Drug Information| Drug ID:   | NPD5695 |
| Drug Name:   | Anecortave Acetate |
| Molecular Formula:   | C23H30O5 |
| Canonical SMILES:   | CC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)CC=C1[C@H]2CCC2=CC(=O)CC[C@]12C |
| Standard InCHI:   | "InChI=1S/C23H30O5/c1-14(24)28-13-20(26)23(27)11-8-19-17-5-4-15-12-16(25)6-9-21(15,2)18(17)7-10-22(19,23)3/h7,12,17,19,27H,4-6,8-11,13H2,1-3H3/t17-,19+,21+,22+,23+/m1/s1" |
| Standard InCHIKey:   | YUWPMEXLKGOSBF-GACAOOTBSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5695Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5325 | NPC488911 |
| Remote Similarity | 0.507 | NPC473246 |
| Remote Similarity | 0.507 | NPC575319 |
| Remote Similarity | 0.5063 | NPC482048 |
| Remote Similarity | 0.5063 | NPC611793 |
| TTD   | DNAP001324 |
| DrugBank   | DB05288 |
| ChEMBL   | CHEMBL2106613 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 111332 |
| ChEBI   | 31215 |
| CAS Number   |
| Molecular Weight   | 386.21 |
| ALogP   | 0.6053 |
| MLogP   | 3.44 |
| XLogP   | 2.286 |
| HDA   | 5 |
| HBD   | 1 |
| Rotatable Bonds   | 8 |
| TPSA   | 80.67 |
| RO5 Violation   | 0 |