Drug Information| Drug ID:   | NPD5956 |
| Drug Name:   | Flucloronide |
| Molecular Formula:   | C24H29Cl2FO5 |
| Canonical SMILES:   | OCC(=O)[C@@]12OC(O[C@@H]1C[C@@H]1[C@]2(C)C[C@H](Cl)[C@]2([C@H]1C[C@@H](C1=CC(=O)C=C[C@]21C)F)Cl)(C)C |
| Standard InCHI:   | "InChI=1S/C24H29Cl2FO5/c1-20(2)31-19-9-13-14-8-16(27)15-7-12(29)5-6-21(15,3)23(14,26)17(25)10-22(13,4)24(19,32-20)18(30)11-28/h5-7,13-14,16-17,19,28H,8-11H2,1-4H3/t13-,14-,16-,17-,19+,21-,22-,23-,24+/m0/s1" |
| Standard InCHIKey:   | NJNWEGFJCGYWQT-VSXGLTOVSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5956Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7534 | NPC313528 |
| TTD   | |
| DrugBank   | DB08973 |
| ChEMBL   | CHEMBL461332 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | 135787 |
| CAS Number   | 3693-39-8 |
| Molecular Weight   | 486.14 |
| ALogP   | 1.1762 |
| MLogP   | 3.22 |
| XLogP   | 2.601 |
| HDA   | 5 |
| HBD   | 1 |
| Rotatable Bonds   | 10 |
| TPSA   | 72.83 |
| RO5 Violation   | 0 |