Drug Information| Drug ID:   | NPD5983 |
| Drug Name:   | Etiprednol Dicloacetate |
| Molecular Formula:   | C24H30Cl2O6 |
| Canonical SMILES:   | CCOC(=O)[C@]1(CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C)OC(=O)C(Cl)Cl |
| Standard InCHI:   | "InChI=1S/C24H30Cl2O6/c1-4-31-21(30)24(32-20(29)19(25)26)10-8-16-15-6-5-13-11-14(27)7-9-22(13,2)18(15)17(28)12-23(16,24)3/h7,9,11,15-19,28H,4-6,8,10,12H2,1-3H3/t15-,16-,17-,18+,22-,23-,24-/m0/s1" |
| Standard InCHIKey:   | QAIOVDNCIZSSSF-RFAJLIJZSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5983Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5286 | NPC594777 |
| Remote Similarity | 0.5217 | NPC197292 |
| Remote Similarity | 0.5217 | NPC209342 |
| Remote Similarity | 0.5135 | NPC69144 |
| Remote Similarity | 0.5135 | NPC217788 |
| Remote Similarity | 0.5132 | NPC44063 |
| Remote Similarity | 0.5132 | NPC235800 |
| Remote Similarity | 0.5132 | NPC611921 |
| TTD   | DIB012163 |
| DrugBank   | DB05442 |
| ChEMBL   | CHEMBL2107614 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | 135783 |
| CAS Number   | 199331-40-3 |
| Molecular Weight   | 484.14 |
| ALogP   | 1.904 |
| MLogP   | 3.22 |
| XLogP   | 3.499 |
| HDA   | 6 |
| HBD   | 1 |
| Rotatable Bonds   | 12 |
| TPSA   | 89.9 |
| RO5 Violation   | 0 |