NPASS drugs

Drug Information

Drug ID:	NPD4632
Drug Name:	Loteprednol
Molecular Formula:	C21H27ClO5
Canonical SMILES:	ClCOC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C
Standard InCHI:	"InChI=1S/C21H27ClO5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,18(25)27-11-22)20(15,2)10-16(24)17(14)19/h5,7,9,14-17,24,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,16-,17+,19-,20-,21-/m0/s1"
Standard InCHIKey:	YPZVAYHNBBHPTO-MXRBDKCISA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD4632

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	70469
0.1-0.2	131580
0.2-0.3	9441
0.3-0.4	185
0.4-0.5	51
0.5-0.6	8
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6818	NPC44063
Remote Similarity	0.6818	NPC235800
Remote Similarity	0.6818	NPC611921
Remote Similarity	0.6562	NPC334061
Remote Similarity	0.6562	NPC530777
Remote Similarity	0.6562	NPC611819
Remote Similarity	0.5846	NPC594777
Remote Similarity	0.5538	NPC197292
Remote Similarity	0.5538	NPC209342
Remote Similarity	0.5211	NPC69144
Remote Similarity	0.5211	NPC217788
Remote Similarity	0.5143	NPC158032
Remote Similarity	0.507	NPC169375
Remote Similarity	0.507	NPC254421

Drug Structure

NPD4632 OpenBabel08211705262D 29 32 0 0 1 0 0 0 0 0999 V2000 3.3772 -0.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8441 0.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5337 -3.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6893 -2.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0648 -1.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8426 -1.4619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2210 -1.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8429 -0.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2216 -3.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6885 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5227 2.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3778 -2.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0651 -2.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6890 -1.9485 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8447 -1.4614 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5329 -0.4867 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5331 -1.4609 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0006 0.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3775 -1.9481 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8444 -0.4872 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2468 3.2288 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 5.9402 -3.4271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3764 0.0007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9254 1.2753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8435 0.4867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7246 1.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3761 0.9749 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7696 0.1854 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 20 1 0 0 0 0 3 4 1 0 0 0 0 3 12 1 0 0 0 0 5 7 2 0 0 0 0 5 13 1 0 0 0 0 6 8 1 0 0 0 0 6 15 1 0 0 0 0 7 19 1 0 0 0 0 8 21 1 0 0 0 0 9 12 2 0 0 0 0 9 13 1 0 0 0 0 10 16 1 0 0 0 0 10 20 1 0 0 0 0 11 22 1 0 0 0 0 11 27 1 0 0 0 0 12 19 1 0 0 0 0 13 23 2 0 0 0 0 14 4 1 1 0 0 0 14 15 1 0 0 0 0 14 17 1 0 0 0 0 15 20 1 6 0 0 0 16 17 1 0 0 0 0 16 24 1 6 0 0 0 17 19 1 6 0 0 0 18 25 2 0 0 0 0 18 27 1 0 0 0 0 19 1 1 6 0 0 0 20 21 1 1 0 0 0 21 18 1 6 0 0 0 21 26 1 0 0 0 0 24 28 1 0 0 0 0 26 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001045
DrugBank	DB00873
ChEMBL
IUPHAR/BPS
PharmaGKB	PA164764569
KEGG Drug	D01689
PubChem CID	0
ChEBI	50848
CAS Number	129260-79-3

Drug Properties

Molecular Weight	394.15
ALogP	0.5163
MLogP	3.11
XLogP	2.092
HDA	5
HBD	2
Rotatable Bonds	8
TPSA	83.83
RO5 Violation	0