Drug Information| Drug ID:   | NPD7128 |
| Drug Name:   | Hydrocortisone Probutate |
| Molecular Formula:   | C28H40O7 |
| Canonical SMILES:   | CCCC(=O)O[C@@]1(CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C)C(=O)COC(=O)CC |
| Standard InCHI:   | "InChI=1S/C28H40O7/c1-5-7-24(33)35-28(22(31)16-34-23(32)6-2)13-11-20-19-9-8-17-14-18(29)10-12-26(17,3)25(19)21(30)15-27(20,28)4/h14,19-21,25,30H,5-13,15-16H2,1-4H3/t19-,20-,21-,25+,26-,27-,28-/m0/s1" |
| Standard InCHIKey:   | FOGXJPFPZOHSQS-AYVLZSQQSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7128Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5556 | NPC305039 |
| Remote Similarity | 0.5556 | NPC612001 |
| Remote Similarity | 0.5522 | NPC257176 |
| Remote Similarity | 0.5522 | NPC607162 |
| Remote Similarity | 0.5441 | NPC328539 |
| Remote Similarity | 0.5278 | NPC326774 |
| Remote Similarity | 0.5211 | NPC185936 |
| Remote Similarity | 0.5211 | NPC168027 |
| Remote Similarity | 0.5211 | NPC611230 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 488.28 |
| ALogP   | -0.499 |
| MLogP   | 3.77 |
| XLogP   | 2.679 |
| HDA   | 7 |
| HBD   | 1 |
| Rotatable Bonds   | 14 |
| TPSA   | 106.97 |
| RO5 Violation   | 0 |