NPASS Compound

Natural Product: NPC235772

Natural Product ID	NPC235772
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Albiziatrioside A
IUPAC Name	(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4R,5S,6R)-3-acetamido-6-[[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL499401
PubChem CID	10772132
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 142149 0 0 0 0 0 0 0 0999 V2000 1.0473 3.2275 -5.6572 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1209 3.0164 -4.6696 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0779 2.0369 -3.8731 N 0 0 0 0 0 0 0 0 0 0 0 0 3.1165 1.7729 -2.8668 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2769 1.1424 -3.6073 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4280 -0.3221 -3.3392 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4084 -0.5727 -1.8623 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8036 -0.2504 -1.3404 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9183 -0.4955 0.0085 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7574 -1.8081 0.3387 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1127 -2.3157 0.9136 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9742 -3.8112 1.0016 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8511 -4.0670 2.0159 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1273 -2.8030 2.3468 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7552 -2.0410 1.2685 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5267 -4.4749 3.1889 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1187 -4.4830 1.3278 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1014 -1.8893 0.0309 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9290 -0.9532 0.6280 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3627 -1.3681 0.4036 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2434 -0.4738 1.2554 C 0 0 2 0 0 0 0 0 0 0 0 0 10.5616 0.8582 1.4197 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6930 1.2128 0.2471 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7586 0.2577 -0.0602 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8947 0.9753 2.6448 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5134 -0.3703 0.7424 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5456 -2.7091 0.6502 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5488 0.2268 -1.1647 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5064 0.7963 -1.8931 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6914 1.3827 -0.9277 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4137 0.8894 -0.8552 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3213 0.0115 0.4025 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0808 -0.3720 0.7026 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9837 0.8353 0.9312 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5241 1.4753 2.1842 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9186 1.6916 -0.2980 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7570 2.8948 -0.1066 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2045 2.4744 0.0222 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4648 1.3032 0.8866 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8659 1.8246 2.2750 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3927 0.2874 0.9649 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6442 -0.6391 2.1065 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0491 -1.1099 2.0409 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0127 -0.5976 1.2901 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4004 -1.1422 1.2938 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7724 -1.8886 0.0555 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0930 -2.5984 0.2669 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9662 -2.5042 -0.9898 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9074 -4.0705 0.5745 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9022 -1.9569 1.3803 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7613 -0.4590 1.2150 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3484 -0.0683 1.6851 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9918 1.3079 1.2830 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9014 1.4944 0.3147 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7274 0.5624 0.4031 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4846 0.0111 -0.9916 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4659 -0.0816 3.1848 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8146 -0.9104 3.8940 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2874 0.8074 3.8627 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5627 2.0075 -0.8343 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0560 3.2267 -0.1486 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7582 2.4183 -2.2906 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3820 -1.0081 -3.9739 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4664 1.8536 -3.4285 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1785 3.9036 -4.6245 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2835 3.9589 -5.3162 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4334 3.5591 -6.6451 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4942 2.2757 -5.8034 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4983 2.6749 -2.3922 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0340 1.2274 -4.7142 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3607 -0.6624 -3.8128 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2032 -1.6591 -1.7212 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5298 -0.8667 -1.9374 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0259 0.8445 -1.4661 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5708 -2.4608 -0.5314 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2718 -1.8120 1.8721 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5708 -4.1547 0.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2150 -4.9108 1.7139 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7003 -2.2190 3.1128 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1740 -3.1001 2.8649 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2272 -3.7944 3.3784 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1403 -5.3318 0.7802 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6539 -0.7630 1.6624 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5756 -1.1547 -0.6733 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2843 -0.9435 2.2591 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3793 1.6327 1.4402 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3283 1.5127 -0.6045 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1327 2.1459 0.5496 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4796 1.8661 2.6611 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6218 -0.9400 -0.0847 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1428 -3.1175 -0.0442 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9264 0.0193 -2.3884 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1546 0.1696 -1.6676 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8653 -0.9373 0.1164 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9163 0.4096 1.2394 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4840 -0.8859 -0.2031 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0870 -1.0885 1.5229 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3954 1.5166 2.2594 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8461 2.4889 2.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7678 0.7614 3.0271 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4038 1.0743 -1.1158 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5349 3.4736 0.8128 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7147 3.5911 -0.9630 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7270 3.3936 0.4274 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6107 2.3900 -1.0095 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0278 1.8025 2.9929 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1837 2.8843 2.1953 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6493 1.1780 2.7333 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4716 -0.3479 0.0292 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5395 -0.1754 3.1104 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9908 -1.5443 2.0809 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3514 -1.9764 2.6743 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4174 -1.9229 2.1140 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8721 -1.3095 -0.8559 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0247 -2.6986 -0.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9121 -3.4164 -1.6099 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0344 -2.3576 -0.7197 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6729 -1.6063 -1.5877 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7639 -4.2368 1.6629 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7731 -4.6628 0.1869 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0322 -4.4208 -0.0154 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9693 -2.2087 1.2161 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5944 -2.2983 2.3883 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8956 -0.1955 0.1560 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5319 0.0948 1.8058 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8186 1.9904 2.1700 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9278 1.7696 0.8349 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5587 2.5626 0.4065 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3510 1.4723 -0.7226 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4872 -1.1181 -1.0015 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3384 0.2885 -1.6858 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6034 0.4165 -1.4936 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2993 0.8560 4.8755 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7000 3.9491 0.1408 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7312 2.9255 0.6812 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7191 3.7049 -0.8968 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0136 3.2263 -2.5225 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7500 2.8548 -2.4917 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5782 1.5174 -2.9483 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6198 -1.9873 -4.0631 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2775 2.6651 -2.8625 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6176 4.1836 -3.7353 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 13 16 1 0 12 17 1 0 11 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 22 25 1 0 21 26 1 0 20 27 1 0 7 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 1 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 1 39 41 1 0 41 42 1 0 42 43 1 0 43 44 2 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 47 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 6 52 57 1 1 57 58 2 0 57 59 1 0 36 60 1 0 60 61 1 0 60 62 1 0 6 63 1 0 5 64 1 0 2 65 1 0 29 4 1 0 60 31 1 0 15 10 1 0 24 19 1 0 41 34 1 0 55 44 1 0 55 39 1 0 52 45 1 0 1 66 1 0 1 67 1 0 1 68 1 0 4 69 1 1 5 70 1 6 6 71 1 6 7 72 1 6 8 73 1 0 8 74 1 0 10 75 1 6 11 76 1 1 12 77 1 6 13 78 1 6 14 79 1 0 14 80 1 0 16 81 1 0 17 82 1 0 19 83 1 1 20 84 1 6 21 85 1 1 22 86 1 1 23 87 1 0 23 88 1 0 25 89 1 0 26 90 1 0 27 91 1 0 29 92 1 6 31 93 1 6 32 94 1 0 32 95 1 0 33 96 1 0 33 97 1 0 35 98 1 0 35 99 1 0 35100 1 0 36101 1 6 37102 1 0 37103 1 0 38104 1 0 38105 1 0 40106 1 0 40107 1 0 40108 1 0 41109 1 6 42110 1 0 42111 1 0 43112 1 0 45113 1 1 46114 1 0 46115 1 0 48116 1 0 48117 1 0 48118 1 0 49119 1 0 49120 1 0 49121 1 0 50122 1 0 50123 1 0 51124 1 0 51125 1 0 53126 1 0 53127 1 0 54128 1 0 54129 1 0 56130 1 0 56131 1 0 56132 1 0 59133 1 0 61134 1 0 61135 1 0 61136 1 0 62137 1 0 62138 1 0 62139 1 0 63140 1 0 64141 1 0 65142 1 0 M END

Standard InCHIKey	ZHJLYHABGRSKOY-IRVOGBMASA-N
Standard InCHI	InChI=1S/C48H77NO16/c1-23(50)49-32-36(56)35(55)28(22-62-41-38(34(54)27(52)21-61-41)65-40-37(57)33(53)26(51)20-60-40)63-39(32)64-31-12-13-45(6)29(44(31,4)5)11-14-47(8)30(45)10-9-24-25-19-43(2,3)15-17-48(25,42(58)59)18-16-46(24,47)7/h9,25-41,51-57H,10-22H2,1-8H3,(H,49,50)(H,58,59)/t25-,26+,27-,28+,29-,30+,31-,32+,33-,34-,35+,36+,37+,38+,39-,40-,41-,45-,46+,47+,48-/m0/s1
SMILES	CC(=N[C@@H]1[C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@H](CO2)O)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O[C@H]1O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C2[C@@H]4CC(C)(C)CC[C@@]4(CC[C@@]32C)C(=O)O)C1(C)C)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	923.52	Volume:	914.043 ? Van der Waals volume.
Dense:	1.01	LogP:	1.742 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.347 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.898 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	46.0
TPSA:	266.88 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.07	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.406	Fsp³:	0.917
MCE-18:	171.174 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.98	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.021	Promiscuous compounds:	0.075

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.946	MDCK Permeability:	-5.207
Pgp-inhibitor:	0.0	Pgp-substrate:	0.032
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.123
20% Bioavailability (F20%):	0.3	30% Bioavailability (F30%):	0.889
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.009	MRP1:	0.062
Plasma Protein Binding (PPB):	72.125%	Volume Distribution (VD):	-0.476
Fu:	19.048% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.003
BSEP inhibitor:	0.004

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.995	CYP3A4-substrate:	0.997
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.013
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.009

Half-life (T1/2):

2.756

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.007
Human Hepatotoxicity (H-HT):	0.995	Drug-induced Liver Injury (DILI):	0.993
AMES Toxicity:	0.834	Rat Oral Acute Toxicity:	0.01
Maximum Recommended Daily Dose:	0.008	Skin Sensitization:	1.0
Carcinogencity:	0.175	Eye Corrosion:	0.0
Eye Irritation:	0.008	Respiratory Toxicity:	0.022
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.993
Hematotoxicity:	0.603	Drug-induced Nephrotoxicity:	0.987
Genotoxicity:	0.893	RPMI-8226 Immunitoxicity:	0.054
A549 Cytotoxicity:	0.1	Hek293 Cytotoxicity:	0.143
BCF:	1.166 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.004 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.856 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.903 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20805	Albizia subdimidiata	Species	Fabaceae	Eukaryota	n.a.	Suriname rainforest	n.a.	PMID[11325245]
NPO32561	acacia tenuifolia	Species	Fabaceae	Eukaryota	n.a.	suriname rainforest	n.a.	PMID[11858750]
NPO20805	Albizia subdimidiata	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	4
IC50	2
IC12	4

Activity Type	# Activity
Cell line	2
Organism	8

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT179	Cell line	A2780	Homo sapiens	IC50	=	0.9	ug.mL-1	PMID[11975483]
NPT726	Cell line	M109	Mus musculus	IC50	=	1.0	ug.mL-1	DrugMatrix in vitro pharmacology data
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	Activity	=	30.0	ug ml-1	DOI[10.6019/CHEMBL3301361]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	Activity	=	35.0	ug ml-1	PMID[22037378]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	IC12	=	30.0	ug ml-1	DrugMatrix in vitro pharmacology data
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	IC12	=	35.0	ug ml-1	DrugMatrix in vitro pharmacology data

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC235772 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23177
0.1-0.2	23186
0.2-0.3	2354
0.3-0.4	743
0.4-0.5	290
0.5-0.6	53
0.6-0.7	34
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC280941
0.898	High Similarity	NPC73829
0.8218	Intermediate Similarity	NPC104400
0.8218	Intermediate Similarity	NPC10320
0.8155	Intermediate Similarity	NPC119794
0.7798	Intermediate Similarity	NPC200788
0.7664	Intermediate Similarity	NPC75318
0.7383	Intermediate Similarity	NPC481082
0.7383	Intermediate Similarity	NPC164419
0.7308	Intermediate Similarity	NPC488561
0.7282	Intermediate Similarity	NPC56713
0.7216	Intermediate Similarity	NPC283849
0.7212	Intermediate Similarity	NPC127056
0.717	Intermediate Similarity	NPC469945
0.708	Intermediate Similarity	NPC288205
0.708	Intermediate Similarity	NPC51465
0.7043	Intermediate Similarity	NPC243680
0.7	Intermediate Similarity	NPC488515
0.6961	Remote Similarity	NPC191410
0.6937	Remote Similarity	NPC145899
0.6842	Remote Similarity	NPC210729
0.6842	Remote Similarity	NPC82931
0.6695	Remote Similarity	NPC166422
0.6695	Remote Similarity	NPC219180
0.6693	Remote Similarity	NPC120667
0.6693	Remote Similarity	NPC278272
0.6636	Remote Similarity	NPC174679
0.6636	Remote Similarity	NPC279554
0.6636	Remote Similarity	NPC59804
0.6579	Remote Similarity	NPC324875
0.6579	Remote Similarity	NPC292677
0.6549	Remote Similarity	NPC79718
0.6535	Remote Similarity	NPC28198
0.6535	Remote Similarity	NPC476123
0.646	Remote Similarity	NPC257468
0.6364	Remote Similarity	NPC6377
0.6364	Remote Similarity	NPC208381
0.6356	Remote Similarity	NPC475119
0.6355	Remote Similarity	NPC164194
0.6346	Remote Similarity	NPC100383
0.632	Remote Similarity	NPC161717
0.6239	Remote Similarity	NPC488564
0.6218	Remote Similarity	NPC172365
0.6216	Remote Similarity	NPC472949
0.6198	Remote Similarity	NPC323341
0.6182	Remote Similarity	NPC25605
0.6161	Remote Similarity	NPC80843
0.6148	Remote Similarity	NPC251263
0.6071	Remote Similarity	NPC488516
0.6068	Remote Similarity	NPC276093
0.6058	Remote Similarity	NPC606107
0.6038	Remote Similarity	NPC242611
0.5948	Remote Similarity	NPC139044
0.5948	Remote Similarity	NPC471383
0.5946	Remote Similarity	NPC136877
0.5926	Remote Similarity	NPC284807
0.5913	Remote Similarity	NPC114304
0.5909	Remote Similarity	NPC76999
0.5877	Remote Similarity	NPC22956
0.5847	Remote Similarity	NPC484832
0.5841	Remote Similarity	NPC109079
0.5814	Remote Similarity	NPC471385
0.5794	Remote Similarity	NPC286347
0.5794	Remote Similarity	NPC54636
0.5772	Remote Similarity	NPC473824
0.575	Remote Similarity	NPC323359
0.575	Remote Similarity	NPC291903
0.5702	Remote Similarity	NPC488209
0.568	Remote Similarity	NPC471384
0.568	Remote Similarity	NPC133818
0.5667	Remote Similarity	NPC37134
0.5664	Remote Similarity	NPC12288
0.5656	Remote Similarity	NPC475486
0.5593	Remote Similarity	NPC488526
0.5591	Remote Similarity	NPC475140
0.5565	Remote Similarity	NPC480424
0.5522	Remote Similarity	NPC488212
0.5514	Remote Similarity	NPC204407
0.5504	Remote Similarity	NPC488211
0.5495	Remote Similarity	NPC473538
0.5484	Remote Similarity	NPC62725
0.5462	Remote Similarity	NPC232237
0.5462	Remote Similarity	NPC180550
0.5462	Remote Similarity	NPC35405
0.5431	Remote Similarity	NPC114441
0.54	Remote Similarity	NPC120840
0.5398	Remote Similarity	NPC475611
0.5351	Remote Similarity	NPC127853
0.5273	Remote Similarity	NPC177246
0.5263	Remote Similarity	NPC475472
0.5217	Remote Similarity	NPC270667
0.5214	Remote Similarity	NPC475296
0.5197	Remote Similarity	NPC482013
0.5175	Remote Similarity	NPC489208
0.5164	Remote Similarity	NPC63159
0.512	Remote Similarity	NPC301449
0.512	Remote Similarity	NPC481079
0.512	Remote Similarity	NPC601290
0.5089	Remote Similarity	NPC31839
0.5088	Remote Similarity	NPC294112
0.5085	Remote Similarity	NPC474589
0.5078	Remote Similarity	NPC476992
0.5071	Remote Similarity	NPC489209
0.5039	Remote Similarity	NPC207738
0.5038	Remote Similarity	NPC123199

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC235772 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6479
0.1-0.2	2624
0.2-0.3	41
0.3-0.4	4
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data