NPASS drugs

Drug Information

Drug ID:	NPD4629
Drug Name:	Prednisone
Molecular Formula:	C21H26O5
Canonical SMILES:	OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)CC(=O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C
Standard InCHI:	"InChI=1S/C21H26O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-15,18,22,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1"
Standard InCHIKey:	XOFYZVNMUHMLCC-ZPOLXVRWSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4629

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	83484
0.1-0.2	121388
0.2-0.3	6618
0.3-0.4	161
0.4-0.5	72
0.5-0.6	11
0.6-0.7	5
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7193	NPC62180
Remote Similarity	0.6949	NPC334061
Remote Similarity	0.6949	NPC611819
Remote Similarity	0.678	NPC154482
Remote Similarity	0.678	NPC233118
Remote Similarity	0.678	NPC611991
Remote Similarity	0.5385	NPC530777
Remote Similarity	0.5303	NPC144956
Remote Similarity	0.5303	NPC608439
Remote Similarity	0.5217	NPC44063
Remote Similarity	0.5217	NPC235800
Remote Similarity	0.5217	NPC611921
Remote Similarity	0.5156	NPC310010
Remote Similarity	0.5156	NPC326627
Remote Similarity	0.5156	NPC600483
Remote Similarity	0.5077	NPC328007
Remote Similarity	0.5077	NPC312669

Drug Structure

NPD4629 OpenBabel08211705262D 28 31 0 0 1 0 0 0 0 0999 V2000 -3.3703 -0.9369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8426 0.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5278 -3.4044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6852 -2.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0542 -1.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8414 -1.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2123 -1.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8414 -0.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2123 -3.4044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6851 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9239 1.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3703 -2.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0543 -2.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6852 -1.9451 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8426 -1.4587 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5277 -0.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0003 0.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5277 -1.4587 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3703 -1.9451 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8426 -0.4864 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1257 2.2232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9275 -3.4219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4008 0.0177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7228 1.6220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8417 0.4859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4032 2.8733 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7660 0.1856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 20 1 0 0 0 0 3 4 1 0 0 0 0 3 12 1 0 0 0 0 5 7 2 0 0 0 0 5 13 1 0 0 0 0 6 8 1 0 0 0 0 6 15 1 0 0 0 0 7 19 1 0 0 0 0 8 21 1 0 0 0 0 9 12 2 0 0 0 0 9 13 1 0 0 0 0 10 16 1 0 0 0 0 10 20 1 0 0 0 0 11 17 1 0 0 0 0 11 22 1 0 0 0 0 12 19 1 0 0 0 0 13 23 2 0 0 0 0 14 4 1 6 0 0 0 14 15 1 0 0 0 0 14 18 1 0 0 0 0 15 20 1 1 0 0 0 16 18 1 0 0 0 0 16 24 2 0 0 0 0 17 25 2 0 0 0 0 18 19 1 1 0 0 0 19 1 1 1 0 0 0 20 21 1 6 0 0 0 21 17 1 1 0 0 0 21 26 1 0 0 0 0 22 27 1 0 0 0 0 26 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001041
DrugBank	DB00635
ChEMBL	CHEMBL635
IUPHAR/BPS	7096
PharmaGKB	PA451100
KEGG Drug	D00473
PubChem CID	5865
ChEBI	8382
CAS Number	1953/3/2

Drug Properties

Molecular Weight	358.18
ALogP	-0.7488
MLogP	3.22
XLogP	0.608
HDA	5
HBD	2
Rotatable Bonds	6
TPSA	91.67
RO5 Violation	0