NPASS Compound

Natural Product: NPC69811

Natural Product ID	NPC69811
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Dianversicoside E
IUPAC Name	8a-O-[(2S,3R,4S,5R,6R)-6-[[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,5-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl] 4-O-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (3S,4S,4aR,6aR,6bS,8R,8aR,12aS,14aR,14bR)-3,8-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate
Synonyms	Dianversicoside E
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL554812
PubChem CID	42640126
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 187196 0 0 0 0 0 0 0 0999 V2000 -6.9886 -6.6577 3.0441 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1683 -5.5296 3.0573 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5861 -4.5687 1.9460 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8148 -3.4456 1.9098 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0286 -3.2935 0.7842 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0238 -2.3739 1.0670 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1540 -1.1883 0.3064 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8702 -0.9827 -0.4466 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1179 -1.3187 -1.7769 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3052 0.3854 -0.4049 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5521 1.0506 0.8119 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9736 1.2391 0.7645 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4587 -0.1123 1.3138 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7527 -0.1152 1.7203 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3667 2.3729 1.6332 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7161 2.7439 1.5504 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0206 3.2102 0.3004 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2146 4.6095 0.4098 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3932 5.2148 -0.8059 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6555 6.0711 -0.8803 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6216 7.0984 0.0813 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3466 4.3187 -1.9998 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1267 3.0293 -1.8344 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2683 2.6904 -0.3453 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5736 1.3794 -0.1159 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8007 1.1691 0.4637 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7224 0.6836 1.7807 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9616 0.9414 2.3854 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.8511 0.7650 3.8753 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4734 -0.5123 4.2272 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0312 0.0284 1.8474 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.3942 -0.7221 0.6763 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7188 0.2628 -0.2843 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7108 0.9279 -0.9893 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3802 -1.5063 1.2775 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1540 0.7399 1.4278 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3570 3.1195 -2.4707 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0320 4.0905 -2.4406 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9116 0.3344 -0.5894 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3737 1.1607 -1.6049 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1332 1.8973 -2.2672 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0906 1.1329 -1.8620 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3849 2.1435 -2.9212 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7160 1.8382 -4.2167 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7944 0.3967 -4.5624 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8368 -0.3536 -3.7616 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5623 -0.2281 -2.2788 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7307 -0.7447 -1.5168 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7985 -2.0777 -1.4071 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8709 -2.8137 -0.6947 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0050 -1.8552 -0.4416 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4382 -0.6475 0.2309 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7668 0.1671 -0.9064 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1603 1.4251 -0.4034 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6885 1.5466 -0.5223 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3415 2.8913 -0.3522 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7738 0.4991 -1.9648 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3031 -0.9554 1.1848 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4173 0.1868 0.9896 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3529 -0.7282 1.7551 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1359 -1.4673 0.7013 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1995 -2.5101 0.1557 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8894 -3.6320 1.0875 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9877 -3.1433 -0.9918 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2236 -3.8184 -0.5306 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0777 -3.0598 0.3980 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4667 -1.9301 1.1502 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5036 -2.1683 2.6689 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3801 -0.7420 0.9323 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3651 -0.8001 0.1636 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0985 0.4068 1.6022 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8336 1.5998 1.5119 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4950 1.9485 2.6888 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5570 2.7812 2.2714 C 0 0 2 0 0 0 0 0 0 0 0 0 12.5370 3.0462 3.3641 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0943 1.8342 3.8144 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0415 4.0766 1.7185 C 0 0 2 0 0 0 0 0 0 0 0 0 10.0751 3.8274 0.5571 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0633 2.7729 1.0120 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2311 2.4806 -0.0437 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4720 5.0062 0.1877 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1199 4.7751 1.1895 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5890 -3.9721 1.3497 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5437 -0.2920 -4.5376 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2823 0.3088 -6.0205 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4487 -4.5610 0.2647 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5517 -5.4842 -0.1680 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7869 -5.2720 0.6365 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6916 -4.4924 -0.1122 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1517 -6.8196 -0.1087 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6883 -4.2523 -0.8676 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9325 -6.3964 2.9766 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0964 -5.7953 2.9916 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3102 -5.0532 4.0580 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6222 -4.2316 2.2630 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6836 -2.8576 0.0042 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0429 -1.3153 -0.3331 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0888 -1.7244 -0.1028 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9162 -0.8081 -2.0599 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7715 1.0434 -1.1836 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2703 1.2824 -0.2781 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7877 -0.3132 2.2068 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8985 -0.3754 2.6526 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6886 3.2293 1.4127 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1576 2.0932 2.6882 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1053 3.1229 -0.3297 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5433 5.9486 -0.9316 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5781 5.4837 -0.8318 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6778 6.5999 -1.8609 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5046 7.5195 0.0993 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8445 4.8815 -2.8373 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5253 2.2192 -2.2910 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1409 3.2999 0.0450 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2957 2.1763 0.5805 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2867 1.9929 2.1850 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2057 1.5571 4.3438 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8711 0.9442 4.3137 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2580 -1.1218 4.3857 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3537 -0.7206 2.5753 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1365 -1.3266 0.1579 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1072 -0.3751 -0.9750 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0451 0.2728 -1.6714 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3513 -2.4067 0.8693 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4544 0.4114 0.5404 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3941 3.9586 -3.0261 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0423 3.4979 -3.2276 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5063 2.2153 -3.0830 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0695 3.1573 -2.5352 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2529 2.4726 -5.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3170 2.2608 -4.2693 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7462 -1.4236 -4.0320 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8000 0.0299 -4.0913 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6744 -0.9170 -2.1205 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0284 -2.6934 -1.8604 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5119 -3.3065 0.2303 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2343 -3.6147 -1.3535 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3219 -1.5204 -1.4776 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6221 2.3353 -0.8934 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3986 1.5627 0.6724 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1086 0.9969 0.2542 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5898 3.2079 0.5708 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6226 1.5453 -2.2866 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7740 -0.1311 -2.8505 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8219 0.4845 -1.5856 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2269 -0.1686 1.9876 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3149 -1.0047 0.7324 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4517 -1.9021 1.7360 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9133 0.7893 1.7731 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0663 0.8398 0.3812 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9703 -0.1094 2.4123 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6956 -1.4244 2.3172 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2975 -0.7529 -0.1632 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3079 -3.3887 1.9693 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8388 -4.0923 1.4350 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3915 -4.4299 0.4586 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3585 -3.8611 -1.5491 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2731 -2.3248 -1.7109 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9435 -4.8299 -0.1074 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7880 -4.1075 -1.4696 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0084 -2.7572 -0.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1897 -1.4729 3.1917 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4908 -1.9592 3.1055 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8540 -3.1844 2.9256 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6614 1.3892 0.7732 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0552 2.2537 1.4141 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3640 3.6865 3.0429 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9982 3.4800 4.2335 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4023 1.2748 3.0415 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5854 4.7062 2.5146 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7076 3.4315 -0.2837 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4888 3.2835 1.8424 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1197 3.2511 -0.6648 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5045 5.7246 0.8522 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9457 4.2280 1.1198 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5362 -3.8582 1.5215 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6217 -1.0189 -5.3832 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3705 0.4346 -4.6806 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6886 -0.9127 -3.6271 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0604 1.1192 -6.1259 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4778 0.6050 -6.7202 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7557 -0.6483 -6.2500 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7388 -5.0465 0.9686 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7665 -5.2850 -1.2567 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3403 -6.2190 0.8613 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0443 -4.9881 -0.9061 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2297 -6.9493 0.1829 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8058 -4.6544 -0.8675 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 19 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 23 37 1 0 22 38 1 0 10 39 1 0 39 40 1 0 40 41 2 0 42 40 1 1 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 2 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 53 57 1 6 52 58 1 1 52 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 1 62 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 1 67 69 1 0 69 70 2 0 69 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 74 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 78 81 1 0 77 82 1 0 66 83 1 0 45 84 1 0 45 85 1 0 5 86 1 0 86 87 1 0 87 88 1 0 88 89 1 0 87 90 1 0 86 91 1 0 88 3 1 0 13 7 1 0 24 17 1 0 33 26 1 0 55 42 1 0 67 61 1 0 79 72 1 0 47 42 1 0 53 48 1 0 62 51 1 0 1 92 1 0 2 93 1 0 2 94 1 0 3 95 1 1 5 96 1 6 7 97 1 6 8 98 1 1 9 99 1 0 10100 1 6 12101 1 6 13102 1 1 14103 1 0 15104 1 0 15105 1 0 17106 1 6 19107 1 6 20108 1 0 20109 1 0 21110 1 0 22111 1 6 23112 1 6 24113 1 1 26114 1 1 28115 1 1 29116 1 0 29117 1 0 30118 1 0 31119 1 1 32120 1 6 33121 1 6 34122 1 0 35123 1 0 36124 1 0 37125 1 0 38126 1 0 43127 1 0 43128 1 0 44129 1 0 44130 1 0 46131 1 0 46132 1 0 47133 1 1 49134 1 0 50135 1 0 50136 1 0 51137 1 6 54138 1 0 54139 1 0 55140 1 1 56141 1 0 57142 1 0 57143 1 0 57144 1 0 58145 1 0 58146 1 0 58147 1 0 59148 1 0 59149 1 0 60150 1 0 60151 1 0 61152 1 6 63153 1 0 63154 1 0 63155 1 0 64156 1 0 64157 1 0 65158 1 0 65159 1 0 66160 1 6 68161 1 0 68162 1 0 68163 1 0 72164 1 6 74165 1 6 75166 1 0 75167 1 0 76168 1 0 77169 1 1 78170 1 6 79171 1 1 80172 1 0 81173 1 0 82174 1 0 83175 1 0 84176 1 0 84177 1 0 84178 1 0 85179 1 0 85180 1 0 85181 1 0 86182 1 1 87183 1 6 88184 1 1 89185 1 0 90186 1 0 91187 1 0 M END

Standard InCHIKey	JGRYZOSHBHWVJX-QPLFLNKMSA-N
Standard InCHI	InChI=1S/C60H96O31/c1-55(2)13-14-60(23(15-55)22-7-8-29-56(3)11-10-31(65)59(6,30(56)9-12-57(29,4)58(22,5)16-32(60)66)53(80)90-50-44(78)40(74)35(69)26(19-63)85-50)54(81)91-51-45(79)46(88-48-42(76)38(72)33(67)24(17-61)83-48)37(71)28(87-51)21-82-52-47(41(75)36(70)27(20-64)86-52)89-49-43(77)39(73)34(68)25(18-62)84-49/h7,23-52,61-79H,8-21H2,1-6H3/t23-,24+,25+,26+,27+,28+,29+,30+,31-,32+,33+,34+,35+,36+,37+,38-,39-,40-,41-,42+,43+,44+,45+,46-,47+,48-,49-,50-,51-,52+,56+,57+,58+,59-,60+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@@H](O[C@@H]([C@H]2O)CO[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)O)OC(=O)[C@@]23CCC(C[C@H]3C3=CC[C@H]4[C@@]([C@@]3(C[C@H]2O)C)(C)CC[C@@H]2[C@]4(C)CC[C@@H]([C@@]2(C)C(=O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1312.59	Volume:	1225.339 ? Van der Waals volume.
Dense:	1.071	LogP:	-1.844 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.023 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.086 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	17.0	Rigid Bonds:	58.0
TPSA:	510.81 ? Topological Polar Surface Area.	H-Bond Acceptor:	31.0
H-Bond Donor:	19.0	Rings:	10.0
Heavy Atoms:	31.0

MedChem Properties

QED Drug-Likeness Score:	0.054	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.457	Fsp³:	0.933
MCE-18:	224.845 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.669	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.309	Promiscuous compounds:	0.169

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.314	MDCK Permeability:	-4.905
Pgp-inhibitor:	0.0	Pgp-substrate:	0.264
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.998
20% Bioavailability (F20%):	0.439	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.566	MRP1:	0.0
Plasma Protein Binding (PPB):	58.62%	Volume Distribution (VD):	-0.292
Fu:	24.811% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.004 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.391

Half-life (T1/2):

5.828

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.855	Drug-induced Liver Injury (DILI):	0.995
AMES Toxicity:	0.998	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.07	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.887	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.833	RPMI-8226 Immunitoxicity:	0.306
A549 Cytotoxicity:	0.981	Hek293 Cytotoxicity:	0.266
BCF:	0.507 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.224 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.806 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.727 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[19290648]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	aerial parts	Changqing, Shangdong Province, China	2004-JUN	PMID[19290648]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	3
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1855	Cell line	HFL1	Homo sapiens	IC50	=	3500.0	nM	PMID[19290648]
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	10000.0	nM	PMID[19290648]
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	10000.0	nM	PMID[19290648]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	7400.0	nM	PMID[19290648]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC69811 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23398
0.1-0.2	22063
0.2-0.3	3222
0.3-0.4	700
0.4-0.5	343
0.5-0.6	109
0.6-0.7	13
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8958	High Similarity	NPC305267
0.8214	Intermediate Similarity	NPC476991
0.7434	Intermediate Similarity	NPC25663
0.7207	Intermediate Similarity	NPC476992
0.6748	Remote Similarity	NPC51564
0.6522	Remote Similarity	NPC75287
0.648	Remote Similarity	NPC220160
0.6396	Remote Similarity	NPC473459
0.6262	Remote Similarity	NPC475208
0.6231	Remote Similarity	NPC33012
0.621	Remote Similarity	NPC475514
0.6198	Remote Similarity	NPC191827
0.6168	Remote Similarity	NPC1046
0.6154	Remote Similarity	NPC8524
0.6106	Remote Similarity	NPC164389
0.6087	Remote Similarity	NPC64715
0.6048	Remote Similarity	NPC21691
0.5968	Remote Similarity	NPC4749
0.595	Remote Similarity	NPC123522
0.584	Remote Similarity	NPC85154
0.5833	Remote Similarity	NPC11242
0.582	Remote Similarity	NPC79643
0.5814	Remote Similarity	NPC302543
0.581	Remote Similarity	NPC48249
0.5806	Remote Similarity	NPC283417
0.5806	Remote Similarity	NPC200049
0.5804	Remote Similarity	NPC150400
0.5804	Remote Similarity	NPC480420
0.5794	Remote Similarity	NPC473386
0.575	Remote Similarity	NPC104137
0.575	Remote Similarity	NPC26626
0.5736	Remote Similarity	NPC135849
0.5727	Remote Similarity	NPC29069
0.5726	Remote Similarity	NPC123199
0.5726	Remote Similarity	NPC609763
0.5703	Remote Similarity	NPC470876
0.569	Remote Similarity	NPC488526
0.5659	Remote Similarity	NPC65105
0.5659	Remote Similarity	NPC43550
0.5652	Remote Similarity	NPC223301
0.5652	Remote Similarity	NPC171544
0.5639	Remote Similarity	NPC68767
0.5636	Remote Similarity	NPC238935
0.563	Remote Similarity	NPC104372
0.562	Remote Similarity	NPC481078
0.561	Remote Similarity	NPC610204
0.5606	Remote Similarity	NPC142151
0.5597	Remote Similarity	NPC51099
0.5577	Remote Similarity	NPC167383
0.5574	Remote Similarity	NPC815
0.5573	Remote Similarity	NPC144644
0.5573	Remote Similarity	NPC170407
0.5565	Remote Similarity	NPC469946
0.5564	Remote Similarity	NPC250247
0.5546	Remote Similarity	NPC471435
0.5546	Remote Similarity	NPC471434
0.5538	Remote Similarity	NPC293330
0.5522	Remote Similarity	NPC293031
0.5512	Remote Similarity	NPC471577
0.5508	Remote Similarity	NPC63159
0.5504	Remote Similarity	NPC13998
0.5492	Remote Similarity	NPC207738
0.5489	Remote Similarity	NPC482010
0.5489	Remote Similarity	NPC267694
0.5481	Remote Similarity	NPC153673
0.5474	Remote Similarity	NPC275225
0.5472	Remote Similarity	NPC237503
0.547	Remote Similarity	NPC309714
0.5462	Remote Similarity	NPC41061
0.5462	Remote Similarity	NPC227551
0.5462	Remote Similarity	NPC475504
0.5462	Remote Similarity	NPC123796
0.5455	Remote Similarity	NPC309223
0.5455	Remote Similarity	NPC37860
0.5439	Remote Similarity	NPC475516
0.5407	Remote Similarity	NPC102505
0.5407	Remote Similarity	NPC488514
0.5398	Remote Similarity	NPC48499
0.5385	Remote Similarity	NPC473452
0.5385	Remote Similarity	NPC286457
0.5379	Remote Similarity	NPC305981
0.5368	Remote Similarity	NPC110385
0.5357	Remote Similarity	NPC489208
0.5354	Remote Similarity	NPC603137
0.5338	Remote Similarity	NPC261506
0.5338	Remote Similarity	NPC298034
0.5338	Remote Similarity	NPC71065
0.5338	Remote Similarity	NPC4328
0.5302	Remote Similarity	NPC23020
0.528	Remote Similarity	NPC185466
0.5255	Remote Similarity	NPC489209
0.5254	Remote Similarity	NPC112352
0.525	Remote Similarity	NPC105800
0.5238	Remote Similarity	NPC610461
0.5231	Remote Similarity	NPC481080
0.5227	Remote Similarity	NPC471580
0.5214	Remote Similarity	NPC295371
0.5207	Remote Similarity	NPC222580
0.5191	Remote Similarity	NPC476068
0.5191	Remote Similarity	NPC237191
0.5185	Remote Similarity	NPC70809
0.5149	Remote Similarity	NPC202828
0.5149	Remote Similarity	NPC119592
0.5149	Remote Similarity	NPC236638
0.5149	Remote Similarity	NPC294453
0.5149	Remote Similarity	NPC481081
0.512	Remote Similarity	NPC609281
0.5118	Remote Similarity	NPC475287
0.5083	Remote Similarity	NPC104071
0.5082	Remote Similarity	NPC297263
0.5081	Remote Similarity	NPC481079
0.5081	Remote Similarity	NPC606145
0.5078	Remote Similarity	NPC151543
0.5077	Remote Similarity	NPC475160
0.5077	Remote Similarity	NPC480423
0.5077	Remote Similarity	NPC473714
0.5068	Remote Similarity	NPC475584
0.5068	Remote Similarity	NPC475152
0.5067	Remote Similarity	NPC478559
0.5067	Remote Similarity	NPC485563
0.5067	Remote Similarity	NPC478560
0.5041	Remote Similarity	NPC102439
0.5041	Remote Similarity	NPC232237
0.5041	Remote Similarity	NPC480475
0.5039	Remote Similarity	NPC323341
0.5035	Remote Similarity	NPC480421

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC69811 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7642
0.1-0.2	1455
0.2-0.3	50
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data