NPASS Compound

Natural Product: NPC480950

Natural Product ID	NPC480950
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZCKFNUDYXYQCEV-DOLOLFCTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	102237001
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 80 84 0 0 0 0 0 0 0 0999 V2000 5.5616 0.3681 -2.0050 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3191 -0.5164 -0.8160 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1087 -1.7952 -1.0361 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7932 0.1834 0.4361 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6765 0.1474 1.4924 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5387 0.9928 0.8906 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9982 0.2706 -0.2732 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8647 -0.9255 -0.6833 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5766 -0.1693 -0.1708 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0182 -1.0124 -1.0288 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3623 -1.5087 -1.0221 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2588 -0.6827 -0.1817 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7001 -0.6276 -0.6486 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8855 -0.1841 -2.0486 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2344 -2.0436 -0.5461 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2913 -2.1773 0.5276 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4458 -1.2183 0.2841 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8949 0.1914 0.3531 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5337 1.0967 -0.6630 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3386 0.7266 1.7298 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4170 0.1961 0.3764 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8940 1.6246 0.4106 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4972 1.5160 1.0119 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6504 0.6326 0.1449 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2599 1.4580 -1.0612 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6543 0.3198 0.9031 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4189 -0.7709 1.9239 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1769 1.5150 1.6232 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6263 1.4530 1.9513 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8614 0.7971 3.1845 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0453 -1.4790 -0.9322 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2592 2.1248 0.3976 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6645 0.7361 -2.4955 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1739 -0.1415 -2.8024 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1820 1.2588 -1.7094 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1651 -1.4930 -1.1972 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9725 -2.5250 -0.2268 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7715 -2.2036 -2.0299 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0626 1.2422 0.2425 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6749 -0.3698 0.8363 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1278 0.6449 2.3770 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4177 -0.8967 1.6238 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1042 0.9373 -1.1967 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5690 -1.2101 -1.7365 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7308 -1.8022 -0.0649 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6511 -1.3830 -1.8399 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3238 -2.5595 -0.6144 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6910 -1.6006 -2.0822 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3560 -1.2291 0.8051 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9989 -0.1929 -2.2434 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5610 0.8308 -2.2866 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5018 -0.9688 -2.7322 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6984 -2.3923 -1.4895 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4447 -2.7844 -0.3031 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9073 -2.1119 1.5438 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7226 -3.2017 0.4093 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1949 -1.4340 1.0736 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8115 1.7803 -1.1532 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1361 0.5122 -1.4202 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3062 1.7865 -0.2087 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2907 0.2651 2.0371 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5967 0.5062 2.5008 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4740 1.8276 1.6887 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1160 -0.2398 1.3786 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8934 2.1118 -0.5641 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5654 2.2009 1.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0725 2.5374 0.9778 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6119 1.1788 2.0410 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9813 2.3041 -1.2415 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6992 1.9993 -0.8397 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1870 0.9023 -1.9910 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5227 -0.5758 2.5138 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1958 -0.7631 2.7175 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4632 -1.7902 1.5063 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9611 2.4762 1.1251 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6227 1.5765 2.6055 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9016 2.5229 2.2299 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3925 -0.0022 3.1192 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0041 -1.2438 -0.8514 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7227 2.4738 1.1977 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 6 24 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 17 31 1 0 6 32 1 6 8 2 1 0 26 9 1 0 29 6 1 0 24 12 1 0 21 13 1 0 1 33 1 0 1 34 1 0 1 35 1 0 3 36 1 0 3 37 1 0 3 38 1 0 4 39 1 0 4 40 1 0 5 41 1 0 5 42 1 0 7 43 1 6 8 44 1 0 8 45 1 0 10 46 1 0 11 47 1 0 11 48 1 0 12 49 1 1 14 50 1 0 14 51 1 0 14 52 1 0 15 53 1 0 15 54 1 0 16 55 1 0 16 56 1 0 17 57 1 1 19 58 1 0 19 59 1 0 19 60 1 0 20 61 1 0 20 62 1 0 20 63 1 0 21 64 1 1 22 65 1 0 22 66 1 0 23 67 1 0 23 68 1 0 25 69 1 0 25 70 1 0 25 71 1 0 27 72 1 0 27 73 1 0 27 74 1 0 28 75 1 0 28 76 1 0 29 77 1 1 30 78 1 0 31 79 1 0 32 80 1 0 M END

Standard InCHIKey	ZCKFNUDYXYQCEV-DOLOLFCTSA-N
Standard InCHI	InChI=1S/C29H48O3/c1-24(2)14-15-29(32)19(16-24)18-8-9-21-26(5)12-11-22(30)25(3,4)20(26)10-13-27(21,6)28(18,7)17-23(29)31/h8,19-23,30-32H,9-17H2,1-7H3/t19-,20-,21+,22-,23+,26-,27+,28+,29+/m0/s1
SMILES	CC1(C)CC[C@]2([C@@H](C1)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	444.36	Volume:	491.092 ? Van der Waals volume.
Dense:	0.905	LogP:	4.606 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.176 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.133 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	0.0	Rigid Bonds:	26.0
TPSA:	60.69 ? Topological Polar Surface Area.	H-Bond Acceptor:	3.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	3.0

MedChem Properties

QED Drug-Likeness Score:	0.41	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.87	Fsp³:	0.931
MCE-18:	105.857 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.698	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.015 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.464	Promiscuous compounds:	0.111

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.405	MDCK Permeability:	-5.009
Pgp-inhibitor:	0.006	Pgp-substrate:	0.354
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.007
20% Bioavailability (F20%):	0.987	30% Bioavailability (F30%):	0.721
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.868	MRP1:	0.909
Plasma Protein Binding (PPB):	91.027%	Volume Distribution (VD):	-0.153
Fu:	8.373% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.923	BCRP inhibitor:	0.317
BSEP inhibitor:	0.504

ADMET: Metabolism

CYP1A2-inhibitor:	0.016	CYP1A2-substrate:	0.015
CYP2C19-inhibitor:	0.976	CYP2C19-substrate:	0.689
CYP2C9-inhibitor:	0.02	CYP2C9-substrate:	0.012
CYP2D6-inhibitor:	0.066	CYP2D6-substrate:	0.009
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.653
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.9
HLM stability:	0.914 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

10.492

Half-life (T1/2):

0.719

ADMET: Toxicity

hERG Blockers:	0.063	hERG Blockers (10um):	0.25
Human Hepatotoxicity (H-HT):	0.627	Drug-induced Liver Injury (DILI):	0.184
AMES Toxicity:	0.482	Rat Oral Acute Toxicity:	0.627
Maximum Recommended Daily Dose:	0.677	Skin Sensitization:	0.971
Carcinogencity:	0.959	Eye Corrosion:	0.036
Eye Irritation:	0.504	Respiratory Toxicity:	0.931
Drug-induced Neurotoxicity:	0.11	Ototoxicity:	0.442
Hematotoxicity:	0.448	Drug-induced Nephrotoxicity:	0.854
Genotoxicity:	0.794	RPMI-8226 Immunitoxicity:	0.086
A549 Cytotoxicity:	0.847	Hek293 Cytotoxicity:	0.698
BCF:	2.408 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.101 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.147 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.789 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	leaf	n.a.	PMID[16926516]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[22834923]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	Roots	n.a.	n.a.	PMID[30395460]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32569471]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39065796]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT804	Cell line	HT-22	Mus musculus	Activity	=	61.9	%	PMID[32569471]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC480950 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26770
0.1-0.2	19509
0.2-0.3	2814
0.3-0.4	612
0.4-0.5	117
0.5-0.6	28
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6719	Remote Similarity	NPC2539
0.629	Remote Similarity	NPC34177
0.619	Remote Similarity	NPC253807
0.619	Remote Similarity	NPC158662
0.6066	Remote Similarity	NPC290598
0.6066	Remote Similarity	NPC30590
0.6032	Remote Similarity	NPC311078
0.5781	Remote Similarity	NPC101475
0.5714	Remote Similarity	NPC228784
0.5714	Remote Similarity	NPC324341
0.5714	Remote Similarity	NPC601810
0.5692	Remote Similarity	NPC235341
0.5652	Remote Similarity	NPC488519
0.5625	Remote Similarity	NPC474989
0.5606	Remote Similarity	NPC159168
0.5556	Remote Similarity	NPC27765
0.5556	Remote Similarity	NPC122418
0.5556	Remote Similarity	NPC491014
0.5538	Remote Similarity	NPC132478
0.5455	Remote Similarity	NPC291379
0.5441	Remote Similarity	NPC246708
0.5312	Remote Similarity	NPC120098
0.5286	Remote Similarity	NPC480946
0.5286	Remote Similarity	NPC130577
0.5286	Remote Similarity	NPC142415
0.5286	Remote Similarity	NPC102683
0.5224	Remote Similarity	NPC480924
0.5211	Remote Similarity	NPC112866
0.5147	Remote Similarity	NPC238992
0.5147	Remote Similarity	NPC470588
0.5075	Remote Similarity	NPC196753
0.507	Remote Similarity	NPC610937
0.5068	Remote Similarity	NPC202728
0.5068	Remote Similarity	NPC158059
0.5068	Remote Similarity	NPC164349

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC480950 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8113
0.1-0.2	1011
0.2-0.3	22
0.3-0.4	3
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data