Drug Information| Drug ID:   | NPD7078 |
| Drug Name:   | Amcinonide |
| Molecular Formula:   | C28H35FO7 |
| Canonical SMILES:   | CC(=O)OCC(=O)[C@@]12OC3(O[C@@H]1C[C@@H]1[C@]2(C)C[C@H](O)[C@]2([C@H]1CCC1=CC(=O)C=C[C@]21C)F)CCCC3 |
| Standard InCHI:   | "InChI=1S/C28H35FO7/c1-16(30)34-15-22(33)28-23(35-26(36-28)9-4-5-10-26)13-20-19-7-6-17-12-18(31)8-11-24(17,2)27(19,29)21(32)14-25(20,28)3/h8,11-12,19-21,23,32H,4-7,9-10,13-15H2,1-3H3/t19-,20-,21-,23+,24-,25-,27-,28+/m0/s1" |
| Standard InCHIKey:   | ILKJAFIWWBXGDU-MOGDOJJUSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD7078Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DAP001044 |
| DrugBank   | DB00288 |
| ChEMBL   | CHEMBL1200732 |
| IUPHAR/BPS   | 7060 |
| PharmaGKB   | PA164746074 |
| KEGG Drug   | D01387 |
| PubChem CID   | 443958 |
| ChEBI   | 31199 |
| CAS Number   | 51022-69-6 |
| Molecular Weight   | 502.24 |
| ALogP   | -1.5354 |
| MLogP   | 3.66 |
| XLogP   | 2.34 |
| HDA   | 7 |
| HBD   | 1 |
| Rotatable Bonds   | 9 |
| TPSA   | 99.13 |
| RO5 Violation   | 0 |