NPASS drugs

Drug Information

Drug ID:	NPD5211
Drug Name:	Prednylidene
Molecular Formula:	C22H28O5
Canonical SMILES:	OCC(=O)[C@@]1(O)C(=C)C[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C
Standard InCHI:	"InChI=1S/C22H28O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-20(13,2)19(15)17(25)10-21(16,3)22(12,27)18(26)11-23/h6-7,9,15-17,19,23,25,27H,1,4-5,8,10-11H2,2-3H3/t15-,16-,17-,19+,20-,21-,22-/m0/s1"
Standard InCHIKey:	WSVOMANDJDYYEY-CWNVBEKCSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD5211

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	66012
0.1-0.2	137143
0.2-0.3	8307
0.3-0.4	199
0.4-0.5	59
0.5-0.6	12
0.6-0.7	4
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7119	NPC334061
Intermediate Similarity	0.7119	NPC611819
Remote Similarity	0.6557	NPC530777
Remote Similarity	0.6066	NPC594777
Remote Similarity	0.6	NPC197292
Remote Similarity	0.6	NPC209342
Remote Similarity	0.5821	NPC44063
Remote Similarity	0.5821	NPC235800
Remote Similarity	0.5821	NPC611921
Remote Similarity	0.5781	NPC158032
Remote Similarity	0.5455	NPC169375
Remote Similarity	0.5455	NPC254421
Remote Similarity	0.5373	NPC69144
Remote Similarity	0.5373	NPC217788
Remote Similarity	0.5231	NPC62180
Remote Similarity	0.5217	NPC116123
Remote Similarity	0.5217	NPC34884
Remote Similarity	0.5156	NPC531127

Drug Structure

NPD5211 OpenBabel08211706322D 30 33 0 0 1 0 0 0 0 0999 V2000 -1.7176 0.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3762 -0.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8438 0.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5329 -3.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6888 -2.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0633 -1.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2197 -1.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8424 -1.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2203 -3.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6880 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9255 1.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8427 -0.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3768 -2.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0635 -2.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6885 -1.9479 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8444 -1.4609 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5321 -0.4865 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0003 0.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5324 -1.4604 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3765 -1.9475 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8441 -0.4870 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6491 0.6234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9384 -3.4261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3754 0.0007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7239 1.6247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8432 0.4865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5749 0.9245 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3751 0.9746 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4944 -0.2372 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 2 0 0 0 0 3 21 1 0 0 0 0 4 5 1 0 0 0 0 4 13 1 0 0 0 0 6 7 2 0 0 0 0 6 14 1 0 0 0 0 7 20 1 0 0 0 0 8 12 1 0 0 0 0 8 16 1 0 0 0 0 9 13 2 0 0 0 0 9 14 1 0 0 0 0 10 17 1 0 0 0 0 10 21 1 0 0 0 0 11 18 1 0 0 0 0 11 23 1 0 0 0 0 12 22 1 0 0 0 0 13 20 1 0 0 0 0 14 24 2 0 0 0 0 15 5 1 1 0 0 0 15 16 1 0 0 0 0 15 19 1 0 0 0 0 16 21 1 6 0 0 0 17 19 1 0 0 0 0 17 25 1 6 0 0 0 18 26 2 0 0 0 0 19 20 1 6 0 0 0 20 2 1 6 0 0 0 21 22 1 1 0 0 0 22 18 1 6 0 0 0 22 27 1 0 0 0 0 23 28 1 0 0 0 0 25 29 1 0 0 0 0 27 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	372.19
ALogP	-0.5358
MLogP	3.33
XLogP	0.767
HDA	5
HBD	3
Rotatable Bonds	7
TPSA	94.83
RO5 Violation	0