Drug Information| Drug ID:   | NPD6882 |
| Drug Name:   | Prednicarbate |
| Molecular Formula:   | C27H36O8 |
| Canonical SMILES:   | CCOC(=O)O[C@@]1(CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C)C(=O)COC(=O)CC |
| Standard InCHI:   | "InChI=1S/C27H36O8/c1-5-22(31)34-15-21(30)27(35-24(32)33-6-2)12-10-19-18-8-7-16-13-17(28)9-11-25(16,3)23(18)20(29)14-26(19,27)4/h9,11,13,18-20,23,29H,5-8,10,12,14-15H2,1-4H3/t18-,19-,20-,23+,25-,26-,27-/m0/s1" |
| Standard InCHIKey:   | FNPXMHRZILFCKX-KAJVQRHHSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD6882Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.56 | NPC44063 |
| Remote Similarity | 0.56 | NPC235800 |
| Remote Similarity | 0.56 | NPC611921 |
| Remote Similarity | 0.5352 | NPC594777 |
| Remote Similarity | 0.5286 | NPC197292 |
| Remote Similarity | 0.5286 | NPC209342 |
| Remote Similarity | 0.52 | NPC69144 |
| Remote Similarity | 0.52 | NPC217788 |
| TTD   | DAP001189 |
| DrugBank   | DB01130 |
| ChEMBL   | CHEMBL1200386 |
| IUPHAR/BPS   | 7605 |
| PharmaGKB   | PA164749394 |
| KEGG Drug   | |
| PubChem CID   | 6714002 |
| ChEBI   | 135791 |
| CAS Number   | 73771-04-7 |
| Molecular Weight   | 488.24 |
| ALogP   | 0.8703 |
| MLogP   | 3.55 |
| XLogP   | 2.919 |
| HDA   | 8 |
| HBD   | 1 |
| Rotatable Bonds   | 14 |
| TPSA   | 116.2 |
| RO5 Violation   | 0 |