Drug Information| Drug ID:   | NPD5955 |
| Drug Name:   | |
| Molecular Formula:   | C24H28O9 |
| Canonical SMILES:   | OC(=O)CCC(=O)O[C@@H]1[C@]2(O[C@H]2[C@H]2[C@@]3([C@@]41O[C@H]4C[C@@H]1C3(C)CCC3=C1COC3=O)O2)C(C)C |
| Standard InCHI:   | "InChI=1S/C24H28O9/c1-10(2)22-17(32-22)18-24(33-18)21(3)7-6-11-12(9-29-19(11)28)13(21)8-14-23(24,31-14)20(22)30-16(27)5-4-15(25)26/h10,13-14,17-18,20H,4-9H2,1-3H3,(H,25,26)/t13-,14-,17-,18-,20+,21?,22-,23+,24+/m0/s1" |
| Standard InCHIKey:   | HROMYAWHLUOUPY-GOONNFATSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5955Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5467 | NPC299590 |
| Remote Similarity | 0.5467 | NPC96148 |
| Remote Similarity | 0.5467 | NPC599829 |
| Remote Similarity | 0.5333 | NPC33360 |
| Remote Similarity | 0.5333 | NPC118039 |
| Remote Similarity | 0.5333 | NPC319889 |
| Remote Similarity | 0.5333 | NPC49738 |
| Remote Similarity | 0.5333 | NPC603052 |
| Remote Similarity | 0.5063 | NPC40458 |
| Remote Similarity | 0.5063 | NPC327234 |
| TTD   | DNCL002276 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 56841561 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 460.17 |
| ALogP   | -0.6882 |
| MLogP   | 3.11 |
| XLogP   | 0.103 |
| HDA   | 9 |
| HBD   | 1 |
| Rotatable Bonds   | 10 |
| TPSA   | 127.49 |
| RO5 Violation   | 0 |