3-0.4	682
0.4-0.5	336
0.5-0.6	101
0.6-0.7	39
0.7-0.8	0
0.8-0.85	4
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8679	High Similarity	NPC60557
0.8679	High Similarity	NPC67857
0.844	Intermediate Similarity	NPC135904
0.8	Intermediate Similarity	NPC76972
0.8	Intermediate Similarity	NPC469782
0.8	Intermediate Similarity	NPC204414
0.7863	Intermediate Similarity	NPC236638
0.7863	Intermediate Similarity	NPC294453
0.7863	Intermediate Similarity	NPC305981
0.7797	Intermediate Similarity	NPC261506
0.7797	Intermediate Similarity	NPC4328
0.7692	Intermediate Similarity	NPC41061
0.7692	Intermediate Similarity	NPC227551
0.7636	Intermediate Similarity	NPC295823
0.7636	Intermediate Similarity	NPC174720
0.7636	Intermediate Similarity	NPC475467
0.7607	Intermediate Similarity	NPC110633
0.7339	Intermediate Similarity	NPC63159
0.7273	Intermediate Similarity	NPC202828
0.7273	Intermediate Similarity	NPC119592
0.7213	Intermediate Similarity	NPC298034
0.7213	Intermediate Similarity	NPC71065
0.719	Intermediate Similarity	NPC43550
0.7182	Intermediate Similarity	NPC148417
0.7177	Intermediate Similarity	NPC250247
0.7107	Intermediate Similarity	NPC258617
0.7105	Intermediate Similarity	NPC473826
0.7064	Intermediate Similarity	NPC112352
0.7059	Intermediate Similarity	NPC488560
0.7034	Intermediate Similarity	NPC309907
0.7018	Intermediate Similarity	NPC241909
0.7009	Intermediate Similarity	NPC79643
0.6992	Remote Similarity	NPC136768
0.6891	Remote Similarity	NPC155410
0.6833	Remote Similarity	NPC475160
0.6833	Remote Similarity	NPC100639
0.6833	Remote Similarity	NPC473714
0.6825	Remote Similarity	NPC220160
0.675	Remote Similarity	NPC123199
0.6721	Remote Similarity	NPC481080
0.6696	Remote Similarity	NPC104071
0.6667	Remote Similarity	NPC469776
0.664	Remote Similarity	NPC65105
0.6639	Remote Similarity	NPC475287
0.6637	Remote Similarity	NPC102439
0.6549	Remote Similarity	NPC160415
0.6532	Remote Similarity	NPC476068
0.6532	Remote Similarity	NPC57484
0.6491	Remote Similarity	NPC480475
0.6446	Remote Similarity	NPC192600
0.6414	Remote Similarity	NPC32723
0.637	Remote Similarity	NPC481323
0.637	Remote Similarity	NPC469778
0.6364	Remote Similarity	NPC48499
0.6356	Remote Similarity	NPC481079
0.6348	Remote Similarity	NPC101744
0.6341	Remote Similarity	NPC475209
0.6328	Remote Similarity	NPC481081
0.6308	Remote Similarity	NPC224381
0.6284	Remote Similarity	NPC135334
0.625	Remote Similarity	NPC293330
0.625	Remote Similarity	NPC161717
0.625	Remote Similarity	NPC481078
0.6242	Remote Similarity	NPC481324
0.6207	Remote Similarity	NPC469775
0.6207	Remote Similarity	NPC46665
0.6148	Remote Similarity	NPC114287
0.6087	Remote Similarity	NPC161674
0.6078	Remote Similarity	NPC295941
0.605	Remote Similarity	NPC134835
0.6033	Remote Similarity	NPC480473
0.5985	Remote Similarity	NPC70809
0.5973	Remote Similarity	NPC469774
0.5948	Remote Similarity	NPC469946
0.5906	Remote Similarity	NPC470218
0.5902	Remote Similarity	NPC480474
0.5882	Remote Similarity	NPC480422
0.5868	Remote Similarity	NPC73318
0.5855	Remote Similarity	NPC100925
0.584	Remote Similarity	NPC268184
0.5798	Remote Similarity	NPC173859
0.5798	Remote Similarity	NPC148603
0.5779	Remote Similarity	NPC469777
0.575	Remote Similarity	NPC68175
0.5726	Remote Similarity	NPC295371
0.5702	Remote Similarity	NPC297263
0.5682	Remote Similarity	NPC475514
0.5669	Remote Similarity	NPC469772
0.5656	Remote Similarity	NPC601659
0.5641	Remote Similarity	NPC473373
0.5625	Remote Similarity	NPC128925
0.5614	Remote Similarity	NPC90856
0.5606	Remote Similarity	NPC286457
0.56	Remote Similarity	NPC31838
0.56	Remote Similarity	NPC36831
0.56	Remote Similarity	NPC187290
0.5597	Remote Similarity	NPC469773
0.5583	Remote Similarity	NPC309714
0.5574	Remote Similarity	NPC222580
0.5565	Remote Similarity	NPC301449
0.5565	Remote Similarity	NPC601290
0.5556	Remote Similarity	NPC235405
0.5538	Remote Similarity	NPC471550
0.5537	Remote Similarity	NPC251768
0.5537	Remote Similarity	NPC164389
0.5528	Remote Similarity	NPC469821
0.5517	Remote Similarity	NPC472268
0.5508	Remote Similarity	NPC249848
0.5508	Remote Similarity	NPC107966
0.5507	Remote Similarity	NPC102505
0.5507	Remote Similarity	NPC488514
0.5492	Remote Similarity	NPC475591
0.5492	Remote Similarity	NPC236870
0.5492	Remote Similarity	NPC235438
0.5462	Remote Similarity	NPC470512
0.5462	Remote Similarity	NPC251263
0.5462	Remote Similarity	NPC480419
0.5448	Remote Similarity	NPC297950
0.5447	Remote Similarity	NPC475504
0.5442	Remote Similarity	NPC45606
0.5433	Remote Similarity	NPC470915
0.5431	Remote Similarity	NPC78046
0.5431	Remote Similarity	NPC29069
0.541	Remote Similarity	NPC10607
0.541	Remote Similarity	NPC488526
0.541	Remote Similarity	NPC232237
0.5397	Remote Similarity	NPC80986
0.5373	Remote Similarity	NPC480418
0.5373	Remote Similarity	NPC13998
0.5372	Remote Similarity	NPC192791
0.5366	Remote Similarity	NPC105800
0.5354	Remote Similarity	NPC104137
0.5354	Remote Similarity	NPC26626
0.5344	Remote Similarity	NPC219180
0.5333	Remote Similarity	NPC470876
0.5328	Remote Similarity	NPC309223
0.5328	Remote Similarity	NPC30735
0.5308	Remote Similarity	NPC123522
0.5302	Remote Similarity	NPC220838
0.5294	Remote Similarity	NPC56713
0.5289	Remote Similarity	NPC473343
0.5286	Remote Similarity	NPC480417
0.5285	Remote Similarity	NPC11551
0.5267	Remote Similarity	NPC470911
0.5263	Remote Similarity	NPC47995
0.5234	Remote Similarity	NPC207738
0.5214	Remote Similarity	NPC204458
0.5214	Remote Similarity	NPC214484
0.5207	Remote Similarity	NPC39211
0.52	Remote Similarity	NPC31193
0.5188	Remote Similarity	NPC283417
0.5188	Remote Similarity	NPC200049
0.5185	Remote Similarity	NPC21691
0.5167	Remote Similarity	NPC475516
0.5164	Remote Similarity	NPC263756
0.5161	Remote Similarity	NPC472269
0.5149	Remote Similarity	NPC54636
0.5147	Remote Similarity	NPC473452
0.5137	Remote Similarity	NPC489208
0.5118	Remote Similarity	NPC114484
0.5086	Remote Similarity	NPC256798
0.5079	Remote Similarity	NPC470514
0.5079	Remote Similarity	NPC470513
0.5078	Remote Similarity	NPC486564
0.5041	Remote Similarity	NPC76497
0.5041	Remote Similarity	NPC213674
0.504	Remote Similarity	NPC104400
0.504	Remote Similarity	NPC10320
0.5039	Remote Similarity	NPC187618
0.5039	Remote Similarity	NPC486563
0.5038	Remote Similarity	NPC133818
0.5038	Remote Similarity	NPC185466

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC165204 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7532
0.1-0.2	1566
0.2-0.3	48
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data