NPASS Compound

Natural Product: NPC480924

Natural Product ID	NPC480924
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DVRCRDISEPGHFZ-ZCVOVAIBSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 84 88 0 0 0 0 0 0 0 0999 V2000 -4.0067 0.4292 2.9962 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6832 0.5848 1.6367 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9897 1.3114 1.9332 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0115 -0.7786 1.1501 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9590 -1.4077 0.2766 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5324 -0.4992 -0.8229 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8429 -0.0348 -1.5066 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5521 0.8281 -2.5597 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8748 0.6892 -0.1584 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7801 1.3948 0.7728 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5214 0.3861 0.2835 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9351 0.8372 1.3838 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4407 0.5385 1.8423 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3099 0.0437 0.7557 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7734 0.4161 0.8625 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0258 1.8574 1.1315 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3233 -0.3350 2.0622 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5207 -1.1617 1.7703 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5421 -0.5614 0.8749 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9366 -0.0395 -0.4102 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4835 1.2815 -0.8181 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3430 -1.0254 -1.5305 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4649 -0.1544 -0.3329 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8727 0.2481 -1.6606 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4886 -0.3052 -1.7195 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6907 0.2646 -0.5761 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4252 1.7010 -0.8734 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6451 -0.5012 -0.5442 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4406 -1.8677 0.0737 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2434 -0.7069 -1.8872 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6742 -1.1054 -1.8765 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8938 -2.4948 -1.8773 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5486 -1.7579 -2.5325 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3230 0.4294 1.5179 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1546 -0.2784 2.9487 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7438 0.1594 3.7750 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5733 1.4113 3.2805 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1421 2.1477 1.1891 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8694 0.6398 1.8244 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0175 1.7713 2.9163 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1470 -1.4821 2.0175 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9679 -0.8396 0.5974 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3654 -2.3435 -0.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1345 -1.6819 0.9402 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4564 0.5356 -0.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3676 -0.8995 -1.9385 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6471 0.3768 -3.4358 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7349 1.3855 -1.0662 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4833 2.0298 0.1358 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2186 2.1799 1.3154 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5213 1.4849 2.0068 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3877 -0.2303 2.6673 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8044 1.4750 2.3299 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3348 -1.0904 0.8725 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7279 2.0591 2.2048 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1383 2.0562 1.1936 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6419 2.5761 0.4274 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5872 0.3445 2.9154 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5548 -1.0243 2.5029 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0102 -1.4118 2.7359 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2134 -2.1413 1.3317 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2826 -1.3605 0.6499 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7192 2.0324 -1.1249 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1604 1.2074 -1.7079 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1634 1.7322 -0.0337 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6302 -1.8456 -1.6166 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3508 -1.3918 -1.2461 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4996 -0.4649 -2.4911 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2573 -1.2716 -0.2726 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4655 -0.3469 -2.4247 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0088 1.2850 -1.9311 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0097 -0.0223 -2.6598 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5837 -1.4091 -1.6994 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3085 2.3732 -0.0295 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4564 1.8485 -1.5331 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2632 2.1553 -1.4815 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4491 -2.3858 -0.3383 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5059 -1.8736 1.1792 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2811 -2.5610 -0.2358 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1068 0.1732 -2.5461 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0773 -0.8083 -2.8959 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4718 -2.9253 -2.6401 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9032 -1.8612 -3.4589 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9647 0.0067 2.1090 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 6 7 8 1 0 6 9 1 0 9 10 1 0 9 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 26 28 1 0 28 29 1 1 28 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 19 34 1 0 10 2 1 0 28 11 1 0 31 6 1 0 26 14 1 0 23 15 1 0 1 35 1 0 1 36 1 0 1 37 1 0 3 38 1 0 3 39 1 0 3 40 1 0 4 41 1 0 4 42 1 0 5 43 1 0 5 44 1 0 7 45 1 0 7 46 1 0 8 47 1 0 9 48 1 6 10 49 1 0 10 50 1 0 12 51 1 0 13 52 1 0 13 53 1 0 14 54 1 1 16 55 1 0 16 56 1 0 16 57 1 0 17 58 1 0 17 59 1 0 18 60 1 0 18 61 1 0 19 62 1 6 21 63 1 0 21 64 1 0 21 65 1 0 22 66 1 0 22 67 1 0 22 68 1 0 23 69 1 1 24 70 1 0 24 71 1 0 25 72 1 0 25 73 1 0 27 74 1 0 27 75 1 0 27 76 1 0 29 77 1 0 29 78 1 0 29 79 1 0 30 80 1 6 31 81 1 6 32 82 1 0 33 83 1 0 34 84 1 0 M END

Standard InCHIKey	DVRCRDISEPGHFZ-ZCVOVAIBSA-N
Standard InCHI	InChI=1S/C30H50O4/c1-25(2)14-15-30(17-31)19(16-25)18-8-9-21-27(5)12-11-22(32)26(3,4)20(27)10-13-28(21,6)29(18,7)23(33)24(30)34/h8,19-24,31-34H,9-17H2,1-7H3/t19-,20-,21+,22-,23-,24+,27-,28+,29-,30+/m0/s1
SMILES	CC1(C)CC[C@@]2(CO)[C@@H](C1)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)[C@H]([C@H]2O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	474.37	Volume:	517.178 ? Van der Waals volume.
Dense:	0.917	LogP:	3.53 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.638 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.207 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	1.0	Rigid Bonds:	26.0
TPSA:	80.92 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	4.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.399	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.078	Fsp³:	0.933
MCE-18:	107.586 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.551	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.042 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.356	Promiscuous compounds:	0.083

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.56	MDCK Permeability:	-5.031
Pgp-inhibitor:	0.001	Pgp-substrate:	0.26
PAMPA:	0.998 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.997	30% Bioavailability (F30%):	0.879
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	1.0	MRP1:	0.84
Plasma Protein Binding (PPB):	91.805%	Volume Distribution (VD):	-0.248
Fu:	6.01% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.995
OATP1B3 inhibitor:	0.029	BCRP inhibitor:	0.636
BSEP inhibitor:	0.251

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.007
CYP2C19-inhibitor:	0.955	CYP2C19-substrate:	0.583
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.011	CYP2D6-substrate:	0.008
CYP3A4-inhibitor:	0.018	CYP3A4-substrate:	0.848
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.937
HLM stability:	0.551 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

8.439

Half-life (T1/2):

0.958

ADMET: Toxicity

hERG Blockers:	0.031	hERG Blockers (10um):	0.161
Human Hepatotoxicity (H-HT):	0.483	Drug-induced Liver Injury (DILI):	0.324
AMES Toxicity:	0.77	Rat Oral Acute Toxicity:	0.608
Maximum Recommended Daily Dose:	0.454	Skin Sensitization:	0.993
Carcinogencity:	0.925	Eye Corrosion:	0.007
Eye Irritation:	0.576	Respiratory Toxicity:	0.933
Drug-induced Neurotoxicity:	0.193	Ototoxicity:	0.602
Hematotoxicity:	0.846	Drug-induced Nephrotoxicity:	0.908
Genotoxicity:	0.811	RPMI-8226 Immunitoxicity:	0.126
A549 Cytotoxicity:	0.94	Hek293 Cytotoxicity:	0.737
BCF:	1.921 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.782 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.063 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.483 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40059	Camellia crapnelliana	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[29064696]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
Activity	1

Activity Type	# Activity
Individual protein	1
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT178	Individual protein	Protein-tyrosine phosphatase 1B	Homo sapiens	IC50	=	14360.0	nM	PMID[29064696]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT21742	Cell line	L02	Homo sapiens	Activity	>	90.0	%	PMID[29064696]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC480924 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26195
0.1-0.2	19968
0.2-0.3	2834
0.3-0.4	707
0.4-0.5	109
0.5-0.6	25
0.6-0.7	12
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7719	Intermediate Similarity	NPC238992
0.7368	Intermediate Similarity	NPC237344
0.7241	Intermediate Similarity	NPC253807
0.7241	Intermediate Similarity	NPC158662
0.7193	Intermediate Similarity	NPC474989
0.678	Remote Similarity	NPC101475
0.6557	Remote Similarity	NPC53744
0.6552	Remote Similarity	NPC290598
0.6552	Remote Similarity	NPC30590
0.6377	Remote Similarity	NPC273668
0.623	Remote Similarity	NPC311078
0.623	Remote Similarity	NPC34177
0.6129	Remote Similarity	NPC235341
0.6032	Remote Similarity	NPC470588
0.6029	Remote Similarity	NPC480919
0.6	Remote Similarity	NPC475263
0.6	Remote Similarity	NPC175006
0.5968	Remote Similarity	NPC196753
0.5946	Remote Similarity	NPC474190
0.5915	Remote Similarity	NPC88349
0.5846	Remote Similarity	NPC246708
0.5781	Remote Similarity	NPC159168
0.5753	Remote Similarity	NPC476132
0.5753	Remote Similarity	NPC480920
0.5652	Remote Similarity	NPC29765
0.5588	Remote Similarity	NPC488519
0.5441	Remote Similarity	NPC198664
0.5441	Remote Similarity	NPC99254
0.5316	Remote Similarity	NPC473586
0.5278	Remote Similarity	NPC294360
0.5238	Remote Similarity	NPC27765
0.5238	Remote Similarity	NPC122418
0.5238	Remote Similarity	NPC491014
0.5224	Remote Similarity	NPC480950
0.5217	Remote Similarity	NPC480946
0.5217	Remote Similarity	NPC130577
0.5217	Remote Similarity	NPC142415
0.5217	Remote Similarity	NPC102683
0.5152	Remote Similarity	NPC40394
0.5128	Remote Similarity	NPC476195
0.5075	Remote Similarity	NPC230295
0.5075	Remote Similarity	NPC98386

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC480924 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8059
0.1-0.2	1062
0.2-0.3	25
0.3-0.4	3
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data