NPASS Compound

Natural Product: NPC7124

Natural Product ID	NPC7124
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	N-Butyl Lucidenate N
IUPAC Name	butyl (4R)-4-[(3S,5R,7S,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11-oxo-1,2,3,5,6,7,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate
Synonyms	N-Butyl Lucidenate N
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1915765
PubChem CID	57390352
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 86 89 0 0 0 0 0 0 0 0999 V2000 10.5540 -1.2898 1.3005 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2462 -0.8447 0.6819 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1496 0.6573 0.6891 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8607 1.1318 0.0810 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7874 0.6158 0.8122 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4484 0.9029 0.4643 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3326 1.6464 -0.5389 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3787 0.3306 1.2721 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0327 0.6687 0.7199 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7674 0.1326 -0.6671 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4379 0.5065 -1.1741 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1726 -0.0496 -2.5715 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3214 -0.4260 -2.5754 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8862 0.4698 -1.5194 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2034 0.2898 -0.4400 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0282 -1.1464 0.0169 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1952 1.3047 0.5945 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4586 0.8061 1.2291 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6189 0.9267 2.4338 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4271 0.1970 0.3247 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1807 0.0325 -0.9488 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1448 -0.5653 -1.8737 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6771 -1.7593 -2.4345 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5416 -0.7404 -1.3534 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7448 0.2101 -0.1691 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7416 -0.2324 0.8506 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7868 -1.7567 0.9266 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0061 0.2469 2.2507 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4278 -0.1651 2.5916 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3585 0.5859 1.7160 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1455 0.3350 0.2467 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0128 -0.8754 -0.1135 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7793 1.5171 -0.4781 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6689 0.2528 2.0443 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0614 1.8829 -1.9509 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1823 -1.2951 -0.6430 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8503 -2.2598 0.9037 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3365 -0.5248 1.0764 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4761 -1.3778 2.4105 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1468 -1.2362 -0.3379 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4282 -1.2573 1.2948 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0315 1.0832 0.1465 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2237 1.0330 1.7277 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8386 2.2407 0.1928 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7965 0.9229 -0.9999 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4301 0.8135 2.2918 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4849 -0.7608 1.4499 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8651 1.7478 0.7838 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3038 0.1875 1.4567 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5092 0.6466 -1.3502 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5189 1.6328 -1.3620 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7982 -0.8895 -2.8485 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3105 0.7225 -3.3654 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7603 -0.2934 -3.5691 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3644 -1.4814 -2.2458 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7765 -1.7525 -0.5795 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9315 -1.6047 -0.2969 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1256 -1.2840 1.0899 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5391 1.6292 1.3026 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5314 2.2417 0.0547 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2200 0.1401 -2.7699 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4708 -2.1364 -2.9272 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6625 -1.8049 -1.0622 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2491 -0.4753 -2.1813 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3833 1.2082 -0.5620 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1421 -2.2556 0.1949 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8261 -2.1455 0.9327 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3780 -2.0569 1.9349 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9202 1.3177 2.4095 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3757 -0.3911 2.9172 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5724 -1.2553 2.6025 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5923 0.1811 3.6393 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2456 1.6686 1.9261 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1414 -1.5429 0.7663 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6586 -1.3889 -1.0137 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0616 -0.5309 -0.3578 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4103 1.6233 -1.5122 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4231 2.4282 0.0823 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8695 1.5169 -0.3910 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7338 -0.5469 2.6185 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3886 1.8446 -3.0340 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9108 2.3728 -1.4332 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2070 2.5378 -1.9275 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9536 -1.8874 -1.5482 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9690 -1.8230 0.3123 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3211 -1.2813 -0.6379 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 2 0 21 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 30 34 1 0 14 35 1 6 10 36 1 0 15 11 1 0 26 20 1 0 21 14 1 0 31 25 1 0 1 37 1 0 1 38 1 0 1 39 1 0 2 40 1 0 2 41 1 0 3 42 1 0 3 43 1 0 4 44 1 0 4 45 1 0 8 46 1 0 8 47 1 0 9 48 1 0 9 49 1 0 10 50 1 6 11 51 1 6 12 52 1 0 12 53 1 0 13 54 1 0 13 55 1 0 16 56 1 0 16 57 1 0 16 58 1 0 17 59 1 0 17 60 1 0 22 61 1 6 23 62 1 0 24 63 1 0 24 64 1 0 25 65 1 6 27 66 1 0 27 67 1 0 27 68 1 0 28 69 1 0 28 70 1 0 29 71 1 0 29 72 1 0 30 73 1 6 32 74 1 0 32 75 1 0 32 76 1 0 33 77 1 0 33 78 1 0 33 79 1 0 34 80 1 0 35 81 1 0 35 82 1 0 35 83 1 0 36 84 1 0 36 85 1 0 36 86 1 0 M END

Standard InCHIKey	CYIDHGULAFNHLR-CGMRBEOHSA-N
Standard InCHI	InChI=1S/C31H50O5/c1-8-9-16-36-25(35)11-10-19(2)20-12-15-30(6)27-21(32)17-23-28(3,4)24(34)13-14-29(23,5)26(27)22(33)18-31(20,30)7/h19-21,23-24,32,34H,8-18H2,1-7H3/t19-,20-,21+,23+,24+,29+,30+,31-/m1/s1
SMILES	CCCCOC(=O)CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	502.37	Volume:	546.548 ? Van der Waals volume.
Dense:	0.919	LogP:	4.256 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.863 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.077 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	22.0
TPSA:	83.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.329	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.766	Fsp³:	0.871
MCE-18:	81.931 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.923	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.394	Promiscuous compounds:	0.362

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.053	MDCK Permeability:	-4.792
Pgp-inhibitor:	0.157	Pgp-substrate:	0.483
PAMPA:	0.952 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.778	30% Bioavailability (F30%):	0.699
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.102	MRP1:	0.946
Plasma Protein Binding (PPB):	90.848%	Volume Distribution (VD):	-0.126
Fu:	9.701% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.998	BCRP inhibitor:	0.083
BSEP inhibitor:	0.884

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.977
CYP2C19-inhibitor:	0.937	CYP2C19-substrate:	0.985
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.015
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.751 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

9.297

Half-life (T1/2):

0.513

ADMET: Toxicity

hERG Blockers:	0.028	hERG Blockers (10um):	0.168
Human Hepatotoxicity (H-HT):	0.543	Drug-induced Liver Injury (DILI):	0.237
AMES Toxicity:	0.585	Rat Oral Acute Toxicity:	0.658
Maximum Recommended Daily Dose:	0.43	Skin Sensitization:	0.999
Carcinogencity:	0.951	Eye Corrosion:	0.033
Eye Irritation:	0.732	Respiratory Toxicity:	0.811
Drug-induced Neurotoxicity:	0.058	Ototoxicity:	0.418
Hematotoxicity:	0.7	Drug-induced Nephrotoxicity:	0.979
Genotoxicity:	0.416	RPMI-8226 Immunitoxicity:	0.137
A549 Cytotoxicity:	0.481	Hek293 Cytotoxicity:	0.248
BCF:	1.323 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.144 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.779 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.108 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.phytochem.2005.10.025]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	fruit body	n.a.	PMID[11520245]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12045343]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[14695801]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1791484]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	spore	n.a.	PMID[18827358]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	fruiting bodies	Nagano, Japan	2008-MAY	PMID[20039640]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20384295]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	fruiting bodies	n.a.	n.a.	PMID[20702092]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	fruiting bodies	n.a.	n.a.	PMID[21924611]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22014750]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	fruit body	n.a.	PMID[22044278]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	fruiting body	n.a.	n.a.	PMID[22047696]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26222905]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	fruit body	n.a.	PMID[9635497]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Individual protein	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT204	Individual protein	Acetylcholinesterase	Homo sapiens	IC50	=	11580.0	nM	PMID[16124771]
NPT439	Individual protein	Butyrylcholinesterase	Homo sapiens	IC50	>	200000.0	nM	PMID[19687244]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC7124 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17382
0.1-0.2	27802
0.2-0.3	4394
0.3-0.4	218
0.4-0.5	43
0.5-0.6	13
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7761	Intermediate Similarity	NPC184870
0.7647	Intermediate Similarity	NPC307954
0.6053	Remote Similarity	NPC129689
0.6	Remote Similarity	NPC121339
0.5942	Remote Similarity	NPC477149
0.5897	Remote Similarity	NPC281702
0.5417	Remote Similarity	NPC233116
0.52	Remote Similarity	NPC191684
0.5195	Remote Similarity	NPC28656
0.5195	Remote Similarity	NPC264404
0.519	Remote Similarity	NPC216245
0.5143	Remote Similarity	NPC297199
0.5132	Remote Similarity	NPC482597
0.5128	Remote Similarity	NPC144660
0.5067	Remote Similarity	NPC484084
0.5065	Remote Similarity	NPC472930
0.5062	Remote Similarity	NPC472924

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC7124 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6585
0.1-0.2	2395
0.2-0.3	170
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data