Drug Information| Drug ID:   | NPD7604 |
| Drug Name:   | "870086 (inhaled, asthma), GlaxoSmithKline" |
| Molecular Formula:   | C31H39F2NO6 |
| Canonical SMILES:   | N#CCOC(=O)[C@@]1(OC(=O)C2C(C2(C)C)(C)C)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F |
| Standard InCHI:   | "InChI=1S/C31H39F2NO6/c1-16-12-18-19-14-21(32)20-13-17(35)8-9-28(20,6)30(19,33)22(36)15-29(18,7)31(16,25(38)39-11-10-34)40-24(37)23-26(2,3)27(23,4)5/h8-9,13,16,18-19,21-23,36H,11-12,14-15H2,1-7H3/t16-,18+,19+,21+,22+,28+,29+,30+,31+/m1/s1" |
| Standard InCHIKey:   | WUBKGTSFJSEIEM-NSHBDUGJSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7604Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5349 | NPC313528 |
| Molecular Weight   | 559.27 |
| ALogP   | 2.1435 |
| MLogP   | 3.88 |
| XLogP   | 4.398 |
| HDA   | 7 |
| HBD   | 1 |
| Rotatable Bonds   | 16 |
| TPSA   | 113.69 |
| RO5 Violation   | 0 |