Drug Information| Drug ID:   | NPD6334 |
| Drug Name:   | Deflazacort |
| Molecular Formula:   | C25H31NO6 |
| Canonical SMILES:   | CC(=O)OCC(=O)[C@@]12N=C(O[C@@H]1C[C@@H]1[C@]2(C)C[C@H](O)[C@H]2[C@H]1CCC1=CC(=O)C=C[C@]21C)C |
| Standard InCHI:   | "InChI=1S/C25H31NO6/c1-13-26-25(20(30)12-31-14(2)27)21(32-13)10-18-17-6-5-15-9-16(28)7-8-23(15,3)22(17)19(29)11-24(18,25)4/h7-9,17-19,21-22,29H,5-6,10-12H2,1-4H3/t17-,18-,19-,21+,22+,23-,24-,25+/m0/s1" |
| Standard InCHIKey:   | FBHSPRKOSMHSIF-GRMWVWQJSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD6334Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5526 | NPC44063 |
| Remote Similarity | 0.5526 | NPC235800 |
| Remote Similarity | 0.5526 | NPC611921 |
| Remote Similarity | 0.5278 | NPC594777 |
| Remote Similarity | 0.5211 | NPC197292 |
| Remote Similarity | 0.5211 | NPC209342 |
| Remote Similarity | 0.5132 | NPC69144 |
| Remote Similarity | 0.5132 | NPC217788 |
| Remote Similarity | 0.5067 | NPC158032 |
| Molecular Weight   | 441.22 |
| ALogP   | -0.2473 |
| MLogP   | 3.44 |
| XLogP   | 1.915 |
| HDA   | 7 |
| HBD   | 1 |
| Rotatable Bonds   | 9 |
| TPSA   | 102.26 |
| RO5 Violation   | 0 |