Drug Information| Drug ID:   | NPD7141 |
| Drug Name:   | |
| Molecular Formula:   | C28H44N2O23 |
| Canonical SMILES:   | OCC1OC(OC2C(OC(C(C2O)O)OC2C(N=C(O)C)C(O)OC(C2O)CO)C(=O)O)C(C(C1O)OC1OC(C(=O)O)C(C(C1O)O)O)N=C(O)C |
| Standard InCHI:   | "InChI=1S/C28H44N2O23/c1-5(33)29-9-18(11(35)7(3-31)47-25(9)46)49-28-17(41)15(39)20(22(53-28)24(44)45)51-26-10(30-6(2)34)19(12(36)8(4-32)48-26)50-27-16(40)13(37)14(38)21(52-27)23(42)43/h7-22,25-28,31-32,35-41,46H,3-4H2,1-2H3,(H,29,33)(H,30,34)(H,42,43)(H,44,45)" |
| Standard InCHIKey:   | KIUKXJAPPMFGSW-UHFFFAOYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7141Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNCL003762 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 453618 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 776.23 |
| ALogP   | -6.9967 |
| MLogP   | 1.79 |
| XLogP   | -6.324 |
| HDA   | 25 |
| HBD   | 14 |
| Rotatable Bonds   | 28 |
| TPSA   | 406.69 |
| RO5 Violation   | 3 |