NPASS Compound

Natural Product: NPC291903

Natural Product ID	NPC291903
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(3S,4Ar,5R,6Ar,6As,6Br,8Ar,10S,12Ar,14Bs)-10-[(2R,3R,4S,5S,6R)-4,5-Dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Oxan-2-Yl]Oxy-6-[[(2S,3R,4S,5S)-3,4,5-Trihydroxyoxan-2-Yl]Oxymethyl]Oxan-2-Yl]Oxy-3,5-Dihydroxy-2,2,6A,6B,9,9,12A-Heptamethyl-1,3,4,5,6,6A,7,8,8A,10,11,12,13,14B-Tetradecahydropicene-4A-Carboxylic Acid
IUPAC Name	(3S,4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-3,5-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL503764
PubChem CID	11803958
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 142149 0 0 0 0 0 0 0 0999 V2000 9.1981 0.3410 1.5130 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3687 1.4201 0.8592 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4001 2.6225 1.8256 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9346 1.0329 0.7341 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6519 0.0921 -0.4262 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1642 -0.0330 -0.4622 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5948 -0.6958 0.5209 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1490 -0.9561 0.7121 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3768 -0.3907 -0.4349 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9303 -0.8371 -0.4784 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7914 -2.3066 -0.1789 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2454 -0.1158 0.6673 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8084 0.8489 0.2191 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8181 0.1229 -0.7049 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1452 -0.4133 -1.8993 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4422 0.6211 -3.0164 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7326 -1.6852 -2.3961 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3521 -0.3911 -1.7669 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0849 -1.0344 -2.8894 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4466 -0.3090 -2.9729 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1650 -0.4783 -1.6822 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9189 -1.8175 -1.7949 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2965 0.5540 -1.5156 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7905 1.8671 -0.9282 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0000 0.8697 -2.7845 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3989 0.4254 -2.9255 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2640 0.5023 -1.7002 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7875 1.9263 -1.5298 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8784 1.8814 -0.4627 C 0 0 2 0 0 0 0 0 0 0 0 0 9.9217 1.1140 -0.9541 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4702 -0.3202 -2.0561 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7887 -1.2420 -1.2877 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2134 -0.0843 -3.1874 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0174 1.2710 -3.8803 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3361 -0.8555 0.1404 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6109 -0.5683 0.5800 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5510 -1.6727 0.8242 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8805 -1.1384 1.2826 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6735 -0.2526 2.4917 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6104 0.7551 2.0972 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4838 1.9213 3.0173 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7174 2.5741 3.0633 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6669 3.7154 3.8602 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8434 4.9647 2.9968 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4316 6.0339 3.8833 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6930 5.9819 5.2152 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0116 4.6614 5.8579 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5143 3.7152 4.9341 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1347 7.0641 5.9569 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7612 5.7298 4.1325 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5672 5.4080 2.5987 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4439 0.0227 1.9141 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8827 0.3901 2.7368 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7653 -2.1724 1.5882 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6786 -2.6275 -0.1689 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1070 -3.8403 0.0440 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1940 -4.8636 0.4180 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2005 -4.9972 -0.6922 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5376 -4.4978 -1.9920 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1312 -4.9951 -1.9299 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4358 -4.8644 -3.2838 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1976 -5.5352 -4.2270 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3875 -4.3502 -0.9864 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2309 -5.1720 -3.0276 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3992 -4.3484 -0.4614 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5955 -6.1209 0.6010 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2457 0.4778 1.2451 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1221 0.5062 2.6247 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7916 -0.6795 1.3689 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5232 3.2821 1.6742 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3444 3.1569 1.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4812 2.2514 2.8766 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2853 1.9330 0.6914 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6523 0.5153 1.6956 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1043 -0.8905 -0.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2323 -1.1293 1.3290 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8202 -0.4835 1.6702 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0633 -2.0486 0.8590 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2934 0.7178 -0.1905 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2744 -2.6020 -0.1660 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3096 -2.9848 -0.8399 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0961 -2.4313 0.9059 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9661 0.4312 1.2900 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2558 -0.8360 1.3492 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3560 1.3540 1.0287 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3347 1.6145 -0.3998 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5919 0.8692 -0.8988 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5473 0.6073 -3.0961 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0012 1.5953 -2.7883 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0585 0.2543 -3.9877 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6999 -1.8696 -1.8687 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0670 -1.6356 -3.4810 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0565 -2.5607 -2.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6334 0.7140 -1.8409 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6354 -0.9090 -3.8876 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3193 -2.0967 -2.7690 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2771 0.7359 -3.2726 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9669 -0.8918 -3.7892 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0103 -1.6945 -1.7369 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6440 -2.5323 -1.0174 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6886 -2.3245 -2.7714 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5720 2.6414 -1.2174 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8473 1.8891 0.1815 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8770 2.2411 -1.3762 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4478 0.4673 -3.6865 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9803 1.9833 -2.9894 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5004 -0.6057 -3.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2640 2.2740 -2.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9874 2.6430 -1.2534 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2630 2.9455 -0.4107 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7853 1.5826 -0.9531 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8568 -0.7898 -3.5711 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7036 2.2165 -3.7661 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9976 0.2910 0.0324 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1040 -2.2430 1.7039 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3467 -0.4792 0.5108 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3640 -0.7842 3.3949 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9382 1.1109 1.0746 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7864 2.6462 2.5495 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0743 1.6787 4.0014 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6146 3.7740 4.2550 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4626 4.7618 2.1009 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3273 7.0096 3.4026 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6027 6.1118 5.0385 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0541 4.2992 6.3210 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7386 4.7582 6.7047 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3797 7.8427 5.3948 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2112 6.2920 4.7862 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5381 5.4665 1.6082 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5834 0.1846 2.1065 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4593 -1.8744 2.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5326 -3.7423 1.0205 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7021 -4.6333 1.3475 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4470 -6.0804 -0.7961 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6019 -3.4220 -2.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1495 -6.1141 -1.7358 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4388 -5.3310 -3.2304 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3439 -3.7821 -3.5128 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6829 -5.4906 -5.0921 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5889 -6.0397 -2.6996 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8420 -4.2540 -1.3601 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4144 -6.3282 1.5474 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 1 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 15 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 21 23 1 0 23 24 1 1 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 27 31 1 6 31 32 2 0 31 33 1 0 26 34 1 0 14 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 44 51 1 0 40 52 1 0 39 53 1 0 38 54 1 0 37 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 60 63 1 0 59 64 1 0 58 65 1 0 57 66 1 0 29 2 1 0 52 36 1 0 63 56 1 0 27 5 1 0 48 43 1 0 23 6 1 0 21 9 1 0 18 10 1 0 1 67 1 0 1 68 1 0 1 69 1 0 3 70 1 0 3 71 1 0 3 72 1 0 4 73 1 0 4 74 1 0 5 75 1 1 7 76 1 0 8 77 1 0 8 78 1 0 9 79 1 1 11 80 1 0 11 81 1 0 11 82 1 0 12 83 1 0 12 84 1 0 13 85 1 0 13 86 1 0 14 87 1 6 16 88 1 0 16 89 1 0 16 90 1 0 17 91 1 0 17 92 1 0 17 93 1 0 18 94 1 6 19 95 1 0 19 96 1 0 20 97 1 0 20 98 1 0 22 99 1 0 22100 1 0 22101 1 0 24102 1 0 24103 1 0 24104 1 0 25105 1 0 25106 1 0 26107 1 6 28108 1 0 28109 1 0 29110 1 1 30111 1 0 33112 1 0 34113 1 0 36114 1 6 37115 1 1 38116 1 6 39117 1 1 40118 1 6 41119 1 0 41120 1 0 43121 1 1 44122 1 6 45123 1 6 46124 1 6 47125 1 0 47126 1 0 49127 1 0 50128 1 0 51129 1 0 53130 1 0 54131 1 0 56132 1 1 57133 1 1 58134 1 6 59135 1 6 60136 1 1 61137 1 0 61138 1 0 62139 1 0 64140 1 0 65141 1 0 66142 1 0 M END

Standard InCHIKey	LNBCLWUAFAKFIC-ADXZEBMWSA-N
Standard InCHI	InChI=1S/C47H76O19/c1-42(2)14-21-20-8-9-26-44(5)12-11-29(43(3,4)25(44)10-13-45(26,6)46(20,7)15-28(51)47(21,41(59)60)16-27(42)50)65-40-37(66-39-36(58)33(55)31(53)23(17-48)63-39)34(56)32(54)24(64-40)19-62-38-35(57)30(52)22(49)18-61-38/h8,21-40,48-58H,9-19H2,1-7H3,(H,59,60)/t21-,22-,23+,24+,25-,26+,27-,28+,29-,30-,31+,32+,33-,34-,35+,36+,37+,38-,39-,40-,44-,45+,46+,47+/m0/s1
SMILES	CC1(C)C[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@H]([C@]2(C[C@@H]1O)C(=O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@H](CO2)O)O)O)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	944.5	Volume:	914.757 ? Van der Waals volume.
Dense:	1.033	LogP:	1.003 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.828 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.492 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	45.0
TPSA:	315.21 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	12.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.1	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.445	Fsp³:	0.936
MCE-18:	177.231 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.674	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.014 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.212	Promiscuous compounds:	0.101

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.413	MDCK Permeability:	-4.99
Pgp-inhibitor:	0.0	Pgp-substrate:	0.801
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.852
20% Bioavailability (F20%):	0.482	30% Bioavailability (F30%):	0.996
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.626
Plasma Protein Binding (PPB):	69.483%	Volume Distribution (VD):	-0.461
Fu:	19.951% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.002
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.003
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.056

Half-life (T1/2):

2.706

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.664	Drug-induced Liver Injury (DILI):	0.881
AMES Toxicity:	0.975	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	1.0
Carcinogencity:	0.242	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.011
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.998
Hematotoxicity:	0.737	Drug-induced Nephrotoxicity:	0.992
Genotoxicity:	0.618	RPMI-8226 Immunitoxicity:	0.123
A549 Cytotoxicity:	0.882	Hek293 Cytotoxicity:	0.224
BCF:	0.625 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.306 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.81 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.812 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	fruits	myanmar	n.a.	PMID[11141109]
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT453	Cell line	HT-1080	Homo sapiens	ED50	>	100.0	ug ml-1	PMID[22664131]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC291903 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22685
0.1-0.2	22332
0.2-0.3	3375
0.3-0.4	831
0.4-0.5	470
0.5-0.6	128
0.6-0.7	17
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9192	High Similarity	NPC475119
0.91	High Similarity	NPC473824
0.8095	Intermediate Similarity	NPC288205
0.8095	Intermediate Similarity	NPC51465
0.7961	Intermediate Similarity	NPC145899
0.7961	Intermediate Similarity	NPC37134
0.7545	Intermediate Similarity	NPC243680
0.7523	Intermediate Similarity	NPC200788
0.7353	Intermediate Similarity	NPC488516
0.7282	Intermediate Similarity	NPC80843
0.7064	Intermediate Similarity	NPC75318
0.7037	Intermediate Similarity	NPC488515
0.6957	Remote Similarity	NPC475140
0.6762	Remote Similarity	NPC480424
0.6727	Remote Similarity	NPC484832
0.6637	Remote Similarity	NPC475486
0.66	Remote Similarity	NPC31839
0.6542	Remote Similarity	NPC488561
0.6535	Remote Similarity	NPC242611
0.6379	Remote Similarity	NPC185466
0.6348	Remote Similarity	NPC207738
0.6296	Remote Similarity	NPC127056
0.6226	Remote Similarity	NPC164194
0.6053	Remote Similarity	NPC73829
0.6033	Remote Similarity	NPC166422
0.6018	Remote Similarity	NPC104400
0.6018	Remote Similarity	NPC10320
0.6	Remote Similarity	NPC151543
0.6	Remote Similarity	NPC119794
0.595	Remote Similarity	NPC471384
0.5913	Remote Similarity	NPC257468
0.5909	Remote Similarity	NPC25605
0.5902	Remote Similarity	NPC219180
0.5897	Remote Similarity	NPC481079
0.5862	Remote Similarity	NPC79718
0.5841	Remote Similarity	NPC469945
0.5804	Remote Similarity	NPC470512
0.5789	Remote Similarity	NPC114304
0.5785	Remote Similarity	NPC610204
0.5776	Remote Similarity	NPC470514
0.5772	Remote Similarity	NPC603137
0.5766	Remote Similarity	NPC59804
0.5763	Remote Similarity	NPC324875
0.5763	Remote Similarity	NPC292677
0.5763	Remote Similarity	NPC606145
0.575	Remote Similarity	NPC280941
0.575	Remote Similarity	NPC235772
0.5714	Remote Similarity	NPC120667
0.5714	Remote Similarity	NPC488564
0.5714	Remote Similarity	NPC278272
0.5664	Remote Similarity	NPC472949
0.5641	Remote Similarity	NPC123796
0.5625	Remote Similarity	NPC56713
0.562	Remote Similarity	NPC470915
0.5619	Remote Similarity	NPC606107
0.5614	Remote Similarity	NPC469946
0.5603	Remote Similarity	NPC173859
0.56	Remote Similarity	NPC283417
0.56	Remote Similarity	NPC200049
0.5593	Remote Similarity	NPC302887
0.5583	Remote Similarity	NPC160452
0.5565	Remote Similarity	NPC323341
0.5547	Remote Similarity	NPC488308
0.5536	Remote Similarity	NPC136877
0.5528	Remote Similarity	NPC607904
0.5528	Remote Similarity	NPC610461
0.5508	Remote Similarity	NPC470513
0.5504	Remote Similarity	NPC312650
0.55	Remote Similarity	NPC301449
0.55	Remote Similarity	NPC23275
0.55	Remote Similarity	NPC601290
0.5495	Remote Similarity	NPC76999
0.5495	Remote Similarity	NPC1046
0.5492	Remote Similarity	NPC480939
0.5472	Remote Similarity	NPC283849
0.5462	Remote Similarity	NPC64715
0.5426	Remote Similarity	NPC265841
0.5424	Remote Similarity	NPC105800
0.5424	Remote Similarity	NPC63159
0.5424	Remote Similarity	NPC139044
0.5414	Remote Similarity	NPC488309
0.541	Remote Similarity	NPC31838
0.541	Remote Similarity	NPC609281
0.5398	Remote Similarity	NPC12288
0.5397	Remote Similarity	NPC251263
0.5396	Remote Similarity	NPC475177
0.5385	Remote Similarity	NPC271610
0.5385	Remote Similarity	NPC117714
0.5385	Remote Similarity	NPC30289
0.5378	Remote Similarity	NPC481082
0.5378	Remote Similarity	NPC164419
0.5378	Remote Similarity	NPC297263
0.5366	Remote Similarity	NPC606553
0.5345	Remote Similarity	NPC22956
0.5339	Remote Similarity	NPC164389
0.5339	Remote Similarity	NPC488526
0.5339	Remote Similarity	NPC232237
0.5339	Remote Similarity	NPC148603
0.5333	Remote Similarity	NPC471435
0.5333	Remote Similarity	NPC471434
0.5323	Remote Similarity	NPC172365
0.5317	Remote Similarity	NPC284449
0.5312	Remote Similarity	NPC54636
0.5304	Remote Similarity	NPC109079
0.5289	Remote Similarity	NPC470914
0.5289	Remote Similarity	NPC276093
0.5285	Remote Similarity	NPC104137
0.5285	Remote Similarity	NPC26626
0.5276	Remote Similarity	NPC609305
0.5273	Remote Similarity	NPC128925
0.5271	Remote Similarity	NPC4749
0.5254	Remote Similarity	NPC14946
0.5254	Remote Similarity	NPC63368
0.5254	Remote Similarity	NPC605226
0.5246	Remote Similarity	NPC323359
0.5242	Remote Similarity	NPC210729
0.5242	Remote Similarity	NPC62725
0.5242	Remote Similarity	NPC82931
0.5234	Remote Similarity	NPC602995
0.5227	Remote Similarity	NPC471385
0.5227	Remote Similarity	NPC161717
0.5217	Remote Similarity	NPC174679
0.5217	Remote Similarity	NPC279554
0.521	Remote Similarity	NPC44716
0.521	Remote Similarity	NPC473383
0.521	Remote Similarity	NPC480475
0.5203	Remote Similarity	NPC488209
0.5185	Remote Similarity	NPC482010
0.5161	Remote Similarity	NPC187290
0.5156	Remote Similarity	NPC123199
0.5152	Remote Similarity	NPC470876
0.5139	Remote Similarity	NPC329893
0.5124	Remote Similarity	NPC222580
0.5122	Remote Similarity	NPC610948
0.512	Remote Similarity	NPC473688
0.512	Remote Similarity	NPC11242
0.5118	Remote Similarity	NPC123522
0.5116	Remote Similarity	NPC470218
0.5115	Remote Similarity	NPC21691
0.5093	Remote Similarity	NPC204407
0.5085	Remote Similarity	NPC263756
0.5085	Remote Similarity	NPC213674
0.5083	Remote Similarity	NPC251768
0.5083	Remote Similarity	NPC180550
0.5083	Remote Similarity	NPC35405
0.5078	Remote Similarity	NPC470911
0.5069	Remote Similarity	NPC40085
0.5046	Remote Similarity	NPC28198
0.5046	Remote Similarity	NPC476123
0.5043	Remote Similarity	NPC480420
0.5043	Remote Similarity	NPC48499
0.5042	Remote Similarity	NPC192791
0.5042	Remote Similarity	NPC112352
0.504	Remote Similarity	NPC469947
0.504	Remote Similarity	NPC480948
0.5037	Remote Similarity	NPC309223
0.5037	Remote Similarity	NPC302543

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC291903 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6841
0.1-0.2	2255
0.2-0.3	49
0.3-0.4	4
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data