Drug Information| Drug ID:   | NPD6313 |
| Drug Name:   | Halobetasol Propionate |
| Molecular Formula:   | C25H31ClF2O5 |
| Canonical SMILES:   | CCC(=O)O[C@@]1([C@@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F)C(=O)CCl |
| Standard InCHI:   | "InChI=1S/C25H31ClF2O5/c1-5-21(32)33-25(20(31)12-26)13(2)8-15-16-10-18(27)17-9-14(29)6-7-22(17,3)24(16,28)19(30)11-23(15,25)4/h6-7,9,13,15-16,18-19,30H,5,8,10-12H2,1-4H3/t13-,15-,16-,18-,19-,22-,23-,24-,25-/m0/s1" |
| Standard InCHIKey:   | BDSYKGHYMJNPAB-LICBFIPMSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6313Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 484.18 |
| ALogP   | 1.0828 |
| MLogP   | 3.33 |
| XLogP   | 2.905 |
| HDA   | 5 |
| HBD   | 1 |
| Rotatable Bonds   | 13 |
| TPSA   | 80.67 |
| RO5 Violation   | 0 |