NPASS Compound

Natural Product: NPC102914

Natural Product ID	NPC102914
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Quadranoside Viii
IUPAC Name	[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (2R,4aS,6aR,6aS,6bR,8aR,9R,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1-methylidene-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms	Quadranoside VIII
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1077634
PubChem CID	10675744
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 102107 0 0 0 0 0 0 0 0999 V2000 1.7074 -3.6066 -3.4088 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1039 -2.2561 -3.9059 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4219 -1.7867 -3.3152 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2677 -1.8849 -1.8379 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2428 -0.9356 -1.2479 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6844 -1.4805 0.0236 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2755 -1.9363 0.0040 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7197 -1.0966 -0.7105 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6705 -2.0366 -1.4212 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0880 -0.1339 -1.6784 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7392 0.9787 -1.9989 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0437 1.4258 -1.5241 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6215 0.3970 -0.5864 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8560 0.8474 0.1287 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8353 2.2442 0.6394 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9955 0.8099 -0.9043 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3158 1.1490 -0.2924 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6832 0.3326 0.8921 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5516 -0.0415 1.7931 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5312 0.8996 2.9993 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9064 -1.4336 2.3520 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0969 -1.4034 3.0564 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2304 -0.1892 1.1441 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1225 -0.2733 2.1353 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9638 -0.9647 1.4359 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5249 -0.1828 0.2416 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5241 0.8541 0.7090 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6150 1.0534 1.6500 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2823 0.9035 -1.3011 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2433 -0.4208 -2.2377 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1077 -1.2237 -3.4702 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0710 -1.0260 -4.2478 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0879 0.2524 -0.8298 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9043 1.3926 -1.2791 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0897 0.0414 0.0808 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9591 1.0385 0.5682 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7495 1.1437 2.0627 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0592 1.1358 2.8200 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1242 1.9683 2.1530 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0171 1.9142 0.6517 C 0 0 1 0 0 0 0 0 0 0 0 0 8.3456 1.8893 -0.0386 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0746 0.7429 0.2806 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2882 0.7787 0.2435 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1370 3.2638 2.6472 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4826 -0.1854 2.9800 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9787 2.2643 2.3844 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9142 -3.5345 -2.6620 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2593 -4.1517 -4.2834 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5597 -4.2427 -3.0900 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2446 -2.2530 -5.0032 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2565 -2.4253 -3.6177 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5584 -0.7314 -3.6540 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2649 -1.7873 -1.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9179 -2.9189 -1.5838 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8961 -0.8332 0.9299 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3068 -2.3945 0.2916 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0028 -2.1408 1.0823 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2779 -2.9851 -0.4258 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9869 -1.7258 -2.4106 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5331 -2.3357 -0.7527 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1642 -3.0380 -1.5907 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2233 1.6445 -2.7148 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0439 2.4456 -1.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7420 1.4982 -2.4093 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9762 -0.4327 -1.2715 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8320 2.9262 -0.2609 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8084 2.4630 1.1273 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0710 2.5047 1.3596 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7886 1.5259 -1.7152 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0658 -0.2183 -1.3134 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4311 2.2475 -0.0841 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2527 -0.5772 0.5371 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5295 1.2941 3.2030 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2871 1.7287 2.8650 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8612 0.3866 3.9332 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0341 -2.1620 1.5183 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1292 -1.8261 3.0055 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9345 -1.4935 4.0297 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2416 -1.1737 0.5875 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3845 -0.7748 3.0828 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7493 0.7628 2.3637 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1428 -0.9272 2.2157 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2700 -1.9989 1.2366 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4251 0.8450 0.1365 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9024 1.8885 0.5916 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3218 0.7560 1.8179 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8212 1.9301 1.2379 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5964 -0.0456 -1.2055 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6390 0.5777 -2.6243 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6951 -0.3103 -4.0229 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0648 -1.5857 -5.1721 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7160 2.0223 0.1114 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1796 0.2507 2.4432 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8939 1.5488 3.8354 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1102 1.4993 2.4213 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4768 2.8208 0.2913 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8888 2.8153 0.2450 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1580 1.9322 -1.1283 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7662 0.6410 -0.4149 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6115 3.3767 3.4666 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0268 -0.5416 3.7809 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0288 2.0101 2.2346 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 6 8 10 1 0 10 11 2 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 1 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 1 19 21 1 0 21 22 1 0 19 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 1 18 28 1 0 17 29 1 0 10 30 1 0 30 31 1 0 31 32 2 0 5 33 1 1 33 34 2 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 38 45 1 0 37 46 1 0 31 2 1 0 43 36 1 0 30 5 1 0 26 8 1 0 26 13 1 0 23 14 1 0 1 47 1 0 1 48 1 0 1 49 1 0 2 50 1 6 3 51 1 0 3 52 1 0 4 53 1 0 4 54 1 0 6 55 1 0 6 56 1 0 7 57 1 0 7 58 1 0 9 59 1 0 9 60 1 0 9 61 1 0 11 62 1 0 12 63 1 0 12 64 1 0 13 65 1 6 15 66 1 0 15 67 1 0 15 68 1 0 16 69 1 0 16 70 1 0 17 71 1 1 18 72 1 6 20 73 1 0 20 74 1 0 20 75 1 0 21 76 1 0 21 77 1 0 22 78 1 0 23 79 1 6 24 80 1 0 24 81 1 0 25 82 1 0 25 83 1 0 27 84 1 0 27 85 1 0 27 86 1 0 28 87 1 0 29 88 1 0 30 89 1 6 32 90 1 0 32 91 1 0 36 92 1 6 37 93 1 1 38 94 1 1 39 95 1 6 40 96 1 6 41 97 1 0 41 98 1 0 42 99 1 0 44100 1 0 45101 1 0 46102 1 0 M END

Standard InCHIKey	VOJUDERLBZKDIW-BVJLKSDVSA-N
Standard InCHI	InChI=1S/C36H56O10/c1-18-9-12-36(31(44)46-30-28(42)27(41)26(40)22(16-37)45-30)14-13-34(5)20(25(36)19(18)2)7-8-24-32(3)15-21(39)29(43)33(4,17-38)23(32)10-11-35(24,34)6/h7,18,21-30,37-43H,2,8-17H2,1,3-6H3/t18-,21-,22-,23-,24-,25+,26-,27+,28-,29+,30+,32+,33+,34-,35-,36+/m1/s1
SMILES	C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@H]([C@@H]([C@@](C)(CO)[C@@H]5CC[C@@]34C)O)O)[C@@H]2C1=C)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO23655.1	Rubus ellipticus	Under-species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[19795885]
NPO23655.1	Rubus ellipticus	Under-species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[38455614]
NPO23655.1	Rubus ellipticus	Under-species	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	IC50	=	1850000.0	nM	PMID[24499304]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC102914 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19798
0.1-0.2	24726
0.2-0.3	4204
0.3-0.4	895
0.4-0.5	162
0.5-0.6	47
0.6-0.7	14
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8831	High Similarity	NPC7870
0.8831	High Similarity	NPC75747
0.8148	Intermediate Similarity	NPC220984
0.7875	Intermediate Similarity	NPC116794
0.7805	Intermediate Similarity	NPC271138
0.7805	Intermediate Similarity	NPC110139
0.7805	Intermediate Similarity	NPC108709
0.7683	Intermediate Similarity	NPC68419
0.6905	Remote Similarity	NPC605954
0.686	Remote Similarity	NPC310014
0.686	Remote Similarity	NPC212968
0.686	Remote Similarity	NPC269315
0.6667	Remote Similarity	NPC137917
0.6477	Remote Similarity	NPC187056
0.6477	Remote Similarity	NPC606216
0.6477	Remote Similarity	NPC607023
0.6364	Remote Similarity	NPC37739
0.6364	Remote Similarity	NPC199457
0.625	Remote Similarity	NPC237503
0.6111	Remote Similarity	NPC604133
0.6	Remote Similarity	NPC65590
0.6	Remote Similarity	NPC125923
0.5977	Remote Similarity	NPC191763
0.5955	Remote Similarity	NPC285576
0.5955	Remote Similarity	NPC46388
0.5922	Remote Similarity	NPC134835
0.5865	Remote Similarity	NPC73318
0.5843	Remote Similarity	NPC167383
0.5773	Remote Similarity	NPC179434
0.5761	Remote Similarity	NPC64106
0.5729	Remote Similarity	NPC269095
0.567	Remote Similarity	NPC78046
0.567	Remote Similarity	NPC29069
0.5579	Remote Similarity	NPC256798
0.5567	Remote Similarity	NPC189884
0.5567	Remote Similarity	NPC138334
0.5543	Remote Similarity	NPC190837
0.55	Remote Similarity	NPC139894
0.549	Remote Similarity	NPC473343
0.5484	Remote Similarity	NPC306746
0.5464	Remote Similarity	NPC47063
0.5446	Remote Similarity	NPC150400
0.5417	Remote Similarity	NPC128925
0.5408	Remote Similarity	NPC204458
0.5408	Remote Similarity	NPC90856
0.5385	Remote Similarity	NPC240125
0.5294	Remote Similarity	NPC473373
0.5253	Remote Similarity	NPC214484
0.5204	Remote Similarity	NPC209894
0.5196	Remote Similarity	NPC235405
0.5192	Remote Similarity	NPC475171
0.5192	Remote Similarity	NPC469946
0.5149	Remote Similarity	NPC48499
0.5146	Remote Similarity	NPC58448
0.5146	Remote Similarity	NPC249848
0.5146	Remote Similarity	NPC107966
0.5096	Remote Similarity	NPC295371
0.5096	Remote Similarity	NPC473884
0.5096	Remote Similarity	NPC39211
0.5094	Remote Similarity	NPC109588
0.5054	Remote Similarity	NPC91583
0.5049	Remote Similarity	NPC475516
0.5048	Remote Similarity	NPC161674
0.5047	Remote Similarity	NPC11551
0.5047	Remote Similarity	NPC480475
0.5046	Remote Similarity	NPC601659
0.5045	Remote Similarity	NPC96641
0.5045	Remote Similarity	NPC481030
0.5045	Remote Similarity	NPC163183

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC102914 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7185
0.1-0.2	1901
0.2-0.3	60
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data