Drug Information| Drug ID:   | NPD6012 |
| Drug Name:   | Paramethasone Acetate |
| Molecular Formula:   | C24H31FO6 |
| Canonical SMILES:   | CC(=O)OCC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F |
| Standard InCHI:   | "InChI=1S/C24H31FO6/c1-12-7-16-15-9-18(25)17-8-14(27)5-6-22(17,3)21(15)19(28)10-23(16,4)24(12,30)20(29)11-31-13(2)26/h5-6,8,12,15-16,18-19,21,28,30H,7,9-11H2,1-4H3/t12-,15+,16+,18+,19+,21-,22+,23+,24+/m1/s1" |
| Standard InCHIKey:   | HYRKAAMZBDSJFJ-LFDBJOOHSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6012Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 434.21 |
| ALogP   | -0.4271 |
| MLogP   | 3.33 |
| XLogP   | 1.347 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 11 |
| TPSA   | 100.9 |
| RO5 Violation   | 0 |