42 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
8 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC99865
Formula: C15H18O5
Ingredient ID: NPC99865
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O=C1/C(=C[C@@H]2O[C@H]2[C@@](CC[C@@H]2[C@@H]1OC(=O)C2=C)(C)O)/C |
| Standard InCHI | InChI=1S/C15H18O5/c1-7-6-10-13(19-10)15(3,18)5-4-9-8(2)14(17)20-12(9)11(7)16/h6,9-10,12-13,18H,2,4-5H2,1,3H3/b7-6-/t9-,10-,12-,13+,15-/m0/s1 |
| Standard InCHIKey | RHXYXANCKVYEID-DVLGHZBISA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD38220] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
 |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC88485
Formula: C22H22O12
Ingredient ID: NPC88485
| Common Name | n.a. |
| IUPAC Name | 2-(3,5-dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-3-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
| Canonical SMILES | COc1c(O)cc(cc1O)c1oc2cc(O)cc(c2c(=O)c1O[C@@H]1OC(C)[C@@H](C([C@@H]1O)O)O)O |
| Standard InCHI | InChI=1S/C22H22O12/c1-7-15(27)17(29)18(30)22(32-7)34-21-16(28)14-10(24)5-9(23)6-13(14)33-19(21)8-3-11(25)20(31-2)12(26)4-8/h3-7,15,17-18,22-27,29-30H,1-2H3/t7?,15-,17?,18-,22-/m0/s1 |
| Standard InCHIKey | NAQNISJXKDSYJD-KAWLKDMASA-N |
| Ingredient External Links |
PubChem CID: 44259504 |
| Plant-Ingredient Association Reference |
Database: TCMID [13621] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Syzygium samarangense | Syzygium | Myrtaceae |
 |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Syzygium cumini | Syzygium | Myrtaceae |
|
Ingredient ID: NPC86246
Formula: C12H16O2
Ingredient ID: NPC86246
| Common Name | n.a. |
| IUPAC Name | [(2R)-4-phenylbutan-2-yl] acetate |
| Canonical SMILES | C[C@@H](OC(=O)C)CCc1ccccc1 |
| Standard InCHI | InChI=1S/C12H16O2/c1-10(14-11(2)13)8-9-12-6-4-3-5-7-12/h3-7,10H,8-9H2,1-2H3/t10-/m1/s1 |
| Standard InCHIKey | IVEWTAOGAGBQGG-SNVBAGLBSA-N |
| Ingredient External Links |
PubChem CID: 6950760 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD59703] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC85698
Formula: C15H20O3
Ingredient ID: NPC85698
| Common Name | n.a. |
| IUPAC Name | (3aS,5aR,6R,9aS,9bS)-6-hydroxy-5a-methyl-3,9-dimethylidene-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-2-one |
| Canonical SMILES | C=C1CC[C@H]([C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC2)C)O |
| Standard InCHI | InChI=1S/C15H20O3/c1-8-4-5-11(16)15(3)7-6-10-9(2)14(17)18-13(10)12(8)15/h10-13,16H,1-2,4-7H2,3H3/t10-,11+,12+,13-,15-/m0/s1 |
| Standard InCHIKey | FKBUODICGDOIGB-PFFFPCNUSA-N |
| Ingredient External Links |
PubChem CID: 482788 ZINC ID: ZINC000006491310 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC85698] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Eleutherococcus giraldii | Eleutherococcus | Araliaceae | |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC80181
Formula: C15H26O2
Ingredient ID: NPC80181
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C[C@@](CC/C=C(/C[C@H](C=C(C)C)O)C)(O)C |
| Standard InCHI | InChI=1S/C15H26O2/c1-6-15(5,17)9-7-8-13(4)11-14(16)10-12(2)3/h6,8,10,14,16-17H,1,7,9,11H2,2-5H3/b13-8+/t14-,15-/m0/s1 |
| Standard InCHIKey | TZCKNDPYYKEPHO-DMUBJSPUSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD93615] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC74458
Formula: C10H12O
Ingredient ID: NPC74458
| Common Name | Benzylacetone |
| IUPAC Name | 4-phenylbutan-2-one |
| Canonical SMILES | CC(=O)CCc1ccccc1 |
| Standard InCHI | InChI=1S/C10H12O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| Standard InCHIKey | AKGGYBADQZYZPD-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 17355 ZINC ID: ZINC000001587606 ChEMBL ID: CHEMBL1490851 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC74458] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aquilaria agallochum | Aquilaria | Thymelaeaceae |
|
| Aquilaria sinensis | Aquilaria | Thymelaeaceae |
|
| Mosla chinensis | Mosla | Lamiaceae |
|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Rhododendron dauricum | Rhododendron | Ericaceae |
|
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Imperata cylindrica | Imperata | Poaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC55726
Formula: C15H22O7
Ingredient ID: NPC55726
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O=C1O[C@@H]2[C@H](C1=C)CC[C@@]([C@]1([C@@H]2[C@](C)(O)[C@@H]([C@@H]1O)O)O)(C)O |
| Standard InCHI | InChI=1S/C15H22O7/c1-6-7-4-5-13(2,19)15(21)9(8(7)22-12(6)18)14(3,20)10(16)11(15)17/h7-11,16-17,19-21H,1,4-5H2,2-3H3/t7-,8+,9-,10+,11-,13+,14-,15+/m0/s1 |
| Standard InCHIKey | FTHQHWNKKLTVLA-XSIQZWMISA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD111922] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC52005
Formula: C16H12O6
Ingredient ID: NPC52005
| Common Name | Diosmetin |
| IUPAC Name | 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)chromen-4-one |
| Canonical SMILES | COc1ccc(cc1O)c1cc(=O)c2c(o1)cc(cc2O)O |
| Standard InCHI | InChI=1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 |
| Standard InCHIKey | MBNGWHIJMBWFHU-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281612 ChEMBL ID: CHEMBL90568 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD113143] Database: NPASS [NPC52005] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Nerium oleander | Nerium | Apocynaceae |
|
| Othonna sedifolia | Othonna | Asteraceae | |
| Aristolochia maxima | Aristolochia | Aristolochiaceae |
|
| Chrysanthemum sinense | Chrysanthemum | Asteraceae | |
| Pterocarpus officinalis | Pterocarpus | Fabaceae |
|
| Vernonia lanuginosa | Vernonia | Asteraceae | |
| Betula mandshurica | Betula | Betulaceae |
|
| Calycanthus floridus | Calycanthus | Calycanthaceae |
|
| Cirsium setosum | Cirsium | Asteraceae |
|
| Achillea collina | Achillea | Asteraceae | |
| Vepris nobilis | Vepris | Rutaceae |
|
| Adenia globosa | Adenia | Passifloraceae | |
| Aglaia grandis | Aglaia | Meliaceae |
|
| Mikania obtusata | Mikania | Asteraceae | |
| Catunaregam tomentosa | Catunaregam | Rubiaceae |
|
| Torilis japonica | Torilis | Apiaceae |
|
| Liriodendron tulipifera | Liriodendron | Magnoliaceae |
 |
| Orobanche speciosa | Orobanche | Orobanchaceae | |
| Veronica pectinata | Veronica | Plantaginaceae | |
| Jasminum officinale | Jasminum | Oleaceae |
 |
| Plantago lanceolata | Plantago | Plantaginaceae |
|
| Bergenia purpurascens | Bergenia | Saxifragaceae |
|
| Mentha canadensis | Mentha | Lamiaceae |
|
| Cryptotaenia japonica | Cryptotaenia | Apiaceae |
|
| Kadsura interior | Kadsura | Schisandraceae |
|
| Scabiosa comosa | Scabiosa | Caprifoliaceae |
|
| Lobelia chinensis | Lobelia | Campanulaceae |
|
| Asparagus africanus | Asparagus | Asparagaceae |
|
| Polygala myrtifolia | Polygala | Polygalaceae | |
| Cnidium monnieri | Cnidium | Apiaceae |
|
| Tripodanthus acutifolius | Tripodanthus | Loranthaceae |
|
| Ligularia platyglossa | Ligularia | Asteraceae |
|
| Convallaria majalis | Convallaria | Asparagaceae |
|
| Rhodiola krylovii | Rhodiola | Crassulaceae | |
| Croton rhamnifolius | Croton | Euphorbiaceae | |
| Penstemon newberryi | Penstemon | Plantaginaceae | |
| Rapanea myricoides | Rapanea | Primulaceae | |
| Citrus wilsonii | Citrus | Rutaceae |
|
| Crataegus sinaica | Crataegus | Rosaceae |
|
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Malus asiatica | Malus | Rosaceae |
|
| Artemisia vachanica | Artemisia | Asteraceae | |
| Lasiocephalus ovatus | Lasiocephalus | Asteraceae | |
| Montrouziera sphaeroidea | Montrouziera | Clusiaceae | |
| Cotoneaster orbicularis | Cotoneaster | Rosaceae | |
| Bischofia trifoliata | Bischofia | Phyllanthaceae | |
| Rabdosia angustifolia | Isodon | Lamiaceae | |
| Pimpinella saxifraga | Pimpinella | Apiaceae |
|
| Caragana tibetica | Caragana | Fabaceae |
|
| Macrotyloma axillare | Macrotyloma | Fabaceae | |
| Trigonostemon reidioides | Trigonostemon | Euphorbiaceae |
|
| Euphorbia ferganensis | Euphorbia | Euphorbiaceae | |
| Arachniodes dimorphophylla | Arachniodes | Dryopteridaceae | |
| Oreosolen wattii | Oreosolen | Scrophulariaceae | |
| Discaria crenata | Discaria | Rhamnaceae | |
| Schizonepeta tenuisfolia | Schizonepeta | Lamiaceae | |
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Solanum chilense | Solanum | Solanaceae | |
| Artemisia anomala | Artemisia | Asteraceae |
|
| Cirsium japonicum | Cirsium | Asteraceae |
|
| Scutellaria seleriana | Scutellaria | Lamiaceae | |
| Eclipta prostrata | Eclipta | Asteraceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Smilax bracteata | Smilax | Smilacaceae |
|
| Trichosanthes kirilowii | Trichosanthes | Cucurbitaceae |
|
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Tropaeolum speciosum | Tropaeolum | Tropaeolaceae | |
| Mentha arvensis | Mentha | Lamiaceae |
|
| Cytisus scoparius | Cytisus | Fabaceae |
|
| Tynanthus panurensis | Tynanthus | Bignoniaceae | |
| Aconitum brevicalcaratum | Aconitum | Ranunculaceae | |
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Hansenia forbesii | Hansenia | Apiaceae | |
| Scutellaria sieberi | Scutellaria | Lamiaceae | |
| Crinum kirkii | Crinum | Amaryllidaceae |
|
| Christisonia bicolor | Christisonia | Orobanchaceae | |
| Solanum bahamense | Solanum | Solanaceae | |
| Atroxima liberica | Atroxima | Polygalaceae | |
| Isodon japonicus | Isodon | Lamiaceae |
|
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Linum crispum | Linum | Linaceae | |
| Tinospora smilacina | Tinospora | Menispermaceae |
|
| Palafoxia texana | Palafoxia | Asteraceae | |
| Taraxacum officinale | Taraxacum | Asteraceae |
|
| Tetrapanax papyrifer | Tetrapanax | Araliaceae |
|
| Sophora viciifolia | Sophora | Fabaceae |
|
| Sanguisorba officinalis | Sanguisorba | Rosaceae |
|
| Sarcomelicope argyrophylla | Sarcomelicope | Rutaceae | |
| Hypericum triquetrifolium | Hypericum | Hypericaceae |
|
| Daiswa polyphylla | Daiswa | Melanthiaceae |
|
| Isodon rubescens | Isodon | Lamiaceae | |
| Ostericum grosseserratum | Ostericum | Apiaceae |
|
| Ammodendron conollyi | Ammodendron | Fabaceae | |
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Cirsium dipsacolepis | Cirsium | Asteraceae |
|
| Mesembryanthemum anatomicum | Mesembryanthemum | Aizoaceae |
|
| Malva sylvestris | Malva | Malvaceae |
|
| Viguiera annua | Viguiera | Asteraceae | |
| Trichosanthes rosthornii | Trichosanthes | Cucurbitaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Zanthoxylum myriacanthum | Zanthoxylum | Rutaceae |
|
| Lawsonia inermis | Lawsonia | Lythraceae |
|
| Anaphalis araneosa | Anaphalis | Asteraceae | |
| Bhesa nitidissima | Bhesa | Centroplacaceae | |
| Petroselinum crispum | Petroselinum | Apiaceae |
|
| Eria subsessilis | Eria | Orchidaceae | |
| Cocculus diversifolius | Cocculus | Menispermaceae | |
| Myrica multiflora | Myrica | Myricaceae |
|
| Bergenia crassifolia | Bergenia | Saxifragaceae |
|
| Trifolium apertum | Trifolium | Fabaceae | |
| Rothmannia wittii | Rothmannia | Rubiaceae |
|
| Vatica diospyroides | Vatica | Dipterocarpaceae | |
| Solanum racemigerum | Solanum | Solanaceae | |
| Teucrium pestalozzae | Teucrium | Lamiaceae | |
| Ranzania japonica | Ranzania | Berberidaceae | |
| Impatiens edgeworthii | Impatiens | Balsaminaceae | |
| Artemisia kurramensis | Artemisia | Asteraceae | |
| Episcia cupreata | Episcia | Gesneriaceae | |
| Camellia sinensis | Camellia | Theaceae |
|
| Pseudocinchona pachyceras | Pseudocinchona | Rubiaceae | |
| Knightia deplanchei | Knightia | Proteaceae | |
| Pithecellobium clypearia | Pithecellobium | Fabaceae |
|
| Licaria brasiliensis | Licaria | Lauraceae | |
| Schizonepeta tenuifolia | Schizonepeta | Lamiaceae |
|
| Crotalaria orixensis | Crotalaria | Fabaceae |
|
| Ptilidium ciliare | Ptilidium | Ptilidiaceae | |
| Cnidium monieri | Cnidium | Apiaceae | |
| Jasonia candicans | Jasonia | Asteraceae | |
| Annona rensoniana | Annona | Annonaceae | |
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Zanthoxylum nitidum | Zanthoxylum | Rutaceae |
|
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC48527
Formula: C17H20O6
Ingredient ID: NPC48527
| Common Name | n.a. |
| IUPAC Name | [(1R)-2-methyl-3-[(2S,3S)-4-methylidene-5-oxo-3-(3-oxobutyl)oxolan-2-yl]-4-oxocyclopent-2-en-1-yl] acetate |
| Canonical SMILES | CC(=O)CC[C@@H]1[C@H](OC(=O)C1=C)C1=C(C)[C@@H](CC1=O)OC(=O)C |
| Standard InCHI | InChI=1S/C17H20O6/c1-8(18)5-6-12-9(2)17(21)23-16(12)15-10(3)14(7-13(15)20)22-11(4)19/h12,14,16H,2,5-7H2,1,3-4H3/t12-,14+,16-/m0/s1 |
| Standard InCHIKey | PZAALKURFIAXND-BJJXKVORSA-N |
| Ingredient External Links |
PubChem CID: 101609005 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD158807] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC47781
Formula: C18H16O7
Ingredient ID: NPC47781
| Common Name | Cirsileneol |
| IUPAC Name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxychromen-4-one |
| Canonical SMILES | COc1cc2oc(cc(=O)c2c(c1OC)O)c1ccc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C18H16O7/c1-22-13-6-9(4-5-10(13)19)12-7-11(20)16-14(25-12)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
| Standard InCHIKey | VKOSQMWSWLZQPA-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 162464 ZINC ID: ZINC000000338331 ChEMBL ID: CHEMBL487213 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC47781] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia apiacea | Artemisia | Asteraceae |
|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Tulipa sylvestris | Tulipa | Liliaceae |
|
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Dacryodes normandii | Dacryodes | Burseraceae | |
| Riccia fluitans | Riccia | Ricciaceae | |
| Salvia palaestina | Salvia | Lamiaceae | |
| Chromolaena odorata | Chromolaena | Asteraceae |
|
| Ilex affinis | Ilex | Aquifoliaceae |
|
| Anaxagorea clavata | Anaxagorea | Annonaceae | |
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Stenostomum lucidum | Stenostomum | Rubiaceae | |
| Beyeria brevifolia | Beyeria | Euphorbiaceae | |
| Kaempferia pulchra | Kaempferia | Zingiberaceae |
|
| Drosera peltata | Drosera | Droseraceae |
|
| Arnica nevadensis | Arnica | Asteraceae | |
| Odixia angusta | Odixia | Asteraceae | |
| Prunus laurocerasus | Prunus | Rosaceae |
|
| Ficus formosana | Ficus | Moraceae |
|
| Dipterocarpus alatus | Dipterocarpus | Dipterocarpaceae |
|
| Echinops amplexicaulis | Echinops | Asteraceae |
|
| Quercus aegilops | Quercus | Fagaceae |
|
| Chloranthus tianmushanensis | Chloranthus | Chloranthaceae | |
| Prosopis glandulosa | Prosopis | Fabaceae |
|
| Aria pallescens | Aria | Rosaceae | |
| Simira eliezeriana | Simira | Rubiaceae | |
| Senecio squalidus | Senecio | Asteraceae |
|
| Araujia sericifera | Araujia | Apocynaceae |
|
| Artemisia monogyna | Artemisia | Asteraceae | |
| Epaltes gariepina | Epaltes | Asteraceae | |
| Seriphidium cinum | Seriphidium | Asteraceae |
|
| Dendrosenecio kilimanjari | Dendrosenecio | Asteraceae | |
| Isodon kameba | Isodon | Lamiaceae |
|
| Pterocarpus grandiflorus | Pterocarpus | Fabaceae | |
| Citrus reticulata | Citrus | Rutaceae |
|
| Chromolaena pulchella | Chromolaena | Asteraceae | |
| Bursaria spinosa | Bursaria | Pittosporaceae |
|
| Taxodium mucronatum | Taxodium | Cupressaceae |
|
| Gardenia fosbergii | Gardenia | Rubiaceae | |
| Vitex madiensis | Vitex | Lamiaceae |
|
| Agnorhiza bolanderi | Agnorhiza | Asteraceae | |
| Artemisia annua | Artemisia | Asteraceae |
|
| Vatica cinerea | Vatica | Dipterocarpaceae | |
| Sesbania punicea | Sesbania | Fabaceae | |
| Artemisia capillaries | Artemisia | Asteraceae | |
| Artemisia chinensis | Artemisia | Asteraceae |
|
| Fritillaria thunbergii | Fritillaria | Liliaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Plectranthus sylvestris | Plectranthus | Lamiaceae |
|
| Eschscholzia californica | Eschscholzia | Papaveraceae |
|
| Bryum weigelii | Bryum | Bryaceae | |
| Walsura chrysogyne | Walsura | Meliaceae | |
| Salvia officinalis | Salvia | Lamiaceae |
|
| Mulguraea tridens | Junellia | Verbenaceae | |
| Securidaca inappendiculata | Securidaca | Polygalaceae |
|
| Pteris prolifera | Pteris | Pteridaceae | |
| Eupatorium lindleyanum | Eupatorium | Asteraceae |
|
| Plantago cornuti | Plantago | Plantaginaceae |
|
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC41587
Formula: C16H20O5
Ingredient ID: NPC41587
| Common Name | n.a. |
| IUPAC Name | (4S,5S)-5-[(3R)-3-methoxy-2-methyl-5-oxocyclopenten-1-yl]-3-methylidene-4-(3-oxobutyl)oxolan-2-one |
| Canonical SMILES | CO[C@@H]1CC(=O)C(=C1C)[C@H]1OC(=O)C(=C)[C@@H]1CCC(=O)C |
| Standard InCHI | InChI=1S/C16H20O5/c1-8(17)5-6-11-9(2)16(19)21-15(11)14-10(3)13(20-4)7-12(14)18/h11,13,15H,2,5-7H2,1,3-4H3/t11-,13+,15-/m0/s1 |
| Standard InCHIKey | YMBVLYVGHGDKHO-LNSITVRQSA-N |
| Ingredient External Links |
PubChem CID: 101609003 ZINC ID: ZINC000095913570 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC41271
Formula: C10H16O2
Ingredient ID: NPC41271
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O[C@H]1C[C@H]2[C@H]([C@@H](C1=C)C2(C)C)O |
| Standard InCHI | InChI=1S/C10H16O2/c1-5-7(11)4-6-9(12)8(5)10(6,2)3/h6-9,11-12H,1,4H2,2-3H3/t6-,7-,8+,9+/m0/s1 |
| Standard InCHIKey | IKEKCZRHLOUEEH-RBXMUDONSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD149259] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC41136
Formula: C15H20O4
Ingredient ID: NPC41136
| Common Name | n.a. |
| IUPAC Name | (3aS,7R,9S,10E,11aR)-7,9-dihydroxy-10-methyl-3,6-dimethylidene-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-2-one |
| Canonical SMILES | O[C@H]1C[C@@H](O)C(=C)CC[C@@H]2[C@@H](/C=C/1C)OC(=O)C2=C |
| Standard InCHI | InChI=1S/C15H20O4/c1-8-4-5-11-10(3)15(18)19-14(11)6-9(2)13(17)7-12(8)16/h6,11-14,16-17H,1,3-5,7H2,2H3/b9-6+/t11-,12+,13-,14+/m0/s1 |
| Standard InCHIKey | KQCHEWVHXSAJIA-RNFGUGDUSA-N |
| Ingredient External Links |
PubChem CID: 5281497 ZINC ID: ZINC000004098175 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC28255
Formula: C10H14O2
Ingredient ID: NPC28255
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O[C@@H]1[C@@H]2CC(=O)C(=C)[C@H]1C2(C)C |
| Standard InCHI | InChI=1S/C10H14O2/c1-5-7(11)4-6-9(12)8(5)10(6,2)3/h6,8-9,12H,1,4H2,2-3H3/t6-,8+,9+/m0/s1 |
| Standard InCHIKey | GRBSRSDJCAPFCB-NBEYISGCSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD59141] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC276842
Formula: C15H18O5
Ingredient ID: NPC276842
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C1C(=O)O[C@H]2[C@H]1CC[C@@]([C@H]1[C@]2(O)C(=CC1=O)C)(C)O |
| Standard InCHI | InChI=1S/C15H18O5/c1-7-6-10(16)11-14(3,18)5-4-9-8(2)13(17)20-12(9)15(7,11)19/h6,9,11-12,18-19H,2,4-5H2,1,3H3/t9-,11-,12-,14+,15+/m0/s1 |
| Standard InCHIKey | VXENIKHPXCFDEG-CPSKLWFRSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD128290] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC275561
Formula: C15H20O5
Ingredient ID: NPC275561
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O[C@@H]1C=C([C@]2([C@@H]1[C@](C)(O)CC[C@@H]1[C@@H]2OC(=O)C1=C)O)C |
| Standard InCHI | InChI=1S/C15H20O5/c1-7-6-10(16)11-14(3,18)5-4-9-8(2)13(17)20-12(9)15(7,11)19/h6,9-12,16,18-19H,2,4-5H2,1,3H3/t9-,10+,11-,12-,14+,15+/m0/s1 |
| Standard InCHIKey | BOGHUASVHIUOSJ-ABBQYLIMSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD194419] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC266331
Formula: C15H18O3
Ingredient ID: NPC266331
| Common Name | n.a. |
| IUPAC Name | (3R,3aS,9aS,9bS)-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
| Canonical SMILES | C[C@H]1C(=O)O[C@H]2[C@H]1CCC(=C1[C@@H]2C(=CC1=O)C)C |
| Standard InCHI | InChI=1S/C15H18O3/c1-7-4-5-10-9(3)15(17)18-14(10)13-8(2)6-11(16)12(7)13/h6,9-10,13-14H,4-5H2,1-3H3/t9-,10+,13+,14+/m1/s1 |
| Standard InCHIKey | BJPSSVHNEGMBDQ-OAACRXHESA-N |
| Ingredient External Links |
PubChem CID: 442139 ZINC ID: ZINC000004081837 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC261607
Formula: C15H18O5
Ingredient ID: NPC261607
| Common Name | Secotanapartholide A |
| IUPAC Name | (4S,5S)-5-[(1S,2R)-2-hydroxy-2-methyl-5-oxocyclopent-3-en-1-yl]-3-methylidene-4-(3-oxobutyl)oxolan-2-one |
| Canonical SMILES | CC(=O)CC[C@H]1C(=C)C(=O)O[C@@H]1[C@@H]1C(=O)C=C[C@@]1(C)O |
| Standard InCHI | InChI=1S/C15H18O5/c1-8(16)4-5-10-9(2)14(18)20-13(10)12-11(17)6-7-15(12,3)19/h6-7,10,12-13,19H,2,4-5H2,1,3H3/t10-,12-,13-,15+/m0/s1 |
| Standard InCHIKey | RTOGTHJTQOMSQZ-GZCFXPHUSA-N |
| Ingredient External Links |
PubChem CID: 10356188 ZINC ID: ZINC000003914357 ChEMBL ID: CHEMBL446076 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC261607] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Artemisia anomala | Artemisia | Asteraceae |
|
| Artemisia gilvescens | Artemisia | Asteraceae | |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC261004
Formula: C19H18O8
Ingredient ID: NPC261004
| Common Name | Chrysosplenol B |
| IUPAC Name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxychromen-4-one |
| Canonical SMILES | COc1cc2oc(c3ccc(c(c3)OC)O)c(c(=O)c2c(c1OC)O)OC |
| Standard InCHI | InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
| Standard InCHIKey | NBVTYGIYKCPHQN-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281608 ZINC ID: ZINC000005999141 ChEMBL ID: CHEMBL33256 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC261004] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Castanopsis eyrei | Castanopsis | Fagaceae |
|
| Ficus conraui | Ficus | Moraceae |
|
| Artemisia apiacea | Artemisia | Asteraceae |
|
| Holarrhena febrifuga | Holarrhena | Apocynaceae |
|
| Potamogeton malaianus | Potamogeton | Potamogetonaceae | |
| Hypericum carinatum | Hypericum | Hypericaceae | |
| Impatiens siculifer | Impatiens | Balsaminaceae |
|
| Solanum aculeatum | Solanum | Solanaceae | |
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Fagraea fragrans | Fagraea | Gentianaceae |
|
| Rabdosia loxothyrsa | Isodon | Lamiaceae | |
| Eucalyptus decorticans | Eucalyptus | Myrtaceae | |
| Trichomanes reniforme | Trichomanes | Hymenophyllaceae | |
| Euryops rupestris | Euryops | Asteraceae | |
| Litsea verticillata | Litsea | Lauraceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Dovyalis abyssinica | Dovyalis | Salicaceae |
|
| Magnolia ovata | Magnolia | Magnoliaceae | |
| Polygonum mite | Polygonum | Polygonaceae | |
| Laggera pterodonta | Laggera | Asteraceae |
|
| Artemisia rutifolia | Artemisia | Asteraceae | |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Eucalyptus cordata | Eucalyptus | Myrtaceae | |
| Jasonia montana | Jasonia | Asteraceae | |
| Nephelium mutabile | Nephelium | Sapindaceae |
|
| Fritillaria ussuriensis | Fritillaria | Liliaceae |
|
| Vicia balansae | Vicia | Fabaceae | |
| Laetia corymbulosa | Laetia | Salicaceae | |
| Euonymus europaeus | Euonymus | Celastraceae |
|
| Salvinia imbricata | Salvinia | Salviniaceae | |
| Ethulia conyzoides | Ethulia | Asteraceae |
|
Ingredient ID: NPC255580
Formula: C17H20O5
Ingredient ID: NPC255580
| Common Name | n.a. |
| IUPAC Name | [(3S,3aR,4S,9aS,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate |
| Canonical SMILES | CC(=O)O[C@H]1CC(=C2[C@@H]([C@@H]3[C@@H]1[C@H](C)C(=O)O3)C(=CC2=O)C)C |
| Standard InCHI | InChI=1S/C17H20O5/c1-7-5-11(19)13-8(2)6-12(21-10(4)18)15-9(3)17(20)22-16(15)14(7)13/h5,9,12,14-16H,6H2,1-4H3/t9-,12-,14-,15+,16+/m0/s1 |
| Standard InCHIKey | QONYNSMAVSRIRD-UPQAZBFISA-N |
| Ingredient External Links |
PubChem CID: 3083923 ZINC ID: ZINC000006018862 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC255580] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Anemone raddeana | Anemone | Ranunculaceae | |
| Castanopsis eyrei | Castanopsis | Fagaceae |
|
| Aristolochia maxima | Aristolochia | Aristolochiaceae |
|
| Betula mandshurica | Betula | Betulaceae |
|
| Achillea collina | Achillea | Asteraceae | |
| Mikania obtusata | Mikania | Asteraceae | |
| Holarrhena febrifuga | Holarrhena | Apocynaceae |
|
| Hypericum carinatum | Hypericum | Hypericaceae | |
| Jasminum officinale | Jasminum | Oleaceae |
|
| Mangifera persiciformis | Mangifera | Anacardiaceae |
|
| Bergenia purpurascens | Bergenia | Saxifragaceae |
|
| Kandelia candel | Kandelia | Rhizophoraceae |
|
| Polygala myrtifolia | Polygala | Polygalaceae | |
| Ligularia platyglossa | Ligularia | Asteraceae |
|
| Rhodiola krylovii | Rhodiola | Crassulaceae | |
| Rapanea myricoides | Rapanea | Primulaceae | |
| Crataegus sinaica | Crataegus | Rosaceae |
|
| Malus asiatica | Malus | Rosaceae |
|
| Artemisia vachanica | Artemisia | Asteraceae | |
| Lasiocephalus ovatus | Lasiocephalus | Asteraceae | |
| Impatiens siculifer | Impatiens | Balsaminaceae |
|
| Montrouziera sphaeroidea | Montrouziera | Clusiaceae | |
| Cotoneaster orbicularis | Cotoneaster | Rosaceae | |
| Bischofia trifoliata | Bischofia | Phyllanthaceae | |
| Pimpinella saxifraga | Pimpinella | Apiaceae |
|
| Caragana tibetica | Caragana | Fabaceae |
|
| Macrotyloma axillare | Macrotyloma | Fabaceae | |
| Solanum aculeatum | Solanum | Solanaceae | |
| Trigonostemon reidioides | Trigonostemon | Euphorbiaceae |
|
| Euphorbia ferganensis | Euphorbia | Euphorbiaceae | |
| Arachniodes dimorphophylla | Arachniodes | Dryopteridaceae | |
| Oreosolen wattii | Oreosolen | Scrophulariaceae | |
| Discaria crenata | Discaria | Rhamnaceae | |
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Rabdosia loxothyrsa | Isodon | Lamiaceae | |
| Eucalyptus decorticans | Eucalyptus | Myrtaceae | |
| Trichomanes reniforme | Trichomanes | Hymenophyllaceae | |
| Euryops rupestris | Euryops | Asteraceae | |
| Litsea verticillata | Litsea | Lauraceae |
|
| Tropaeolum speciosum | Tropaeolum | Tropaeolaceae | |
| Solanum bahamense | Solanum | Solanaceae | |
| Tinospora smilacina | Tinospora | Menispermaceae |
|
| Sarcomelicope argyrophylla | Sarcomelicope | Rutaceae | |
| Isodon rubescens | Isodon | Lamiaceae | |
| Polygonum mite | Polygonum | Polygonaceae | |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Laetia corymbulosa | Laetia | Salicaceae | |
| Vatica diospyroides | Vatica | Dipterocarpaceae | |
| Pithecellobium clypearia | Pithecellobium | Fabaceae |
|
| Annona rensoniana | Annona | Annonaceae | |
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC250981
Formula: C15H22O3
Ingredient ID: NPC250981
| Common Name | n.a. |
| IUPAC Name | (3S,3aS,5aR,6R,9bS)-6-hydroxy-3,5a,9-trimethyl-3,3a,4,5,6,7,8,9b-octahydrobenzo[g][1]benzofuran-2-one |
| Canonical SMILES | O=C1O[C@H]2[C@H]([C@@H]1C)CC[C@@]1(C2=C(C)CC[C@H]1O)C |
| Standard InCHI | InChI=1S/C15H22O3/c1-8-4-5-11(16)15(3)7-6-10-9(2)14(17)18-13(10)12(8)15/h9-11,13,16H,4-7H2,1-3H3/t9-,10-,11+,13-,15-/m0/s1 |
| Standard InCHIKey | BWOPOAOBPJWDBF-UWSPEPLBSA-N |
| Ingredient External Links |
PubChem CID: 10422228 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD147890] Database: NPASS [NPC250981] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ligusticum jeholense | Ligusticum | Apiaceae |
|
| Balanophora harlandii | Balanophora | Balanophoraceae | |
| Polemonium caeruleum | Polemonium | Polemoniaceae |
|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Strychnos ledermannii | Strychnos | Loganiaceae | |
| Euphorbia biglandulosa | Euphorbia | Euphorbiaceae | |
| Lupinus cosentinii | Lupinus | Fabaceae | |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Viburnum davidii | Viburnum | Adoxaceae | |
| Agathosma scaberula | Agathosma | Rutaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae | |
| Cichorium intybus | Cichorium | Asteraceae |
|
Ingredient ID: NPC227941
Formula: C17H20O6
Ingredient ID: NPC227941
| Common Name | n.a. |
| IUPAC Name | [(1S)-2-methyl-3-[(2S,3S)-4-methylidene-5-oxo-3-(3-oxobutyl)oxolan-2-yl]-4-oxocyclopent-2-en-1-yl] acetate |
| Canonical SMILES | CC(=O)CC[C@@H]1[C@H](OC(=O)C1=C)C1=C(C)[C@H](CC1=O)OC(=O)C |
| Standard InCHI | InChI=1S/C17H20O6/c1-8(18)5-6-12-9(2)17(21)23-16(12)15-10(3)14(7-13(15)20)22-11(4)19/h12,14,16H,2,5-7H2,1,3-4H3/t12-,14-,16-/m0/s1 |
| Standard InCHIKey | PZAALKURFIAXND-NOLJZWGESA-N |
| Ingredient External Links |
PubChem CID: 101609004 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD59291] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC22448
Formula: C16H24O5
Ingredient ID: NPC22448
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC(=O)C(=C)[C@H]1CC[C@@]2([C@@H]([C@H]1O)C(=C)[C@H](C[C@H]2O)O)C |
| Standard InCHI | InChI=1S/C16H24O5/c1-8(15(20)21-4)10-5-6-16(3)12(18)7-11(17)9(2)13(16)14(10)19/h10-14,17-19H,1-2,5-7H2,3-4H3/t10-,11+,12-,13-,14+,16+/m1/s1 |
| Standard InCHIKey | VZVFUXBMPZFNOZ-MKRTWGBSSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD88916] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC190456
Formula: C15H18O4
Ingredient ID: NPC190456
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C1C(=O)O[C@H]2[C@H]1CCC(=C)[C@]1([C@@H]2[C@@](C)(O)C=C1)O |
| Standard InCHI | InChI=1S/C15H18O4/c1-8-4-5-10-9(2)13(16)19-11(10)12-14(3,17)6-7-15(8,12)18/h6-7,10-12,17-18H,1-2,4-5H2,3H3/t10-,11-,12-,14-,15+/m0/s1 |
| Standard InCHIKey | OOFQAUVGYPFQPZ-ZCRGAIPPSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD91199] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC190207
Formula: C10H16O2
Ingredient ID: NPC190207
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O=C[C@@H]1C[C@@H](O)C(=CC1(C)C)C |
| Standard InCHI | InChI=1S/C10H16O2/c1-7-5-10(2,3)8(6-11)4-9(7)12/h5-6,8-9,12H,4H2,1-3H3/t8-,9+/m0/s1 |
| Standard InCHIKey | DOSSOWWECQMMRD-DTWKUNHWSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD160629] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC189029
Formula: C15H20O5
Ingredient ID: NPC189029
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C1C(=O)O[C@H]2[C@H]1CC[C@@]([C@]1([C@@H]2[C@](C)(O)C=C1)O)(C)O |
| Standard InCHI | InChI=1S/C15H20O5/c1-8-9-4-5-14(3,18)15(19)7-6-13(2,17)11(15)10(9)20-12(8)16/h6-7,9-11,17-19H,1,4-5H2,2-3H3/t9-,10-,11-,13+,14+,15-/m0/s1 |
| Standard InCHIKey | SGHTVVJDLWGFLU-HFSUPIEXSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD170514] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC186363
Formula: C15H20O3
Ingredient ID: NPC186363
| Common Name | n.a. |
| IUPAC Name | (3aS,5aR,6R,9aS,9bS)-6-hydroxy-5a,9-dimethyl-3-methylidene-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-2-one |
| Canonical SMILES | CC1=CC[C@H]([C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC2)C)O |
| Standard InCHI | InChI=1S/C15H20O3/c1-8-4-5-11(16)15(3)7-6-10-9(2)14(17)18-13(10)12(8)15/h4,10-13,16H,2,5-7H2,1,3H3/t10-,11+,12+,13-,15-/m0/s1 |
| Standard InCHIKey | PLSSEPIRACGCBO-PFFFPCNUSA-N |
| Ingredient External Links |
PubChem CID: 188297 ZINC ID: ZINC000004098178 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC186363] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dolomiaea souliei | Dolomiaea | Asteraceae | |
| Santalum album | Santalum | Santalaceae |
|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC18453
Formula: C17H24O4
Ingredient ID: NPC18453
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC(=O)O[C@@H]1CC=C([C@H]2[C@@]1(C)CC[C@@H]1[C@@H]2OC(=O)[C@H]1C)C |
| Standard InCHI | InChI=1S/C17H24O4/c1-9-5-6-13(20-11(3)18)17(4)8-7-12-10(2)16(19)21-15(12)14(9)17/h5,10,12-15H,6-8H2,1-4H3/t10-,12-,13+,14+,15-,17-/m0/s1 |
| Standard InCHIKey | NESWKHBGLOAXDL-YSZIICFESA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD167892] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC168400
Formula: C15H18O4
Ingredient ID: NPC168400
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C1C(=O)O[C@H]2[C@H]1CCC(=C)[C@]1([C@@H]2[C@](C)(O)C=C1)O |
| Standard InCHI | InChI=1S/C15H18O4/c1-8-4-5-10-9(2)13(16)19-11(10)12-14(3,17)6-7-15(8,12)18/h6-7,10-12,17-18H,1-2,4-5H2,3H3/t10-,11-,12-,14+,15+/m0/s1 |
| Standard InCHIKey | OOFQAUVGYPFQPZ-JQPXUNLUSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD87655] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC154923
Formula: C16H20O5
Ingredient ID: NPC154923
| Common Name | n.a. |
| IUPAC Name | (4S,5S)-5-[(3S)-3-methoxy-2-methyl-5-oxocyclopenten-1-yl]-3-methylidene-4-(3-oxobutyl)oxolan-2-one |
| Canonical SMILES | CO[C@H]1CC(=O)C(=C1C)[C@H]1OC(=O)C(=C)[C@@H]1CCC(=O)C |
| Standard InCHI | InChI=1S/C16H20O5/c1-8(17)5-6-11-9(2)16(19)21-15(11)14-10(3)13(20-4)7-12(14)18/h11,13,15H,2,5-7H2,1,3-4H3/t11-,13-,15-/m0/s1 |
| Standard InCHIKey | YMBVLYVGHGDKHO-WHOFXGATSA-N |
| Ingredient External Links |
PubChem CID: 70697791 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD111085] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC154650
Formula: C10H16O
Ingredient ID: NPC154650
| Common Name | n.a. |
| IUPAC Name | (1R,2R,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol |
| Canonical SMILES | CC1=C[C@@H](O)[C@@H]2C[C@H]1C2(C)C |
| Standard InCHI | InChI=1S/C10H16O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-9,11H,5H2,1-3H3/t7-,8+,9-/m1/s1 |
| Standard InCHIKey | WONIGEXYPVIKFS-HRDYMLBCSA-N |
| Ingredient External Links |
PubChem CID: 164888 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD68771] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Daucus carota | Daucus | Apiaceae |
|
| Schizonepeta tenuisfolia | Schizonepeta | Lamiaceae | |
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Citrus sinensis | Citrus | Rutaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Citrus trifoliata | Citrus | Rutaceae |
|
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Citrus natsudaidai | Citrus | Rutaceae |
|
| Citrus aurantium | Citrus | Rutaceae |
|
| Magnolia officinalis rehd et wils | Magnolia | Magnoliaceae | |
| Schizonepeta tenuifolia | Schizonepeta | Lamiaceae |
|
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC153297
Formula: C15H16O3
Ingredient ID: NPC153297
| Common Name | n.a. |
| IUPAC Name | (3aS,9aR,9bS)-6,9-dimethyl-3-methylidene-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,7-dione |
| Canonical SMILES | CC1=CC(=O)C2=C(C)CC[C@@H]3[C@@H]([C@H]12)OC(=O)C3=C |
| Standard InCHI | InChI=1S/C15H16O3/c1-7-4-5-10-9(3)15(17)18-14(10)13-8(2)6-11(16)12(7)13/h6,10,13-14H,3-5H2,1-2H3/t10-,13+,14-/m0/s1 |
| Standard InCHIKey | SKNVIAFTENCNGB-GDLCADMTSA-N |
| Ingredient External Links |
PubChem CID: 15558827 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD185947] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC137633
Formula: C16H12O8
Ingredient ID: NPC137633
| Common Name | n.a. |
| IUPAC Name | 5,7-dihydroxy-3-methoxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| Canonical SMILES | COc1c(oc2c(c1=O)c(O)cc(c2)O)c1cc(O)c(c(c1)O)O |
| Standard InCHI | InChI=1S/C16H12O8/c1-23-16-14(22)12-8(18)4-7(17)5-11(12)24-15(16)6-2-9(19)13(21)10(20)3-6/h2-5,17-21H,1H3 |
| Standard InCHIKey | XWTLYULBWZQAAZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 44259709 ZINC ID: ZINC000014647251 |
| Plant-Ingredient Association Reference |
Database: TCMID [1339] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros kaki | Diospyros | Ebenaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae |
Ingredient ID: NPC12529
Formula: C15H22O3
Ingredient ID: NPC12529
| Common Name | n.a. |
| IUPAC Name | (3R,3aS,6E,9R,10E,11aS)-9-hydroxy-3,6,10-trimethyl-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2-one |
| Canonical SMILES | C/C/1=CC[C@@H](O)/C(=C/[C@@H]2[C@@H](CC1)[C@@H](C)C(=O)O2)/C |
| Standard InCHI | InChI=1S/C15H22O3/c1-9-4-6-12-11(3)15(17)18-14(12)8-10(2)13(16)7-5-9/h5,8,11-14,16H,4,6-7H2,1-3H3/b9-5+,10-8+/t11-,12+,13-,14-/m1/s1 |
| Standard InCHIKey | RLHPCSSGTQNSJN-QMPNBSENSA-N |
| Ingredient External Links |
PubChem CID: 54607887 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD157713] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Aristolochia maxima | Aristolochia | Aristolochiaceae |
|
| Betula mandshurica | Betula | Betulaceae |
|
| Achillea collina | Achillea | Asteraceae | |
| Mikania obtusata | Mikania | Asteraceae | |
| Jasminum officinale | Jasminum | Oleaceae |
|
| Bergenia purpurascens | Bergenia | Saxifragaceae |
|
| Polygala myrtifolia | Polygala | Polygalaceae | |
| Ligularia platyglossa | Ligularia | Asteraceae |
|
| Rhodiola krylovii | Rhodiola | Crassulaceae | |
| Rapanea myricoides | Rapanea | Primulaceae | |
| Crataegus sinaica | Crataegus | Rosaceae |
|
| Malus asiatica | Malus | Rosaceae |
|
| Artemisia vachanica | Artemisia | Asteraceae | |
| Lasiocephalus ovatus | Lasiocephalus | Asteraceae | |
| Montrouziera sphaeroidea | Montrouziera | Clusiaceae | |
| Cotoneaster orbicularis | Cotoneaster | Rosaceae | |
| Bischofia trifoliata | Bischofia | Phyllanthaceae | |
| Pimpinella saxifraga | Pimpinella | Apiaceae |
|
| Caragana tibetica | Caragana | Fabaceae |
|
| Macrotyloma axillare | Macrotyloma | Fabaceae | |
| Trigonostemon reidioides | Trigonostemon | Euphorbiaceae |
|
| Euphorbia ferganensis | Euphorbia | Euphorbiaceae | |
| Arachniodes dimorphophylla | Arachniodes | Dryopteridaceae | |
| Oreosolen wattii | Oreosolen | Scrophulariaceae | |
| Discaria crenata | Discaria | Rhamnaceae | |
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Tropaeolum speciosum | Tropaeolum | Tropaeolaceae | |
| Solanum bahamense | Solanum | Solanaceae | |
| Tinospora smilacina | Tinospora | Menispermaceae |
|
| Sarcomelicope argyrophylla | Sarcomelicope | Rutaceae | |
| Isodon rubescens | Isodon | Lamiaceae | |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Vatica diospyroides | Vatica | Dipterocarpaceae | |
| Pithecellobium clypearia | Pithecellobium | Fabaceae |
|
| Annona rensoniana | Annona | Annonaceae | |
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC120926
Formula: C15H24
Ingredient ID: NPC120926
| Common Name | Germacrene D |
| IUPAC Name | (1E,6E,8S)-1-methyl-5-methylidene-8-propan-2-ylcyclodeca-1,6-diene |
| Canonical SMILES | C/C/1=CCCC(=C)/C=C/[C@@H](CC1)C(C)C |
| Standard InCHI | InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h7-8,10,12,15H,3,5-6,9,11H2,1-2,4H3/b10-8+,14-7+/t15-/m0/s1 |
| Standard InCHIKey | GAIBLDCXCZKKJE-RXJOXMPGSA-N |
| Ingredient External Links |
PubChem CID: 5317570 ZINC ID: ZINC000030730221 ChEMBL ID: CHEMBL105432 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC120926] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Citrus unshiu | Citrus | Rutaceae |
|
| Oreoherzogia fallax | Oreoherzogia | Rhamnaceae |
|
| Ichthyothere terminalis | Ichthyothere | Asteraceae | |
| Strophanthus eminii | Strophanthus | Apocynaceae |
|
| Artemisia montana | Artemisia | Asteraceae |
|
| Artemisia apiacea | Artemisia | Asteraceae |
|
| Epimedium sagittatum | Epimedium | Berberidaceae |
|
| Moringa oleifera | Moringa | Moringaceae |
|
| Piper taboganum | Piper | Piperaceae | |
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Stevia alpina | Stevia | Asteraceae | |
| Piper cubeba | Piper | Piperaceae |
|
| Byrsonima microphylla | Byrsonima | Malpighiaceae | |
| Incarvillea emodi | Incarvillea | Bignoniaceae | |
| Ligusticum jeholense | Ligusticum | Apiaceae |
|
| Polygala reinii | Polygala | Polygalaceae |
|
| Crotalaria madurensis | Crotalaria | Fabaceae |
|
| Magnolia obovata | Magnolia | Magnoliaceae |
|
| Amomum villosum | Amomum | Zingiberaceae |
|
| Illicium difengpi | Illicium | Schisandraceae |
|
| Amaioua guianensis | Amaioua | Rubiaceae |
|
| Murraya exotica | Murraya | Rutaceae |
|
| Cassipourea guianensis | Cassipourea | Rhizophoraceae | |
| Atractylodes chinensis | Atractylodes | Asteraceae |
|
| Torilis japonica | Torilis | Apiaceae |
|
| Heracleum maximum | Heracleum | Apiaceae |
|
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Notholaena peninsularis | Notholaena | Pteridaceae | |
| Strychnos tomentosa | Strychnos | Loganiaceae | |
| Pinus sitchensis | Pinus | Pinaceae | |
| Mcneillia graminifolia | Mcneillia | Caryophyllaceae | |
| Eriogonum nudum | Eriogonum | Polygonaceae | |
| Humulus lupulus | Humulus | Cannabaceae |
|
| Microglossa pyrrhopappa | Microglossa | Asteraceae | |
| Ficus mucuso | Ficus | Moraceae |
|
| Calanthe arisanensis | Calanthe | Orchidaceae | |
| Adenocarpus foliolosus | Adenocarpus | Fabaceae | |
| Dacryodes normandii | Dacryodes | Burseraceae | |
| Veratrum eschscholtzii | Veratrum | Melanthiaceae | |
| Ipomoea reptans | Ipomoea | Convolvulaceae |
|
| Riccia fluitans | Riccia | Ricciaceae | |
| Retama duriaei | Retama | Fabaceae | |
| Rubia schumanniana | Rubia | Rubiaceae | |
| Santolina rosmarinifolia | Santolina | Asteraceae |
|
| Aloe ferox | Aloe | Asphodelaceae |
|
| Amomum longiligulare | Amomum | Zingiberaceae |
|
| Angiopteris evecta | Angiopteris | Marattiaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Euphorbia balsamifera | Euphorbia | Euphorbiaceae |
|
| Mucuna sloanei | Mucuna | Fabaceae |
|
| Senecio othonniformis | Senecio | Asteraceae | |
| Cnidium monnieri | Cnidium | Apiaceae |
|
| Senecio coahuilensis | Senecio | Asteraceae | |
| Citrus medica | Citrus | Rutaceae |
|
| Chrysosplenium oppositifolium | Chrysosplenium | Saxifragaceae |
|
| Atractylodes lancea | Atractylodes | Asteraceae |
|
| Swertia decora | Swertia | Gentianaceae | |
| Serratula xeranthemoides | Serratula | Asteraceae | |
| Daucus carota | Daucus | Apiaceae |
|
| Amomum xanthioides | Amomum | Zingiberaceae |
|
| Ochrocarpos odoratus | Ochrocarpos | Clusiaceae | |
| Baccharis santelicis | Baccharis | Asteraceae | |
| Capsicum annuum | Capsicum | Solanaceae |
|
| Choisya arizonica | Choisya | Rutaceae | |
| Erythrina sandwicensis | Erythrina | Fabaceae | |
| Roldana barba-johannis | Roldana | Asteraceae | |
| Chrysanthemum zawadskii | Chrysanthemum | Asteraceae |
|
| Pluchea dioscoridis | Pluchea | Asteraceae |
|
| Pittosporum viridiflorum | Pittosporum | Pittosporaceae |
|
| Agathosma betulina | Agathosma | Rutaceae |
|
| Agrimonia pilosa | Agrimonia | Rosaceae |
|
| Mosla chinensis | Mosla | Lamiaceae |
|
| Curcuma phaeocaulis | Curcuma | Zingiberaceae | |
| Pyrrosia davidii | Pyrrosia | Polypodiaceae |
|
| Schizonepeta tenuisfolia | Schizonepeta | Lamiaceae | |
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Citrus sinensis | Citrus | Rutaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Panax quinquefolius | Panax | Araliaceae |
|
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Ligusticum tenuissimum | Ligusticum | Apiaceae |
|
| Citrus trifoliata | Citrus | Rutaceae |
|
| Rothmannia urcelliformis | Rothmannia | Rubiaceae |
|
| Panax notoginseng | Panax | Araliaceae |
|
| Cnidium officinale | Cnidium | Apiaceae |
|
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Clethra macrophylla | Clethra | Clethraceae | |
| Rhaponticum carthamoides | Rhaponticum | Asteraceae |
|
| Pyrola rotundifolia | Pyrola | Ericaceae |
|
| Hyacinthoides hispanica | Hyacinthoides | Hyacinthaceae | |
| Curcuma kwangsiensis | Curcuma | Zingiberaceae |
|
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Leonurus japonicus | Leonurus | Lamiaceae |
|
| Grazielia serrata | Grazielia | Asteraceae | |
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Curcuma longa | Curcuma | Zingiberaceae |
|
| Hansenia forbesii | Hansenia | Apiaceae | |
| Artemisia princeps | Artemisia | Asteraceae |
|
| Citrus reticulata | Citrus | Rutaceae |
|
| Acorus calamus | Acorus | Acoraceae |
|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Agastache rugosa | Agastache | Lamiaceae |
|
| Bistorta manshuriensis | Bistorta | Polygonaceae | |
| Artemisia annua | Artemisia | Asteraceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Citrus maxima | Citrus | Rutaceae |
|
| Pseudotaxus chienii | Pseudotaxus | Taxaceae | |
| Berchemia floribunda | Berchemia | Rhamnaceae |
|
| Aster altaicus | Aster | Asteraceae | |
| Artemisia argyi | Artemisia | Asteraceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Piper nigrum | Piper | Piperaceae |
|
| Anthoxanthum nitens | Anthoxanthum | Poaceae |
|
| Tritomaria quinquedentata | Tritomaria | Scapaniaceae | |
| Litsea cubeba | Litsea | Lauraceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Ostericum grosseserratum | Ostericum | Apiaceae |
|
| Sabal causiarum | Sabal | Arecaceae | |
| Betula maximowicziana | Betula | Betulaceae | |
| Asterolasia squamuligera | Asterolasia | Rutaceae | |
| Magnolia officinalis | Magnolia | Magnoliaceae |
|
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Lindera aggregata | Lindera | Lauraceae | |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Cassia roxburghii | Cassia | Fabaceae | |
| Nervilia fordii | Nervilia | Orchidaceae |
|
| Citrus natsudaidai | Citrus | Rutaceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Cinnamomum tenuifolium | Cinnamomum | Lauraceae |
|
| Acorus gramineus | Acorus | Acoraceae |
|
| Hygrophila polysperma | Hygrophila | Acanthaceae | |
| Catharanthus roseus | Catharanthus | Apocynaceae |
|
| Polygonatum falcatum | Polygonatum | Asparagaceae |
|
| Mulguraea tridens | Junellia | Verbenaceae | |
| Betula exilis | Betula | Betulaceae | |
| Citrus aurantium | Citrus | Rutaceae |
|
| Chromolaena arnottiana | Chromolaena | Asteraceae | |
| Pseudocedrela kotschyi | Pseudocedrela | Meliaceae |
|
| Curcuma zedoaria | Curcuma | Zingiberaceae |
|
| Schisandra chinensis | Schisandra | Schisandraceae |
|
| Citrus junos | Citrus | Rutaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Zanthoxylum schinifolium | Zanthoxylum | Rutaceae |
|
| Arnica sachalinensis | Arnica | Asteraceae | |
| Schizonepeta tenuifolia | Schizonepeta | Lamiaceae |
|
| Glehnia littoralis | Glehnia | Apiaceae |
|
| Cnidium monieri | Cnidium | Apiaceae | |
| Lomatia silaifolia | Lomatia | Proteaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae | |
| Aglaia lawii | Aglaia | Meliaceae |
|
Ingredient ID: NPC120464
Formula: C17H14O7
Ingredient ID: NPC120464
| Common Name | Tricin |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one |
| Canonical SMILES | COc1cc(cc(c1O)OC)c1cc(=O)c2c(o1)cc(cc2O)O |
| Standard InCHI | InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)17(14)21)12-7-11(20)16-10(19)5-9(18)6-13(16)24-12/h3-7,18-19,21H,1-2H3 |
| Standard InCHIKey | HRGUSFBJBOKSML-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281702 ZINC ID: ZINC000005998961 ChEMBL ID: CHEMBL454320 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC120464] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Plectranthus nummularius | Plectranthus | Lamiaceae |
|
| Dracaena concinna | Dracaena | Asparagaceae | |
| Epimedium sagittatum | Epimedium | Berberidaceae |
|
| Osmorhiza aristata | Osmorhiza | Apiaceae |
|
| Entada polystachya | Entada | Fabaceae | |
| Litsea salicifolia | Litsea | Lauraceae |
|
| Stipa vaseyi | Stipa | Poaceae | |
| Entada africana | Entada | Fabaceae |
|
| Ledebouria floribunda | Ledebouria | Hyacinthaceae | |
| Iberis sempervirens | Iberis | Brassicaceae | |
| Ageratina adenophora | Ageratina | Asteraceae |
|
| Anthemis pseudocotula | Anthemis | Asteraceae | |
| Triticum estivum | Triticum | Poaceae | |
| Cleistopholis staudtii | Cleistopholis | Annonaceae | |
| Albizia julibrissin | Albizia | Fabaceae |
|
| Leuzea centauroides | Leuzea | Asteraceae | |
| Orobanche speciosa | Orobanche | Orobanchaceae | |
| Scutellaria amoena | Scutellaria | Lamiaceae |
|
| Schumanniophyton magnificum | Schumanniophyton | Rubiaceae | |
| Epimedium sempervirens | Epimedium | Berberidaceae | |
| Fumaria indica | Fumaria | Papaveraceae |
|
| Persea kusanoi | Persea | Lauraceae | |
| Kadsura interior | Kadsura | Schisandraceae |
|
| Anaxagorea dolichocarpa | Anaxagorea | Annonaceae | |
| Dioscorea gracillima | Dioscorea | Dioscoreaceae |
|
| Ophiorrhiza kuroiwae | Ophiorrhiza | Rubiaceae | |
| Vitex limonifolia | Vitex | Lamiaceae | |
| Asparagus africanus | Asparagus | Asparagaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Eichhornia crassipes | Eichhornia | Pontederiaceae |
|
| Echium rubrum | Echium | Boraginaceae | |
| Cedrela fissilis | Cedrela | Meliaceae |
|
| Penstemon newberryi | Penstemon | Plantaginaceae | |
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Dorycnium suffruticosum | Dorycnium | Fabaceae | |
| Epimedium pubescens | Epimedium | Berberidaceae |
|
| Teucrium heterophyllum | Teucrium | Lamiaceae | |
| Ephedra herba | Ephedra | Ephedraceae | |
| Isodon amethystoides | Isodon | Lamiaceae |
|
| Baccharis sagittalis | Baccharis | Asteraceae | |
| Senecio ambraceus | Senecio | Asteraceae | |
| Agathis lanceolata | Agathis | Araucariaceae |
|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Epimedium grandiflorum | Epimedium | Berberidaceae |
|
| Solanum chilense | Solanum | Solanaceae | |
| Populus tomentosa | Populus | Salicaceae |
|
| Pycnandra acuminata | Pycnandra | Sapotaceae | |
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Psychotria serpens | Psychotria | Rubiaceae |
|
| Capsicum tetragonum | Capsicum | Solanaceae | |
| Acer carpinifolium | Acer | Sapindaceae |
|
| Phellodendron chinense | Phellodendron | Rutaceae |
|
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Croton megistocarpus | Croton | Euphorbiaceae | |
| Epimedium koreanum | Epimedium | Berberidaceae |
|
| Lycoris traubii | Lycoris | Amaryllidaceae | |
| Hypericum revolutum | Hypericum | Hypericaceae |
|
| Caesalpinia crista | Guilandina | Fabaceae |
|
| Lygodium flexuosum | Lygodium | Lygodiaceae |
|
| Oroxylum indicum | Oroxylum | Bignoniaceae |
|
| Strychnos staudtii | Strychnos | Loganiaceae | |
| Dictyoloma incanescens | Dictyoloma | Rutaceae | |
| Saccharum spontaneum | Saccharum | Poaceae |
|
| Crotalaria anagyroides | Crotalaria | Fabaceae |
|
| Scutellaria baicalensis | Scutellaria | Lamiaceae |
|
| Dasymaschalon sootepense | Dasymaschalon | Annonaceae | |
| Croton poilanei | Croton | Euphorbiaceae | |
| Tsuga mertensiana | Tsuga | Pinaceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Guatteria melosma | Guatteria | Annonaceae | |
| Securinega melanthesoides | Securinega | Phyllanthaceae | |
| Euonymus sachalinensis | Euonymus | Celastraceae |
|
| Felicia erigeroides | Felicia | Asteraceae | |
| Lupinus paniculatus | Lupinus | Fabaceae | |
| Boehmeria nivea | Boehmeria | Urticaceae |
|
| Vigna angularis | Vigna | Fabaceae |
|
| Scutellaria balcalensis | Scutellaria | Lamiaceae | |
| Kniphofia pumila | Kniphofia | Xanthorrhoeaceae | |
| Neolitsea pulchella | Neolitsea | Lauraceae |
|
| Pedicularis procera | Pedicularis | Orobanchaceae | |
| Scabiosa succisa | Scabiosa | Caprifoliaceae |
|
| Geranium sibiricum | Geranium | Geraniaceae |
|
| Baphicacanthus cusia | Baphicacanthus | Acanthaceae |
|
| Lagerstroemia indica | Lagerstroemia | Lythraceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Helleborus multifidus | Helleborus | Ranunculaceae | |
| Epimedium brevicornu | Epimedium | Berberidaceae | |
| Dipteryx odorata | Dipteryx | Fabaceae |
|
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Mesembryanthemum expansum | Mesembryanthemum | Aizoaceae |
|
| Roemeria carica | Roemeria | Papaveraceae | |
| Echinacea pallida | Echinacea | Asteraceae |
|
| Artemisia ludoviciana subsp. mexicana | Artemisia | Asteraceae |
|
| Galium dasypodum | Galium | Rubiaceae | |
| Senecio isatideus | Senecio | Asteraceae | |
| Pachyrhizus tuberosus | Pachyrhizus | Fabaceae |
|
| Helichrysum lepidissimum | Helichrysum | Asteraceae |
|
| Trigonella foenum-graecum | Trigonella | Fabaceae |
|
| Camellia sinensis | Camellia | Theaceae |
|
| Pteris setuloso-costulata | Pteris | Pteridaceae | |
| Liparis loeselii | Liparis | Orchidaceae |
|
| Hopea utilis | Hopea | Dipterocarpaceae |
|
| Aglaia tsangii | Aglaia | Meliaceae | |
| Centipeda minima | Centipeda | Asteraceae |
|
| Epimedium wushanense | Epimedium | Berberidaceae |
|
| Pseuduvaria indochinensis | Pseuduvaria | Annonaceae | |
| Vernonia anisochaetoides | Vernonia | Asteraceae | |
| Myrtopsis novae-caledoniae | Myrtopsis | Rutaceae | |
| Magnolia pterocarpa | Magnolia | Magnoliaceae | |
| Monomeria barbata | Monomeria | Orchidaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC117378
Formula: C15H20O3
Ingredient ID: NPC117378
| Common Name | n.a. |
| IUPAC Name | (3aS,6E,9R,10E,11aR)-9-hydroxy-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| Canonical SMILES | C/C/1=CC[C@@H](O)/C(=C/[C@@H]2[C@@H](CC1)C(=C)C(=O)O2)/C |
| Standard InCHI | InChI=1S/C15H20O3/c1-9-4-6-12-11(3)15(17)18-14(12)8-10(2)13(16)7-5-9/h5,8,12-14,16H,3-4,6-7H2,1-2H3/b9-5+,10-8+/t12-,13+,14+/m0/s1 |
| Standard InCHIKey | XQVSREKNQZKAKU-WQURXQIUSA-N |
| Ingredient External Links |
PubChem CID: 12443214 ZINC ID: ZINC000100392377 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Heracleum maximum | Heracleum | Apiaceae |
|
| Ficus mucuso | Ficus | Moraceae |
|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC116087
Formula: C10H14O
Ingredient ID: NPC116087
| Common Name | n.a. |
| IUPAC Name | (2S)-4-phenylbutan-2-ol |
| Canonical SMILES | C[C@@H](CCc1ccccc1)O |
| Standard InCHI | InChI=1S/C10H14O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-/m0/s1 |
| Standard InCHIKey | GDWRKZLROIFUML-VIFPVBQESA-N |
| Ingredient External Links |
PubChem CID: 6994425 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD17731] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC115597
Formula: C20H28O7
Ingredient ID: NPC115597
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OCC(=C)C(=O)O[C@H]1[C@@H](CC[C@@]2([C@@H]1C(=C)[C@@H](O)C[C@H]2O)C)C(=C)C(=O)OC |
| Standard InCHI | InChI=1S/C20H28O7/c1-10(9-21)18(24)27-17-13(11(2)19(25)26-5)6-7-20(4)15(23)8-14(22)12(3)16(17)20/h13-17,21-23H,1-3,6-9H2,4-5H3/t13-,14-,15+,16+,17-,20-/m0/s1 |
| Standard InCHIKey | WTUJWAGXQOPSNS-WUMBSXJCSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD95856] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC115168
Formula: C15H18O5
Ingredient ID: NPC115168
| Common Name | n.a. |
| IUPAC Name | (E)-1-[(2S,3S)-4-methylidene-5-oxo-3-(3-oxobutyl)oxolan-2-yl]hex-3-ene-2,5-dione |
| Canonical SMILES | O=C(C[C@@H]1OC(=O)C(=C)[C@@H]1CCC(=O)C)/C=C/C(=O)C |
| Standard InCHI | InChI=1S/C15H18O5/c1-9(16)4-6-12(18)8-14-13(7-5-10(2)17)11(3)15(19)20-14/h4,6,13-14H,3,5,7-8H2,1-2H3/b6-4+/t13-,14-/m0/s1 |
| Standard InCHIKey | VNOAOFGIURPXMV-HHAVJRIZSA-N |
| Ingredient External Links |
PubChem CID: 101317829 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD71737] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC111114
Formula: C15H18O5
Ingredient ID: NPC111114
| Common Name | (4S,5S)-5-[(1R,2R)-2-Hydroxy-2-Methyl-5-Oxocyclopent-3-En-1-Yl]-3-Methylidene-4-(3-Oxobutyl)Oxolan-2-One |
| IUPAC Name | (4S,5S)-5-[(1R,2R)-2-hydroxy-2-methyl-5-oxocyclopent-3-en-1-yl]-3-methylidene-4-(3-oxobutyl)oxolan-2-one |
| Canonical SMILES | CC(=O)CC[C@H]1C(=C)C(=O)O[C@@H]1[C@H]1C(=O)C=C[C@@]1(C)O |
| Standard InCHI | InChI=1S/C15H18O5/c1-8(16)4-5-10-9(2)14(18)20-13(10)12-11(17)6-7-15(12,3)19/h6-7,10,12-13,19H,2,4-5H2,1,3H3/t10-,12+,13-,15+/m0/s1 |
| Standard InCHIKey | RTOGTHJTQOMSQZ-QMPIGLIWSA-N |
| Ingredient External Links |
PubChem CID: 13918470 ZINC ID: ZINC000034187461 ChEMBL ID: CHEMBL467620 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC111114] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Artemisia gilvescens | Artemisia | Asteraceae | |
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
Ingredient ID: NPC104657
Formula: C15H20O5
Ingredient ID: NPC104657
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC1=C[C@H]([C@@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC[C@@]2(C)O)O)O |
| Standard InCHI | InChI=1S/C15H20O5/c1-7-6-10(16)15(19)11(7)12-9(4-5-14(15,3)18)8(2)13(17)20-12/h6,9-12,16,18-19H,2,4-5H2,1,3H3/t9-,10+,11+,12-,14+,15-/m0/s1 |
| Standard InCHIKey | GQOBRQOZHHNFJO-XGTBMDPHSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD7625] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus haspan | Cyperus | Cyperaceae |
|
| Goniothalamus thwaitesii | Goniothalamus | Annonaceae | |
| Salvinia imbricata | Salvinia | Salviniaceae |
