12 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
4 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC66343
Formula: C4H9NO3
Ingredient ID: NPC66343
| Common Name | n.a. |
| IUPAC Name | (2S)-2-azaniumyl-4-hydroxybutanoate |
| Canonical SMILES | OCC[C@@H](C(=O)O)N |
| Standard InCHI | InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1 |
| Standard InCHIKey | UKAUYVFTDYCKQA-VKHMYHEASA-N |
| Ingredient External Links |
PubChem CID: 6971022 |
| Plant-Ingredient Association Reference |
Database: HerDing Database: TCMID [23724] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pisum sativum | Pisum | Fabaceae |
  |
| Astragalus sinicus | Astragalus | Fabaceae |
 |
| Glycine falcata | Glycine | Fabaceae | |
| Salvia trijuga | Salvia | Lamiaceae |
|
| Polygonatum cyrtonema | Polygonatum | Asparagaceae |
|
| Picradeniopsis pringlei | Picradeniopsis | Asteraceae | |
| Achillea moschata | Achillea | Asteraceae | |
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Canavalia gladiata | Canavalia | Fabaceae |
|
| Agathosma thymifolia | Agathosma | Rutaceae | |
| Pterocarpus indicus | Pterocarpus | Fabaceae |
|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC57429
Formula: C4H7NO3
Ingredient ID: NPC57429
| Common Name | n.a. |
| IUPAC Name | (3S)-3-amino-4-oxobutanoic acid |
| Canonical SMILES | O=C[C@H](CC(=O)O)N |
| Standard InCHI | InChI=1S/C4H7NO3/c5-3(2-6)1-4(7)8/h2-3H,1,5H2,(H,7,8)/t3-/m0/s1 |
| Standard InCHIKey | CGJJPOYORMGCGE-VKHMYHEASA-N |
| Ingredient External Links |
PubChem CID: 6540254 |
| Plant-Ingredient Association Reference |
Database: TCMID [23532] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cistanche deserticola | Cistanche | Orobanchaceae |
|
| Changium smyrnioides | Changium | Apiaceae |
|
| Ficus simplicissima | Ficus | Moraceae |
|
| Ageratum conyzoides | Ageratum | Asteraceae |
|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC312977
Formula: C41H64O14
Ingredient ID: NPC312977
| Common Name | n.a. |
| IUPAC Name | 3-[(3S,5R,8R,10S,12R,13S,14S)-3-[(2R,4S,5S,6R)-5-[(2S,4S,5S,6R)-5-[(2S,4S,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-12,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| Canonical SMILES | O=C1OCC(=C1)C1CC[C@]2([C@]1(C)[C@H](O)CC1[C@H]2CC[C@H]2[C@]1(C)CC[C@@H](C2)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O)O |
| Standard InCHI | InChI=1S/C41H64O14/c1-19-36(47)28(42)15-34(50-19)54-38-21(3)52-35(17-30(38)44)55-37-20(2)51-33(16-29(37)43)53-24-8-10-39(4)23(13-24)6-7-26-27(39)14-31(45)40(5)25(9-11-41(26,40)48)22-12-32(46)49-18-22/h12,19-21,23-31,33-38,42-45,47-48H,6-11,13-18H2,1-5H3/t19-,20-,21-,23-,24+,25?,26-,27?,28+,29+,30+,31-,33+,34+,35+,36-,37-,38-,39+,40+,41+/m1/s1 |
| Standard InCHIKey | LTMHDMANZUZIPE-ZLPXOKQYSA-N |
| Ingredient External Links |
PubChem CID: 53477737 |
| Plant-Ingredient Association Reference |
Database: TCMID [24594] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC30127
Formula: C30H48O
Ingredient ID: NPC30127
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O=C1C=C2[C@]3(C)CC[C@@H]4[C@]([C@@H]3CC[C@]2([C@H]2[C@]1(C)CCC(C2)(C)C)C)(C)CCCC4(C)C |
| Standard InCHI | InChI=1S/C30H48O/c1-25(2)16-17-30(8)23(19-25)29(7)15-11-21-27(5)13-9-12-26(3,4)20(27)10-14-28(21,6)22(29)18-24(30)31/h18,20-21,23H,9-17,19H2,1-8H3/t20-,21-,23-,27-,28+,29+,30-/m0/s1 |
| Standard InCHIKey | GPCATANXBCPEGH-GWKPGGNQSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD36555] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dioscorea communis | Dioscorea | Dioscoreaceae |
|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC22895
Formula: C26H28O15
Ingredient ID: NPC22895
| Common Name | n.a. |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[3,4,5-trihydroxy-6-[(3,4,5,6-tetrahydroxyoxan-2-yl)oxymethyl]oxan-2-yl]chromen-4-one |
| Canonical SMILES | Oc1ccc(cc1)c1cc(=O)c2c(o1)c(c(cc2O)O)C1OC(COC2OC(O)C(C(C2O)O)O)C(C(C1O)O)O |
| Standard InCHI | InChI=1S/C26H28O15/c27-9-3-1-8(2-4-9)13-6-12(30)15-10(28)5-11(29)16(23(15)39-13)24-20(34)18(32)17(31)14(40-24)7-38-26-22(36)19(33)21(35)25(37)41-26/h1-6,14,17-22,24-29,31-37H,7H2 |
| Standard InCHIKey | JPMTYZSEANLMKJ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5364006 |
| Plant-Ingredient Association Reference |
Database: TCMID [23819] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC19174
Formula: C15H12O4
Ingredient ID: NPC19174
| Common Name | Isoliquiritigenin |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Canonical SMILES | Oc1ccc(cc1)/C=C/C(=O)c1ccc(cc1O)O |
| Standard InCHI | InChI=1S/C15H12O4/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19/h1-9,16-17,19H/b8-3+ |
| Standard InCHIKey | DXDRHHKMWQZJHT-FPYGCLRLSA-N |
| Ingredient External Links |
PubChem CID: 638278 ZINC ID: ZINC000003869608 ChEMBL ID: CHEMBL129795 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC19174] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Mitracarpus scaber | Mitracarpus | Rubiaceae | |
| Abies pinsapo var. marocana | Abies | Pinaceae | |
| Teucrium betonicum | Teucrium | Lamiaceae | |
| Centaurea solstitialis | Centaurea | Asteraceae |
|
| Xanthorrhoea resinosa | Xanthorrhoea | Asphodelaceae |
|
| Ocimum pilosum | Ocimum | Lamiaceae |
|
| Psorothamnus arborescens | Psorothamnus | Fabaceae | |
| Rhododendron ungerni | Rhododendron | Ericaceae | |
| Albizia julibrissin | Albizia | Fabaceae |
|
| Lagochilus leiacanthus | Lagochilus | Lamiaceae | |
| Glycyrrhiza yunnanensis | Glycyrrhiza | Fabaceae |
|
| Strychnos tricalysioides | Strychnos | Loganiaceae | |
| Piptostigma fugax | Piptostigma | Annonaceae | |
| Chara ceratophylla | Chara | Characeae | |
| Euphrasia genargentea | Euphrasia | Orobanchaceae | |
| Cosmos diversifolius | Cosmos | Asteraceae | |
| Trichodesma incanum | Trichodesma | Boraginaceae | |
| Dalbergia parviflora | Dalbergia | Fabaceae |
|
| Rhododendron mucronatum | Rhododendron | Ericaceae |
|
| Onobrychis viciifolia | Onobrychis | Fabaceae |
|
| Xanthorhiza simplicissima | Xanthorhiza | Ranunculaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Glycyrrhiza | Glycyrrhiza | Fabaceae |
|
| Inga velutina | Inga | Fabaceae |
|
| Curcuma caesia | Curcuma | Zingiberaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Crinum bulbispermum | Crinum | Amaryllidaceae |
|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Cathormion altissimum | Cathormion | Fabaceae | |
| Urochloa decumbens | Urochloa | Poaceae | |
| Dactylorhiza viridis | Dactylorhiza | Orchidaceae | |
| Pterolobium hexapetalum | Pterolobium | Fabaceae |
|
| Polygonatum cyrtonema | Polygonatum | Asparagaceae |
|
| Sophora tomentosa | Sophora | Fabaceae |
|
| Dalbergia louvelii | Dalbergia | Fabaceae | |
| Diplopterygium glaucum | Diplopterygium | Gleicheniaceae | |
| Platymiscium floribundum | Platymiscium | Fabaceae | |
| Erythrophleum couminga | Erythrophleum | Fabaceae |
|
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Maytenus chuchuhuasha | Maytenus | Celastraceae | |
| Anemarrhena asphodeloides | Anemarrhena | Asparagaceae |
|
| Oxytropis falcata | Oxytropis | Fabaceae | |
| Polygonatum kingianum | Polygonatum | Asparagaceae |
|
| Angelica acutiloba | Angelica | Apiaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Erythrina pallida | Erythrina | Fabaceae | |
| Solanum lanceolatum | Solanum | Solanaceae |
|
| Bryonia alba | Bryonia | Cucurbitaceae |
|
| Sophora mollis | Sophora | Fabaceae |
|
| Dracaena draco | Dracaena | Asparagaceae |
|
| Robinia pseudoacacia | Robinia | Fabaceae |
|
| Viburnum erubescens | Viburnum | Adoxaceae |
|
| Remirea maritima | Remirea | Cyperaceae | |
| Arnica mollis | Arnica | Asteraceae | |
| Dipteryx odorata | Dipteryx | Fabaceae |
|
| Eucalyptus australiana | Eucalyptus | Myrtaceae | |
| Croton gratissimus | Croton | Euphorbiaceae |
|
| Wikstroemia viridiflora | Wikstroemia | Thymelaeaceae |
|
| Polygonatum falcatum | Polygonatum | Asparagaceae |
|
| Brassica carinata | Brassica | Brassicaceae |
|
| Turpinia arguta | Turpinia | Staphyleaceae | |
| Hedysarum polybotrys | Hedysarum | Fabaceae |
|
| Ranunculus asiaticus | Ranunculus | Ranunculaceae | |
| Eurycoma harmandiana | Eurycoma | Simaroubaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Eucalyptus resinifera | Eucalyptus | Myrtaceae |
|
| Allium azureum ledeb | Allium | Amaryllidaceae | |
| Phelline lucida | Phelline | Phellinaceae | |
| Glycine max | Glycine | Fabaceae |
|
| Lactuca serriola | Lactuca | Asteraceae |
|
| Sinapis alba | Sinapis | Brassicaceae |
|
| Cicer arietinum | Cicer | Fabaceae |
|
| Artocarpus altilis | Artocarpus | Moraceae |
|
| Carpha glomerata | Carpha | Cyperaceae | |
| Cryptocarya oblata | Cryptocarya | Lauraceae | |
| Cyanostegia angustifolia | Cyanostegia | Lamiaceae | |
| Orthosiphon spicatus | Orthosiphon | Lamiaceae |
|
| Solenopsis punctaticeps | Solenopsis | Campanulaceae | |
| Lysimachia fordiana | Lysimachia | Primulaceae | |
| Ampelocera edentula | Ampelocera | Ulmaceae | |
| Ixeris debilis | Ixeris | Asteraceae | |
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
| Abies excelsa | Abies | Pinaceae |
Ingredient ID: NPC156358
Formula: C30H50O
Ingredient ID: NPC156358
| Common Name | n.a. |
| IUPAC Name | (3S,4aR,6aR,6aS,8aR,12aR,14aS,14bR)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-ol |
| Canonical SMILES | O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@H]2CC[C@@]2(C1=CC[C@@]1([C@H]2CC(C)(C)CC1)C)C)C)C |
| Standard InCHI | InChI=1S/C30H50O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-24,31H,10-19H2,1-8H3/t20-,22-,23+,24-,27-,28-,29-,30+/m0/s1 |
| Standard InCHIKey | GGGUGZHBAOMSFJ-OQQXFSLTSA-N |
| Ingredient External Links |
PubChem CID: 11876268 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD51446] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Thymus transcaucasicus | Thymus | Lamiaceae | |
| Bruguiera cylindrica | Bruguiera | Rhizophoraceae |
|
| Plantago uniflora | Plantago | Plantaginaceae | |
| Kalanchoe marmorata | Kalanchoe | Crassulaceae | |
| Rhododendron luteum | Rhododendron | Ericaceae | |
| Machilus robusta | Machilus | Lauraceae | |
| Dioscorea communis | Dioscorea | Dioscoreaceae |
|
| Thymus magnus | Thymus | Lamiaceae |
|
| Ecbolium linneanum | Ecbolium | Acanthaceae |
|
| Euphorbia lathyris | Euphorbia | Euphorbiaceae |
|
| Jacobaea arnautorum | Jacobaea | Asteraceae | |
| Pseudophegopteris subaurita | Pseudophegopteris | Thelypteridaceae |
|
| Catunaregam spinosa | Catunaregam | Rubiaceae |
|
| Symphytum tuberosum | Symphytum | Boraginaceae |
|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC155156
Formula: C4H7NO2
Ingredient ID: NPC155156
| Common Name | n.a. |
| IUPAC Name | azetidin-1-ium-2-carboxylate |
| Canonical SMILES | OC(=O)C1CCN1 |
| Standard InCHI | InChI=1S/C4H7NO2/c6-4(7)3-1-2-5-3/h3,5H,1-2H2,(H,6,7) |
| Standard InCHIKey | IADUEWIQBXOCDZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 17288; 5248351 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC155156] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Convallaria keiskei | Convallaria | Asparagaceae |
|
| Polygonatum cyrtonema | Polygonatum | Asparagaceae |
|
| Polygonatum odoratum | Polygonatum | Asparagaceae |
 |
| Beta vulgaris | Beta | Chenopodiaceae |
|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC147686
Formula: C15H12O4
Ingredient ID: NPC147686
| Common Name | Liquirtigenin |
| IUPAC Name | (2S)-7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| Canonical SMILES | Oc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)cc(cc2)O |
| Standard InCHI | InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2/t14-/m0/s1 |
| Standard InCHIKey | FURUXTVZLHCCNA-AWEZNQCLSA-N |
| Ingredient External Links |
PubChem CID: 114829 ChEMBL ID: CHEMBL252642 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC147686] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Mitracarpus scaber | Mitracarpus | Rubiaceae | |
| Abies pinsapo var. marocana | Abies | Pinaceae | |
| Teucrium betonicum | Teucrium | Lamiaceae | |
| Euphrasia genargentea | Euphrasia | Orobanchaceae | |
| Helichrysum asperum | Helichrysum | Asteraceae |
|
| Dalbergia parviflora | Dalbergia | Fabaceae |
|
| Dioscorea nipponica | Dioscorea | Dioscoreaceae |
|
| Xanthorhiza simplicissima | Xanthorhiza | Ranunculaceae |
|
| Glycyrrhiza | Glycyrrhiza | Fabaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Searsia leptodictya | Searsia | Anacardiaceae |
|
| Lophopetalum toxicum | Lophopetalum | Celastraceae | |
| Jasminum sambac | Jasminum | Oleaceae |
|
| Anthoceros punctatus | Anthoceros | Anthocerotaceae | |
| Dactylorhiza viridis | Dactylorhiza | Orchidaceae | |
| Elaeocarpus sphaericus | Elaeocarpus | Elaeocarpaceae |
|
| Pterolobium hexapetalum | Pterolobium | Fabaceae |
|
| Panax notoginseng | Panax | Araliaceae |
|
| Lupinus holosericeus | Lupinus | Fabaceae | |
| Cinchona officinalis | Cinchona | Rubiaceae |
|
| Datura wrightii | Datura | Solanaceae | |
| Polygonatum cyrtonema | Polygonatum | Asparagaceae |
|
| Angelica hirsutiflora | Angelica | Apiaceae | |
| Clausena suffruticosa | Clausena | Rutaceae | |
| Lysimachia christinae | Lysimachia | Primulaceae |
|
| Diplopterygium glaucum | Diplopterygium | Gleicheniaceae | |
| Platymiscium floribundum | Platymiscium | Fabaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Glycine soja | Glycine | Fabaceae |
|
| Maytenus chuchuhuasha | Maytenus | Celastraceae | |
| Dorstenia dinklagei | Dorstenia | Moraceae | |
| Croton zehntneri | Croton | Euphorbiaceae | |
| Oxytropis falcata | Oxytropis | Fabaceae | |
| Sapium haematospermum | Sapium | Euphorbiaceae |
|
| Polygonatum kingianum | Polygonatum | Asparagaceae |
|
| Angelica acutiloba | Angelica | Apiaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Solanum lanceolatum | Solanum | Solanaceae |
|
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Bryonia alba | Bryonia | Cucurbitaceae |
|
| Viburnum erubescens | Viburnum | Adoxaceae |
|
| Remirea maritima | Remirea | Cyperaceae | |
| Arnica mollis | Arnica | Asteraceae | |
| Daemonorops draco | Daemonorops | Arecaceae |
|
| Croton gratissimus | Croton | Euphorbiaceae |
|
| Wikstroemia viridiflora | Wikstroemia | Thymelaeaceae |
|
| Polygonatum falcatum | Polygonatum | Asparagaceae |
|
| Brassica carinata | Brassica | Brassicaceae |
|
| Turpinia arguta | Turpinia | Staphyleaceae | |
| Hedysarum polybotrys | Hedysarum | Fabaceae |
|
| Ranunculus asiaticus | Ranunculus | Ranunculaceae | |
| Eurycoma harmandiana | Eurycoma | Simaroubaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Eucalyptus resinifera | Eucalyptus | Myrtaceae |
|
| Sinapis alba | Sinapis | Brassicaceae |
|
| Carpha glomerata | Carpha | Cyperaceae | |
| Cyanostegia angustifolia | Cyanostegia | Lamiaceae | |
| Orthosiphon spicatus | Orthosiphon | Lamiaceae |
|
| Lysimachia fordiana | Lysimachia | Primulaceae | |
| Ampelocera edentula | Ampelocera | Ulmaceae | |
| Ixeris debilis | Ixeris | Asteraceae | |
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
| Abies excelsa | Abies | Pinaceae |
Ingredient ID: NPC133961
Formula: C6H12O6
Ingredient ID: NPC133961
| Common Name | n.a. |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal |
| Canonical SMILES | OCC(C(C(C(C=O)O)O)O)O |
| Standard InCHI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2 |
| Standard InCHIKey | GZCGUPFRVQAUEE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 24749 |
| Plant-Ingredient Association Reference |
Database: TCMID [13500] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sinopodophyllum hexandrum | Sinopodophyllum | Berberidaceae |
|
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Changium smyrnioides | Changium | Apiaceae |
|
| Codonopsis pilosula | Codonopsis | Campanulaceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Papaver somniferum | Papaver | Papaveraceae |
|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC107482
Formula: C6H6O3
Ingredient ID: NPC107482
| Common Name | 5-Hydroxymethyl-Furfural |
| IUPAC Name | 5-(hydroxymethyl)furan-2-carbaldehyde |
| Canonical SMILES | OCc1ccc(o1)C=O |
| Standard InCHI | InChI=1S/C6H6O3/c7-3-5-1-2-6(4-8)9-5/h1-3,8H,4H2 |
| Standard InCHIKey | NOEGNKMFWQHSLB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 237332 ZINC ID: ZINC000000900788 ChEMBL ID: CHEMBL185885 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC107482] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Dioscorea japonica | Dioscorea | Dioscoreaceae |
|
| Ranunculus ternatus | Ranunculus | Ranunculaceae | |
| Tithonia rotundifolia | Tithonia | Asteraceae |
|
| Stellaria dichotoma | Stellaria | Caryophyllaceae | |
| Asparagus cochinchinensis | Asparagus | Asparagaceae |
|
| Eleutherococcus senticosus | Eleutherococcus | Araliaceae |
|
| Dendrobium chrysanthum | Dendrobium | Orchidaceae |
|
| Albizia julibrissin | Albizia | Fabaceae |
|
| Atractylodes chinensis | Atractylodes | Asteraceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Hymenoxys microcephala | Hymenoxys | Asteraceae | |
| Trichosanthes bracteata | Trichosanthes | Cucurbitaceae |
|
| Achyranthes fauriei | Achyranthes | Amaranthaceae |
|
| Schefflera divaricata | Schefflera | Araliaceae | |
| Tecoma heptaphylla | Tecoma | Bignoniaceae | |
| Saussurea cordifolia | Saussurea | Asteraceae | |
| Lobelia chinensis | Lobelia | Campanulaceae |
|
| Scrophularia nodosa | Scrophularia | Scrophulariaceae |
|
| Dioscorea collettii var. hypoglauca | Dioscorea | Dioscoreaceae | |
| Achyranthes bidentata | Achyranthes | Amaranthaceae |
|
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Codonopsis pilosula | Codonopsis | Campanulaceae |
|
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Ephedra herba | Ephedra | Ephedraceae | |
| Lycium chinense | Lycium | Solanaceae |
|
| Carthamus tinctorius | Carthamus | Asteraceae |
|
| Clerodendrum trichotomum | Clerodendrum | Lamiaceae |
|
| Pinellia ternata | Pinellia | Araceae |
|
| Curculigo orchioides | Curculigo | Hypoxidaceae |
|
| Dendrobium chrysotoxum | Dendrobium | Orchidaceae |
|
| Rhododendron dauricum | Rhododendron | Ericaceae |
|
| Trichosanthes kirilowii | Trichosanthes | Cucurbitaceae |
|
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Polygonatum cyrtonema | Polygonatum | Asparagaceae |
|
| Achyranthes japonica | Achyranthes | Amaranthaceae |
|
| Dendrobium fimbriatum | Dendrobium | Orchidaceae |
|
| Lycium barbarum | Lycium | Solanaceae |
|
| Imperata cylindrica | Imperata | Poaceae |
|
| Jatropha curcas | Jatropha | Euphorbiaceae |
|
| Dioscorea polystachya | Dioscorea | Dioscoreaceae |
|
| Xanthium strumarium | Xanthium | Asteraceae |
|
| Citrus reticulata | Citrus | Rutaceae |
|
| Acorus calamus | Acorus | Acoraceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Euphorbia hirta | Euphorbia | Euphorbiaceae |
|
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Anemarrhena asphodeloides | Anemarrhena | Asparagaceae |
|
| Prunus mume | Prunus | Rosaceae |
|
| Polygonatum kingianum | Polygonatum | Asparagaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Alisma orientalis | Alisma | Alismataceae | |
| Amomum neoaurantiacum | Amomum | Zingiberaceae | |
| Dendrobium nobile | Dendrobium | Orchidaceae |
|
| Homalomena occulta | Homalomena | Araceae |
|
| Aconitum zuccarini | Aconitum | Ranunculaceae | |
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Trichosanthes rosthornii | Trichosanthes | Cucurbitaceae |
|
| Arum ternatum thunb | Arum | Araceae | |
| Scrophularia ningpoensis | Scrophularia | Scrophulariaceae |
|
| Codonopsis radix | Codonopsis | Campanulaceae | |
| Liriope muscari | Liriope | Asparagaceae |
|
| Acorus gramineus | Acorus | Acoraceae |
|
| Polygonatum falcatum | Polygonatum | Asparagaceae |
|
| Chamaecyparis pisifera | Chamaecyparis | Cupressaceae |
|
| Scrophularia buergeriana | Scrophularia | Scrophulariaceae |
|
| Clematis chinensis | Clematis | Ranunculaceae |
|
| Persicaria perfoliata | Persicaria | Polygonaceae |
|
| Dioscorea opposita | Dioscorea | Dioscoreaceae |
|
| Gypsophila licentiana hand.-mazz. | Gypsophila | Caryophyllaceae | |
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Schisandra chinensis | Schisandra | Schisandraceae |
|
| Dendrobium loddigesii | Dendrobium | Orchidaceae |
|
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Ophiopogon japonicus | Ophiopogon | Asparagaceae |
|
| Crocus sativus | Crocus | Iridaceae |
|
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Ingredient ID: NPC100551
Formula: C7H6O3
Ingredient ID: NPC100551
| Common Name | Salicylic Acid |
| IUPAC Name | 2-hydroxybenzoic acid |
| Canonical SMILES | OC(=O)c1ccccc1O |
| Standard InCHI | InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
| Standard InCHIKey | YGSDEFSMJLZEOE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 338 ChEMBL ID: CHEMBL424 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC100551] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Citrus unshiu | Citrus | Rutaceae |
|
| Passiflora incarnata | Passiflora | Passifloraceae |
|
| Bletilla striata | Bletilla | Orchidaceae |
|
| Centella asiatica | Centella | Apiaceae |
|
| Alstonia muelleriana | Alstonia | Apocynaceae | |
| Dacrydium cupressinum | Dacrydium | Podocarpaceae |
|
| Trigonella grandiflora | Trigonella | Fabaceae | |
| Nicotiana undulata | Nicotiana | Solanaceae | |
| Artemisia cina | Artemisia | Asteraceae |
|
| Cedronella canariensis | Cedronella | Lamiaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Humata pectinata | Humata | Davalliaceae | |
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Isodon japonica var. glaucocalyx | Isodon | Lamiaceae | |
| Broussonetia kazinoki | Broussonetia | Moraceae |
|
| Inula britannica | Inula | Asteraceae |
|
| Physalis edulis | Physalis | Solanaceae | |
| Diospyros kaki | Diospyros | Ebenaceae |
|
| Artemisia scoparia | Artemisia | Asteraceae |
|
| Tripolium pannonicum | Tripolium | Asteraceae | |
| Rubus coreanus | Rubus | Rosaceae |
|
| Melia azedarach | Melia | Meliaceae |
|
| Gleditsia caspica | Gleditsia | Fabaceae |
|
| Coreopsis nodosa | Coreopsis | Asteraceae | |
| Rubus idaeus | Rubus | Rosaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Uvaria calamistrata | Uvaria | Annonaceae |
|
| Plantago major | Plantago | Plantaginaceae |
|
| Hordeum vulgare | Hordeum | Poaceae |
|
| Polygonatum cyrtonema | Polygonatum | Asparagaceae |
|
| Paeonia suffruticosa | Paeonia | Paeoniaceae |
|
| Haematococcus lacustris | Haematococcus | Haematococcaceae | |
| Swertia angustifolia | Swertia | Gentianaceae |
|
| Bistorta vivipara | Bistorta | Polygonaceae |
|
| Citrus reticulata | Citrus | Rutaceae |
|
| Rubus chingii | Rubus | Rosaceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Pteris multifida | Pteris | Pteridaceae |
|
| Swertia swertopsis | Swertia | Gentianaceae | |
| Premna tomentosa | Premna | Lamiaceae |
|
| Sagittaria sagittifolia | Sagittaria | Alismataceae |
|
| Cunonia macrophylla | Cunonia | Cunoniaceae |
|
| Tsuga chinensis | Tsuga | Pinaceae |
|
| Taxus brevifolia | Taxus | Taxaceae |
|
| Virgilia divaricata | Virgilia | Fabaceae | |
| Entada rheedei | Entada | Fabaceae |
|
| Aucuba chinensis | Aucuba | Garryaceae | |
| Utricularia australis | Utricularia | Lentibulariaceae | |
| Actaea simplex | Actaea | Ranunculaceae | |
| Amsinckia tessellata | Amsinckia | Boraginaceae | |
| Carica dodecaphylla | Carica | Caricaceae | |
| Citrus tangerina | Citrus | Rutaceae |
|
| Crocus minimus | Crocus | Iridaceae |
|
| Curculigo pilosa | Curculigo | Hypoxidaceae |
|
| Sideritis euboea | Sideritis | Lamiaceae | |
| Osteospermum muricatum | Osteospermum | Asteraceae | |
| Centaurea huber-morathii | Centaurea | Asteraceae | |
| Sisyrinchium californicum | Sisyrinchium | Iridaceae | |
| Saussurea amara | Saussurea | Asteraceae | |
| Lysiana subfalcata | Lysiana | Loranthaceae |
|
| Haplophyllum ramosissimum | Haplophyllum | Rutaceae | |
| Peperomia vulcanica | Peperomia | Piperaceae |
|
| Sorbus tianschanica | Sorbus | Rosaceae |
|
| Platycarya strobilacea | Platycarya | Juglandaceae |
|
| Helichrysum mixtum | Helichrysum | Asteraceae | |
| Cynometra lujae | Cynometra | Fabaceae | |
| Aspalathus linearis | Aspalathus | Fabaceae |
|
| Eupatorium areolare | Eupatorium | Asteraceae | |
| Stephania elegans | Stephania | Menispermaceae |
|
| Calendula officinalis | Calendula | Asteraceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Polygonatum kingianum | Polygonatum | Asparagaceae |
|
| Brickellia vernicosa | Brickellia | Asteraceae | |
| Macaranga peltata | Macaranga | Euphorbiaceae |
|
| Mangifera indica | Mangifera | Anacardiaceae |
|
| Isatis indigotica | Isatis | Brassicaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Tabebuia avellanedae | Tabebuia | Bignoniaceae |
|
| Aconitum carmichaelii | Aconitum | Ranunculaceae |
|
| Glycine tomentella | Glycine | Fabaceae |
|
| Broussonetia papyrifera | Broussonetia | Moraceae |
|
| Polygonatum falcatum | Polygonatum | Asparagaceae |
|
| Pseudostellaria heterophylla | Pseudostellaria | Caryophyllaceae |
|
| Kali turgidum | Kali | Chenopodiaceae |
|
| Panax schinseng | Panax | Araliaceae | |
| Citrus aurantium | Citrus | Rutaceae |
|
| Aconitum japonicum | Aconitum | Ranunculaceae |
|
| Senecio paludaffinis | Senecio | Asteraceae | |
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Schisandra chinensis | Schisandra | Schisandraceae |
|
| Crocus sativus | Crocus | Iridaceae |
|
| Parablechnum minus | Parablechnum | Blechnaceae | |
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC100551 | C7H6O3 | Salicylic Acid | 138.03 | -0.7001 | 1.9 | 2.264 | 2 | 2 | 57.53 | 3 | 1 | 10 | 0 |
| NPC107482 | C6H6O3 | 5-Hydroxymethyl-Furfural | 126.03 | -0.7952 | 1.79 | 0.422 | 2 | 1 | 50.44 | 3 | 1 | 9 | 0 |
| NPC133961 | C6H12O6 | 2,3,4,5,6-pentahydroxyhexanal | 180.0633881 | -2.7906 | 1.46 | -3.325 | 6 | 5 | 118.22 | 5 | 0 | 12 | 0 |
| NPC147686 | C15H12O4 | Liquirtigenin | 256.07 | -1.3541 | 2.67 | 1.86 | 1 | 2 | 66.76 | 3 | 3 | 19 | 0 |
| NPC155156 | C4H7NO2 | 101.0476785 | -1.0937 | 1.57 | -0.543 | 3 | 2 | 49.33 | 2 | 1 | 7 | 0 | |
| NPC156358 | C30H50O | (3S,4aR,6aR,6aS,8aR,12aR,14aS,14bR)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-ol | 426.3861662 | 3.4636 | 4.65 | 11.352 | 1 | 1 | 20.23 | 0 | 5 | 31 | 1 |
| NPC19174 | C15H12O4 | Isoliquiritigenin | 256.07 | -1.2836 | 2.67 | 2.764 | 1 | 3 | 77.76 | 6 | 2 | 19 | 0 |
| NPC22895 | C26H28O15 | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[3,4,5-trihydroxy-6-[(3,4,5,6-tetrahydroxyoxan-2-yl)oxymethyl]oxan-2-yl]chromen-4-one | 580.1428202 | -5.6961 | 2.67 | -1.908 | 11 | 10 | 256.29 | 5 | 5 | 41 | 2 |
| NPC30127 | C30H48O | 424.3705162 | 3.345 | 4.65 | 11.147 | 1 | 0 | 17.07 | 0 | 5 | 31 | 1 | |
| NPC312977 | C41H64O14 | 3-[(3S,5R,8R,10S,12R,13S,14S)-3-[(2R,4S,5S,6R)-5-[(2S,4S,5S,6R)-5-[(2S,4S,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-12,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one | 780.4296067 | -3.6782 | 4.43 | 2.174 | 14 | 6 | 203.06 | 7 | 8 | 55 | 2 |
| NPC57429 | C4H7NO3 | (3S)-3-amino-4-oxobutanoic acid | 117.0425931 | -1.3044 | 1.46 | -1.127 | 4 | 2 | 80.39 | 3 | 0 | 8 | 0 |
| NPC66343 | C4H9NO3 | (2S)-2-azaniumyl-4-hydroxybutanoate | 119.0582431 | -1.8835 | 1.46 | -3.598 | 4 | 3 | 83.55 | 3 | 0 | 8 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
