NPASS Compound

Natural Product: NPC243680

Natural Product ID	NPC243680
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(3S,4Ar,5R,6Ar,6As,6Br,8Ar,10S,12Ar,14Bs)-10-[(2R,3R,4R,5S,6R)-3-Acetamido-6-[[(2R,3R,4S,5R,6R)-4,5-Dihydroxy-6-Methyl-3-[(2S,3R,4S,5R)-3,4,5-Trihydroxyoxan-2-Yl]Oxyoxan-2-Yl]Oxymethyl]-4,5-Dihydroxyoxan-2-Yl]Oxy-3,5-Dihydroxy-2,2,6A,6B,9,9,12A-Heptamethyl-1,3,4,5,6,6A,7,8,8A,10,11,12,13,14B-Tetradecahydropicene-4A-Carboxylic Acid
IUPAC Name	(3S,4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4R,5S,6R)-3-acetamido-6-[[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxy-3,5-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL453973
PubChem CID	11051331
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 147154 0 0 0 0 0 0 0 0999 V2000 8.0589 0.7989 4.5550 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8041 0.4509 3.7731 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9876 -0.8577 3.0870 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8002 -0.7811 1.8122 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5751 0.5971 1.2420 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1740 0.9998 1.6508 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5949 1.9621 0.9027 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3080 1.8952 0.5349 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9186 0.6734 -0.2190 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6859 0.4775 -1.4790 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7477 0.2812 -2.6728 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7633 -0.8406 -2.3041 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1301 -0.5187 -0.9594 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5389 0.7552 -0.5695 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7355 -0.5737 -1.0300 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1576 -1.3826 -0.0798 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5608 -0.5262 0.9751 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5687 0.3830 0.3476 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4542 -0.3555 -0.6751 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9938 0.1167 -2.0250 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2522 -1.8108 -0.4243 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2996 -2.6682 -1.0970 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6066 -2.2818 -0.4036 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9707 -0.8488 -0.7155 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3603 -0.8221 -2.1688 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8598 0.0286 -0.3338 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1110 1.4962 -0.7107 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4182 1.8254 -0.1069 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3726 0.9985 0.2508 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6090 1.5681 0.8402 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3079 1.8728 2.2848 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5123 1.9657 3.1605 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2570 3.2371 2.7965 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0951 2.0882 4.5948 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4112 0.7857 3.0001 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9186 0.8367 1.6031 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8641 0.8641 0.5284 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7304 -0.5532 0.0335 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4676 -0.8807 -0.6565 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2016 -0.4420 0.0750 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1712 -1.2324 1.3542 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9992 -1.5127 1.0069 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5556 1.5816 -0.6089 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6803 2.0833 -0.5310 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8452 1.6613 -1.8060 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5126 0.9693 3.8428 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8697 -2.3488 -0.5719 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5188 -2.8815 -1.9093 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7879 -3.5459 0.4078 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4394 -2.0218 -2.2237 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9646 -3.0415 -2.0237 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8349 -3.7063 -3.0742 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8768 -3.7806 -0.8312 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0946 1.4278 -3.0486 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4125 -0.7319 -1.3275 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3532 1.4888 2.9965 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8024 0.5744 -0.1029 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8338 1.3573 -0.5458 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8940 0.6665 -1.3404 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6173 1.5996 -2.2853 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7014 2.4627 -3.0805 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2701 2.0968 -2.6600 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2035 2.3819 -1.2997 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8703 3.8000 -2.7641 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4623 0.8941 -3.1055 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8722 0.2211 -0.4270 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1445 -1.0464 2.0372 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7449 -1.6753 3.9602 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1833 0.0964 5.4287 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9439 1.8064 4.9815 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9877 0.6925 3.9823 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0126 0.2848 4.5617 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0315 -1.4337 2.9417 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4401 -1.5352 1.0867 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3265 1.2630 1.7736 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5056 0.1280 1.7520 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5916 1.9345 1.4299 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0476 2.8105 -0.0841 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9547 -0.2352 0.4348 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3925 1.2721 -1.7368 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3523 -0.0928 -3.5103 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9987 -0.8430 -3.1192 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4494 -1.1938 -0.1527 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9770 -1.8521 0.5003 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2308 0.1029 1.4302 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9372 -1.2035 1.7499 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1685 0.8101 1.1808 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0483 1.2450 -0.1124 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8177 0.4675 -2.6797 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4656 -0.6487 -2.6234 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2972 0.9965 -1.9748 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4970 -1.9262 0.6810 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3291 -2.5969 -2.1711 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0995 -3.7195 -0.8080 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3314 -2.3755 0.6889 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3533 -3.0066 -0.7101 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1243 -1.6388 -2.3044 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7135 0.1667 -2.5153 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5584 -1.1323 -2.8665 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8882 0.0591 0.8039 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1069 1.6776 -1.7850 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2841 2.0606 -0.1980 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5630 2.9274 0.0416 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7196 2.6204 0.4031 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7968 2.8829 2.4116 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5596 1.1916 2.7447 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1325 3.4278 1.7272 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3096 3.2238 3.1305 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7727 4.0788 3.3468 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6700 3.1138 4.7725 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3753 1.3021 4.9069 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0076 2.0349 5.2212 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8979 -0.1682 3.2086 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5840 1.7499 1.5463 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6181 -0.0060 1.4273 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5315 -0.7814 -0.7476 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4733 -1.9847 -0.8344 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4848 -0.3115 -1.6330 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0122 -1.0289 2.0461 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2654 -1.1452 1.9471 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3044 -2.2961 1.0701 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8837 -1.9060 0.9790 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9776 2.4421 -2.4523 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2895 0.4529 3.5460 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2455 -2.3002 -2.4657 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0420 -3.9059 -1.8275 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3847 -3.0537 -2.5796 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1919 -4.4618 -0.0762 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3076 -3.7338 0.5362 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2383 -3.2984 1.3677 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0422 -3.0181 -3.9011 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8225 -3.9543 -2.5907 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3741 -4.6607 -3.3550 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4882 -3.3728 0.0116 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9527 1.4736 -4.0429 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9474 -0.9018 -2.1525 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3565 1.9139 0.2769 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5073 -0.1800 -1.9429 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2648 2.2751 -1.6534 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8387 2.2586 -4.1594 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1086 1.0205 -2.7903 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5695 2.7392 -3.2033 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3899 4.4118 -3.3572 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3114 1.3594 -3.3248 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6499 0.8081 -0.4055 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5371 -1.6542 1.3471 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7370 -2.5812 3.5141 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 6 24 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 32 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 1 38 42 1 0 37 43 1 6 43 44 2 0 43 45 1 0 35 46 1 0 21 47 1 0 47 48 1 0 47 49 1 0 12 50 1 0 50 51 2 3 51 52 1 0 51 53 1 0 11 54 1 0 10 55 1 0 6 56 1 0 5 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 61 64 1 0 60 65 1 0 59 66 1 0 4 67 1 0 3 68 1 0 56 2 1 0 63 58 1 0 14 9 1 0 47 16 1 0 26 19 1 0 40 29 1 0 40 24 1 0 37 30 1 0 1 69 1 0 1 70 1 0 1 71 1 0 2 72 1 1 3 73 1 6 4 74 1 6 5 75 1 1 6 76 1 1 8 77 1 0 8 78 1 0 9 79 1 1 10 80 1 6 11 81 1 6 12 82 1 6 13 83 1 1 16 84 1 1 17 85 1 0 17 86 1 0 18 87 1 0 18 88 1 0 20 89 1 0 20 90 1 0 20 91 1 0 21 92 1 1 22 93 1 0 22 94 1 0 23 95 1 0 23 96 1 0 25 97 1 0 25 98 1 0 25 99 1 0 26100 1 1 27101 1 0 27102 1 0 28103 1 0 30104 1 6 31105 1 0 31106 1 0 33107 1 0 33108 1 0 33109 1 0 34110 1 0 34111 1 0 34112 1 0 35113 1 1 36114 1 0 36115 1 0 38116 1 6 39117 1 0 39118 1 0 41119 1 0 41120 1 0 41121 1 0 42122 1 0 45123 1 0 46124 1 0 48125 1 0 48126 1 0 48127 1 0 49128 1 0 49129 1 0 49130 1 0 52131 1 0 52132 1 0 52133 1 0 53134 1 0 54135 1 0 55136 1 0 58137 1 1 59138 1 6 60139 1 1 61140 1 6 62141 1 0 62142 1 0 64143 1 0 65144 1 0 66145 1 0 67146 1 0 68147 1 0 M END

Standard InCHIKey	CZNVTQBHIFLJPM-FSNQEJLMSA-N
Standard InCHI	InChI=1S/C49H79NO18/c1-21-33(55)37(59)39(68-41-38(60)34(56)25(52)19-63-41)42(65-21)64-20-26-35(57)36(58)32(50-22(2)51)40(66-26)67-31-13-14-46(7)27(45(31,5)6)12-15-47(8)28(46)11-10-23-24-16-44(3,4)29(53)18-49(24,43(61)62)30(54)17-48(23,47)9/h10,21,24-42,52-60H,11-20H2,1-9H3,(H,50,51)(H,61,62)/t21-,24+,25-,26-,27+,28-,29+,30-,31+,32-,33+,34+,35-,36-,37+,38-,39-,40+,41+,42-,46+,47-,48-,49-/m1/s1
SMILES	C[C@@H]1[C@@H]([C@@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@H]2CC[C@@]3(C)[C@@H](CC[C@]4(C)[C@@H]3CC=C3[C@@H]5CC(C)(C)[C@H](C[C@@]5([C@@H](C[C@@]43C)O)C(=O)O)O)C2(C)C)N=C(C)O)O)O)O1)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	969.53	Volume:	948.92 ? Van der Waals volume.
Dense:	1.022	LogP:	0.968 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.773 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.589 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	46.0
TPSA:	307.34 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.067	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.674	Fsp³:	0.918
MCE-18:	178.404 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.762	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.039	Promiscuous compounds:	0.072

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.045	MDCK Permeability:	-5.195
Pgp-inhibitor:	0.0	Pgp-substrate:	0.487
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.346
20% Bioavailability (F20%):	0.642	30% Bioavailability (F30%):	0.977
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.007	MRP1:	0.101
Plasma Protein Binding (PPB):	66.109%	Volume Distribution (VD):	-0.449
Fu:	23.144% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.006
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.967	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.399
HLM stability:	0.011 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.16

Half-life (T1/2):

3.382

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.004
Human Hepatotoxicity (H-HT):	0.979	Drug-induced Liver Injury (DILI):	0.977
AMES Toxicity:	0.865	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.01	Skin Sensitization:	1.0
Carcinogencity:	0.132	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.01
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.997
Hematotoxicity:	0.558	Drug-induced Nephrotoxicity:	0.984
Genotoxicity:	0.851	RPMI-8226 Immunitoxicity:	0.074
A549 Cytotoxicity:	0.136	Hek293 Cytotoxicity:	0.17
BCF:	0.488 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.569 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.429 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.326 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7559	Albizia adianthifolia	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12662095]
NPO29529	Acacia victoriae	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12828461]
NPO29529	Acacia victoriae	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7559	Albizia adianthifolia	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29529	Acacia victoriae	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7559	Albizia adianthifolia	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT15	Cell line	Jurkat	Homo sapiens	IC50	>	100.0	ug.mL-1	PMID[20359898]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC243680 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24017
0.1-0.2	22196
0.2-0.3	2586
0.3-0.4	705
0.4-0.5	294
0.5-0.6	35
0.6-0.7	11
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9038	High Similarity	NPC200788
0.8824	High Similarity	NPC145899
0.8333	Intermediate Similarity	NPC473824
0.8286	Intermediate Similarity	NPC37134
0.7706	Intermediate Similarity	NPC75318
0.7589	Intermediate Similarity	NPC475119
0.7545	Intermediate Similarity	NPC291903
0.7281	Intermediate Similarity	NPC172365
0.7054	Intermediate Similarity	NPC484832
0.7043	Intermediate Similarity	NPC280941
0.7043	Intermediate Similarity	NPC235772
0.6875	Remote Similarity	NPC120667
0.6875	Remote Similarity	NPC278272
0.6814	Remote Similarity	NPC73829
0.6695	Remote Similarity	NPC288205
0.6695	Remote Similarity	NPC51465
0.661	Remote Similarity	NPC210729
0.661	Remote Similarity	NPC82931
0.6466	Remote Similarity	NPC488515
0.6186	Remote Similarity	NPC119794
0.614	Remote Similarity	NPC488516
0.6111	Remote Similarity	NPC242611
0.5984	Remote Similarity	NPC207738
0.5982	Remote Similarity	NPC76999
0.5948	Remote Similarity	NPC80843
0.5882	Remote Similarity	NPC105800
0.5781	Remote Similarity	NPC475140
0.5667	Remote Similarity	NPC104400
0.5667	Remote Similarity	NPC10320
0.5641	Remote Similarity	NPC480424
0.56	Remote Similarity	NPC475486
0.5593	Remote Similarity	NPC488561
0.5533	Remote Similarity	NPC488618
0.55	Remote Similarity	NPC469945
0.5497	Remote Similarity	NPC488619
0.5447	Remote Similarity	NPC481082
0.5447	Remote Similarity	NPC164419
0.5425	Remote Similarity	NPC113620
0.5424	Remote Similarity	NPC56713
0.5391	Remote Similarity	NPC185466
0.5355	Remote Similarity	NPC100612
0.5344	Remote Similarity	NPC166422
0.5321	Remote Similarity	NPC488620
0.5285	Remote Similarity	NPC232237
0.5268	Remote Similarity	NPC283849
0.5267	Remote Similarity	NPC471384
0.522	Remote Similarity	NPC265699
0.52	Remote Similarity	NPC257468
0.5191	Remote Similarity	NPC151543
0.5175	Remote Similarity	NPC31839
0.5161	Remote Similarity	NPC488526
0.5128	Remote Similarity	NPC191410
0.5124	Remote Similarity	NPC127056
0.5078	Remote Similarity	NPC481079
0.5061	Remote Similarity	NPC174336
0.5035	Remote Similarity	NPC482010
0.5034	Remote Similarity	NPC489208

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC243680 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6642
0.1-0.2	2462
0.2-0.3	44
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data