NPASS Compound

Natural Product: NPC203354

Natural Product ID	NPC203354
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JVUSSFLOGJOFHV-BGYKETSFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3792557
PubChem CID	NA
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 128134 0 0 0 0 0 0 0 0999 V2000 2.8299 1.8844 -3.1915 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2443 0.8890 -2.3188 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8763 1.1470 -0.9894 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1774 1.5368 -0.3366 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8662 0.8057 0.5011 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1345 1.1931 1.1351 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9314 2.2389 0.4278 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9081 1.7487 -0.5876 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7733 2.9539 -0.9863 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3069 1.2234 -1.8457 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8622 0.7165 -0.0371 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0181 -0.3863 0.5519 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0216 0.0831 1.5723 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8828 0.6475 2.7284 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7511 -0.3709 3.1909 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3303 -1.1133 2.1605 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8452 -1.0876 2.1196 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2877 -0.5223 0.8440 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7847 -0.2334 1.0215 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2472 -0.0200 -0.3543 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7341 -0.1309 -0.4746 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0120 1.0812 0.0420 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4333 -0.2544 -1.9481 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5584 -1.2629 -2.3659 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6406 -1.5850 -1.3365 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0703 -1.8760 -0.0175 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3432 -1.4009 0.1896 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6840 -1.3904 1.6872 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2221 -1.4358 1.7161 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9283 -1.3118 1.0822 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1005 -3.4059 0.2015 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6298 -0.6497 -1.3163 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8459 -1.0294 -1.8818 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0736 -0.3636 -3.0764 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3620 -0.6902 -3.4937 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5664 -0.2417 -4.9061 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2580 0.1621 -2.5829 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2666 -0.4824 -1.2581 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9163 -0.9978 -0.8653 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0349 -2.3108 -0.3342 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7114 0.3390 -0.2270 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8018 -0.1644 0.4653 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.8222 0.7695 0.3142 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9045 0.5895 1.1363 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9513 1.6164 0.6759 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3432 2.8596 0.8339 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5200 0.8757 2.5891 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9912 0.9254 2.6671 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5101 -0.3184 1.9438 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2789 -1.3850 2.4648 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5045 2.0807 2.0764 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9646 -0.2135 3.3280 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6377 1.4082 -2.4999 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6170 0.9593 1.9293 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5727 -1.4825 -0.2520 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6786 -1.3226 3.5196 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7623 2.0636 -3.2374 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3822 2.8164 -2.9322 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2137 1.5836 -4.2014 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2625 2.0815 -1.0491 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5423 2.5188 -0.6119 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8087 1.7014 2.1093 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5624 2.7547 1.2172 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3676 3.0666 -0.0143 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1461 3.8643 -1.0666 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5831 3.0160 -0.2582 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2325 2.6799 -1.9748 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0773 1.3573 -2.6626 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4418 1.8430 -2.2056 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0752 0.1512 -1.8450 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6035 1.1268 0.6462 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4081 0.2809 -0.8995 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7199 -1.0757 1.1084 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5886 -0.9852 -0.2427 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1826 0.9617 3.5205 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5374 1.4539 2.4093 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4209 0.1052 3.7453 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6910 -2.0686 1.6735 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4667 -0.6471 3.0422 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4967 -2.1654 2.1454 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5830 -0.9189 -0.9654 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5856 2.0255 -0.0074 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8970 1.3280 -0.5892 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3482 1.0097 1.0745 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3778 -0.4563 -2.5154 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0385 0.7435 -2.3190 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1045 -1.0055 -3.2943 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0028 -2.2141 -2.6150 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1078 -2.5143 -1.7661 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0020 -2.2015 -0.2270 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3627 -2.3195 2.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3136 -0.5169 2.2138 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5149 -2.3876 1.2482 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5258 -1.4106 2.7785 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4572 -1.4201 2.0959 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8155 -2.0065 1.1533 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3206 -0.3135 0.9033 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8853 -3.8228 -0.8269 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0850 -3.7414 0.5385 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2463 -3.7222 0.8180 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6933 -2.1096 -2.2023 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5765 -1.7679 -3.3797 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9547 0.6618 -5.1292 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2824 -1.0916 -5.5669 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6305 0.0212 -5.0419 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2586 0.2349 -3.0650 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9677 -1.3805 -1.2491 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5243 -0.4095 0.0128 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9062 -2.9990 -1.0144 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1652 -1.1279 0.1155 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3023 -0.4221 0.9984 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9002 1.5233 1.2052 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0425 1.4391 -0.4226 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5805 3.4175 0.0603 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9645 1.8185 2.9518 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7315 0.8336 3.7273 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4616 -0.5690 2.1618 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5888 -1.9482 1.6873 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8477 2.8527 2.5842 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8762 -0.5181 3.0203 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9052 1.5057 -3.1450 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4920 1.9185 1.4137 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5410 1.0872 2.5456 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8237 0.7342 2.6671 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8280 -2.3124 -0.3228 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8398 -1.0378 -1.2308 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5188 -2.0446 0.0283 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3218 -2.2242 3.7413 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 2 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 8 11 1 0 11 12 1 0 12 13 1 0 13 14 1 1 14 15 1 0 13 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 1 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 26 30 1 0 26 31 1 0 25 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 38 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 44 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 47 52 1 0 37 53 1 0 19 54 1 1 18 55 1 6 16 56 1 0 20 3 1 0 27 21 1 0 39 33 1 0 49 42 1 0 18 5 1 0 29 19 1 0 13 6 1 0 1 57 1 0 1 58 1 0 1 59 1 0 3 60 1 6 4 61 1 0 6 62 1 1 7 63 1 0 7 64 1 0 9 65 1 0 9 66 1 0 9 67 1 0 10 68 1 0 10 69 1 0 10 70 1 0 11 71 1 0 11 72 1 0 12 73 1 0 12 74 1 0 14 75 1 0 14 76 1 0 15 77 1 0 16 78 1 6 17 79 1 0 17 80 1 0 20 81 1 6 22 82 1 0 22 83 1 0 22 84 1 0 23 85 1 0 23 86 1 0 24 87 1 0 24 88 1 0 25 89 1 6 27 90 1 6 28 91 1 0 28 92 1 0 29 93 1 0 29 94 1 0 30 95 1 0 30 96 1 0 30 97 1 0 31 98 1 0 31 99 1 0 31100 1 0 33101 1 6 35102 1 6 36103 1 0 36104 1 0 36105 1 0 37106 1 6 38107 1 6 39108 1 1 40109 1 0 42110 1 6 44111 1 1 45112 1 0 45113 1 0 46114 1 0 47115 1 1 48116 1 1 49117 1 6 50118 1 0 51119 1 0 52120 1 0 53121 1 0 54122 1 0 54123 1 0 54124 1 0 55125 1 0 55126 1 0 55127 1 0 56128 1 0 M END

Standard InCHIKey	JVUSSFLOGJOFHV-BGYKETSFSA-N
Standard InCHI	InChI=1S/C43H72O13/c1-21-29(47)34(56-36-32(50)31(49)30(48)25(19-44)54-36)33(51)37(53-21)55-28-11-12-40(6)26(39(28,4)5)10-13-41(7)35(40)24(52-9)16-22-23-17-38(2,3)14-15-43(23,20-45)27(46)18-42(22,41)8/h16,21,23-37,44-51H,10-15,17-20H2,1-9H3/t21-,23+,24-,25-,26+,27+,28+,29+,30-,31+,32-,33-,34+,35-,36+,37+,40+,41-,42-,43-/m1/s1
SMILES	CO[C@@H]1C=C2[C@@H]3CC(C)(C)CC[C@]3(CO)[C@H](C[C@]2([C@]2([C@H]1[C@@]1(C)CC[C@@H](C([C@@H]1CC2)(C)C)O[C@@H]1O[C@H](C)[C@@H]([C@@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)C)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	796.5	Volume:	804.025 ? Van der Waals volume.
Dense:	0.991	LogP:	2.444 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.759 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.586 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	38.0
TPSA:	207.99 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	8.0	Rings:	7.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.138	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.095	Fsp³:	0.953
MCE-18:	152.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.775	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.027 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.218	Promiscuous compounds:	0.148

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.947	MDCK Permeability:	-5.179
Pgp-inhibitor:	0.002	Pgp-substrate:	0.221
PAMPA:	0.969 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.021
20% Bioavailability (F20%):	0.514	30% Bioavailability (F30%):	0.994
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.713	MRP1:	0.041
Plasma Protein Binding (PPB):	70.317%	Volume Distribution (VD):	-0.329
Fu:	24.566% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.444
BSEP inhibitor:	0.029

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.021	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.049
CYP3A4-inhibitor:	0.999	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.992
HLM stability:	0.927 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.651

Half-life (T1/2):

2.794

ADMET: Toxicity

hERG Blockers:	0.033	hERG Blockers (10um):	0.085
Human Hepatotoxicity (H-HT):	0.62	Drug-induced Liver Injury (DILI):	0.8
AMES Toxicity:	0.96	Rat Oral Acute Toxicity:	0.052
Maximum Recommended Daily Dose:	0.058	Skin Sensitization:	1.0
Carcinogencity:	0.37	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.051
Drug-induced Neurotoxicity:	0.017	Ototoxicity:	0.995
Hematotoxicity:	0.67	Drug-induced Nephrotoxicity:	0.823
Genotoxicity:	0.422	RPMI-8226 Immunitoxicity:	0.281
A549 Cytotoxicity:	0.907	Hek293 Cytotoxicity:	0.827
BCF:	1.811 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.771 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.229 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.496 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3107	Bupleurum falcatum	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3107	Bupleurum falcatum	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO3107	Bupleurum falcatum	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO3107	Bupleurum falcatum	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO3107	Bupleurum falcatum	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO3107	Bupleurum falcatum	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4
Activity	3

Activity Type	# Activity
Cell line	7

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT81	Cell line	A549	Homo sapiens	IC50	>	80000.0	nM	PMID[26883148]
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	43200.0	nM	PMID[26883148]
NPT1872	Cell line	Bcap37	Homo sapiens	IC50	>	80000.0	nM	PMID[26883148]
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	80000.0	nM	PMID[26883148]
NPT519	Cell line	SH-SY5Y	Homo sapiens	Activity	=	64.94	%	PMID[26883148]
NPT519	Cell line	SH-SY5Y	Homo sapiens	Activity	=	7.15	%	PMID[26883148]
NPT519	Cell line	SH-SY5Y	Homo sapiens	Activity	=	6.02	%	PMID[26883148]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC203354 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22960
0.1-0.2	22767
0.2-0.3	3033
0.3-0.4	863
0.4-0.5	199
0.5-0.6	25
0.6-0.7	0
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9167	High Similarity	NPC473127
0.9167	High Similarity	NPC110656
0.8193	Intermediate Similarity	NPC473124
0.7442	Intermediate Similarity	NPC473123
0.7283	Intermediate Similarity	NPC162354
0.7158	Intermediate Similarity	NPC281939
0.581	Remote Similarity	NPC76497
0.58	Remote Similarity	NPC109792
0.58	Remote Similarity	NPC57065
0.58	Remote Similarity	NPC54521
0.5728	Remote Similarity	NPC285253
0.541	Remote Similarity	NPC475514
0.5321	Remote Similarity	NPC223301
0.5321	Remote Similarity	NPC171544
0.5299	Remote Similarity	NPC475287
0.5283	Remote Similarity	NPC180459
0.5283	Remote Similarity	NPC195116
0.5283	Remote Similarity	NPC221110
0.5273	Remote Similarity	NPC230948
0.5221	Remote Similarity	NPC302887
0.5133	Remote Similarity	NPC475504
0.5133	Remote Similarity	NPC123796
0.5094	Remote Similarity	NPC473126
0.5094	Remote Similarity	NPC1046
0.5093	Remote Similarity	NPC475516
0.5089	Remote Similarity	NPC164389
0.5078	Remote Similarity	NPC220160
0.5043	Remote Similarity	NPC475486
0.5043	Remote Similarity	NPC104372
0.5043	Remote Similarity	NPC481078
0.5041	Remote Similarity	NPC481080

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC203354 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7597
0.1-0.2	1479
0.2-0.3	68
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data