NPASS Compound

Natural Product: NPC153673

Natural Product ID	NPC153673
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3''o-Acetylpolygalacin D
IUPAC Name	[(2S,3R,4S,5S)-3-[(2S,3R,4R,5R,6S)-3-acetyloxy-5-[(2S,3R,4S,5R)-4-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3,5-dihydroxyoxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl] (4aR,5R,6aR,6aS,6bR,8aR,9R,10R,11S,12aR,14bS)-5,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms	3'O-Acetylpolygalacin D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1641865
PubChem CID	53321793
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 181190 0 0 0 0 0 0 0 0999 V2000 5.9786 2.3311 -0.0051 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8024 0.8918 0.4931 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0703 0.4480 1.2024 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7895 -0.8318 1.9482 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5837 -0.5939 2.8681 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4150 -0.2920 1.9572 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6983 0.8751 1.2901 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2224 -1.3982 1.1222 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0186 -2.0146 1.3528 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1506 -3.4393 1.8595 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8223 -3.7161 2.5834 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7598 -3.1071 1.6672 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1710 -3.1547 0.3390 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1114 -2.0652 0.1655 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2280 -0.9355 0.1416 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8973 -0.3650 -1.0496 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3489 -0.8217 -2.1218 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0304 0.8282 -1.0623 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8460 2.0438 -0.8815 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3991 2.1036 0.5001 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3574 2.4099 1.5405 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2941 3.9000 1.8537 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5119 1.6200 2.8094 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9829 2.0525 0.9333 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9247 0.7451 0.1564 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3093 0.3252 -0.1476 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8484 -0.5861 0.6482 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2195 -1.1420 0.5171 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9643 -0.2267 -0.4367 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4037 -0.5911 -0.5780 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6626 -2.0671 -0.6004 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0655 -0.0562 0.6806 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5283 -0.1059 0.6839 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2502 0.1787 -0.6014 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4793 0.1405 -1.8543 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9523 -0.9324 -2.8077 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7868 1.4729 -2.5767 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1491 1.5563 -2.8152 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9855 0.1678 -1.7080 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2737 -0.1625 -2.9671 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8748 0.4460 -2.8578 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1418 -0.0654 -1.6563 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4070 -1.3416 -2.0812 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0468 0.9274 -1.3071 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6746 2.2135 -0.7439 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1355 1.2937 -2.4069 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7448 0.7716 -2.3646 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0103 1.5899 -3.2494 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2531 -0.8239 -0.6553 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5212 -0.3239 -0.4070 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.5103 -0.8822 -1.3667 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.8364 -0.1558 -1.1017 C 0 0 2 0 0 0 0 0 0 0 0 0 -14.2007 -0.1498 0.3447 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.9971 0.0377 1.2471 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.3855 -0.3088 2.6579 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3107 -0.1323 3.5301 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9497 -0.8019 0.8771 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.0173 0.9720 0.5603 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.8829 -0.7462 -1.8128 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1577 -0.7003 -2.6749 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9887 -1.3057 1.2882 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8862 -3.0117 3.7898 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2244 -3.6771 2.6610 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8172 0.6298 3.5981 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8304 0.5567 4.9816 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6388 -0.5704 5.5074 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0641 1.7747 5.8365 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7974 -1.2571 2.7698 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0328 0.2164 0.2561 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1539 0.9906 0.3618 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3463 0.1243 0.7198 C 0 0 1 0 0 0 0 0 0 0 0 0 11.6336 0.7888 0.1897 C 0 0 2 0 0 0 0 0 0 0 0 0 11.4625 2.2538 0.3318 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3716 2.7408 -0.5824 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4150 1.7829 -0.7413 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1093 2.5566 1.6701 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8557 0.3001 -1.0618 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0144 -0.4549 -1.1826 C 0 0 1 0 0 0 0 0 0 0 0 0 12.8357 -1.8130 -1.7535 C 0 0 1 0 0 0 0 0 0 0 0 0 13.2863 -1.6532 -3.1854 C 0 0 1 0 0 0 0 0 0 0 0 0 12.1050 -1.6564 -4.1323 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2237 -0.6122 -3.8584 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0216 -0.3634 -3.1738 C 0 0 0 0 0 0 0 0 0 0 0 0 13.9050 0.2493 -1.9599 O 0 0 0 0 0 0 0 0 0 0 0 0 14.1105 -2.7320 -3.5270 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6704 -2.7488 -1.1477 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4535 0.0708 2.0893 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4880 2.3844 -0.9662 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5313 2.8528 0.8261 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9916 2.8571 -0.0694 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6402 0.2745 -0.4065 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3633 1.2189 1.9458 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4809 -1.6169 1.2360 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4435 -1.4312 3.5448 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5009 -0.1286 2.5927 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5285 -1.4484 2.1841 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1737 -4.1521 0.9988 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6670 -4.7753 2.7839 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6240 -2.0462 1.9363 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2236 -3.6235 1.8056 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5516 -2.3009 -0.8006 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3294 2.9783 -1.1894 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7156 1.9576 -1.5779 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2593 2.8434 0.5706 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8705 1.1396 0.7532 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6635 4.0841 2.4068 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3234 4.4446 0.8923 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1152 4.1296 2.5444 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4357 1.0123 2.8175 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3849 0.9735 3.0112 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5704 2.3236 3.6713 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7382 1.8795 1.7419 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2997 2.9068 0.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4562 0.0227 0.8575 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2532 -0.9900 1.4979 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1002 -2.1759 0.1336 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6961 -1.1542 1.5220 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9472 0.7742 0.1022 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3032 -2.5988 -1.4757 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7056 -2.3370 -0.4257 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1004 -2.4962 0.2799 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6883 -0.5285 1.6006 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7285 1.0205 0.7445 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8773 0.6680 1.4374 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8445 1.1325 -0.4553 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1357 -1.4200 -3.3451 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6245 -1.6626 -2.2993 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5893 -0.4575 -3.5795 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5306 2.2936 -1.8702 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2931 1.5557 -3.5397 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3784 2.0924 -3.6212 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7254 1.2540 -1.4956 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7440 0.3179 -3.8366 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1903 -1.2467 -3.2054 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9522 1.5418 -2.9170 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3422 0.1172 -3.7745 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2545 -1.2512 -3.1977 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9692 -2.2550 -1.8913 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4159 -1.4380 -1.5761 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6028 2.2852 0.3397 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1009 3.0905 -1.1682 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7023 2.3751 -1.1158 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0510 2.4221 -2.4875 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5343 1.0202 -3.4290 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6525 -0.2464 -2.8305 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6244 1.0878 -3.8057 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5952 0.7516 -0.3069 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6908 -1.9661 -1.1258 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6538 0.8933 -1.4139 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7968 -1.0256 0.6727 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6969 1.1144 1.2298 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7604 -1.3408 2.6580 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1832 0.3715 2.9747 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8120 0.6859 3.3519 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.4228 1.7620 0.4874 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.8240 -1.7256 -1.7390 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2894 -1.5611 -3.1474 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7721 -1.2549 2.2526 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8943 -3.6487 4.5594 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8247 -4.3419 2.2628 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0825 2.1295 5.5928 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3451 2.5217 5.4954 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9427 1.4746 6.8983 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0900 -0.5173 3.3689 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9898 1.6715 1.2304 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2163 -0.8425 0.2122 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4406 0.4841 0.9175 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3823 2.8446 0.1492 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8107 3.0480 -1.5562 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9173 3.6414 -0.1137 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8206 2.2564 2.2914 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4661 -0.4588 -0.1466 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7810 -2.1588 -1.7918 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6153 -2.6646 -4.0130 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4817 -1.5565 -5.1607 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3110 -1.0253 -3.8163 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5906 0.3500 -3.9355 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0793 -0.5255 -3.4612 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8899 -2.7304 -2.9344 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2975 -2.3011 -0.5224 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9013 -0.7347 2.4335 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 18 16 1 6 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 6 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 6 35 37 1 0 37 38 1 0 35 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 6 42 44 1 0 44 45 1 1 44 46 1 0 46 47 1 0 47 48 1 0 34 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 52 59 1 0 51 60 1 0 33 61 1 0 11 62 1 0 10 63 1 0 5 64 1 0 64 65 1 0 65 66 2 0 65 67 1 0 4 68 1 0 3 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 73 76 1 0 72 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 80 83 1 0 83 84 1 0 80 85 1 6 79 86 1 0 71 87 1 0 7 2 1 0 14 9 1 0 25 18 1 0 44 26 1 0 57 50 1 0 75 70 1 0 84 78 1 0 47 18 1 0 42 29 1 0 39 30 1 0 1 88 1 0 1 89 1 0 1 90 1 0 2 91 1 6 3 92 1 1 4 93 1 6 5 94 1 1 6 95 1 1 9 96 1 1 10 97 1 6 11 98 1 1 12 99 1 0 12100 1 0 14101 1 6 19102 1 0 19103 1 0 20104 1 0 20105 1 0 22106 1 0 22107 1 0 22108 1 0 23109 1 0 23110 1 0 23111 1 0 24112 1 0 24113 1 0 25114 1 1 27115 1 0 28116 1 0 28117 1 0 29118 1 1 31119 1 0 31120 1 0 31121 1 0 32122 1 0 32123 1 0 33124 1 1 34125 1 1 36126 1 0 36127 1 0 36128 1 0 37129 1 0 37130 1 0 38131 1 0 39132 1 1 40133 1 0 40134 1 0 41135 1 0 41136 1 0 43137 1 0 43138 1 0 43139 1 0 45140 1 0 45141 1 0 45142 1 0 46143 1 0 46144 1 0 47145 1 6 48146 1 0 50147 1 1 51148 1 1 52149 1 6 53150 1 1 54151 1 1 55152 1 0 55153 1 0 56154 1 0 58155 1 0 59156 1 0 60157 1 0 61158 1 0 62159 1 0 63160 1 0 67161 1 0 67162 1 0 67163 1 0 68164 1 0 70165 1 1 71166 1 6 72167 1 1 73168 1 6 74169 1 0 74170 1 0 76171 1 0 78172 1 1 79173 1 6 81174 1 0 81175 1 0 82176 1 0 83177 1 0 83178 1 0 85179 1 0 86180 1 0 87181 1 0 M END

Standard InCHIKey	VBEBKYZOUNIPAW-WFLDLCASSA-N
Standard InCHI	InChI=1S/C59H94O28/c1-24-41(83-47-40(73)42(30(66)20-77-47)84-51-45(74)58(76,22-62)23-79-51)39(72)44(81-25(2)63)50(80-24)85-43-35(68)29(65)19-78-49(43)87-52(75)59-14-13-53(3,4)15-27(59)26-9-10-33-54(5)16-28(64)46(86-48-38(71)37(70)36(69)31(18-60)82-48)55(6,21-61)32(54)11-12-56(33,7)57(26,8)17-34(59)67/h9,24,27-51,60-62,64-74,76H,10-23H2,1-8H3/t24-,27-,28-,29-,30+,31+,32+,33+,34+,35-,36+,37-,38+,39+,40+,41-,42-,43+,44+,45-,46-,47-,48-,49-,50-,51-,54-,55-,56+,57+,58+,59+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H](CO[C@H]1OC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)C[C@@H]([C@@H]([C@@](C)(CO)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)OC(=O)C)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O[C@H]1[C@@H]([C@@](CO)(CO1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1250.59	Volume:	1181.672 ? Van der Waals volume.
Dense:	1.058	LogP:	-0.027 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.939 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.444 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	57.0
TPSA:	439.12 ? Topological Polar Surface Area.	H-Bond Acceptor:	28.0
H-Bond Donor:	15.0	Rings:	10.0
Heavy Atoms:	28.0

MedChem Properties

QED Drug-Likeness Score:	0.045	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.503	Fsp³:	0.932
MCE-18:	221.754 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.672	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.24	Promiscuous compounds:	0.565

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.723	MDCK Permeability:	-5.087
Pgp-inhibitor:	0.0	Pgp-substrate:	0.987
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.279
20% Bioavailability (F20%):	0.196	30% Bioavailability (F30%):	0.989
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.104
Plasma Protein Binding (PPB):	60.683%	Volume Distribution (VD):	-0.427
Fu:	24.188% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.006
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.015
HLM stability:	0.014 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.59

Half-life (T1/2):

3.396

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.868	Drug-induced Liver Injury (DILI):	0.913
AMES Toxicity:	0.987	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.08	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.803	Drug-induced Nephrotoxicity:	0.996
Genotoxicity:	0.467	RPMI-8226 Immunitoxicity:	0.3
A549 Cytotoxicity:	0.972	Hek293 Cytotoxicity:	0.606
BCF:	0.423 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.329 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.134 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.955 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	root	n.a.	PMID[17851435]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	Roots	n.a.	n.a.	PMID[20939516]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	root	n.a.	PMID[20939516]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	1
Non-molecular	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT148	Cell line	HCT-15	Homo sapiens	IC50	>	10000.0	nM	PMID[24224794]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	6200.0	nM	PMID[20939516]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	6300.0	nM	PMID[20939516]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[20939516]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC153673 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25529
0.1-0.2	21029
0.2-0.3	2463
0.3-0.4	489
0.4-0.5	265
0.5-0.6	54
0.6-0.7	12
0.7-0.8	0
0.8-0.85	3
0.85-0.9	5
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9746	High Similarity	NPC275225
0.9328	High Similarity	NPC110385
0.8908	High Similarity	NPC144644
0.8908	High Similarity	NPC170407
0.877	High Similarity	NPC68767
0.8607	High Similarity	NPC142151
0.8548	High Similarity	NPC51099
0.8293	Intermediate Similarity	NPC37860
0.8175	Intermediate Similarity	NPC293031
0.8016	Intermediate Similarity	NPC267694
0.7259	Intermediate Similarity	NPC480421
0.7188	Intermediate Similarity	NPC237191
0.7059	Intermediate Similarity	NPC33012
0.6985	Remote Similarity	NPC8524
0.6977	Remote Similarity	NPC85154
0.688	Remote Similarity	NPC815
0.6382	Remote Similarity	NPC23020
0.637	Remote Similarity	NPC13998
0.6279	Remote Similarity	NPC104137
0.6279	Remote Similarity	NPC26626
0.625	Remote Similarity	NPC473452
0.6116	Remote Similarity	NPC475208
0.6053	Remote Similarity	NPC475584
0.6053	Remote Similarity	NPC475152
0.6026	Remote Similarity	NPC475394
0.5984	Remote Similarity	NPC164389
0.5956	Remote Similarity	NPC480423
0.5935	Remote Similarity	NPC485563
0.5926	Remote Similarity	NPC475899
0.5903	Remote Similarity	NPC102505
0.5903	Remote Similarity	NPC488514
0.5899	Remote Similarity	NPC480418
0.5899	Remote Similarity	NPC286457
0.5797	Remote Similarity	NPC471577
0.5734	Remote Similarity	NPC309223
0.5714	Remote Similarity	NPC480422
0.5714	Remote Similarity	NPC473386
0.5655	Remote Similarity	NPC476113
0.5655	Remote Similarity	NPC220160
0.5646	Remote Similarity	NPC489209
0.5634	Remote Similarity	NPC470876
0.5594	Remote Similarity	NPC293330
0.5591	Remote Similarity	NPC150400
0.5591	Remote Similarity	NPC480420
0.5548	Remote Similarity	NPC482010
0.553	Remote Similarity	NPC488517
0.5526	Remote Similarity	NPC489208
0.5524	Remote Similarity	NPC471580
0.5524	Remote Similarity	NPC475514
0.5481	Remote Similarity	NPC69811
0.5479	Remote Similarity	NPC70809
0.5478	Remote Similarity	NPC475892
0.5476	Remote Similarity	NPC475527
0.5473	Remote Similarity	NPC480417
0.5473	Remote Similarity	NPC478825
0.546	Remote Similarity	NPC472270
0.546	Remote Similarity	NPC112492
0.5423	Remote Similarity	NPC4749
0.5412	Remote Similarity	NPC488513
0.5397	Remote Similarity	NPC1046
0.5396	Remote Similarity	NPC123522
0.539	Remote Similarity	NPC283417
0.539	Remote Similarity	NPC200049
0.5385	Remote Similarity	NPC21691
0.5306	Remote Similarity	NPC302543
0.5299	Remote Similarity	NPC475504
0.5203	Remote Similarity	NPC33068
0.5175	Remote Similarity	NPC471550
0.5172	Remote Similarity	NPC57484
0.5149	Remote Similarity	NPC488526
0.5149	Remote Similarity	NPC305267
0.5139	Remote Similarity	NPC484546
0.5105	Remote Similarity	NPC480419
0.5071	Remote Similarity	NPC11242
0.5065	Remote Similarity	NPC485562
0.5065	Remote Similarity	NPC477464
0.5034	Remote Similarity	NPC477463
0.5033	Remote Similarity	NPC224381
0.5029	Remote Similarity	NPC475599

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC153673 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7855
0.1-0.2	1257
0.2-0.3	38
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data