NPASS drugs

Drug Information

Drug ID:	NPD3668
Drug Name:	dehydroepiandrosterone sulfate
Molecular Formula:	C19H28O5S
Canonical SMILES:	O=C1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC=C2[C@]1(C)CC[C@@H](C2)OS(=O)(=O)O
Standard InCHI:	"InChI=1S/C19H28O5S/c1-18-9-7-13(24-25(21,22)23)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h3,13-16H,4-11H2,1-2H3,(H,21,22,23)/t13-,14-,15-,16-,18-,19-/m0/s1"
Standard InCHIKey:	CZWCKYRVOZZJNM-USOAJAOKSA-N
Max Developmental Stage:	Pre-clinical
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD3668

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	90355
0.1-0.2	111632
0.2-0.3	8804
0.3-0.4	873
0.4-0.5	60
0.5-0.6	1
0.6-0.7	10
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC25833
Intermediate Similarity	0.7636	NPC328351
Intermediate Similarity	0.7636	NPC320867
Intermediate Similarity	0.7	NPC328633
Remote Similarity	0.6897	NPC323667
Remote Similarity	0.6452	NPC328192
Remote Similarity	0.6393	NPC132156
Remote Similarity	0.625	NPC329444
Remote Similarity	0.619	NPC549599
Remote Similarity	0.6034	NPC151519
Remote Similarity	0.6034	NPC510389
Remote Similarity	0.6034	NPC612036
Remote Similarity	0.6	NPC126642
Remote Similarity	0.6	NPC299962
Remote Similarity	0.5405	NPC170548

Drug Structure

NPD3668 OpenBabel08211703112D 26 29 0 0 1 0 0 0 0 0999 V2000 -3.4193 -0.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3362 -0.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9159 -2.6552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8883 -2.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8044 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2902 -1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4579 -0.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3738 -0.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4298 -0.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3462 -0.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4577 -1.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4296 -1.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9719 -0.9719 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3743 -1.8130 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3467 -1.8128 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8880 -0.9709 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8049 -0.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9156 -0.9710 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8325 -0.9712 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3050 -0.1051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9719 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 0.9719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9719 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.9719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1.4578 0.8417 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3 4 1 0 0 0 0 3 12 2 0 0 0 0 5 6 1 0 0 0 0 5 15 1 0 0 0 0 6 17 1 0 0 0 0 7 9 1 0 0 0 0 7 13 1 0 0 0 0 8 10 1 0 0 0 0 8 16 1 0 0 0 0 9 18 1 0 0 0 0 10 19 1 0 0 0 0 11 12 1 0 0 0 0 11 13 1 0 0 0 0 12 18 1 0 0 0 0 13 24 1 6 0 0 0 14 4 1 1 0 0 0 14 15 1 0 0 0 0 14 16 1 0 0 0 0 15 19 1 6 0 0 0 16 18 1 6 0 0 0 17 19 1 0 0 0 0 17 20 2 0 0 0 0 18 1 1 6 0 0 0 19 2 1 6 0 0 0 21 25 1 0 0 0 0 21 26 1 0 0 0 0 22 25 2 0 0 0 0 23 25 2 0 0 0 0 24 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB05804
ChEMBL	CHEMBL259898
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI	16814
CAS Number	651-48-9

Drug Properties

Molecular Weight	368.17
ALogP	0.1262
MLogP	2.89
XLogP	1.738
HDA	5
HBD	1
Rotatable Bonds	5
TPSA	89.05
RO5 Violation	0