NPASS drugs

Drug Information

Drug ID:	NPD7637
Drug Name:	tisocalcitate
Molecular Formula:	C31H48O5
Canonical SMILES:	CC(OC(=O)C([C@@H](/C=C/[C@H]([C@H]1CC[C@@H]2[C@]1(C)CCC/C/2=CC=C/1C[C@@H](O)C[C@@H](C1=C)O)C)O)(C)C)C
Standard InCHI:	"InChI=1S/C31H48O5/c1-19(2)36-29(35)30(5,6)28(34)15-10-20(3)25-13-14-26-22(9-8-16-31(25,26)7)11-12-23-17-24(32)18-27(33)21(23)4/h10-12,15,19-20,24-28,32-34H,4,8-9,13-14,16-18H2,1-3,5-7H3/b15-10+,22-11+,23-12-/t20-,24-,25-,26+,27+,28-,31-/m1/s1"
Standard InCHIKey:	AUMBXYDXKLLKEK-BGMQPCSBSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD7637

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	57287
0.1-0.2	137476
0.2-0.3	16774
0.3-0.4	165
0.4-0.5	14
0.5-0.6	17
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6866	NPC316856
Remote Similarity	0.6866	NPC607632
Remote Similarity	0.625	NPC324848
Remote Similarity	0.6111	NPC23466
Remote Similarity	0.6	NPC63893
Remote Similarity	0.6	NPC324772
Remote Similarity	0.6	NPC611865
Remote Similarity	0.5915	NPC320525
Remote Similarity	0.5915	NPC320548
Remote Similarity	0.5352	NPC153043
Remote Similarity	0.5352	NPC49422
Remote Similarity	0.5352	NPC58258
Remote Similarity	0.5352	NPC220569
Remote Similarity	0.5352	NPC67059
Remote Similarity	0.5352	NPC220672
Remote Similarity	0.5352	NPC104448
Remote Similarity	0.5352	NPC120474
Remote Similarity	0.5352	NPC9161
Remote Similarity	0.5352	NPC178317
Remote Similarity	0.5352	NPC5386
Remote Similarity	0.5352	NPC287442
Remote Similarity	0.5352	NPC146946
Remote Similarity	0.5352	NPC611829
Remote Similarity	0.5135	NPC325017

Drug Structure

NPD7637 OpenBabel08211712022D 39 41 0 0 1 0 0 0 0 0999 V2000 -0.6410 -4.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2882 -4.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3904 1.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4404 -3.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3915 -3.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 -0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0303 -0.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3364 1.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6581 1.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0085 -0.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3101 -3.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7213 0.4612 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3301 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7431 0.6691 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1962 2.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3175 -1.6488 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6702 -2.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6483 -2.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9282 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2956 -1.8567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3612 -1.2330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0011 -2.9272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6046 -2.8078 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 19 1 0 0 0 0 2 19 1 0 0 0 0 4 21 2 0 0 0 0 5 30 1 0 0 0 0 6 30 1 0 0 0 0 8 9 1 0 0 0 0 8 16 1 0 0 0 0 9 22 1 0 0 0 0 10 15 2 0 0 0 0 10 20 1 0 0 0 0 11 12 1 0 0 0 0 11 22 2 0 0 0 0 12 23 2 0 0 0 0 13 14 1 0 0 0 0 13 25 1 0 0 0 0 14 26 1 0 0 0 0 16 31 1 0 0 0 0 17 23 1 0 0 0 0 17 24 1 0 0 0 0 18 24 1 0 0 0 0 18 27 1 0 0 0 0 19 36 1 0 0 0 0 20 3 1 1 0 0 0 20 25 1 0 0 0 0 21 23 1 0 0 0 0 21 27 1 0 0 0 0 22 26 1 0 0 0 0 24 32 1 6 0 0 0 25 31 1 1 0 0 0 26 31 1 1 0 0 0 27 33 1 1 0 0 0 28 15 1 6 0 0 0 28 30 1 0 0 0 0 28 34 1 0 0 0 0 29 30 1 0 0 0 0 29 35 2 0 0 0 0 29 36 1 0 0 0 0 31 7 1 1 0 0 0 32 37 1 0 0 0 0 33 38 1 0 0 0 0 34 39 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB015383
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	500.35
ALogP	1.2301
MLogP	4.32
XLogP	6.32
HDA	5
HBD	3
Rotatable Bonds	17
TPSA	86.99
RO5 Violation	1