NPASS drugs

Drug Information

Drug ID:	NPD5286
Drug Name:	Methylprednisolone
Molecular Formula:	C22H30O5
Canonical SMILES:	OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)C
Standard InCHI:	InChI=1S/C22H30O5/c1-12-8-14-15-5-7-22(27,18(26)11-23)21(15,3)10-17(25)19(14)20(2)6-4-13(24)9-16(12)20/h4,6,9,12,14-15,17,19,23,25,27H,5,7-8,10-11H2,1-3H3/t12-,14-,15-,17-,19+,20-,21-,22-/m0/s1
Standard InCHIKey:	VHRSUDSXCMQTMA-PJHHCJLFSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5286

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	142
0.1-0.2	817
0.2-0.3	3095
0.3-0.4	6593
0.4-0.5	9159
0.5-0.6	4502
0.6-0.7	4167
0.7-0.8	2092
0.8-0.85	251
0.85-0.9	60
0.9-0.95	10
0.95-1	2

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC144956
High Similarity	0.9783	NPC18509
High Similarity	0.9388	NPC44063
High Similarity	0.9239	NPC185936
High Similarity	0.9239	NPC168027
High Similarity	0.92	NPC2766
High Similarity	0.9109	NPC235077
High Similarity	0.9082	NPC311612
High Similarity	0.9022	NPC310010
High Similarity	0.9022	NPC326627

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD5286 OpenBabel08211706322D 30 33 0 0 1 0 0 0 0 0999 V2000 -2.5320 -4.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3759 -0.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8440 0.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0627 -1.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8428 -1.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2193 -1.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8428 -0.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6880 -2.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2194 -3.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6880 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9255 1.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5320 -3.4101 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0628 -2.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6880 -1.9484 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8440 -1.4612 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3760 -2.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5320 -0.4872 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0003 0.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5320 -1.4611 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3760 -1.9484 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8440 -0.4872 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1276 2.2269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9374 -3.4277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3754 -0.0002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7240 1.6247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8431 0.4867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4039 2.8781 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3754 0.9737 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7690 0.1859 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3 21 1 0 0 0 0 4 6 2 0 0 0 0 4 13 1 0 0 0 0 5 7 1 0 0 0 0 5 15 1 0 0 0 0 6 20 1 0 0 0 0 7 22 1 0 0 0 0 8 12 1 0 0 0 0 9 13 1 0 0 0 0 9 16 2 0 0 0 0 10 17 1 0 0 0 0 10 21 1 0 0 0 0 11 18 1 0 0 0 0 11 23 1 0 0 0 0 12 1 1 6 0 0 0 12 16 1 0 0 0 0 13 24 2 0 0 0 0 14 8 1 6 0 0 0 14 15 1 0 0 0 0 14 19 1 0 0 0 0 15 21 1 1 0 0 0 16 20 1 0 0 0 0 17 19 1 0 0 0 0 17 25 1 1 0 0 0 18 26 2 0 0 0 0 19 20 1 1 0 0 0 20 2 1 1 0 0 0 21 22 1 6 0 0 0 22 18 1 1 0 0 0 22 27 1 0 0 0 0 23 28 1 0 0 0 0 25 29 1 0 0 0 0 27 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001040
DrugBank	DB00959
ChEMBL	CHEMBL650
IUPHAR/BPS	7088
PharmaGKB	PA450466
KEGG Drug	D00407
PubChem CID
ChEBI	6888
CAS Number	83-43-2

Drug Properties

Molecular Weight	374.21
ALogP	-0.9799
MLogP	3.33
XLogP	1.525
HDA	5
HBD	3
Rotatable Bonds	8
TPSA	94.83
RO5 Violation	0