Drug Information| Drug ID:   | NPD7524 |
| Drug Name:   | Eldecalcitol |
| Molecular Formula:   | C30H50O5 |
| Canonical SMILES:   | OCCCO[C@@H]1[C@H](O)C/C(=C/C=C/2CCC[C@]3([C@H]2CC[C@@H]3[C@@H](CCCC(O)(C)C)C)C)/C(=C)[C@H]1O |
| Standard InCHI:   | "InChI=1S/C30H50O5/c1-20(9-6-15-29(3,4)34)24-13-14-25-22(10-7-16-30(24,25)5)11-12-23-19-26(32)28(27(33)21(23)2)35-18-8-17-31/h11-12,20,24-28,31-34H,2,6-10,13-19H2,1,3-5H3/b22-11+,23-12-/t20-,24-,25+,26-,27-,28-,30-/m1/s1" |
| Standard InCHIKey:   | FZEXGDDBXLBRTD-AYIMTCTASA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD7524Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6056 | NPC63893 |
| Remote Similarity | 0.6056 | NPC324772 |
| Remote Similarity | 0.6056 | NPC611865 |
| Remote Similarity | 0.5694 | NPC27395 |
| Remote Similarity | 0.5694 | NPC611888 |
| Remote Similarity | 0.5128 | NPC23466 |
| Molecular Weight   | 490.37 |
| ALogP   | 0.1131 |
| MLogP   | 4.21 |
| XLogP   | 5.883 |
| HDA   | 5 |
| HBD   | 4 |
| Rotatable Bonds   | 18 |
| TPSA   | 90.15 |
| RO5 Violation   | 1 |