37 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC9498
Formula: C48H76O19
Ingredient ID: NPC9498
| Common Name | n.a. |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,2R,4aS,6aR,6aS,6bR,8aR,9S,10R,11R,12aR,14bS)-9-formyl-10,11-dihydroxy-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]([C@H]4C4=CC[C@H]5[C@@]([C@@]4(CC3)C)(C)CC[C@@H]3[C@]5(C)C[C@H]([C@@H]([C@@]3(C)C=O)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H76O19/c1-20-10-13-48(15-14-46(6)23(29(48)21(20)2)8-9-28-44(4)16-24(51)39(60)45(5,19-50)27(44)11-12-47(28,46)7)43(61)67-42-36(58)33(55)31(53)26(65-42)18-62-40-37(59)34(56)38(25(17-49)64-40)66-41-35(57)32(54)30(52)22(3)63-41/h8,19-22,24-42,49,51-60H,9-18H2,1-7H3/t20-,21+,22+,24-,25-,26-,27-,28-,29+,30+,31-,32-,33+,34-,35-,36-,37-,38-,39+,40-,41+,42+,44+,45+,46-,47-,48+/m1/s1 |
| Standard InCHIKey | RHTRIPCUQWIJPM-FGWHUCSPSA-N |
| Ingredient External Links |
PubChem CID: 101675277 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD111709] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
 |
| Schefflera heptaphylla | Schefflera | Araliaceae |
 |
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
  |
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC90096
Formula: C48H78O19
Ingredient ID: NPC90096
| Common Name | n.a. |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,2R,4aS,6aR,6aS,6bR,8aR,9S,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]([C@H]4C4=CC[C@H]5[C@@]([C@@]4(CC3)C)(C)CC[C@@H]3[C@]5(C)C[C@H]([C@@H]([C@]3(C)CO)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H78O19/c1-20-10-13-48(15-14-46(6)23(29(48)21(20)2)8-9-28-44(4)16-24(51)39(60)45(5,19-50)27(44)11-12-47(28,46)7)43(61)67-42-36(58)33(55)31(53)26(65-42)18-62-40-37(59)34(56)38(25(17-49)64-40)66-41-35(57)32(54)30(52)22(3)63-41/h8,20-22,24-42,49-60H,9-19H2,1-7H3/t20-,21+,22+,24-,25-,26-,27-,28-,29+,30+,31-,32-,33+,34-,35-,36-,37-,38-,39+,40-,41+,42+,44+,45-,46-,47-,48+/m1/s1 |
| Standard InCHIKey | WYQVAPGDARQUBT-VELJHDPYSA-N |
| Ingredient External Links |
PubChem CID: 101675278 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD155096] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Centella asiatica | Centella | Apiaceae |
|
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Rubus rosa | Rubus | Rosaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Euonymus nanoides | Euonymus | Celastraceae | |
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Jacobaea subalpina | Jacobaea | Asteraceae |
Ingredient ID: NPC7645
Formula: C48H76O20
Ingredient ID: NPC7645
| Common Name | n.a. |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,8S,9R,11aS,11bR,12R,13aR,13bR)-3a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-9,12-dihydroxy-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]4[C@@H]4[C@](CC3)(C)[C@]3(C)CC[C@@H]5[C@]([C@H]3[C@@H](C4)O)(C)CC[C@H]([C@@]5(C)C(=O)O)O)C(=C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H76O20/c1-19(2)21-8-13-48(15-14-45(5)22(28(21)48)16-23(50)38-44(4)11-10-27(51)47(7,42(60)61)26(44)9-12-46(38,45)6)43(62)68-41-35(58)32(55)30(53)25(66-41)18-63-39-36(59)33(56)37(24(17-49)65-39)67-40-34(57)31(54)29(52)20(3)64-40/h20-41,49-59H,1,8-18H2,2-7H3,(H,60,61)/t20-,21-,22+,23+,24+,25+,26+,27+,28+,29-,30+,31+,32-,33+,34+,35+,36+,37+,38+,39+,40-,41-,44-,45+,46+,47-,48-/m0/s1 |
| Standard InCHIKey | JYJSDPJHFJZKFG-CRNRAUGNSA-N |
| Ingredient External Links |
PubChem CID: 101606374 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD4521] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC74418
Formula: C66H106O33
Ingredient ID: NPC74418
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,11R,12S,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]([C@H]4C4=CC[C@H]5[C@@]([C@@]4(CC3)C)(C)CC[C@@H]3[C@]5(C)CC[C@@H](C3(C)C)O[C@@H]3O[C@H](C(=O)O)[C@H]([C@@H]([C@H]3O[C@@H]3O[C@H](CO)[C@@H]([C@@H]([C@H]3O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)O)O)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C66H106O33/c1-23-11-16-66(61(87)99-58-48(83)41(76)38(73)30(93-58)22-88-55-49(84)45(80)50(29(21-69)92-55)95-56-46(81)39(74)35(70)25(3)89-56)18-17-64(7)26(34(66)24(23)2)9-10-32-63(6)14-13-33(62(4,5)31(63)12-15-65(32,64)8)94-60-53(44(79)43(78)51(96-60)54(85)86)98-59-52(42(77)37(72)28(20-68)91-59)97-57-47(82)40(75)36(71)27(19-67)90-57/h9,23-25,27-53,55-60,67-84H,10-22H2,1-8H3,(H,85,86)/t23-,24+,25+,27-,28-,29-,30-,31+,32-,33+,34+,35+,36-,37+,38-,39-,40+,41+,42+,43+,44+,45-,46-,47-,48-,49-,50-,51+,52-,53-,55-,56+,57+,58+,59+,60-,63+,64-,65-,66+/m1/s1 |
| Standard InCHIKey | NLIWGNYNSMLCGV-SDJYETCISA-N |
| Ingredient External Links |
PubChem CID: 101675599 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD11682] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC68464
Formula: C48H76O19
Ingredient ID: NPC68464
| Common Name | n.a. |
| IUPAC Name | (3R,4S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-3-hydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)CC[C@H]([C@@]5(C)C(=O)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H76O19/c1-21-29(51)31(53)34(56)39(63-21)66-37-24(19-49)64-38(36(58)33(37)55)62-20-25-30(52)32(54)35(57)40(65-25)67-42(61)48-16-14-43(2,3)18-23(48)22-8-9-26-44(4)12-11-28(50)47(7,41(59)60)27(44)10-13-46(26,6)45(22,5)15-17-48/h8,21,23-40,49-58H,9-20H2,1-7H3,(H,59,60)/t21-,23-,24+,25+,26+,27+,28+,29-,30+,31+,32-,33+,34+,35+,36+,37+,38+,39-,40-,44+,45+,46+,47-,48-/m0/s1 |
| Standard InCHIKey | LEXLFIULVWKBPT-ZOGDPUPDSA-N |
| Ingredient External Links |
PubChem CID: 101675598 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD127995] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC62307
Formula: C48H78O17
Ingredient ID: NPC62307
| Common Name | n.a. |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]4[C@@H]4[C@](CC3)(C)[C@]3(C)CC[C@@H]5[C@]([C@H]3CC4)(C)CC[C@H](C5(C)C)O)C(=C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H78O17/c1-21(2)23-11-16-48(18-17-46(7)24(30(23)48)9-10-28-45(6)14-13-29(50)44(4,5)27(45)12-15-47(28,46)8)43(59)65-42-37(57)34(54)32(52)26(63-42)20-60-40-38(58)35(55)39(25(19-49)62-40)64-41-36(56)33(53)31(51)22(3)61-41/h22-42,49-58H,1,9-20H2,2-8H3/t22-,23-,24+,25+,26+,27-,28+,29+,30+,31-,32+,33+,34-,35+,36+,37+,38+,39+,40+,41-,42-,45-,46+,47+,48-/m0/s1 |
| Standard InCHIKey | KRJGIYUSEZHRFC-UMWNHQQHSA-N |
| Ingredient External Links |
PubChem CID: 101606373 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD182428] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC57954
Formula: C30H46O6
Ingredient ID: NPC57954
| Common Name | n.a. |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,8S,9R,11aS,11bR,12R,13aR,13bR)-9,12-dihydroxy-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a,8-dicarboxylic acid |
| Canonical SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1C[C@@H](O)[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@H]([C@@]1(C)C(=O)O)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H46O6/c1-16(2)17-7-12-30(25(35)36)14-13-27(4)18(22(17)30)15-19(31)23-26(3)10-9-21(32)29(6,24(33)34)20(26)8-11-28(23,27)5/h17-23,31-32H,1,7-15H2,2-6H3,(H,33,34)(H,35,36)/t17-,18+,19+,20+,21+,22+,23+,26-,27+,28+,29-,30-/m0/s1 |
| Standard InCHIKey | VZYJGZZXVOHUMY-DPPLFAKZSA-N |
| Ingredient External Links |
PubChem CID: 14866192 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD196827] Database: NPASS [NPC57954] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC5290
Formula: C48H76O19
Ingredient ID: NPC5290
| Common Name | n.a. |
| IUPAC Name | (3R,4S,4aR,6aR,6bS,8aS,11R,12S,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-3-hydroxy-4,6a,6b,11,12,14b-hexamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-4-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]([C@H]4C4=CC[C@H]5[C@@]([C@@]4(CC3)C)(C)CC[C@@H]3[C@]5(C)CC[C@H]([C@@]3(C)C(=O)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H76O19/c1-20-10-15-48(17-16-45(5)23(29(48)21(20)2)8-9-26-44(4)13-12-28(50)47(7,42(59)60)27(44)11-14-46(26,45)6)43(61)67-41-36(57)33(54)31(52)25(65-41)19-62-39-37(58)34(55)38(24(18-49)64-39)66-40-35(56)32(53)30(51)22(3)63-40/h8,20-22,24-41,49-58H,9-19H2,1-7H3,(H,59,60)/t20-,21+,22+,24-,25-,26-,27-,28-,29+,30+,31-,32-,33+,34-,35-,36-,37-,38-,39-,40+,41+,44-,45-,46-,47+,48+/m1/s1 |
| Standard InCHIKey | JHJCKCJXKSJEBD-SEZZLRRHSA-N |
| Ingredient External Links |
PubChem CID: 101618891 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD16579] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC51700
Formula: C30H48O3
Ingredient ID: NPC51700
| Common Name | Ursolic Acid |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| Canonical SMILES | C[C@@H]1CC[C@]2([C@@H]([C@H]1C)C1=CC[C@H]3[C@@]([C@@]1(CC2)C)(C)CC[C@@H]1[C@]3(C)CC[C@@H](C1(C)C)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H48O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-24,31H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1 |
| Standard InCHIKey | WCGUUGGRBIKTOS-GPOJBZKASA-N |
| Ingredient External Links |
PubChem CID: 64945 ChEMBL ID: CHEMBL169 |
| Plant-Ingredient Association Reference |
PMID: 16441080 Database: NPASS [NPC51700] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Nerium oleander | Nerium | Apocynaceae |
|
| Euphorbia antiquorum | Euphorbia | Euphorbiaceae |
|
| Verbascum spinosum | Verbascum | Scrophulariaceae | |
| Rauvolfia tetraphylla | Rauvolfia | Apocynaceae |
|
| Prunus cerasoides | Prunus | Rosaceae |
|
| Arctium lappa | Arctium | Asteraceae |
|
| Cyathula tomentosa | Cyathula | Amaranthaceae |
|
| Artemisia hanseniana | Artemisia | Asteraceae | |
| Viburnum furcatum | Viburnum | Adoxaceae |
|
| Dipsacus asper | Dipsacus | Caprifoliaceae | |
| Glycyrrhiza squamulosa | Glycyrrhiza | Fabaceae |
|
| Euphorbia sancta | Euphorbia | Euphorbiaceae | |
| Moringa oleifera | Moringa | Moringaceae |
|
| Centella asiatica | Centella | Apiaceae |
|
| Isoplexis chalcantha | Isoplexis | Plantaginaceae | |
| Scapania aequiloba | Scapania | Scapaniaceae | |
| Exochorda giraldii | Exochorda | Rosaceae | |
| Sideritis lotsyi | Sideritis | Lamiaceae | |
| Styrax benzoin | Styrax | Styracaceae |
|
| Garcinia cantleyana | Garcinia | Clusiaceae | |
| Juniperus formosana | Juniperus | Cupressaceae |
|
| Benkara malabarica | Benkara | Rubiaceae |
|
| Tithonia rotundifolia | Tithonia | Asteraceae |
|
| Matricaria parthenium | Matricaria | Asteraceae | |
| Tulipa sylvestris | Tulipa | Liliaceae |
|
| Coussarea paniculata | Coussarea | Rubiaceae | |
| Centaurea cadmea | Centaurea | Asteraceae | |
| Senecio madagascariensis | Senecio | Asteraceae |
|
| Kopsia grandifolia | Kopsia | Apocynaceae | |
| Artemisia argentea | Artemisia | Asteraceae | |
| Elaeagnus commutata | Elaeagnus | Elaeagnaceae |
|
| Agrimonia eupatoria | Agrimonia | Rosaceae |
|
| Lithospermum erythrorhizon | Lithospermum | Boraginaceae |
|
| Asphodeline tenuior | Asphodeline | Asphodelaceae | |
| Adenopeltis colliguaya | Adenopeltis | Euphorbiaceae | |
| Glycyrrhiza triphylla | Glycyrrhiza | Fabaceae | |
| Ledebouria socialis | Ledebouria | Hyacinthaceae | |
| Crataegus pinnatifida | Crataegus | Rosaceae |
|
| Conyza canadensis | Conyza | Asteraceae |
|
| Ipomoea purpurea | Ipomoea | Convolvulaceae |
|
| Pulicaria wightiana | Pulicaria | Asteraceae |
|
| Amsinckia menziesii | Amsinckia | Boraginaceae | |
| Lycopus europaeus | Lycopus | Lamiaceae |
|
| Coreopsis fasciculata | Coreopsis | Asteraceae | |
| Quercus mongolica | Quercus | Fagaceae |
|
| Acicarpha tribuloides | Acicarpha | Calyceraceae | |
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Asarum heterotropoides | Asarum | Aristolochiaceae | |
| Brodiaea californica | Brodiaea | Asparagaceae | |
| Dipterocarpus dyeri | Dipterocarpus | Dipterocarpaceae | |
| Phedimus aizoon | Phedimus | Crassulaceae | |
| Cornus officinalis | Cornus | Cornaceae |
|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Lonicera korolkowii | Lonicera | Caprifoliaceae | |
| Perityle vaseyi | Perityle | Asteraceae | |
| Sideritis hirsuta | Sideritis | Lamiaceae | |
| Fritillaria cirrhosa | Fritillaria | Liliaceae |
|
| Glycine falcata | Glycine | Fabaceae | |
| Styrax tonkinensis | Styrax | Styracaceae |
|
| Rhododendron farrerae | Rhododendron | Ericaceae | |
| Allium stipitatum | Allium | Amaryllidaceae |
|
| Ipomoea cairica | Ipomoea | Convolvulaceae |
|
| Orobanche speciosa | Orobanche | Orobanchaceae | |
| Sindora wallichii | Sindora | Fabaceae |
|
| Veronica pectinata | Veronica | Plantaginaceae | |
| Hymenoxys microcephala | Hymenoxys | Asteraceae | |
| Vallaris heynei | Vallaris | Apocynaceae |
|
| Iris hoogiana | Iris | Iridaceae | |
| Spergula japonica | Spergula | Caryophyllaceae | |
| Pedicularis condensata | Pedicularis | Orobanchaceae | |
| Ulva lactuca | Ulva | Ulvaceae |
|
| Plantago lanceolata | Plantago | Plantaginaceae |
|
| Selinum carvifolium | Selinum | Apiaceae | |
| Palafoxia rosea | Palafoxia | Asteraceae | |
| Nitraria tangutorum | Nitraria | Nitrariaceae |
|
| Asphodeline damascena | Asphodeline | Asphodelaceae | |
| Ligustrum japonicus | Ligustrum | Oleaceae | |
| Pyrola japonica | Pyrola | Ericaceae |
|
| Chrozophora obliqua | Chrozophora | Euphorbiaceae |
|
| Zanthoxylum brachyacanthum | Zanthoxylum | Rutaceae |
|
| Metanarthecium luteoviride | Metanarthecium | Nartheciaceae | |
| Populus yunnanensis | Populus | Salicaceae | |
| Dolichandrone crispa | Dolichandrone | Bignoniaceae |
|
| Acrostichum aureum | Acrostichum | Pteridaceae |
|
| Ceanothus velutinus | Ceanothus | Rhamnaceae |
|
| Polygala amarella | Polygala | Polygalaceae |
|
| Mentha canadensis | Mentha | Lamiaceae |
|
| Senecio flavus | Senecio | Asteraceae |
|
| Gnaphalium oligandrum | Gnaphalium | Asteraceae | |
| Ficus mucuso | Ficus | Moraceae |
|
| Fraxinus ornus | Fraxinus | Oleaceae |
|
| Plantago alpina | Plantago | Plantaginaceae | |
| Garcinia scortechinii | Garcinia | Clusiaceae | |
| Uncaria macrophylla | Uncaria | Rubiaceae |
|
| Dacryodes normandii | Dacryodes | Burseraceae | |
| Salvia coulteri | Salvia | Lamiaceae | |
| Cryptotaenia japonica | Cryptotaenia | Apiaceae |
|
| Apollonias barbujana | Apollonias | Lauraceae | |
| Kadsura interior | Kadsura | Schisandraceae |
|
| Uncaria rhynchophylla | Uncaria | Rubiaceae |
|
| Centaurea aspera | Centaurea | Asteraceae | |
| Chlorophytum borivilianum | Chlorophytum | Asparagaceae |
|
| Campsis radicans | Campsis | Bignoniaceae |
|
| Riccia fluitans | Riccia | Ricciaceae | |
| Schefflera divaricata | Schefflera | Araliaceae | |
| Melaleuca uncinata | Melaleuca | Myrtaceae | |
| Salvia palaestina | Salvia | Lamiaceae | |
| Bothriocline longipes | Bothriocline | Asteraceae |
|
| Ficus sarmentosa var. thunbergii | Ficus | Moraceae |
|
| Tecoma heptaphylla | Tecoma | Bignoniaceae | |
| Scabiosa comosa | Scabiosa | Caprifoliaceae |
|
| Ixeris denticulata | Ixeris | Asteraceae |
|
| Hakea saligna | Hakea | Proteaceae | |
| Mnium hornum | Mnium | Mniaceae | |
| Plectranthus lanuginosus | Plectranthus | Lamiaceae |
|
| Porella swartziana | Porella | Porellaceae | |
| Kopsia longiflora | Kopsia | Apocynaceae |
|
| Saussurea cordifolia | Saussurea | Asteraceae | |
| Stevia salicifolia | Stevia | Asteraceae | |
| Trollius chinensis | Trollius | Ranunculaceae |
|
| Cytisus austriacus | Cytisus | Fabaceae | |
| Mollinedia costaricensis | Mollinedia | Monimiaceae | |
| Lepidophorum repandum | Lepidophorum | Asteraceae | |
| Scrophularia nodosa | Scrophularia | Scrophulariaceae |
|
| Echinops niveus | Echinops | Asteraceae | |
| Asparagus africanus | Asparagus | Asparagaceae |
|
| Meconopsis napaulensis | Meconopsis | Papaveraceae |
|
| Cissus quinquefolia | Cissus | Vitaceae | |
| Alstonia pittieri | Alstonia | Apocynaceae | |
| Angiopteris evecta | Angiopteris | Marattiaceae |
|
| Rheum webbianum | Rheum | Polygonaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Mascarenhasia arborescens | Mascarenhasia | Apocynaceae | |
| Phyllosma capensis | Phyllosma | Rutaceae | |
| Achillea lycaonica | Achillea | Asteraceae | |
| Eucalyptus flocktoniae | Eucalyptus | Myrtaceae | |
| Proustia ilicifolia | Proustia | Asteraceae | |
| Vitex rotundifolia | Vitex | Lamiaceae |
|
| Oldenlandia diffusa | Oldenlandia | Rubiaceae |
|
| Albizia gummifera | Albizia | Fabaceae |
|
| Kummerowia striata | Kummerowia | Fabaceae |
|
| Corymbia citriodora | Corymbia | Myrtaceae |
|
| Tripodanthus acutifolius | Tripodanthus | Loranthaceae |
|
| Thymbra spicata | Thymbra | Lamiaceae |
|
| Rhododendron campylocarpum | Rhododendron | Ericaceae | |
| Maytenus buxifolia | Maytenus | Celastraceae | |
| Glycyrrhiza | Glycyrrhiza | Fabaceae |
|
| Onobrychis bobrovii | Onobrychis | Fabaceae | |
| Phoebe formosana | Phoebe | Lauraceae | |
| Sida cordifolia | Sida | Malvaceae |
|
| Blainvillea rhomboidea | Blainvillea | Asteraceae | |
| Berberis brandisiana | Berberis | Berberidaceae | |
| Centaurea musimomum | Centaurea | Asteraceae | |
| Croton rhamnifolius | Croton | Euphorbiaceae | |
| Penstemon newberryi | Penstemon | Plantaginaceae | |
| Senecio chinensis | Senecio | Asteraceae | |
| Stephania aculeata | Stephania | Menispermaceae | |
| Acacia glaucescens | Acacia | Fabaceae | |
| Pterocaulon rugosum | Pterocaulon | Asteraceae | |
| Clematis terniflora var. mandshurica | Clematis | Ranunculaceae |
|
| Thuja plicata | Thuja | Cupressaceae |
|
| Millettia conraui | Millettia | Fabaceae |
|
| Centaurea seridis | Centaurea | Asteraceae | |
| Rubia yunnanensis | Rubia | Rubiaceae |
|
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Flindersia brayleyana | Flindersia | Rutaceae | |
| Agave utahensis | Agave | Asparagaceae |
|
| Isodon lophanthoides | Isodon | Lamiaceae |
|
| Satureja cuneifolia | Satureja | Lamiaceae |
|
| Knoxia valerianoides | Knoxia | Rubiaceae |
|
| Thermopsis lanceolata | Thermopsis | Fabaceae |
|
| Euodia bodinieri | Euodia | Rutaceae | |
| Consolida ajacis | Consolida | Ranunculaceae |
|
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Chisocheton siamensis | Chisocheton | Meliaceae |
|
| Ipomoea nil | Ipomoea | Convolvulaceae |
|
| Lonicera macranthoides | Lonicera | Caprifoliaceae |
|
| Melaleuca genistifolia | Melaleuca | Myrtaceae | |
| Radermachera boniana | Radermachera | Bignoniaceae | |
| Prunella vulgaris | Prunella | Lamiaceae |
|
| Hymenaea courbaril | Hymenaea | Fabaceae |
|
| Toddalia aculeata | Toddalia | Rutaceae |
|
| Corydalis claviculata | Corydalis | Papaveraceae |
|
| Avrainvillea nigricans | Avrainvillea | Udoteaceae | |
| Hedyotis diffusae herba | Hedyotis | Rubiaceae | |
| Fragaria vesca | Fragaria | Rosaceae |
|
| Styrax japonicus | Styrax | Styracaceae |
|
| Agrimonia pilosa | Agrimonia | Rosaceae |
|
| Geranium nepalense | Geranium | Geraniaceae |
|
| Mosla chinensis | Mosla | Lamiaceae |
|
| Liquidambar formosana | Liquidambar | Altingiaceae |
|
| Centaurea horrida | Centaurea | Asteraceae | |
| Kopsia albiflora | Kopsia | Apocynaceae | |
| Rhododendron ferrugineum | Rhododendron | Ericaceae |
|
| Uvaria kirkii | Uvaria | Annonaceae |
|
| Diospyros kaki | Diospyros | Ebenaceae |
|
| Ligustrum lucidum | Ligustrum | Oleaceae |
|
| Pteris fauriei | Pteris | Pteridaceae |
|
| Ligularia dentata | Ligularia | Asteraceae |
|
| Drypetes roxburghii | Drypetes | Putranjivaceae |
|
| Pteris aquilina | Pteris | Pteridaceae |
|
| Schizonepeta tenuisfolia | Schizonepeta | Lamiaceae | |
| Eria robusta | Eria | Orchidaceae | |
| Rubus coreanus | Rubus | Rosaceae |
|
| Phlegmariurus fordii | Phlegmariurus | Lycopodiaceae |
|
| Podolepis longipedata | Podolepis | Asteraceae | |
| Centaurea arbutifolia | Centaurea | Asteraceae | |
| Strychnos vanprukii | Strychnos | Loganiaceae | |
| Catananche caerulea | Catananche | Asteraceae | |
| Buddleja variabilis | Buddleja | Scrophulariaceae | |
| Amaranthus hybr | Amaranthus | Amaranthaceae |
|
| Empetrum nigrum | Empetrum | Ericaceae |
|
| Euphorbia franckiana | Euphorbia | Euphorbiaceae | |
| Agrostis epigeios | Agrostis | Poaceae | |
| Ormosia flava | Ormosia | Fabaceae | |
| Salvia prionitis | Salvia | Lamiaceae |
|
| Senecio zoellneri | Senecio | Asteraceae | |
| Garcinia conrauana | Garcinia | Clusiaceae |
|
| Ficus nervosa | Ficus | Moraceae |
|
| Solanum chilense | Solanum | Solanaceae | |
| Senecio scandens | Senecio | Asteraceae |
|
| Pluchea lanceolata | Pluchea | Asteraceae |
|
| Pyracantha coccinea | Pyracantha | Rosaceae |
|
| Forsythia viridissima | Forsythia | Oleaceae |
|
| Crotalaria novae-hollandiae | Crotalaria | Fabaceae | |
| Crepis foetida | Crepis | Asteraceae |
|
| Jateorhiza palmata | Jateorhiza | Menispermaceae |
|
| Tetradium ruticarpum | Tetradium | Rutaceae |
|
| Stephania sasakii | Stephania | Menispermaceae |
|
| Murdannia triquetra | Murdannia | Commelinaceae |
|
| Uncaria gambier | Uncaria | Rubiaceae |
|
| Vallaris solanacea | Vallaris | Apocynaceae |
|
| Cirsium japonicum | Cirsium | Asteraceae |
|
| Ephedra lomatolepis | Ephedra | Ephedraceae | |
| Decaisnea fargesii | Decaisnea | Lardizabalaceae |
|
| Ilex cornuta | Ilex | Aquifoliaceae |
|
| Scutellaria seleriana | Scutellaria | Lamiaceae | |
| Erythrina sacleuxii | Erythrina | Fabaceae | |
| Dorstenia lindeniana | Dorstenia | Moraceae | |
| Campsis grandiflora | Campsis | Bignoniaceae |
|
| Dioscoreophyllum cumminsii | Dioscoreophyllum | Menispermaceae |
|
| Daphne aurantiaca | Daphne | Thymelaeaceae | |
| Mentha pulegiformis | Mentha | Lamiaceae | |
| Tanacetum balsamitoides | Tanacetum | Asteraceae | |
| Hypolepis punctata | Hypolepis | Dennstaedtiaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Lasianthus fordii | Lasianthus | Rubiaceae | |
| Hydrocotyle ranunculoides | Hydrocotyle | Araliaceae |
|
| Salvia nubicola | Salvia | Lamiaceae |
|
| Piper acutifolium | Piper | Piperaceae |
|
| Mucuna urens | Mucuna | Fabaceae |
|
| Phytolacca acinosa | Phytolacca | Phytolaccaceae |
|
| Grindelia nana | Grindelia | Asteraceae | |
| Garcinia hombroniana | Garcinia | Clusiaceae |
|
| Achyranthes aspera | Achyranthes | Amaranthaceae |
|
| Artemisia pedemontana | Artemisia | Asteraceae | |
| Patrinia scabiosifolia | Patrinia | Caprifoliaceae |
|
| Haloxylon salicornicum | Haloxylon | Chenopodiaceae |
|
| Picradeniopsis oppositifolia | Picradeniopsis | Asteraceae | |
| Phlomis nissolii | Phlomis | Lamiaceae | |
| Dracocephalum moldavica | Dracocephalum | Lamiaceae |
|
| Cardiospermum halicacabum | Cardiospermum | Sapindaceae |
|
| Aglaia elaeagnoidea | Aglaia | Meliaceae |
|
| Eucalyptus rubida | Eucalyptus | Myrtaceae |
|
| Leucanthemum maximum | Leucanthemum | Asteraceae | |
| Morus macroura | Morus | Moraceae |
|
| Lonicera hypoglauca | Lonicera | Caprifoliaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Vitex trifolia | Vitex | Lamiaceae |
|
| Tetraria capillaris | Tetraria | Cyperaceae | |
| Forsythia suspensa | Forsythia | Oleaceae |
|
| Microglossa zeylanica | Microglossa | Asteraceae | |
| Urtica triangularis | Urtica | Urticaceae |
|
| Calea megacephala | Calea | Asteraceae | |
| Astilbe myriantha | Astilbe | Saxifragaceae | |
| Maytenus guianensis | Maytenus | Celastraceae | |
| Bidens tripartita | Bidens | Asteraceae |
|
| Saussurea triangulata | Saussurea | Asteraceae | |
| Pouzolzia occidentalis | Pouzolzia | Urticaceae | |
| Abies nobilis | Abies | Pinaceae | |
| Phleum africanum | Phleum | Poaceae | |
| Sesbania grandiflora | Sesbania | Fabaceae |
|
| Eucalyptus kitsoni | Eucalyptus | Myrtaceae | |
| Lindera umbellata | Lindera | Lauraceae |
|
| Lycopus lucidus | Lycopus | Lamiaceae |
|
| Centaurea nigrescens | Centaurea | Asteraceae |
|
| Persea indica | Persea | Lauraceae |
|
| Stephania succifera | Stephania | Menispermaceae |
|
| Persicaria filiformis | Persicaria | Polygonaceae | |
| Hypericum japonicum | Hypericum | Hypericaceae |
|
| Astragalus asper | Astragalus | Fabaceae | |
| Corydalis cornuta | Corydalis | Papaveraceae | |
| Orthocaulis attenuatus | Orthocaulis | Anastrophyllaceae | |
| Clausena indica | Clausena | Rutaceae |
|
| Gentiana olivieri | Gentiana | Gentianaceae |
|
| Himantoglossum hircinum | Himantoglossum | Orchidaceae | |
| Piper arboreum | Piper | Piperaceae |
|
| Disepalum plagioneurum | Disepalum | Annonaceae | |
| Vernonia serratuloides | Vernonia | Asteraceae | |
| Genista sessilifolia | Genista | Fabaceae | |
| Daphne lancifolia | Daphne | Thymelaeaceae | |
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Aframomum sulcatum | Aframomum | Zingiberaceae |
|
| Piper aequale | Piper | Piperaceae |
|
| Helichrysum candolleanum | Helichrysum | Asteraceae |
|
| Rhizophora mangle | Rhizophora | Rhizophoraceae |
|
| Alkanna hirsutissima | Alkanna | Boraginaceae | |
| Parastrephia lepidophylla | Parastrephia | Asteraceae | |
| Raphanus raphanistrum | Raphanus | Brassicaceae |
|
| Phlogacanthus thyrsiflorus | Phlogacanthus | Acanthaceae |
|
| Pinus picea | Pinus | Pinaceae | |
| Euphorbia segetalis | Euphorbia | Euphorbiaceae | |
| Ardisia macrocarpa | Ardisia | Primulaceae |
|
| Microtropis japonica | Microtropis | Celastraceae | |
| Sideritis romana | Sideritis | Lamiaceae | |
| Eurya japonica | Eurya | Pentaphylacaceae |
|
| Sidastrum acuminatum | Sidastrum | Malvaceae | |
| Picris radicata | Picris | Asteraceae | |
| Corydalis sewerzowi | Corydalis | Papaveraceae |
|
| Chlorophytum malayense | Chlorophytum | Asparagaceae |
|
| Kippistia suaedifolia | Kippistia | Asteraceae | |
| Bombax ceiba | Bombax | Malvaceae |
|
| Syncolostemon parviflorus | Syncolostemon | Lamiaceae | |
| Gnetum cleistostachyum | Gnetum | Gnetaceae | |
| Aristolochia elegans | Aristolochia | Aristolochiaceae | |
| Trapa bicornis | Trapa | Lythraceae |
|
| Clematis tangutica | Clematis | Ranunculaceae |
|
| Calea cuneifolia | Calea | Asteraceae | |
| Penstemon secundiflorus | Penstemon | Plantaginaceae | |
| Phebalium bilobum | Phebalium | Rutaceae | |
| Echinops setifer | Echinops | Asteraceae |
|
| Acrocomia sclerocarpa | Acrocomia | Arecaceae | |
| Pinus thunbergii | Pinus | Pinaceae |
|
| Neopringlea integrifolia | Neopringlea | Salicaceae | |
| Picradeniopsis pringlei | Picradeniopsis | Asteraceae | |
| Eremophila serrulata | Eremophila | Scrophulariaceae | |
| Cuphea carthagenensis | Cuphea | Lythraceae | |
| Teucrium alyssifolium | Teucrium | Lamiaceae | |
| Rodgersia podophylla | Rodgersia | Saxifragaceae |
|
| Ozoroa insignis | Ozoroa | Anacardiaceae |
|
| Actinidia chinensis planch | Actinidia | Actinidiaceae | |
| Orthosiphon stamineus | Orthosiphon | Lamiaceae |
|
| Delphinium campylocentrum | Delphinium | Ranunculaceae | |
| Senecio grandiflorus | Senecio | Asteraceae | |
| Ruta microcarpa | Ruta | Rutaceae |
|
| Cordyline indivisa | Cordyline | Asparagaceae |
|
| Zephyranthes carinata | Zephyranthes | Amaryllidaceae |
|
| Crinum defixum | Crinum | Amaryllidaceae |
|
| Primula hirsuta | Primula | Primulaceae | |
| Cacalia robusta | Cacalia | Asteraceae | |
| Angelica ursina | Angelica | Apiaceae |
|
| Jasminum grandiflorum | Jasminum | Oleaceae |
|
| Pinus halepensis | Pinus | Pinaceae |
|
| Xyris indica | Xyris | Xyridaceae |
|
| Viscum coloratum | Viscum | Viscaceae |
|
| Satureja montana | Satureja | Lamiaceae |
|
| Leptosyne bigelovii | Leptosyne | Asteraceae | |
| Mentha arvensis | Mentha | Lamiaceae |
|
| Heracleum sphondylium | Heracleum | Apiaceae |
|
| Dioscorea althaeoides | Dioscorea | Dioscoreaceae |
|
| Aconitum palmatum | Aconitum | Ranunculaceae |
|
| Micranthemum umbrosum | Micranthemum | Plantaginaceae | |
| Hertia intermedia | Hertia | Asteraceae | |
| Cytisus scoparius | Cytisus | Fabaceae |
|
| Schisandra sphaerandra | Schisandra | Schisandraceae |
|
| Onoseris alata | Onoseris | Asteraceae | |
| Carpesium faberi | Carpesium | Asteraceae | |
| Bituminaria bituminosa | Bituminaria | Fabaceae |
|
| Vellozia streptophylla | Vellozia | Velloziaceae | |
| Aconitum brevicalcaratum | Aconitum | Ranunculaceae | |
| Aconitum tianschanicum | Aconitum | Ranunculaceae | |
| Diospyros buxifolia | Diospyros | Ebenaceae |
|
| Solanum diflorum | Solanum | Solanaceae | |
| Gardneria insularis | Gardneria | Loganiaceae | |
| Staehelina fruticosa | Staehelina | Asteraceae | |
| Litsea zeylanica | Litsea | Lauraceae |
|
| Gomphostemma parviflorum | Gomphostemma | Lamiaceae | |
| Chlamydomonas allensworthii | Chlamydomonas | Chlamydomonadaceae | |
| Swertia angustifolia | Swertia | Gentianaceae |
|
| Scilla maritima | Scilla | Hyacinthaceae |
|
| Hippobroma longiflora | Hippobroma | Campanulaceae | |
| Psilotum nudum | Psilotum | Psilotaceae |
|
| Zanthoxylum monophyllum | Zanthoxylum | Rutaceae | |
| Osteophloeum platyspermum | Osteophloeum | Myristicaceae | |
| Pelargonium reniforme | Pelargonium | Geraniaceae |
|
| Codonopsis cordifolioidea | Codonopsis | Campanulaceae |
|
| Glycyrrhiza lepidota | Glycyrrhiza | Fabaceae |
|
| Ariocarpus fissuratus | Ariocarpus | Cactaceae |
|
| Artemisia tournefortiana | Artemisia | Asteraceae | |
| Centaurea hololeuca | Centaurea | Asteraceae | |
| Haplopappus ciliatus | Haplopappus | Asteraceae | |
| Rumex dentatus | Rumex | Polygonaceae |
|
| Stevia origanoides | Stevia | Asteraceae | |
| Toxicodendron succedaneum | Toxicodendron | Anacardiaceae |
|
| Lonicera fulvotomentosa | Lonicera | Caprifoliaceae |
|
| Trifolium strepens | Trifolium | Fabaceae | |
| Crinum kirkii | Crinum | Amaryllidaceae |
|
| Magnolia sprengeri | Magnolia | Magnoliaceae |
|
| Peperomia heyneana | Peperomia | Piperaceae | |
| Castanopsis cuspidata | Castanopsis | Fagaceae |
|
| Aulacomnium androgynum | Aulacomnium | Aulacomniaceae |
|
| Beaumontia brevituba | Beaumontia | Apocynaceae | |
| Valeriana fedtschenkoi | Valeriana | Caprifoliaceae | |
| Putterlickia verrucosa | Putterlickia | Celastraceae | |
| Garcinia cowa | Garcinia | Clusiaceae |
|
| Solanum pseudopersicum | Solanum | Solanaceae | |
| Blitum virgatum | Blitum | Chenopodiaceae | |
| Cosmos pringlei | Cosmos | Asteraceae | |
| Symplocos lancifolia | Symplocos | Symplocaceae | |
| Eriobotrya japonica | Eriobotrya | Rosaceae |
|
| Taraxacum bicorne | Taraxacum | Asteraceae | |
| Albertisia papuana | Albertisia | Menispermaceae |
|
| Hyptis brevipes | Hyptis | Lamiaceae |
|
| Cirsium wallichii | Cirsium | Asteraceae |
|
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Cordia curassavica | Cordia | Cordiaceae |
|
| Tanacetum praeteritum | Tanacetum | Asteraceae | |
| Erysimum odoratum | Erysimum | Brassicaceae | |
| Heterotheca inuloides | Heterotheca | Asteraceae |
|
| Buddleja scordioides | Buddleja | Scrophulariaceae | |
| Delphinium andersoni | Delphinium | Ranunculaceae | |
| Lafoensia glyptocarpa | Lafoensia | Lythraceae | |
| Vaccinium vitis-idaea | Vaccinium | Ericaceae |
|
| Vismia jefensis | Vismia | Hypericaceae | |
| Heliotropium glutinosum | Heliotropium | Heliotropiaceae | |
| Dalbergia stipulacea | Dalbergia | Fabaceae |
|
| Angelica tarokoensis | Angelica | Apiaceae | |
| Osmitopsis osmitoides | Osmitopsis | Asteraceae | |
| Swertia delavayi | Swertia | Gentianaceae | |
| Aconitum campylorrhynchum | Aconitum | Ranunculaceae |
|
| Epimedium davidii | Epimedium | Berberidaceae |
|
| Globba malaccensis | Globba | Zingiberaceae |
|
| Scabiosa pyrenaica | Scabiosa | Caprifoliaceae | |
| Diphasia angolensis | Diphasia | Rutaceae | |
| Knightia excelsa | Knightia | Proteaceae |
|
| Fagus crenata | Fagus | Fagaceae |
|
| Isodon japonicus | Isodon | Lamiaceae |
|
| Viburnum ayavacense | Viburnum | Adoxaceae | |
| Solanum acaule | Solanum | Solanaceae | |
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Narcissus triandrus | Narcissus | Amaryllidaceae |
|
| Frullania tamarisci | Frullania | Frullaniaceae | |
| Iryanthera juruensis | Iryanthera | Myristicaceae |
|
| Alangium premnifolium | Alangium | Cornaceae | |
| Sigesbeckia pubescens | Sigesbeckia | Asteraceae | |
| Saussurea carthamoides | Saussurea | Asteraceae | |
| Rubus chingii | Rubus | Rosaceae |
|
| Portulaca pilosa | Portulaca | Portulacaceae |
|
| Galenia africana | Galenia | Aizoaceae |
|
| Micromeria pineolens | Micromeria | Lamiaceae | |
| Artemisia umbelliformis | Artemisia | Asteraceae |
|
| Astragalus pamirensis | Astragalus | Fabaceae | |
| Gnidia lamprantha | Gnidia | Thymelaeaceae |
|
| Croton steenkampianus | Croton | Euphorbiaceae | |
| Ilex amara | Ilex | Aquifoliaceae | |
| Casimiroa tetrameria | Casimiroa | Rutaceae |
|
| Acacia lasiopetala | Acacia | Fabaceae | |
| Leonurus glaucescens | Leonurus | Lamiaceae |
|
| Barbarea verna | Barbarea | Brassicaceae |
|
| Wulfenia orientalis | Wulfenia | Plantaginaceae | |
| Salacia madagascariensis | Salacia | Celastraceae |
|
| Maba buxifolia | Maba | Ebenaceae |
|
| Gentiana dahurica | Gentiana | Gentianaceae |
|
| Valeriana hardwickii | Valeriana | Caprifoliaceae |
|
| Cynomorium songaricum | Cynomorium | Cynomoriaceae |
|
| Petteria ramentacea | Petteria | Fabaceae | |
| Monochaetum vulcanicum | Monochaetum | Melastomataceae | |
| Coleus coerulescens | Coleus | Lamiaceae | |
| Euphrasia rubra | Euphrasia | Orobanchaceae | |
| Vatica cinerea | Vatica | Dipterocarpaceae | |
| Prosopis spicigera | Prosopis | Fabaceae |
|
| Citrus maxima | Citrus | Rutaceae |
|
| Mandragora officinarum | Mandragora | Solanaceae |
|
| Drymaria cordata | Drymaria | Caryophyllaceae |
|
| Ribes sanguineum | Ribes | Grossulariaceae |
|
| Hypericum triquetrifolium | Hypericum | Hypericaceae |
|
| Caralluma stalagmifera | Caralluma | Apocynaceae | |
| Cirsium brevistylum | Cirsium | Asteraceae |
|
| Ageratina tomentella | Ageratina | Asteraceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Acer triflorum | Acer | Sapindaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Anisopappus pinnatifidus | Anisopappus | Asteraceae | |
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Metzgeria pubescens | Metzgeria | Metzgeriaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Notholaena lemmonii | Notholaena | Pteridaceae | |
| Rubus rosa | Rubus | Rosaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Rubus xanthocarpus | Rubus | Rosaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Verbena officinalis | Verbena | Verbenaceae |
|
| Euonymus nanoides | Euonymus | Celastraceae | |
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Isodon rubescens | Isodon | Lamiaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Rhaponticum uniflorum | Rhaponticum | Asteraceae |
|
| Astragalus gummifer | Astragalus | Fabaceae |
|
| Sigesbeckia glabrescens | Sigesbeckia | Asteraceae |
|
| Quercus sessiliflora | Quercus | Fagaceae | |
| Aglaia elliptica | Aglaia | Meliaceae |
|
| Ficus cordata subsp. salicifolia | Ficus | Moraceae |
|
| Rhodanthe maryonii | Rhodanthe | Asteraceae | |
| Uncaria sinensis | Uncaria | Rubiaceae |
|
| Triglochin maritima | Triglochin | Juncaginaceae |
|
| Samadera indica | Samadera | Simaroubaceae |
|
| Hippophae fructus | Hippophae | Elaeagnaceae | |
| Rhododendron formosanum | Rhododendron | Ericaceae | |
| Aralia continentalis | Aralia | Araliaceae |
|
| Geum japonicum | Geum | Rosaceae |
|
| Rhododendron brachycarpum | Rhododendron | Ericaceae |
|
| Ammodendron conollyi | Ammodendron | Fabaceae | |
| Echinops kebericho | Echinops | Asteraceae |
|
| Salix alba | Salix | Salicaceae |
|
| Eriostemon brucei | Eriostemon | Rutaceae | |
| Jungermannia obovata | Jungermannia | Jungermanniaceae | |
| Aconitum leucostomum | Aconitum | Ranunculaceae |
|
| Plantago asiatica | Plantago | Plantaginaceae |
|
| Cirsium dipsacolepis | Cirsium | Asteraceae |
|
| Euonymus maackii | Euonymus | Celastraceae | |
| Potentilla chinensis | Potentilla | Rosaceae |
|
| Mesembryanthemum anatomicum | Mesembryanthemum | Aizoaceae |
|
| Montanoa guatemalensis | Montanoa | Asteraceae | |
| Salix japonica | Salix | Salicaceae |
|
| Trichilia claussenii | Trichilia | Meliaceae | |
| Chaenomeles speciosa | Chaenomeles | Rosaceae |
|
| Senecio sinuatus | Senecio | Asteraceae | |
| Medinilla magnifica | Medinilla | Melastomataceae |
|
| Malva sylvestris | Malva | Malvaceae |
|
| Senecio variabilis | Senecio | Asteraceae | |
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Aquilegia ecalcarata | Aquilegia | Ranunculaceae |
|
| Flemingia philippinensis | Flemingia | Fabaceae |
|
| Lonchocarpus orotinus | Lonchocarpus | Fabaceae | |
| Hedysarum multijugum | Hedysarum | Fabaceae |
|
| Echinopsis latifolius | Echinopsis | Cactaceae | |
| Drimia sanguinea | Drimia | Hyacinthaceae |
|
| Viguiera annua | Viguiera | Asteraceae | |
| Dendrobium thyrsiflorum | Dendrobium | Orchidaceae |
|
| Morinda citrifolia | Morinda | Rubiaceae |
|
| Aconitum zuccarini | Aconitum | Ranunculaceae | |
| Laggera alata | Laggera | Asteraceae |
|
| Fritillaria thunbergii | Fritillaria | Liliaceae |
|
| Lonicera confusa | Lonicera | Caprifoliaceae |
|
| Calypogeia integristipula | Calypogeia | Calypogeiaceae | |
| Onopordum anatolicum | Onopordum | Asteraceae |
|
| Pteris pacifica | Pteris | Pteridaceae | |
| Persea mexicana | Persea | Lauraceae | |
| Yucca flexilis | Yucca | Asparagaceae | |
| Adiantum caudatum | Adiantum | Pteridaceae |
|
| Colchicum speciosum | Colchicum | Colchicaceae | |
| Helipterum gnaphaloides | Helipterum | Asteraceae | |
| Plectranthus sylvestris | Plectranthus | Lamiaceae |
|
| Euodia officinalis | Euodia | Rutaceae | |
| Daemonorops draco | Daemonorops | Arecaceae |
|
| Derris uliginosa | Derris | Fabaceae |
|
| Turraeanthus mannii | Turraeanthus | Meliaceae | |
| Myristica malabarica | Myristica | Myristicaceae |
|
| Laburnum watereri | Laburnum | Fabaceae | |
| Myristica fragrans | Myristica | Myristicaceae |
|
| Strychnos ligustrina | Strychnos | Loganiaceae |
|
| Coleus garckeanus | Coleus | Lamiaceae | |
| Phebalium whitei | Phebalium | Rutaceae | |
| Bryum weigelii | Bryum | Bryaceae | |
| Campsis flos | Campsis | Bignoniaceae | |
| Stachys chinensis | Stachys | Lamiaceae |
|
| Lepidium draba | Lepidium | Brassicaceae |
|
| Papaver persicum | Papaver | Papaveraceae |
|
| Solanum sisymbriifolium | Solanum | Solanaceae |
|
| Gerbera piloselloides | Gerbera | Asteraceae |
|
| Rumex nepalensis | Rumex | Polygonaceae |
|
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Aniba rosaeodora | Aniba | Lauraceae |
|
| Walsura chrysogyne | Walsura | Meliaceae | |
| Desmodium oxyphyllum | Desmodium | Fabaceae | |
| Morus yunnanensis | Morus | Moraceae | |
| Drimia fugax | Drimia | Hyacinthaceae | |
| Garrya laurifolia | Garrya | Garryaceae | |
| Phegopteris bukoensis | Phegopteris | Thelypteridaceae | |
| Coprosma australis | Coprosma | Rubiaceae |
|
| Eria subsessilis | Eria | Orchidaceae | |
| Rosa agrestis | Rosa | Rosaceae | |
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Spartium junceum | Spartium | Fabaceae |
|
| Vitis betulifolia | Vitis | Vitaceae |
|
| Dahlstedtia araripensis | Dahlstedtia | Fabaceae | |
| Vaccinium oxycoccos | Vaccinium | Ericaceae |
|
| Sequoia sempervirens | Sequoia | Cupressaceae |
|
| Solanum giganteum | Solanum | Solanaceae |
|
| Chamaecyparis pisifera | Chamaecyparis | Cupressaceae |
|
| Agathosma thymifolia | Agathosma | Rutaceae | |
| Jacobaea subalpina | Jacobaea | Asteraceae | |
| Cocculus diversifolius | Cocculus | Menispermaceae | |
| Dendrobium crepidatum | Dendrobium | Orchidaceae | |
| Mulguraea tridens | Junellia | Verbenaceae | |
| Phedimus kamtschaticus | Phedimus | Crassulaceae |
|
| Artemisia bigelovii | Artemisia | Asteraceae | |
| Betula davurica | Betula | Betulaceae | |
| Phlomis regelii | Phlomis | Lamiaceae | |
| Humulus scandens | Humulus | Cannabaceae |
|
| Vernonia condensata | Vernonia | Asteraceae | |
| Juglans sinensis | Juglans | Juglandaceae |
|
| Myrica multiflora | Myrica | Myricaceae |
|
| Licania pittieri | Licania | Chrysobalanaceae | |
| Pseudostellaria heterophylla | Pseudostellaria | Caryophyllaceae |
|
| Trifolium apertum | Trifolium | Fabaceae | |
| Sutherlandia frutescens | Sutherlandia | Fabaceae | |
| Mesua ferrea | Mesua | Calophyllaceae |
|
| Ixora coccinea | Ixora | Rubiaceae |
|
| Dalea purpurea | Dalea | Fabaceae |
|
| Cistanche tubulosa | Cistanche | Orobanchaceae |
|
| Solanum racemigerum | Solanum | Solanaceae | |
| Baillonella toxisperma | Baillonella | Sapotaceae |
|
| Anthocleista procera | Anthocleista | Gentianaceae | |
| Gardenia tubifera | Gardenia | Rubiaceae |
|
| Zaluzianskya capensis | Zaluzianskya | Scrophulariaceae | |
| Smilax glabra | Smilax | Smilacaceae |
|
| Teucrium pestalozzae | Teucrium | Lamiaceae | |
| Corydalis calliantha | Corydalis | Papaveraceae | |
| Goupia glabra | Goupia | Goupiaceae | |
| Nicotiana gossei | Nicotiana | Solanaceae |
|
| Crataegus monogyna | Crataegus | Rosaceae |
|
| Rosa laevigata | Rosa | Rosaceae |
|
| Dahlstedtia pentaphylla | Dahlstedtia | Fabaceae | |
| Panax innovans | Panax | Araliaceae | |
| Veronica kellereri | Veronica | Plantaginaceae | |
| Salacia chinensis | Salacia | Celastraceae |
|
| Centaurea cana | Centaurea | Asteraceae | |
| Cyathocline purpurea | Cyathocline | Asteraceae |
|
| Viscum album | Viscum | Viscaceae |
|
| Alhagi persarum | Alhagi | Fabaceae | |
| Scapania nemorea | Scapania | Scapaniaceae | |
| Verbena littoralis | Verbena | Verbenaceae |
|
| Salvia urolepis | Salvia | Lamiaceae | |
| Diphasiastrum alpinum | Diphasiastrum | Lycopodiaceae | |
| Excoecaria acerifolia | Excoecaria | Euphorbiaceae |
|
| Bryum rutilans | Bryum | Bryaceae | |
| Phlomoides hamosa | Phlomoides | Lamiaceae | |
| Blumea mollis | Blumea | Asteraceae |
|
| Acacia kempeana | Acacia | Fabaceae |
|
| Stylotrichium rotundifolium | Stylotrichium | Asteraceae | |
| Senecio cathcartensis | Senecio | Asteraceae | |
| Camellia sinensis | Camellia | Theaceae |
|
| Vaccaria hispanica | Vaccaria | Caryophyllaceae |
|
| Polygonatum stenophyllum | Polygonatum | Asparagaceae | |
| Euodia ruticarpa | Euodia | Rutaceae | |
| Knightia deplanchei | Knightia | Proteaceae | |
| Teucrium lanigerum | Teucrium | Lamiaceae | |
| Piper marginatum | Piper | Piperaceae |
|
| Helichrysum dendroideum | Helichrysum | Asteraceae | |
| Eucalyptus kitsoniana | Eucalyptus | Myrtaceae | |
| Mallotus repandus | Mallotus | Euphorbiaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Monopteryx uaucu | Monopteryx | Fabaceae |
|
| Koompassia malaccensis | Koompassia | Fabaceae |
|
| Schizonepeta tenuifolia | Schizonepeta | Lamiaceae |
|
| Rohdea wattii | Rohdea | Asparagaceae | |
| Ptilidium ciliare | Ptilidium | Ptilidiaceae | |
| Craibiodendron yunnanese | Craibiodendron | Ericaceae |
|
| Euthamia graminifolia | Euthamia | Asteraceae |
|
| Patrinia villosa | Patrinia | Caprifoliaceae |
|
| Scutellaria lateriflora | Scutellaria | Lamiaceae | |
| Plantago cornuti | Plantago | Plantaginaceae |
|
| Heliomeris multiflora | Heliomeris | Asteraceae | |
| Tiliacora triandra | Tiliacora | Menispermaceae |
|
| Ixeris tamagawaensis | Ixeris | Asteraceae | |
| Merremia umbellata | Merremia | Convolvulaceae |
|
| Plagiomnium cuspidatum | Plagiomnium | Mniaceae |
Ingredient ID: NPC41518
Formula: C48H78O19
Ingredient ID: NPC41518
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]([C@H]4C4=CC[C@H]5[C@@]([C@@]4(CC3)C)(C)CC[C@H]3[C@]5(C)C[C@H]([C@@H]([C@@]3(C)CO)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H78O19/c1-20-10-13-48(15-14-46(6)23(29(48)21(20)2)8-9-28-44(4)16-24(51)39(60)45(5,19-50)27(44)11-12-47(28,46)7)43(61)67-42-36(58)33(55)31(53)26(65-42)18-62-40-37(59)34(56)38(25(17-49)64-40)66-41-35(57)32(54)30(52)22(3)63-41/h8,20-22,24-42,49-60H,9-19H2,1-7H3/t20-,21+,22+,24-,25-,26-,27+,28-,29+,30+,31-,32-,33+,34-,35-,36-,37-,38-,39+,40-,41+,42+,44+,45+,46-,47-,48+/m1/s1 |
| Standard InCHIKey | WYQVAPGDARQUBT-XBCCZEPJSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD169497] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Centella asiatica | Centella | Apiaceae |
|
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Rubus rosa | Rubus | Rosaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Euonymus nanoides | Euonymus | Celastraceae | |
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Jacobaea subalpina | Jacobaea | Asteraceae |
Ingredient ID: NPC312971
Formula: C48H78O20S
Ingredient ID: NPC312971
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]4[C@@H]4[C@](CC3)(C)[C@]3(C)CC[C@H]5[C@]([C@H]3CC4)(C)CC[C@H](C5(C)C)OS(=O)(=O)O)C(=C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H78O20S/c1-21(2)23-11-16-48(18-17-46(7)24(30(23)48)9-10-28-45(6)14-13-29(68-69(59,60)61)44(4,5)27(45)12-15-47(28,46)8)43(58)67-42-37(56)34(53)32(51)26(65-42)20-62-40-38(57)35(54)39(25(19-49)64-40)66-41-36(55)33(52)31(50)22(3)63-41/h22-42,49-57H,1,9-20H2,2-8H3,(H,59,60,61)/t22-,23-,24+,25+,26+,27+,28+,29+,30+,31-,32+,33+,34-,35+,36+,37+,38+,39+,40+,41-,42-,45-,46+,47+,48-/m0/s1 |
| Standard InCHIKey | RXASQTFSUBGXML-WNFSKGBJSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD20646] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC307122
Formula: C30H46O5
Ingredient ID: NPC307122
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@H]1[C@]3(C)CC[C@H]([C@@]1(C)C(=O)O)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H46O5/c1-17(2)18-9-14-30(25(34)35)16-15-27(4)19(23(18)30)7-8-20-26(3)12-11-22(31)29(6,24(32)33)21(26)10-13-28(20,27)5/h18-23,31H,1,7-16H2,2-6H3,(H,32,33)(H,34,35)/t18-,19+,20+,21-,22+,23+,26+,27+,28+,29-,30-/m0/s1 |
| Standard InCHIKey | NSLGONDVJPFEEN-HDIQXJTLSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD31526] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC304110
Formula: C39H54O6
Ingredient ID: NPC304110
| Common Name | n.a. |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-11-hydroxy-10-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| Canonical SMILES | O=C(O[C@H]1[C@H](O)C[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@@H](C)[C@H](C)CC1)C(=O)O)C)C)/C=C/c1ccc(cc1)O |
| Standard InCHI | InChI=1S/C39H54O6/c1-23-16-19-39(34(43)44)21-20-37(6)27(32(39)24(23)2)13-14-30-36(5)22-28(41)33(35(3,4)29(36)17-18-38(30,37)7)45-31(42)15-10-25-8-11-26(40)12-9-25/h8-13,15,23-24,28-30,32-33,40-41H,14,16-22H2,1-7H3,(H,43,44)/b15-10+/t23-,24+,28-,29+,30-,32+,33+,36+,37-,38-,39+/m1/s1 |
| Standard InCHIKey | FEVUQLLYZLSRLB-SVRRIJHPSA-N |
| Ingredient External Links |
PubChem CID: 14335960 ZINC ID: ZINC000049898685 |
| Plant-Ingredient Association Reference |
PMID: 16441080 Database: NPASS [NPC304110] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Buddleja scordioides | Buddleja | Scrophulariaceae | |
| Fagus crenata | Fagus | Fagaceae |
|
| Echinochloa crus-galli | Echinochloa | Poaceae |
|
Ingredient ID: NPC294438
Formula: C30H48O3
Ingredient ID: NPC294438
| Common Name | n.a. |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| Canonical SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@H](C1(C)C)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H48O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,23+,24+,27-,28+,29+,30-/m0/s1 |
| Standard InCHIKey | QGJZLNKBHJESQX-ULZDWRHHSA-N |
| Ingredient External Links |
PubChem CID: 485711 ZINC ID: ZINC000004716552 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC294438] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Coussarea paniculata | Coussarea | Rubiaceae | |
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Maytenus chiapensis | Maytenus | Celastraceae | |
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Helichrysum candolleanum | Helichrysum | Asteraceae |
|
| Microtropis fokienensis | Microtropis | Celastraceae | |
| Maytenus cuzcoina | Maytenus | Celastraceae | |
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC287207
Formula: C48H76O19
Ingredient ID: NPC287207
| Common Name | n.a. |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,9S,10R,11R,12aR,14bS)-9-formyl-10,11-dihydroxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)C[C@H]([C@@H]([C@@]5(C)C=O)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H76O19/c1-21-29(52)31(54)34(57)40(63-21)66-37-25(18-49)64-39(36(59)33(37)56)62-19-26-30(53)32(55)35(58)41(65-26)67-42(61)48-14-12-43(2,3)16-23(48)22-8-9-28-44(4)17-24(51)38(60)45(5,20-50)27(44)10-11-47(28,7)46(22,6)13-15-48/h8,20-21,23-41,49,51-60H,9-19H2,1-7H3/t21-,23-,24+,25+,26+,27+,28+,29-,30+,31+,32-,33+,34+,35+,36+,37+,38-,39+,40-,41-,44-,45-,46+,47+,48-/m0/s1 |
| Standard InCHIKey | QDBYXCVLZAHMEZ-FTOKAHLBSA-N |
| Ingredient External Links |
PubChem CID: 101675596 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD164053] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC27518
Formula: C39H54O6
Ingredient ID: NPC27518
| Common Name | n.a. |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-11-hydroxy-10-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| Canonical SMILES | O=C(O[C@H]1[C@H](O)C[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@@H](C)[C@H](C)CC1)C(=O)O)C)C)/C=Cc1ccc(cc1)O |
| Standard InCHI | InChI=1S/C39H54O6/c1-23-16-19-39(34(43)44)21-20-37(6)27(32(39)24(23)2)13-14-30-36(5)22-28(41)33(35(3,4)29(36)17-18-38(30,37)7)45-31(42)15-10-25-8-11-26(40)12-9-25/h8-13,15,23-24,28-30,32-33,40-41H,14,16-22H2,1-7H3,(H,43,44)/b15-10-/t23-,24+,28-,29+,30-,32+,33+,36+,37-,38-,39+/m1/s1 |
| Standard InCHIKey | FEVUQLLYZLSRLB-XURUTGAWSA-N |
| Ingredient External Links |
PubChem CID: 44566278 ZINC ID: ZINC000049823157 |
| Plant-Ingredient Association Reference |
PMID: 16441080 Database: NPASS [NPC27518] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Echinochloa crus-galli | Echinochloa | Poaceae |
|
Ingredient ID: NPC272713
Formula: C18H32O15
Ingredient ID: NPC272713
| Common Name | n.a. |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](O)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C18H32O15/c1-4-7(20)9(22)13(26)18(30-4)33-15-5(2-19)32-17(14(27)11(15)24)29-3-6-8(21)10(23)12(25)16(28)31-6/h4-28H,2-3H2,1H3/t4-,5+,6+,7-,8+,9+,10-,11+,12+,13+,14+,15+,16+,17+,18-/m0/s1 |
| Standard InCHIKey | HMICOLSPNWTQEF-VOSXJIGGSA-N |
| Ingredient External Links |
PubChem CID: 91857681 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD81505] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC271974
Formula: C30H48O6S
Ingredient ID: NPC271974
| Common Name | 3-Epi-Betulinic Acid 3-O-Sulfate |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-9-sulfooxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| Canonical SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@H](C1(C)C)OS(=O)(=O)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H48O6S/c1-18(2)19-10-15-30(25(31)32)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(36-37(33,34)35)26(3,4)21(27)11-14-29(22,28)7/h19-24H,1,8-17H2,2-7H3,(H,31,32)(H,33,34,35)/t19-,20+,21-,22+,23+,24+,27-,28+,29+,30-/m0/s1 |
| Standard InCHIKey | YFXBKUYUDSKMET-ULZDWRHHSA-N |
| Ingredient External Links |
PubChem CID: 21582889 ChEMBL ID: CHEMBL3601067 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD141855] Database: NPASS [NPC271974] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Fraxinus chinensis | Fraxinus | Oleaceae |
|
| Euphorbia fischeriana | Euphorbia | Euphorbiaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC267691
Formula: C30H46O3
Ingredient ID: NPC267691
| Common Name | Oleanonic Acid |
| IUPAC Name | (4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid |
| Canonical SMILES | OC(=O)[C@]12CC[C@@]3(C(=CC[C@H]4[C@@]3(C)CC[C@@H]3[C@]4(C)CCC(=O)C3(C)C)[C@@H]2CC(CC1)(C)C)C |
| Standard InCHI | InChI=1S/C30H46O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-22H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,27-,28+,29+,30-/m0/s1 |
| Standard InCHIKey | FMIMFCRXYXVFTA-FUAOEXFOSA-N |
| Ingredient External Links |
PubChem CID: 12313704 ZINC ID: ZINC000013558220 ChEMBL ID: CHEMBL470029 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC267691] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Styrax benzoin | Styrax | Styracaceae |
|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Xylosalsola richteri | Xylosalsola | Chenopodiaceae | |
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Styrax tonkinensis | Styrax | Styracaceae |
|
| Pedicularis plicata | Pedicularis | Orobanchaceae | |
| Sonchus gummifer | Sonchus | Asteraceae | |
| Uncaria macrophylla | Uncaria | Rubiaceae |
|
| Uncaria rhynchophylla | Uncaria | Rubiaceae |
|
| Stephania hispidula | Stephania | Menispermaceae | |
| Micranthes stellaris | Micranthes | Saxifragaceae | |
| Rabdosia flexicaulis | Isodon | Lamiaceae | |
| Baccharis sarothroides | Baccharis | Asteraceae | |
| Ipomoea hederacea | Ipomoea | Convolvulaceae |
|
| Andropogon laniger | Andropogon | Poaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Liquidambar formosana | Liquidambar | Altingiaceae |
|
| Capparis flavicans | Capparis | Capparaceae |
|
| Malus sieboldii | Malus | Rosaceae |
|
| Oxytropis pseudoglandulosa | Oxytropis | Fabaceae | |
| Styrax | Styrax | Styracaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Uncaria sinensis | Uncaria | Rubiaceae |
|
| Xyris semifuscata | Xyris | Xyridaceae | |
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Ixora coccinea | Ixora | Rubiaceae |
|
| Vaccaria hispanica | Vaccaria | Caryophyllaceae |
|
Ingredient ID: NPC261096
Formula: C30H46O5
Ingredient ID: NPC261096
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C[C@@H]1CC[C@]2([C@@H]([C@H]1C)C1=CC[C@H]3[C@@]([C@@]1(CC2)C)(C)CC[C@H]1[C@]3(C)CC[C@H]([C@@]1(C)C(=O)O)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H46O5/c1-17-9-14-30(25(34)35)16-15-27(4)19(23(30)18(17)2)7-8-20-26(3)12-11-22(31)29(6,24(32)33)21(26)10-13-28(20,27)5/h7,17-18,20-23,31H,8-16H2,1-6H3,(H,32,33)(H,34,35)/t17-,18+,20-,21+,22-,23+,26-,27-,28-,29+,30+/m1/s1 |
| Standard InCHIKey | OVHNDEYISNIAOA-ZCBFTHFESA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD186066] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC248222
Formula: C48H78O19
Ingredient ID: NPC248222
| Common Name | n.a. |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,9R,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)C[C@H]([C@@H]([C@@]5(C)CO)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H78O19/c1-21-29(52)31(54)34(57)40(63-21)66-37-25(18-49)64-39(36(59)33(37)56)62-19-26-30(53)32(55)35(58)41(65-26)67-42(61)48-14-12-43(2,3)16-23(48)22-8-9-28-44(4)17-24(51)38(60)45(5,20-50)27(44)10-11-47(28,7)46(22,6)13-15-48/h8,21,23-41,49-60H,9-20H2,1-7H3/t21-,23-,24+,25+,26+,27+,28+,29-,30+,31+,32-,33+,34+,35+,36+,37+,38-,39+,40-,41-,44-,45-,46+,47+,48-/m0/s1 |
| Standard InCHIKey | LGOPJRNHNGETGG-FTOKAHLBSA-N |
| Ingredient External Links |
PubChem CID: 101675595 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD50392] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Centella asiatica | Centella | Apiaceae |
|
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Rubus rosa | Rubus | Rosaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Euonymus nanoides | Euonymus | Celastraceae | |
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Jacobaea subalpina | Jacobaea | Asteraceae |
Ingredient ID: NPC247312
Formula: C30H48O6S
Ingredient ID: NPC247312
| Common Name | Betulinic Acid Sulfate |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-9-sulfooxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| Canonical SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@@H](C1(C)C)OS(=O)(=O)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H48O6S/c1-18(2)19-10-15-30(25(31)32)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(36-37(33,34)35)26(3,4)21(27)11-14-29(22,28)7/h19-24H,1,8-17H2,2-7H3,(H,31,32)(H,33,34,35)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1 |
| Standard InCHIKey | YFXBKUYUDSKMET-FZFNOLFKSA-N |
| Ingredient External Links |
PubChem CID: 11756976 ChEMBL ID: CHEMBL397684 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD142781] Database: NPASS [NPC247312] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC244940
Formula: C53H86O22
Ingredient ID: NPC244940
| Common Name | n.a. |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,2R,4aS,6aR,6aS,6bR,8aR,9R,10S,12aR,14bS)-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]([C@H]4C4=CC[C@H]5[C@@]([C@@]4(CC3)C)(C)CC[C@@H]3[C@]5(C)CC[C@@H]([C@@]3(C)CO)O[C@@H]3OC[C@@H]([C@@H]([C@H]3O)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C53H86O22/c1-22-10-15-53(48(67)75-47-41(65)37(61)35(59)28(72-47)20-69-44-42(66)38(62)43(27(18-54)71-44)74-46-40(64)36(60)33(57)24(3)70-46)17-16-51(6)25(32(53)23(22)2)8-9-30-49(4)13-12-31(73-45-39(63)34(58)26(56)19-68-45)50(5,21-55)29(49)11-14-52(30,51)7/h8,22-24,26-47,54-66H,9-21H2,1-7H3/t22-,23+,24+,26+,27-,28-,29-,30-,31+,32+,33+,34+,35-,36-,37+,38-,39-,40-,41-,42-,43-,44-,45+,46+,47+,49+,50+,51-,52-,53+/m1/s1 |
| Standard InCHIKey | FDSRWPZECMMOFD-LURBLWJMSA-N |
| Ingredient External Links |
PubChem CID: 101675597 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD6530] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC241909
Formula: C53H86O22
Ingredient ID: NPC241909
| Common Name | Cauloside D |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,9R,10S,12aR,14bS)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)CC[C@@H]([C@@]5(C)CO)O[C@@H]5OC[C@@H]([C@@H]([C@H]5O)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C53H86O22/c1-23-32(57)35(60)39(64)45(70-23)74-42-27(19-54)71-43(41(66)37(42)62)69-21-28-34(59)36(61)40(65)46(72-28)75-47(67)53-16-14-48(2,3)18-25(53)24-8-9-30-49(4)12-11-31(73-44-38(63)33(58)26(56)20-68-44)50(5,22-55)29(49)10-13-52(30,7)51(24,6)15-17-53/h8,23,25-46,54-66H,9-22H2,1-7H3/t23-,25-,26-,27+,28+,29+,30+,31-,32-,33-,34+,35+,36-,37+,38+,39+,40+,41+,42+,43+,44-,45-,46-,49-,50-,51+,52+,53-/m0/s1 |
| Standard InCHIKey | UEHILKCNLIKLEV-LXABABOZSA-N |
| Ingredient External Links |
PubChem CID: 21630094 ChEMBL ID: CHEMBL538919 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD47299] Database: NPASS [NPC241909] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Clematis chinensis | Clematis | Ranunculaceae |
|
Ingredient ID: NPC213832
Formula: C30H46O5
Ingredient ID: NPC213832
| Common Name | n.a. |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,8S,9R,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a,8-dicarboxylic acid |
| Canonical SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@H]([C@@]1(C)C(=O)O)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H46O5/c1-17(2)18-9-14-30(25(34)35)16-15-27(4)19(23(18)30)7-8-20-26(3)12-11-22(31)29(6,24(32)33)21(26)10-13-28(20,27)5/h18-23,31H,1,7-16H2,2-6H3,(H,32,33)(H,34,35)/t18-,19+,20+,21+,22+,23+,26+,27+,28+,29-,30-/m0/s1 |
| Standard InCHIKey | NSLGONDVJPFEEN-JOPFMIIHSA-N |
| Ingredient External Links |
PubChem CID: 14466871 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD171412] Database: NPASS [NPC213832] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC213645
Formula: C30H46O5
Ingredient ID: NPC213645
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@@H]3[C@@]([C@@H]1[C@H](C2)C)(C)CC[C@H]1[C@]3(C)CC[C@H]([C@@]1(C)C(=O)O)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H46O5/c1-16(2)18-9-14-30(26(34)35)15-17(3)23-19(24(18)30)7-8-20-27(4)13-11-22(31)29(6,25(32)33)21(27)10-12-28(20,23)5/h17-24,31H,1,7-15H2,2-6H3,(H,32,33)(H,34,35)/t17-,18-,19-,20-,21-,22+,23+,24+,27+,28+,29-,30-/m0/s1 |
| Standard InCHIKey | LZRAEABBGSAANR-OLWGDLAQSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD86752] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
Ingredient ID: NPC189224
Formula: C30H48O5
Ingredient ID: NPC189224
| Common Name | n.a. |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aS,9R,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| Canonical SMILES | OC[C@]1(C)[C@@H](O)[C@H](O)C[C@]2([C@@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@@H](C)[C@@H](CC1)C)C(=O)O)C)C |
| Standard InCHI | InChI=1S/C30H48O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,17-18,20-24,31-33H,8-16H2,1-6H3,(H,34,35)/t17-,18+,20-,21+,22-,23+,24+,26+,27+,28-,29-,30+/m1/s1 |
| Standard InCHIKey | JXSVIVRDWWRQRT-LBWJMHIJSA-N |
| Ingredient External Links |
PubChem CID: 51531959 ZINC ID: ZINC000014243544 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Centella asiatica | Centella | Apiaceae |
|
| Conyza canadensis | Conyza | Asteraceae |
|
| Coreopsis fasciculata | Coreopsis | Asteraceae | |
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Xylosalsola richteri | Xylosalsola | Chenopodiaceae | |
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Selinum carvifolium | Selinum | Apiaceae | |
| Pedicularis plicata | Pedicularis | Orobanchaceae | |
| Sonchus gummifer | Sonchus | Asteraceae | |
| Stephania hispidula | Stephania | Menispermaceae | |
| Micranthes stellaris | Micranthes | Saxifragaceae | |
| Thuja plicata | Thuja | Cupressaceae |
|
| Rabdosia flexicaulis | Isodon | Lamiaceae | |
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Baccharis sarothroides | Baccharis | Asteraceae | |
| Ipomoea hederacea | Ipomoea | Convolvulaceae |
|
| Andropogon laniger | Andropogon | Poaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Capparis flavicans | Capparis | Capparaceae |
|
| Malus sieboldii | Malus | Rosaceae |
|
| Oxytropis pseudoglandulosa | Oxytropis | Fabaceae | |
| Crepis foetida | Crepis | Asteraceae |
|
| Cirsium japonicum | Cirsium | Asteraceae |
|
| Dorstenia lindeniana | Dorstenia | Moraceae | |
| Dioscoreophyllum cumminsii | Dioscoreophyllum | Menispermaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Phytolacca acinosa | Phytolacca | Phytolaccaceae |
|
| Garcinia hombroniana | Garcinia | Clusiaceae |
|
| Cardiospermum halicacabum | Cardiospermum | Sapindaceae |
|
| Aglaia elaeagnoidea | Aglaia | Meliaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Urtica triangularis | Urtica | Urticaceae |
|
| Pouzolzia occidentalis | Pouzolzia | Urticaceae | |
| Centaurea nigrescens | Centaurea | Asteraceae |
|
| Piper arboreum | Piper | Piperaceae |
|
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Parastrephia lepidophylla | Parastrephia | Asteraceae | |
| Phlogacanthus thyrsiflorus | Phlogacanthus | Acanthaceae |
|
| Euphorbia segetalis | Euphorbia | Euphorbiaceae | |
| Sidastrum acuminatum | Sidastrum | Malvaceae | |
| Syncolostemon parviflorus | Syncolostemon | Lamiaceae | |
| Aristolochia elegans | Aristolochia | Aristolochiaceae | |
| Penstemon secundiflorus | Penstemon | Plantaginaceae | |
| Cuphea carthagenensis | Cuphea | Lythraceae | |
| Ozoroa insignis | Ozoroa | Anacardiaceae |
|
| Ruta microcarpa | Ruta | Rutaceae |
|
| Crinum defixum | Crinum | Amaryllidaceae |
|
| Zanthoxylum monophyllum | Zanthoxylum | Rutaceae | |
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Rubus rosa | Rubus | Rosaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Euonymus nanoides | Euonymus | Celastraceae | |
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Astragalus gummifer | Astragalus | Fabaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Triglochin maritima | Triglochin | Juncaginaceae |
|
| Xyris semifuscata | Xyris | Xyridaceae | |
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Jacobaea subalpina | Jacobaea | Asteraceae | |
| Phedimus kamtschaticus | Phedimus | Crassulaceae |
|
| Vaccaria hispanica | Vaccaria | Caryophyllaceae |
|
Ingredient ID: NPC179215
Formula: C36H58O8
Ingredient ID: NPC179215
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@H](O[C@@H]2CC[C@]3([C@@H](C2(C)C)CC[C@@]2([C@H]3CC[C@@H]3[C@H]2[C@@H](C)C[C@@]2([C@H]3[C@@H](CC2)C(=C)C)C(=O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C36H58O8/c1-18(2)20-10-15-36(32(41)42)16-19(3)26-21(27(20)36)8-9-24-34(6)14-12-25(33(4,5)23(34)11-13-35(24,26)7)44-31-30(40)29(39)28(38)22(17-37)43-31/h19-31,37-40H,1,8-17H2,2-7H3,(H,41,42)/t19-,20-,21+,22+,23+,24-,25+,26+,27-,28+,29-,30+,31+,34-,35+,36-/m0/s1 |
| Standard InCHIKey | JYXYOLLEHMLZDH-RPDVKDJZSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD62218] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC172311
Formula: C39H54O6
Ingredient ID: NPC172311
| Common Name | n.a. |
| IUPAC Name | (1R,2S,4aR,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2-hydroxy-10-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| Canonical SMILES | O=C(O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@@H](C)[C@@](C)(O)CC1)C(=O)O)C)C)/C=Cc1ccc(cc1)O |
| Standard InCHI | InChI=1S/C39H54O6/c1-24-32-27-13-14-29-35(4)18-17-30(45-31(41)15-10-25-8-11-26(40)12-9-25)34(2,3)28(35)16-19-37(29,6)36(27,5)20-22-39(32,33(42)43)23-21-38(24,7)44/h8-13,15,24,28-30,32,40,44H,14,16-23H2,1-7H3,(H,42,43)/b15-10-/t24-,28+,29-,30+,32+,35+,36-,37-,38+,39-/m1/s1 |
| Standard InCHIKey | QBVWEVAJCNZONP-JKGUJMMISA-N |
| Ingredient External Links |
PubChem CID: 11692990 |
| Plant-Ingredient Association Reference |
PMID: 16441080 Database: NPASS [NPC172311] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
Ingredient ID: NPC172206
Formula: C48H78O19
Ingredient ID: NPC172206
| Common Name | n.a. |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,2R,4aS,6aR,6aS,6bR,8aR,9R,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]([C@H]4C4=CC[C@H]5[C@@]([C@@]4(CC3)C)(C)CC[C@@H]3[C@]5(C)C[C@H]([C@@H]([C@@]3(C)CO)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H78O19/c1-20-10-13-48(15-14-46(6)23(29(48)21(20)2)8-9-28-44(4)16-24(51)39(60)45(5,19-50)27(44)11-12-47(28,46)7)43(61)67-42-36(58)33(55)31(53)26(65-42)18-62-40-37(59)34(56)38(25(17-49)64-40)66-41-35(57)32(54)30(52)22(3)63-41/h8,20-22,24-42,49-60H,9-19H2,1-7H3/t20-,21+,22+,24-,25-,26-,27-,28-,29+,30+,31-,32-,33+,34-,35-,36-,37-,38-,39+,40-,41+,42+,44+,45+,46-,47-,48+/m1/s1 |
| Standard InCHIKey | WYQVAPGDARQUBT-FGWHUCSPSA-N |
| Ingredient External Links |
PubChem CID: 11954171 ZINC ID: ZINC000253529453 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Centella asiatica | Centella | Apiaceae |
|
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Rubus rosa | Rubus | Rosaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Euonymus nanoides | Euonymus | Celastraceae | |
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Jacobaea subalpina | Jacobaea | Asteraceae |
Ingredient ID: NPC16712
Formula: C66H106O33
Ingredient ID: NPC16712
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)CC[C@@H](C5(C)C)O[C@@H]5O[C@H](C(=O)O)[C@H]([C@@H]([C@H]5O[C@@H]5O[C@H](CO)[C@@H]([C@@H]([C@H]5O[C@@H]5O[C@H](CO)[C@H]([C@@H]([C@H]5O)O)O)O)O)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C66H106O33/c1-24-34(70)38(74)45(81)55(89-24)95-49-29(22-69)92-54(48(84)44(49)80)88-23-30-37(73)40(76)47(83)57(93-30)99-60(87)66-17-15-61(2,3)19-26(66)25-9-10-32-63(6)13-12-33(62(4,5)31(63)11-14-65(32,8)64(25,7)16-18-66)94-59-52(43(79)42(78)50(96-59)53(85)86)98-58-51(41(77)36(72)28(21-68)91-58)97-56-46(82)39(75)35(71)27(20-67)90-56/h9,24,26-52,54-59,67-84H,10-23H2,1-8H3,(H,85,86)/t24-,26-,27+,28+,29+,30+,31-,32+,33-,34-,35+,36-,37+,38+,39-,40-,41-,42-,43-,44+,45+,46+,47+,48+,49+,50-,51+,52+,54+,55-,56-,57-,58-,59+,63-,64+,65+,66-/m0/s1 |
| Standard InCHIKey | DDDMOKRUFAPSQY-HRIIJUAJSA-N |
| Ingredient External Links |
PubChem CID: 101675600 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD4520] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC146563
Formula: C48H76O19
Ingredient ID: NPC146563
| Common Name | n.a. |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,8S,9R,11aR,11bR,13aR,13bR)-3a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-9-hydroxy-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]4[C@@H]4[C@](CC3)(C)[C@]3(C)CC[C@@H]5[C@]([C@H]3CC4)(C)CC[C@H]([C@@]5(C)C(=O)O)O)C(=C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H76O19/c1-20(2)22-10-15-48(17-16-45(5)23(29(22)48)8-9-26-44(4)13-12-28(50)47(7,42(59)60)27(44)11-14-46(26,45)6)43(61)67-41-36(57)33(54)31(52)25(65-41)19-62-39-37(58)34(55)38(24(18-49)64-39)66-40-35(56)32(53)30(51)21(3)63-40/h21-41,49-58H,1,8-19H2,2-7H3,(H,59,60)/t21-,22-,23+,24+,25+,26+,27+,28+,29+,30-,31+,32+,33-,34+,35+,36+,37+,38+,39+,40-,41-,44+,45+,46+,47-,48-/m0/s1 |
| Standard InCHIKey | OSXJYFIVZQMFMF-ATHBPGJJSA-N |
| Ingredient External Links |
PubChem CID: 10795959 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD152504] Database: NPASS [NPC146563] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC14319
Formula: C48H78O19
Ingredient ID: NPC14319
| Common Name | n.a. |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,9S,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)C[C@H]([C@@H]([C@]5(C)CO)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H78O19/c1-21-29(52)31(54)34(57)40(63-21)66-37-25(18-49)64-39(36(59)33(37)56)62-19-26-30(53)32(55)35(58)41(65-26)67-42(61)48-14-12-43(2,3)16-23(48)22-8-9-28-44(4)17-24(51)38(60)45(5,20-50)27(44)10-11-47(28,7)46(22,6)13-15-48/h8,21,23-41,49-60H,9-20H2,1-7H3/t21-,23-,24+,25+,26+,27+,28+,29-,30+,31+,32-,33+,34+,35+,36+,37+,38-,39+,40-,41-,44-,45+,46+,47+,48-/m0/s1 |
| Standard InCHIKey | LGOPJRNHNGETGG-KALHFNAPSA-N |
| Ingredient External Links |
PubChem CID: 101675601 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD65333] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC136923
Formula: C48H76O19
Ingredient ID: NPC136923
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@H]4[C@H]4[C@@H]([C@H](C3)C)[C@]3(C)CC[C@H]5[C@]([C@H]3CC4)(C)CC[C@H]([C@@]5(C)C(=O)O)O)C(=C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C48H76O19/c1-19(2)22-10-15-48(16-20(3)29-23(30(22)48)8-9-26-45(5)14-12-28(50)47(7,43(59)60)27(45)11-13-46(26,29)6)44(61)67-42-37(57)34(54)32(52)25(65-42)18-62-40-38(58)35(55)39(24(17-49)64-40)66-41-36(56)33(53)31(51)21(4)63-41/h20-42,49-58H,1,8-18H2,2-7H3,(H,59,60)/t20-,21-,22-,23+,24+,25+,26+,27-,28+,29+,30-,31-,32+,33+,34-,35+,36+,37+,38+,39+,40+,41-,42-,45+,46+,47-,48-/m0/s1 |
| Standard InCHIKey | JBMHEOBXOQXYCN-FADUUMCWSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD154040] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC129854
Formula: C54H88O22
Ingredient ID: NPC129854
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]4[C@@H]4[C@](CC3)(C)[C@]3(C)CC[C@H]5[C@]([C@H]3CC4)(C)CC[C@H](C5(C)C)O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)C(=C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Standard InCHI | InChI=1S/C54H88O22/c1-22(2)24-11-16-54(49(68)76-48-42(66)38(62)35(59)28(73-48)21-69-45-43(67)39(63)44(27(20-56)72-45)75-46-40(64)36(60)33(57)23(3)70-46)18-17-52(7)25(32(24)54)9-10-30-51(6)14-13-31(50(4,5)29(51)12-15-53(30,52)8)74-47-41(65)37(61)34(58)26(19-55)71-47/h23-48,55-67H,1,9-21H2,2-8H3/t23-,24-,25+,26+,27+,28+,29+,30+,31+,32+,33-,34+,35+,36+,37-,38-,39+,40+,41+,42+,43+,44+,45+,46-,47-,48-,51-,52+,53+,54-/m0/s1 |
| Standard InCHIKey | AMSVTLCTZVZTHY-VQWZJKGVSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD127109] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Ingredient ID: NPC118033
Formula: C40H56O7
Ingredient ID: NPC118033
| Common Name | n.a. |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-11-hydroxy-10-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| Canonical SMILES | COc1cc(/C=C/C(=O)O[C@H]2[C@H](O)C[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3[C@@H](C)[C@H](C)CC2)C(=O)O)C)C)ccc1O |
| Standard InCHI | InChI=1S/C40H56O7/c1-23-15-18-40(35(44)45)20-19-38(6)26(33(40)24(23)2)11-13-31-37(5)22-28(42)34(36(3,4)30(37)16-17-39(31,38)7)47-32(43)14-10-25-9-12-27(41)29(21-25)46-8/h9-12,14,21,23-24,28,30-31,33-34,41-42H,13,15-20,22H2,1-8H3,(H,44,45)/b14-10+/t23-,24+,28-,30+,31-,33+,34+,37+,38-,39-,40+/m1/s1 |
| Standard InCHIKey | LOYUSEWSBJOCNL-DAKVFCDHSA-N |
| Ingredient External Links |
PubChem CID: 44566279 |
| Plant-Ingredient Association Reference |
PMID: 16441080 Database: NPASS [NPC118033] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
Ingredient ID: NPC110676
Formula: C30H46O6
Ingredient ID: NPC110676
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1C[C@@H](O)[C@@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@H]([C@@]1(C)C(=O)O)O)C(=O)O |
| Standard InCHI | InChI=1S/C30H46O6/c1-16(2)17-7-12-30(25(35)36)14-13-27(4)18(22(17)30)15-19(31)23-26(3)10-9-21(32)29(6,24(33)34)20(26)8-11-28(23,27)5/h17-23,31-32H,1,7-15H2,2-6H3,(H,33,34)(H,35,36)/t17-,18+,19+,20+,21+,22+,23-,26-,27+,28+,29-,30-/m0/s1 |
| Standard InCHIKey | VZYJGZZXVOHUMY-YWDIVLBZSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD189091] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros dendo | Diospyros | Ebenaceae |
|
| Schefflera heptaphylla | Schefflera | Araliaceae |
|
| Narcissus tazetta | Narcissus | Amaryllidaceae |
|
| Primula veris | Primula | Primulaceae |
|
| Solanum tuberosum | Solanum | Solanaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC110676 | C30H46O6 | 502.3294392 | 0.7014 | 4.1 | 6.101 | 6 | 4 | 115.06 | 3 | 5 | 36 | 1 | |
| NPC118033 | C40H56O7 | 648.4026041 | 1.4793 | 5.09 | 9.764 | 5 | 3 | 113.29 | 17 | 6 | 47 | 1 | |
| NPC129854 | C54H88O22 | 1088.576724 | -4.2956 | 4.98 | 4.193 | 22 | 13 | 353.9 | 13 | 9 | 76 | 3 | |
| NPC136923 | C48H76O19 | 956.4980802 | -3.7756 | 4.65 | 4.193 | 19 | 11 | 312.05 | 11 | 8 | 67 | 3 | |
| NPC14319 | C48H78O19 | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,9S,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate | 958.5137303 | -4.0818 | 4.65 | 3.431 | 19 | 12 | 315.21 | 10 | 8 | 67 | 2 |
| NPC146563 | C48H76O19 | 956.4980802 | -3.4305 | 4.65 | 4.291 | 19 | 11 | 312.05 | 28 | 8 | 67 | 3 | |
| NPC16712 | C66H106O33 | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid | 1426.661636 | -7.9069 | 5.09 | 0.921 | 33 | 19 | 529.27 | 18 | 11 | 99 | 3 |
| NPC172206 | C48H78O19 | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,2R,4aS,6aR,6aS,6bR,8aR,9R,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate | 958.5137303 | -4.7278 | 4.65 | 3.333 | 19 | 12 | 315.21 | 10 | 8 | 67 | 2 |
| NPC172311 | C39H54O6 | 618.3920394 | 1.3147 | 5.09 | 9.695 | 5 | 3 | 104.06 | 15 | 6 | 45 | 1 | |
| NPC179215 | C36H58O8 | 618.4131688 | 0.2575 | 4.54 | 8.201 | 8 | 5 | 136.68 | 5 | 6 | 44 | 1 | |
| NPC189224 | C30H48O5 | (1S,2R,4aS,6aR,6aS,6bR,8aS,9R,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid | 488.3501746 | 0.1704 | 4.21 | 7.439 | 5 | 4 | 97.99 | 2 | 5 | 35 | 1 |
| NPC213645 | C30H46O5 | 486.3345246 | 1.1226 | 4.21 | 8.299 | 5 | 3 | 94.83 | 3 | 5 | 35 | 1 | |
| NPC213832 | C30H46O5 | 486.3345246 | 1.4677 | 4.21 | 8.397 | 5 | 3 | 94.83 | 11 | 5 | 35 | 1 | |
| NPC241909 | C53H86O22 | Cauloside D | 1074.56 | -5.0953 | 4.87 | 2.949 | 22 | 13 | 353.9 | 32 | 9 | 75 | 3 |
| NPC244940 | C53H86O22 | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,2R,4aS,6aR,6aS,6bR,8aR,9R,10S,12aR,14bS)-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate | 1074.561074 | -5.7413 | 4.87 | 2.851 | 22 | 13 | 353.9 | 12 | 9 | 75 | 3 |
| NPC247312 | C30H48O6S | Betulinic Acid Sulfate | 536.32 | 2.3007 | 3.99 | 8.11 | 6 | 2 | 109.28 | 12 | 5 | 37 | 1 |
| NPC248222 | C48H78O19 | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,9R,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate | 958.5137303 | -4.0818 | 4.65 | 3.431 | 19 | 12 | 315.21 | 10 | 8 | 67 | 2 |
| NPC261096 | C30H46O5 | 486.3345246 | 0.602 | 4.21 | 7.944 | 5 | 3 | 94.83 | 2 | 5 | 35 | 1 | |
| NPC267691 | C30H46O3 | Oleanonic Acid | 454.34 | 2.6995 | 4.43 | 8.445 | 3 | 1 | 54.37 | 9 | 5 | 33 | 1 |
| NPC271974 | C30H48O6S | 3-Epi-Betulinic Acid 3-O-Sulfate | 536.32 | 2.3007 | 3.99 | 8.11 | 6 | 2 | 109.28 | 12 | 5 | 37 | 1 |
| NPC272713 | C18H32O15 | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol | 488.1741203 | -5.5072 | 1.79 | -4.497 | 15 | 10 | 248.45 | 6 | 3 | 33 | 2 |
| NPC27518 | C39H54O6 | 618.3920394 | 1.5311 | 5.09 | 10.419 | 5 | 3 | 104.06 | 15 | 6 | 45 | 1 | |
| NPC287207 | C48H76O19 | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,9S,10R,11R,12aR,14bS)-9-formyl-10,11-dihydroxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate | 956.4980802 | -3.8255 | 4.65 | 3.538 | 19 | 11 | 312.05 | 10 | 8 | 67 | 2 |
| NPC294438 | C30H48O3 | 456.3603454 | 2.3495 | 4.43 | 9.407 | 3 | 2 | 57.53 | 10 | 5 | 33 | 1 | |
| NPC304110 | C39H54O6 | 618.3920394 | 1.5311 | 5.09 | 10.419 | 5 | 3 | 104.06 | 15 | 6 | 45 | 1 | |
| NPC307122 | C30H46O5 | 486.3345246 | 1.4677 | 4.21 | 8.397 | 5 | 3 | 94.83 | 3 | 5 | 35 | 1 | |
| NPC312971 | C48H78O20S | 1006.480716 | -2.5975 | 4.43 | 4.004 | 20 | 10 | 326.5 | 12 | 8 | 69 | 3 | |
| NPC41518 | C48H78O19 | 958.5137303 | -4.7278 | 4.65 | 3.333 | 19 | 12 | 315.21 | 10 | 8 | 67 | 2 | |
| NPC51700 | C30H48O3 | Ursolic Acid | 456.36 | 1.4838 | 4.43 | 8.954 | 3 | 2 | 57.53 | 10 | 5 | 33 | 1 |
| NPC5290 | C48H76O19 | (3R,4S,4aR,6aR,6bS,8aS,11R,12S,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-3-hydroxy-4,6a,6b,11,12,14b-hexamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-4-carboxylic acid | 956.4980802 | -4.2962 | 4.65 | 3.838 | 19 | 11 | 312.05 | 10 | 8 | 67 | 2 |
| NPC57954 | C30H46O6 | 502.3294392 | 0.7014 | 4.1 | 6.101 | 6 | 4 | 115.06 | 12 | 5 | 36 | 1 | |
| NPC62307 | C48H78O17 | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate | 926.523901 | -2.5487 | 4.87 | 5.301 | 17 | 10 | 274.75 | 10 | 8 | 65 | 3 |
| NPC68464 | C48H76O19 | (3R,4S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-3-hydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylic acid | 956.4980802 | -3.6502 | 4.65 | 3.936 | 19 | 11 | 312.05 | 10 | 8 | 67 | 2 |
| NPC74418 | C66H106O33 | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,11R,12S,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid | 1426.661636 | -8.5529 | 5.09 | 0.823 | 33 | 19 | 529.27 | 18 | 11 | 99 | 3 |
| NPC7645 | C48H76O20 | (1R,3aS,5aR,5bR,7aR,8S,9R,11aS,11bR,12R,13aR,13bR)-3a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-9,12-dihydroxy-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid | 972.4929948 | -4.1968 | 4.54 | 1.995 | 20 | 12 | 332.28 | 11 | 8 | 68 | 3 |
| NPC90096 | C48H78O19 | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,2R,4aS,6aR,6aS,6bR,8aR,9S,10R,11R,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate | 958.5137303 | -4.7278 | 4.65 | 3.333 | 19 | 12 | 315.21 | 10 | 8 | 67 | 2 |
| NPC9498 | C48H76O19 | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,2R,4aS,6aR,6aS,6bR,8aR,9S,10R,11R,12aR,14bS)-9-formyl-10,11-dihydroxy-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate | 956.4980802 | -4.4715 | 4.65 | 3.44 | 19 | 11 | 312.05 | 10 | 8 | 67 | 2 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
