NPASS Compound

Natural Product: NPC478066

Natural Product ID	NPC478066
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	methyl (2S,3S,4S,5R,6R)-6-[[(3S,6aR,6bS,7R,8S,8aS,9R,10R,12aS,14aR,14bR)-7,8,9,10-tetrahydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylate
IUPAC Name	methyl (2S,3S,4S,5R,6R)-6-[[(3S,6aR,6bS,7R,8S,8aS,9R,10R,12aS,14aR,14bR)-7,8,9,10-tetrahydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44575722
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 147154 0 0 0 0 0 0 0 0999 V2000 0.9579 -2.0122 0.5791 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3246 -0.6540 -0.0667 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7859 0.3821 0.8555 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3484 1.2075 0.3928 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3685 0.4345 -0.4628 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7429 -0.3637 -1.5119 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7010 -0.6826 -1.4077 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5496 0.1750 -2.3447 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8692 -0.5464 -2.5344 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5665 -0.9004 -1.2727 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8278 -0.4804 -0.0666 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4923 -1.0803 1.1176 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9424 -0.7906 1.0644 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6079 -0.3698 0.0109 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9121 -0.1391 -1.2762 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7547 -0.5411 -2.4572 C 0 0 2 0 0 0 0 0 0 0 0 0 7.0683 -1.1240 -2.1599 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8700 -0.5714 -1.0396 C 0 0 2 0 0 0 0 0 0 0 0 0 7.0891 -0.1577 0.1652 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3235 1.2283 0.6509 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7868 1.5949 0.7397 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5960 1.1577 -0.4368 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8346 0.5014 -1.5355 C 0 0 2 0 0 0 0 0 0 0 0 0 8.2584 1.4132 -2.3828 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6394 0.3511 0.0669 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8567 3.1156 0.8048 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3711 1.1023 2.0692 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8161 -1.7227 -0.6269 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6267 -2.1012 -1.6690 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8663 -1.0108 -3.3252 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9678 0.5387 -3.3504 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6550 1.3534 -1.4205 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9772 -2.3707 -1.2512 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9261 0.4294 -2.8287 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5444 -1.6192 -1.7539 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1237 -0.2498 0.4804 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3717 0.3156 0.7245 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4609 -0.6220 1.0199 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7250 0.1241 1.3385 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5296 1.4380 1.9997 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1436 2.0008 1.9967 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1733 0.9980 2.0039 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9136 2.8909 3.1387 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9735 2.6673 3.9427 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7033 3.9914 3.3746 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5330 4.8879 4.4572 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3872 2.4115 1.4509 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3038 2.9166 2.3313 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6487 4.3514 2.2082 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6365 4.3973 1.0357 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.8397 2.9443 0.7428 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5459 2.3180 1.9457 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2696 2.6389 0.3356 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6185 3.2327 -0.8518 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0828 5.0945 -0.0255 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3214 4.7271 3.3945 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5456 -0.6656 2.1556 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6961 -1.6364 0.0968 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4284 -2.9107 0.4985 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7624 -3.6191 0.7857 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6771 -5.0998 0.3888 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4141 -5.1215 -1.0780 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2090 -4.2771 -1.3905 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6349 -3.6363 -0.3393 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4968 -3.4166 -2.6066 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3372 -2.3596 -2.3499 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3031 -6.4209 -1.5683 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8848 -5.7077 0.6618 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0694 -3.6192 2.1449 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9647 -2.7963 -0.2021 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5245 -2.2189 1.4813 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1166 -1.9926 0.9275 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4954 -0.0506 1.8416 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6201 1.1036 1.1139 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8949 1.7040 1.2213 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0738 2.0454 -0.2035 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0213 1.2521 -0.8394 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8657 -1.7275 -1.8142 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1264 0.2065 -3.3765 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6086 1.1476 -1.8689 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5750 -1.5267 -3.0226 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5121 -0.0668 -3.3020 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0038 0.6369 0.0199 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4570 -2.2162 1.1030 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0892 -0.7440 2.0914 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4969 -0.9504 2.0172 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1692 -1.2635 -3.0630 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9515 -2.2398 -2.0318 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3972 -0.8216 1.0305 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8148 2.0351 0.1373 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9527 1.2705 1.7190 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1395 2.0241 -0.9217 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5999 -0.0505 -2.1611 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6635 2.2933 -2.3703 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5050 0.5624 -0.3155 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8896 3.4717 0.6046 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2526 3.4865 -0.0674 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4024 3.5295 1.7026 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4617 1.0240 1.9220 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1810 1.8580 2.8352 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9441 0.1141 2.3412 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1186 -2.5947 -0.4454 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3058 -1.5395 0.3268 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3578 -2.6528 -1.2836 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5368 -1.6701 -3.9863 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2406 0.1388 -4.2136 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5998 1.7788 -1.8776 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8982 1.5906 -2.1989 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5145 1.8823 -0.4839 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2700 -3.0259 -0.7469 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0457 -2.7668 -2.3061 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9550 -2.5066 -0.7407 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8232 -0.1929 -3.7119 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0259 0.7108 -2.8057 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4083 1.3862 -2.8084 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3971 -1.9391 -2.8099 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2722 -2.4485 -1.0982 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6338 -1.4467 -1.6525 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6591 1.1351 0.0828 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1681 -1.1896 1.9673 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3058 0.2903 0.3666 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7901 1.2998 3.0981 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0076 2.5317 1.0107 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2285 5.7387 4.2767 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7575 4.3650 5.4104 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4708 5.2160 4.4590 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1874 2.5315 3.3757 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8302 5.0454 2.0113 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5861 4.8242 1.4011 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2047 2.6167 -0.0910 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9491 2.9795 1.1206 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3754 1.5435 0.2091 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5301 4.1979 -0.8947 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2400 6.0609 0.0442 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1543 4.1869 3.4897 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3807 -0.9285 1.7065 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9423 -2.9056 1.5259 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6038 -3.1885 0.2429 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9027 -5.6164 0.9884 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3369 -4.7014 -1.5705 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4290 -5.0160 -1.7637 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5499 -3.1277 -3.0957 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0231 -4.0465 -3.3949 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2755 -2.6374 -2.4881 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1764 -6.8370 -1.7375 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8112 -6.3848 1.3961 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3112 -4.5180 2.4650 H 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 1 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 22 25 1 0 21 26 1 0 21 27 1 0 18 28 1 1 28 29 1 0 17 30 1 0 16 31 1 0 15 32 1 6 10 33 1 1 6 34 1 0 6 35 1 0 5 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 43 44 2 0 43 45 1 0 45 46 1 0 40 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 50 55 1 0 49 56 1 0 39 57 1 0 38 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 62 67 1 0 61 68 1 0 60 69 1 0 7 2 1 0 11 2 1 0 15 10 1 0 19 14 1 0 23 18 1 0 42 37 1 0 52 48 1 0 64 59 1 0 1 70 1 0 1 71 1 0 1 72 1 0 3 73 1 0 3 74 1 0 4 75 1 0 4 76 1 0 5 77 1 6 7 78 1 0 8 79 1 0 8 80 1 0 9 81 1 0 9 82 1 0 11 83 1 1 12 84 1 0 12 85 1 0 13 86 1 0 16 87 1 6 17 88 1 1 19 89 1 1 20 90 1 0 20 91 1 0 22 92 1 6 23 93 1 6 24 94 1 0 25 95 1 0 26 96 1 0 26 97 1 0 26 98 1 0 27 99 1 0 27100 1 0 27101 1 0 28102 1 0 28103 1 0 29104 1 0 30105 1 0 31106 1 0 32107 1 0 32108 1 0 32109 1 0 33110 1 0 33111 1 0 33112 1 0 34113 1 0 34114 1 0 34115 1 0 35116 1 0 35117 1 0 35118 1 0 37119 1 6 38120 1 1 39121 1 6 40122 1 1 41123 1 6 46124 1 0 46125 1 0 46126 1 0 48127 1 1 49128 1 6 50129 1 1 51130 1 6 53131 1 0 53132 1 0 54133 1 0 55134 1 0 56135 1 0 57136 1 0 59137 1 1 60138 1 6 61139 1 1 62140 1 6 63141 1 6 65142 1 0 65143 1 0 66144 1 0 67145 1 0 68146 1 0 69147 1 0 M END

Standard InCHIKey	HAKHPDLODDSOTK-XWMBHQINSA-N
Standard InCHI	InChI=1S/C48H78O21/c1-43(2)15-20-19-9-10-24-45(5)13-12-25(44(3,4)23(45)11-14-46(24,6)47(19,7)36(59)38(61)48(20,18-51)37(60)35(43)58)66-42-33(68-41-30(56)28(54)26(52)21(16-49)64-41)31(57)32(34(69-42)39(62)63-8)67-40-29(55)27(53)22(17-50)65-40/h9,20-38,40-42,49-61H,10-18H2,1-8H3/t20-,21+,22-,23?,24+,25-,26+,27-,28-,29+,30+,31-,32-,33+,34-,35-,36-,37-,38+,40-,41-,42+,45-,46+,47-,48+/m0/s1
SMILES	C[C@]12CC[C@@H](C(C1CC[C@@]3([C@@H]2CC=C4[C@]3([C@H]([C@H]([C@@]5([C@H]4CC([C@H]([C@@H]5O)O)(C)C)CO)O)O)C)C)(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)OC)O[C@H]7[C@@H]([C@H]([C@@H](O7)CO)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	990.5	Volume:	949.634 ? Van der Waals volume.
Dense:	1.043	LogP:	0.496 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.524 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.426 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	44.0
TPSA:	344.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	13.0	Rings:	8.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.06	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.616	Fsp³:	0.938
MCE-18:	180.258 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.644	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.011 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.251	Promiscuous compounds:	0.256

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.727	MDCK Permeability:	-5.098
Pgp-inhibitor:	0.0	Pgp-substrate:	0.196
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.076
20% Bioavailability (F20%):	0.809	30% Bioavailability (F30%):	0.985
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.076	MRP1:	0.025
Plasma Protein Binding (PPB):	67.184%	Volume Distribution (VD):	-0.318
Fu:	21.274% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.998	BCRP inhibitor:	0.0
BSEP inhibitor:	0.003

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.004	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.019	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.65
HLM stability:	0.344 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.074

Half-life (T1/2):

3.137

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.008
Human Hepatotoxicity (H-HT):	0.304	Drug-induced Liver Injury (DILI):	0.712
AMES Toxicity:	0.951	Rat Oral Acute Toxicity:	0.009
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.074	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.828	Drug-induced Nephrotoxicity:	0.986
Genotoxicity:	0.302	RPMI-8226 Immunitoxicity:	0.295
A549 Cytotoxicity:	0.917	Hek293 Cytotoxicity:	0.604
BCF:	0.852 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.301 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.661 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.589 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	roots	n.a.	n.a.	PMID[15620235]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	roots	Nanning City, Guangxi Province, People's Republic of China	1997-Jan	PMID[17190442]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4
Ratio IC50	1

Activity Type	# Activity
Cell line	3
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	IC50	=	0.3	ug/ml	PMID[15620235]
NPT180	Cell line	HCT-8	Homo sapiens	IC50	=	6.8	ug/ml	PMID[15620235]
NPT81	Cell line	A549	Homo sapiens	IC50	=	0.66	ug/ml	PMID[15620235]
NPT27	Others	Unspecified	n.a.	IC50	>	10	ug/ml	PMID[15620235]
NPT2	Others	Unspecified	n.a.	Ratio IC50	=	33	n.a.	PMID[15620235]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478066 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21752
0.1-0.2	23719
0.2-0.3	3151
0.3-0.4	808
0.4-0.5	346
0.5-0.6	57
0.6-0.7	11
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7054	Intermediate Similarity	NPC134914
0.7	Intermediate Similarity	NPC603026
0.6667	Remote Similarity	NPC301639
0.6667	Remote Similarity	NPC478065
0.6496	Remote Similarity	NPC329993
0.6333	Remote Similarity	NPC173435
0.6333	Remote Similarity	NPC172374
0.6333	Remote Similarity	NPC478064
0.6296	Remote Similarity	NPC470913
0.6083	Remote Similarity	NPC475513
0.608	Remote Similarity	NPC69425
0.6036	Remote Similarity	NPC470914
0.6019	Remote Similarity	NPC605226
0.5982	Remote Similarity	NPC606145
0.5826	Remote Similarity	NPC605294
0.5826	Remote Similarity	NPC606553
0.5812	Remote Similarity	NPC1314
0.5812	Remote Similarity	NPC273878
0.5794	Remote Similarity	NPC249848
0.5794	Remote Similarity	NPC107966
0.575	Remote Similarity	NPC470912
0.5739	Remote Similarity	NPC329976
0.5739	Remote Similarity	NPC609281
0.5702	Remote Similarity	NPC475167
0.5593	Remote Similarity	NPC607904
0.5575	Remote Similarity	NPC470514
0.5536	Remote Similarity	NPC10607
0.5536	Remote Similarity	NPC2370
0.5455	Remote Similarity	NPC470512
0.5446	Remote Similarity	NPC30735
0.5413	Remote Similarity	NPC235405
0.5405	Remote Similarity	NPC213674
0.5366	Remote Similarity	NPC46823
0.5349	Remote Similarity	NPC295408
0.5328	Remote Similarity	NPC609305
0.531	Remote Similarity	NPC480947
0.5304	Remote Similarity	NPC470513
0.5294	Remote Similarity	NPC470915
0.5268	Remote Similarity	NPC263756
0.5263	Remote Similarity	NPC173859
0.5263	Remote Similarity	NPC148603
0.5242	Remote Similarity	NPC277212
0.5242	Remote Similarity	NPC30279
0.5207	Remote Similarity	NPC475287
0.5207	Remote Similarity	NPC610461
0.52	Remote Similarity	NPC192765
0.5197	Remote Similarity	NPC225791
0.5185	Remote Similarity	NPC214484
0.5172	Remote Similarity	NPC123796
0.5172	Remote Similarity	NPC297263
0.5169	Remote Similarity	NPC477076
0.5161	Remote Similarity	NPC264566
0.5159	Remote Similarity	NPC178264
0.5159	Remote Similarity	NPC473755
0.5159	Remote Similarity	NPC57484
0.5138	Remote Similarity	NPC164194
0.5126	Remote Similarity	NPC488564
0.512	Remote Similarity	NPC473918
0.5089	Remote Similarity	NPC109079
0.5086	Remote Similarity	NPC235438
0.5085	Remote Similarity	NPC78034
0.5082	Remote Similarity	NPC609119
0.5079	Remote Similarity	NPC329923
0.5079	Remote Similarity	NPC475281
0.5079	Remote Similarity	NPC71391
0.5078	Remote Similarity	NPC470876
0.5043	Remote Similarity	NPC222580
0.5043	Remote Similarity	NPC309714
0.5043	Remote Similarity	NPC30289
0.5042	Remote Similarity	NPC477075

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478066 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7309
0.1-0.2	1783
0.2-0.3	52
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data