Drug Information| Drug ID:   | NPD6009 |
| Drug Name:   | Loteprednol Etabonate |
| Molecular Formula:   | C24H31ClO7 |
| Canonical SMILES:   | ClCOC(=O)[C@]1(CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C)OC(=O)OCC |
| Standard InCHI:   | "InChI=1S/C24H31ClO7/c1-4-30-21(29)32-24(20(28)31-13-25)10-8-17-16-6-5-14-11-15(26)7-9-22(14,2)19(16)18(27)12-23(17,24)3/h7,9,11,16-19,27H,4-6,8,10,12-13H2,1-3H3/t16-,17-,18-,19+,22-,23-,24-/m0/s1" |
| Standard InCHIKey:   | DMKSVUSAATWOCU-HROMYWEYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD6009Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5205 | NPC594777 |
| Remote Similarity | 0.5063 | NPC44063 |
| Remote Similarity | 0.5063 | NPC235800 |
| Remote Similarity | 0.5063 | NPC611921 |
| Molecular Weight   | 466.18 |
| ALogP   | 1.789 |
| MLogP   | 3.22 |
| XLogP   | 3.426 |
| HDA   | 7 |
| HBD   | 1 |
| Rotatable Bonds   | 12 |
| TPSA   | 99.13 |
| RO5 Violation   | 0 |