NPASS Compound

Natural Product: NPC488519

Natural Product ID	NPC488519
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZSRIUUWYDGCPHU-HPXKIVQKSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44584184
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 85 89 0 0 0 0 0 0 0 0999 V2000 -5.5386 -1.3245 0.9660 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1288 -0.2467 -0.0185 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0760 -0.4160 -1.2172 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3950 1.0753 0.6036 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4603 2.1720 0.1692 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0558 1.6393 0.3935 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8293 0.6102 -0.6507 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7454 -0.5343 -0.4752 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4034 0.1793 -0.7213 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1336 -1.0647 -1.0681 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2187 -1.6702 -1.1903 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2827 -0.6317 -0.9639 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6369 -1.2473 -0.8722 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5942 -2.6176 -0.2938 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1718 -1.4725 -2.3057 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5035 -2.1568 -2.2496 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5132 -1.5445 -1.3751 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0183 -0.8587 -0.1380 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9055 0.3977 0.0203 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2489 -1.6682 1.1113 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6337 -0.3166 -0.2825 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1607 0.3678 0.9711 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9807 1.2151 0.5859 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8634 0.2959 0.1191 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3506 -0.3868 1.3539 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2851 1.1140 -0.4395 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0877 1.6929 -1.8118 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6540 2.2910 0.4102 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0578 2.7689 0.2724 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3057 3.5697 -0.8275 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3834 -2.5737 -0.9354 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0237 1.1564 1.7881 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7823 -0.0398 2.0707 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2599 2.0064 2.8505 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2460 1.6204 4.1923 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6519 -1.9632 1.2529 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8849 -0.8877 1.9293 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2857 -2.0235 0.5729 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0966 -0.4958 -0.7514 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8791 -1.4031 -1.6848 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0115 0.4237 -1.9075 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4246 1.4024 0.3413 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3642 1.0388 1.7135 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6525 3.0582 0.7828 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5824 2.3342 -0.9195 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0785 1.0967 -1.6389 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8024 -1.0445 -1.4897 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2598 -1.2885 0.1779 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9718 -1.7574 -1.3004 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2993 -2.0004 -2.2629 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3347 -2.5448 -0.5070 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3024 -0.0168 -1.9140 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5935 -3.0687 -0.1394 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1278 -3.2883 -1.0781 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0209 -2.7547 0.6104 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4792 -2.0711 -2.8972 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3201 -0.4883 -2.8051 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8817 -2.1769 -3.3148 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3454 -3.2540 -2.0247 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1701 -0.8842 -1.9986 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9944 0.6351 1.1158 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5179 1.2338 -0.5701 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9167 0.1115 -0.3084 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0012 -1.1994 1.8131 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3480 -1.8058 1.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7276 -2.6641 0.8714 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7298 0.5349 -1.0306 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0402 -0.2649 1.8390 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9792 1.0933 1.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3172 1.8835 -0.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6487 1.7559 1.4786 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4360 -1.1343 1.1955 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1465 -0.8932 1.9399 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0616 0.3560 2.0637 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5142 2.6177 -1.9544 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1287 2.0018 -1.8812 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2608 1.0262 -2.6452 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4209 2.2129 1.4750 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0092 3.1606 0.0646 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2723 3.4332 1.1638 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9858 4.2710 -0.6331 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2684 -2.2028 -0.7676 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5554 0.5502 4.2459 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2785 1.7589 4.6930 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0722 2.1839 4.7095 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 1 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 1 24 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 17 31 1 0 6 32 1 1 32 33 2 0 32 34 1 0 34 35 1 0 8 2 1 0 26 9 1 0 29 6 1 0 24 12 1 0 21 13 1 0 1 36 1 0 1 37 1 0 1 38 1 0 3 39 1 0 3 40 1 0 3 41 1 0 4 42 1 0 4 43 1 0 5 44 1 0 5 45 1 0 7 46 1 6 8 47 1 0 8 48 1 0 10 49 1 0 11 50 1 0 11 51 1 0 12 52 1 6 14 53 1 0 14 54 1 0 14 55 1 0 15 56 1 0 15 57 1 0 16 58 1 0 16 59 1 0 17 60 1 6 19 61 1 0 19 62 1 0 19 63 1 0 20 64 1 0 20 65 1 0 20 66 1 0 21 67 1 6 22 68 1 0 22 69 1 0 23 70 1 0 23 71 1 0 25 72 1 0 25 73 1 0 25 74 1 0 27 75 1 0 27 76 1 0 27 77 1 0 28 78 1 0 28 79 1 0 29 80 1 1 30 81 1 0 31 82 1 0 35 83 1 0 35 84 1 0 35 85 1 0 M END

Standard InCHIKey	ZSRIUUWYDGCPHU-HPXKIVQKSA-N
Standard InCHI	InChI=1S/C31H50O4/c1-26(2)15-16-31(25(34)35-8)20(17-26)19-9-10-22-28(5)13-12-23(32)27(3,4)21(28)11-14-29(22,6)30(19,7)18-24(31)33/h9,20-24,32-33H,10-18H2,1-8H3/t20-,21+,22-,23+,24-,28+,29-,30-,31-/m1/s1
SMILES	CC1(C)CC[C@]2([C@H](C1)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O)C(=O)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	486.37	Volume:	531.838 ? Van der Waals volume.
Dense:	0.915	LogP:	4.697 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.212 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.621 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	27.0
TPSA:	66.76 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.337	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.803	Fsp³:	0.903
MCE-18:	107.119 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.825	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.012 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.38	Promiscuous compounds:	0.187

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.338	MDCK Permeability:	-4.999
Pgp-inhibitor:	0.048	Pgp-substrate:	0.021
PAMPA:	0.996 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.841	30% Bioavailability (F30%):	0.51
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.976	MRP1:	0.899
Plasma Protein Binding (PPB):	97.348%	Volume Distribution (VD):	-0.137
Fu:	3.604% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.996	BCRP inhibitor:	0.559
BSEP inhibitor:	0.957

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.073
CYP2C19-inhibitor:	0.856	CYP2C19-substrate:	0.97
CYP2C9-inhibitor:	0.003	CYP2C9-substrate:	0.009
CYP2D6-inhibitor:	0.019	CYP2D6-substrate:	0.027
CYP3A4-inhibitor:	0.005	CYP3A4-substrate:	0.557
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.744
HLM stability:	0.894 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

10.553

Half-life (T1/2):

0.526

ADMET: Toxicity

hERG Blockers:	0.094	hERG Blockers (10um):	0.182
Human Hepatotoxicity (H-HT):	0.652	Drug-induced Liver Injury (DILI):	0.262
AMES Toxicity:	0.317	Rat Oral Acute Toxicity:	0.479
Maximum Recommended Daily Dose:	0.751	Skin Sensitization:	0.819
Carcinogencity:	0.897	Eye Corrosion:	0.011
Eye Irritation:	0.288	Respiratory Toxicity:	0.904
Drug-induced Neurotoxicity:	0.079	Ototoxicity:	0.531
Hematotoxicity:	0.286	Drug-induced Nephrotoxicity:	0.778
Genotoxicity:	0.531	RPMI-8226 Immunitoxicity:	0.071
A549 Cytotoxicity:	0.51	Hek293 Cytotoxicity:	0.428
BCF:	1.985 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.309 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.674 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.124 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
IC50	1

Activity Type	# Activity
Cell line	1
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT759	Cell line	H9	Homo sapiens	IC50	=	4900.0	nM	PMID[7494144]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	3100.0	nM	PMID[7494144]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488519 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18231
0.1-0.2	26078
0.2-0.3	4305
0.3-0.4	960
0.4-0.5	202
0.5-0.6	58
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7581	Intermediate Similarity	NPC246708
0.7463	Intermediate Similarity	NPC488520
0.7246	Intermediate Similarity	NPC488522
0.7213	Intermediate Similarity	NPC34177
0.7097	Intermediate Similarity	NPC253807
0.7097	Intermediate Similarity	NPC158662
0.7042	Intermediate Similarity	NPC488524
0.7015	Intermediate Similarity	NPC164349
0.6984	Remote Similarity	NPC470588
0.6825	Remote Similarity	NPC235341
0.6721	Remote Similarity	NPC290598
0.6721	Remote Similarity	NPC30590
0.6667	Remote Similarity	NPC311078
0.6406	Remote Similarity	NPC101475
0.6087	Remote Similarity	NPC136313
0.6029	Remote Similarity	NPC40552
0.6	Remote Similarity	NPC474989
0.597	Remote Similarity	NPC159168
0.589	Remote Similarity	NPC294360
0.5696	Remote Similarity	NPC167383
0.5672	Remote Similarity	NPC132478
0.5672	Remote Similarity	NPC196753
0.5658	Remote Similarity	NPC283343
0.5652	Remote Similarity	NPC480950
0.5634	Remote Similarity	NPC214756
0.5616	Remote Similarity	NPC49776
0.5616	Remote Similarity	NPC63118
0.5616	Remote Similarity	NPC474436
0.5588	Remote Similarity	NPC480924
0.5584	Remote Similarity	NPC473160
0.5517	Remote Similarity	NPC1046
0.5484	Remote Similarity	NPC488526
0.5455	Remote Similarity	NPC27765
0.5455	Remote Similarity	NPC471433
0.5455	Remote Similarity	NPC471432
0.5455	Remote Similarity	NPC122418
0.5455	Remote Similarity	NPC491014
0.5429	Remote Similarity	NPC267517
0.5422	Remote Similarity	NPC48249
0.5417	Remote Similarity	NPC2539
0.5405	Remote Similarity	NPC228784
0.5405	Remote Similarity	NPC324341
0.5405	Remote Similarity	NPC601810
0.5342	Remote Similarity	NPC481361
0.5333	Remote Similarity	NPC480919
0.5319	Remote Similarity	NPC305267
0.5286	Remote Similarity	NPC238992
0.5286	Remote Similarity	NPC95594
0.5281	Remote Similarity	NPC475208
0.5256	Remote Similarity	NPC86368
0.5224	Remote Similarity	NPC120098
0.5205	Remote Similarity	NPC480946
0.5205	Remote Similarity	NPC130577
0.5205	Remote Similarity	NPC142415
0.5205	Remote Similarity	NPC102683
0.5143	Remote Similarity	NPC475862
0.5135	Remote Similarity	NPC7260
0.5135	Remote Similarity	NPC210037
0.5135	Remote Similarity	NPC120968
0.5135	Remote Similarity	NPC171203
0.5135	Remote Similarity	NPC307426
0.5135	Remote Similarity	NPC98442
0.5135	Remote Similarity	NPC242468
0.5135	Remote Similarity	NPC227467
0.5135	Remote Similarity	NPC273621
0.5128	Remote Similarity	NPC488518
0.5128	Remote Similarity	NPC175006
0.5109	Remote Similarity	NPC480420
0.507	Remote Similarity	NPC230295
0.507	Remote Similarity	NPC253402
0.507	Remote Similarity	NPC53744
0.507	Remote Similarity	NPC98386
0.5068	Remote Similarity	NPC162107
0.5068	Remote Similarity	NPC46912
0.5068	Remote Similarity	NPC477579

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488519 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7054
0.1-0.2	2004
0.2-0.3	87
0.3-0.4	4
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5135	Remote Similarity	NPD7645	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data