Drug Information| Drug ID:   | NPD6940 |
| Drug Name:   | cordil |
| Molecular Formula:   | C27H45NO7 |
| Canonical SMILES:   | COC(=O)[C@H]1CC[C@]2([C@]1(C)CC[C@H]1[C@H]2CC[C@H]2[C@]1(C)CC[C@@H](C2)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)N |
| Standard InCHI:   | "InChI=1S/C27H45NO7/c1-14-20(29)21(30)22(31)24(34-14)35-16-7-10-25(2)15(13-16)5-6-18-17(25)8-11-26(3)19(23(32)33-4)9-12-27(18,26)28/h14-22,24,29-31H,5-13,28H2,1-4H3/t14-,15+,16-,17-,18+,19+,20-,21+,22+,24-,25-,26+,27-/m0/s1" |
| Standard InCHIKey:   | HKWLCBGLVAWZRK-CBYCSKBWSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD6940Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5634 | NPC526025 |
| Remote Similarity | 0.5238 | NPC64235 |
| Remote Similarity | 0.5238 | NPC99620 |
| Remote Similarity | 0.5238 | NPC571074 |
| Remote Similarity | 0.5238 | NPC579794 |
| Remote Similarity | 0.5067 | NPC318452 |
| Molecular Weight   | 495.32 |
| ALogP   | -1.6576 |
| MLogP   | 3.55 |
| XLogP   | 3.295 |
| HDA   | 8 |
| HBD   | 4 |
| Rotatable Bonds   | 12 |
| TPSA   | 131.47 |
| RO5 Violation   | 0 |