Drug Information| Drug ID:   | NPD6650 |
| Drug Name:   | Methylprednisolone Hemisuccinate |
| Molecular Formula:   | C26H34O8 |
| Canonical SMILES:   | OC(=O)CCC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)C |
| Standard InCHI:   | "InChI=1S/C26H34O8/c1-14-10-16-17-7-9-26(33,20(29)13-34-22(32)5-4-21(30)31)25(17,3)12-19(28)23(16)24(2)8-6-15(27)11-18(14)24/h6,8,11,14,16-17,19,23,28,33H,4-5,7,9-10,12-13H2,1-3H3,(H,30,31)/t14-,16-,17-,19-,23+,24-,25-,26-/m0/s1" |
| Standard InCHIKey:   | IMBXEJJVJRTNOW-XYMSELFBSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6650Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6479 | NPC144956 |
| Remote Similarity | 0.6479 | NPC608439 |
| Remote Similarity | 0.6049 | NPC482048 |
| Remote Similarity | 0.6049 | NPC611793 |
| Remote Similarity | 0.5921 | NPC44063 |
| Remote Similarity | 0.5921 | NPC235800 |
| Remote Similarity | 0.5921 | NPC611921 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 474.23 |
| ALogP   | -0.7809 |
| MLogP   | 3.44 |
| XLogP   | 1.206 |
| HDA   | 8 |
| HBD   | 3 |
| Rotatable Bonds   | 13 |
| TPSA   | 138.2 |
| RO5 Violation   | 0 |