NPASS Compound

Natural Product: NPC488517

Natural Product ID	NPC488517
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HUHHCLUNWYNJMF-BLLFROECSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44584169
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 137145 0 0 0 0 0 0 0 0999 V2000 -8.7183 -5.2235 -0.3348 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5553 -3.7937 -0.8742 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5501 -3.9108 -2.3739 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2601 -3.2187 -0.3415 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2767 -1.7289 -0.6065 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0287 -1.0533 -0.1492 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0977 -1.7716 0.4584 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8132 -1.1865 0.9511 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6297 0.0921 0.1856 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2995 0.7693 0.3917 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9687 1.0774 1.8023 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2253 -0.2098 -0.1025 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2724 0.3630 -1.0729 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2211 1.7587 -0.8048 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9743 2.6898 -0.5809 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7804 3.6214 0.5562 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0687 3.5728 -1.8426 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1262 4.2831 -1.9610 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2632 1.9052 -0.5778 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4403 2.8066 -0.5977 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6266 2.4060 0.1703 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8241 0.9548 0.4268 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3226 0.8305 1.8743 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9698 0.4029 -0.4394 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6556 0.6043 -1.9184 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2517 1.1222 -0.1683 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4235 0.3462 0.2583 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4384 -1.1100 0.0616 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6852 -1.5646 -0.7210 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7176 -3.0161 -0.3368 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.5295 -2.9325 1.0848 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6778 -1.8675 1.3413 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2101 -1.6205 2.4803 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7328 0.5930 1.6224 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1612 1.8299 0.2003 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4312 2.2185 -0.2124 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8746 3.5157 0.3884 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2225 3.4148 1.8447 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4341 1.9173 2.1142 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2453 1.4214 0.9608 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0583 0.2050 1.2766 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8507 -0.2542 0.2603 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8214 0.5941 -0.1987 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2213 0.0054 -0.0703 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1624 1.1858 0.0651 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6054 2.2435 -0.9012 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8301 1.5676 -1.9850 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6737 0.9295 -1.5588 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6839 2.8960 -1.5298 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4518 0.9264 -0.3253 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3069 -0.9160 0.9395 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7234 -2.1308 0.4032 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9392 -2.7128 1.0353 C 0 0 1 0 0 0 0 0 0 0 0 0 10.1587 -4.0859 0.4356 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1946 -4.4060 -0.6792 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7737 -4.0485 -0.3687 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6767 -3.0506 0.6048 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6378 -3.9079 -1.9089 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9895 -5.1024 1.4003 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0360 -1.9078 0.7417 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3612 1.2012 -0.1014 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0113 1.7160 3.3568 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2725 3.9601 2.6959 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9128 4.1065 -0.3599 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8801 -0.4620 -1.0609 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3073 -5.2698 0.6953 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1347 -5.8920 -0.9827 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7862 -5.5162 -0.3753 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1621 -3.1707 -2.8864 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4873 -3.8033 -2.6935 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8884 -4.9127 -2.7325 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3856 -3.7104 -0.8374 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2282 -3.4379 0.7482 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4135 -1.6234 -1.7112 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2716 -2.8589 0.6160 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7551 -1.1243 2.0297 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0367 -1.9599 0.6637 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5942 -0.2519 -0.8945 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8702 1.1734 1.9239 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2010 0.1409 2.3951 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5008 1.8875 2.2768 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6510 -0.6498 0.7448 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6977 -1.1023 -0.6093 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6196 0.3132 -2.1446 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7727 2.0512 -1.7513 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0437 3.2768 1.2491 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4044 4.6357 0.2206 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6351 3.8311 1.1924 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8761 4.3012 -1.7807 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1885 2.8757 -2.6974 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4524 4.1667 -2.8874 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2574 1.3907 -1.5954 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0888 3.8156 -0.2206 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7366 3.0711 -1.6604 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5410 2.7770 -0.3878 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6830 3.0158 1.1252 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5264 0.6517 2.5962 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0725 0.0564 1.9957 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7882 1.8026 2.2163 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3453 1.3567 -2.3477 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6538 0.9157 -2.1509 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8691 -0.3433 -2.4460 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0322 1.8822 0.6390 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5133 1.8076 -1.0345 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3382 0.7649 -0.2639 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5379 -1.4003 -1.8065 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5467 -1.0552 -0.2876 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6880 -3.4973 -0.5328 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5867 1.5732 1.8139 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3445 2.3963 -1.3266 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0302 4.2318 0.3034 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2173 3.9183 1.9762 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4490 1.4135 2.1331 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9307 2.2133 0.6130 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7153 0.4608 2.1374 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4123 -0.6269 1.6068 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8115 1.5353 0.3545 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4979 -0.4659 -1.0592 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1042 1.5609 1.1199 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0585 3.0237 -0.3635 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5338 2.3700 -2.7200 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5125 0.9111 -2.5552 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3935 2.2472 -1.7628 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0303 0.9854 0.5001 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9187 -2.0452 -0.7067 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8437 -2.7874 2.1503 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1864 -4.1983 0.0397 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2343 -5.5291 -0.7993 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2642 -3.6276 -1.2740 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1808 -4.9301 -0.0595 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2910 -4.4579 -2.6308 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6050 -5.8512 1.1984 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2283 -1.3116 1.5084 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8267 2.2991 3.4403 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8181 3.1887 3.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8968 3.6585 -1.2384 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6349 -1.3987 -1.3493 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 1 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 15 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 6 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 27 34 1 0 14 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 44 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 54 59 1 0 53 60 1 0 40 61 1 0 39 62 1 0 38 63 1 0 37 64 1 0 13 65 1 0 30 2 1 0 61 36 1 0 28 5 1 0 48 43 1 0 57 52 1 0 24 6 1 0 28 32 1 1 22 9 1 0 19 10 1 0 1 66 1 0 1 67 1 0 1 68 1 0 3 69 1 0 3 70 1 0 3 71 1 0 4 72 1 0 4 73 1 0 5 74 1 6 7 75 1 0 8 76 1 0 8 77 1 0 9 78 1 6 11 79 1 0 11 80 1 0 11 81 1 0 12 82 1 0 12 83 1 0 13 84 1 6 14 85 1 6 16 86 1 0 16 87 1 0 16 88 1 0 17 89 1 0 17 90 1 0 18 91 1 0 19 92 1 6 20 93 1 0 20 94 1 0 21 95 1 0 21 96 1 0 23 97 1 0 23 98 1 0 23 99 1 0 25100 1 0 25101 1 0 25102 1 0 26103 1 0 26104 1 0 27105 1 6 29106 1 0 29107 1 0 30108 1 1 34109 1 0 36110 1 6 37111 1 1 38112 1 6 39113 1 1 40114 1 6 41115 1 0 41116 1 0 43117 1 1 44118 1 6 45119 1 1 46120 1 1 47121 1 0 47122 1 0 49123 1 0 50124 1 0 52125 1 6 53126 1 1 54127 1 6 55128 1 6 56129 1 0 56130 1 0 58131 1 0 59132 1 0 60133 1 0 62134 1 0 63135 1 0 64136 1 0 65137 1 0 M END

Standard InCHIKey	HUHHCLUNWYNJMF-BLLFROECSA-N
Standard InCHI	InChI=1S/C46H72O19/c1-41(2)11-20-19-7-8-26-42(3)12-21(48)36(43(4,18-47)25(42)9-10-44(26,5)45(19,6)13-27(51)46(20)14-28(41)63-40(46)58)65-38-34(57)32(55)31(54)24(62-38)17-61-39-35(30(53)23(50)16-60-39)64-37-33(56)29(52)22(49)15-59-37/h7,20-39,47-57H,8-18H2,1-6H3/t20-,21+,22-,23+,24-,25-,26-,27+,28+,29+,30+,31-,32+,33-,34-,35-,36+,37+,38+,39+,42+,43+,44-,45-,46-/m1/s1
SMILES	CC1(C)C[C@@H]2C3=CC[C@@H]4[C@@]5(C)C[C@@H]([C@@H]([C@@](C)(CO)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@@H]([C@]32C[C@@H]1OC3=O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@H](CO2)O)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O1)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	928.47	Volume:	888.905 ? Van der Waals volume.
Dense:	1.045	LogP:	0.726 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.534 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.172 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	304.21 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	11.0	Rings:	9.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.074	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.767	Fsp³:	0.935
MCE-18:	253.697 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.686	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.199	Promiscuous compounds:	0.039

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.582	MDCK Permeability:	-5.052
Pgp-inhibitor:	0.0	Pgp-substrate:	0.705
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.113
20% Bioavailability (F20%):	0.038	30% Bioavailability (F30%):	0.648
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.008	MRP1:	0.08
Plasma Protein Binding (PPB):	70.165%	Volume Distribution (VD):	-0.374
Fu:	18.675% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.031
BSEP inhibitor:	0.006

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.001	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.07
HLM stability:	0.023 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.236

Half-life (T1/2):

2.641

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.004
Human Hepatotoxicity (H-HT):	0.674	Drug-induced Liver Injury (DILI):	0.967
AMES Toxicity:	0.993	Rat Oral Acute Toxicity:	0.016
Maximum Recommended Daily Dose:	0.03	Skin Sensitization:	1.0
Carcinogencity:	0.244	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.005
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.998
Hematotoxicity:	0.921	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.908	RPMI-8226 Immunitoxicity:	0.399
A549 Cytotoxicity:	0.983	Hek293 Cytotoxicity:	0.477
BCF:	0.837 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.302 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.762 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.8 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
IC50	1

Activity Type	# Activity
Cell line	1
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT759	Cell line	H9	Homo sapiens	IC50	>	100000.0	nM	PMID[7494144]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	100000.0	nM	PMID[7494144]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488517 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22250
0.1-0.2	23127
0.2-0.3	3408
0.3-0.4	670
0.4-0.5	292
0.5-0.6	92
0.6-0.7	6
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8351	Intermediate Similarity	NPC232237
0.7549	Intermediate Similarity	NPC105800
0.7064	Intermediate Similarity	NPC210729
0.7064	Intermediate Similarity	NPC82931
0.6972	Remote Similarity	NPC207738
0.6792	Remote Similarity	NPC488526
0.6635	Remote Similarity	NPC480420
0.6404	Remote Similarity	NPC172365
0.6271	Remote Similarity	NPC480423
0.6174	Remote Similarity	NPC815
0.5906	Remote Similarity	NPC488513
0.5888	Remote Similarity	NPC475208
0.5748	Remote Similarity	NPC144644
0.5748	Remote Similarity	NPC170407
0.5739	Remote Similarity	NPC488515
0.568	Remote Similarity	NPC13998
0.568	Remote Similarity	NPC476774
0.5678	Remote Similarity	NPC104137
0.5678	Remote Similarity	NPC26626
0.5659	Remote Similarity	NPC142151
0.5639	Remote Similarity	NPC480421
0.5636	Remote Similarity	NPC139894
0.5614	Remote Similarity	NPC164389
0.5606	Remote Similarity	NPC8524
0.5573	Remote Similarity	NPC68767
0.5573	Remote Similarity	NPC102505
0.5573	Remote Similarity	NPC488514
0.5564	Remote Similarity	NPC33012
0.5556	Remote Similarity	NPC473452
0.5556	Remote Similarity	NPC480418
0.553	Remote Similarity	NPC153673
0.553	Remote Similarity	NPC51099
0.5528	Remote Similarity	NPC480419
0.5528	Remote Similarity	NPC603137
0.551	Remote Similarity	NPC488518
0.5507	Remote Similarity	NPC484831
0.5507	Remote Similarity	NPC484830
0.5487	Remote Similarity	NPC473343
0.5478	Remote Similarity	NPC104400
0.5478	Remote Similarity	NPC305267
0.5478	Remote Similarity	NPC10320
0.5462	Remote Similarity	NPC476775
0.5455	Remote Similarity	NPC179434
0.5433	Remote Similarity	NPC476780
0.5417	Remote Similarity	NPC164349
0.5407	Remote Similarity	NPC275225
0.5398	Remote Similarity	NPC295371
0.539	Remote Similarity	NPC484829
0.5364	Remote Similarity	NPC1046
0.536	Remote Similarity	NPC283417
0.536	Remote Similarity	NPC200049
0.5352	Remote Similarity	NPC233223
0.5352	Remote Similarity	NPC183816
0.5352	Remote Similarity	NPC43589
0.5328	Remote Similarity	NPC475119
0.5328	Remote Similarity	NPC185466
0.5328	Remote Similarity	NPC288205
0.5328	Remote Similarity	NPC51465
0.531	Remote Similarity	NPC480424
0.5303	Remote Similarity	NPC220160
0.5299	Remote Similarity	NPC63159
0.5294	Remote Similarity	NPC37134
0.5285	Remote Similarity	NPC76972
0.5285	Remote Similarity	NPC469782
0.5285	Remote Similarity	NPC204414
0.5276	Remote Similarity	NPC85154
0.5267	Remote Similarity	NPC37860
0.5229	Remote Similarity	NPC488204
0.5225	Remote Similarity	NPC127853
0.5205	Remote Similarity	NPC311178
0.52	Remote Similarity	NPC475899
0.5194	Remote Similarity	NPC488308
0.5194	Remote Similarity	NPC286457
0.5191	Remote Similarity	NPC202828
0.5191	Remote Similarity	NPC119592
0.5188	Remote Similarity	NPC267694
0.518	Remote Similarity	NPC475177
0.518	Remote Similarity	NPC489208
0.5166	Remote Similarity	NPC322904
0.5161	Remote Similarity	NPC610204
0.5156	Remote Similarity	NPC4749
0.5154	Remote Similarity	NPC271610
0.5154	Remote Similarity	NPC312650
0.5152	Remote Similarity	NPC309223
0.5141	Remote Similarity	NPC329893
0.512	Remote Similarity	NPC123522
0.5111	Remote Similarity	NPC293031
0.5111	Remote Similarity	NPC476776
0.5103	Remote Similarity	NPC300655
0.5103	Remote Similarity	NPC13989
0.5103	Remote Similarity	NPC196874
0.5085	Remote Similarity	NPC473383
0.5082	Remote Similarity	NPC241909
0.5079	Remote Similarity	NPC284449
0.5077	Remote Similarity	NPC265841
0.5076	Remote Similarity	NPC110700
0.5076	Remote Similarity	NPC476777
0.5074	Remote Similarity	NPC110385
0.504	Remote Similarity	NPC200788
0.5039	Remote Similarity	NPC123199
0.5037	Remote Similarity	NPC279915
0.5037	Remote Similarity	NPC476778

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488517 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7330
0.1-0.2	1775
0.2-0.3	43
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data