NPASS drugs

Drug Information

Drug ID:	NPD5785
Drug Name:	Gemeprost
Molecular Formula:	C23H38O5
Canonical SMILES:	CCCCC([C@@H](/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCC/C=C/C(=O)OC)O)(C)C
Standard InCHI:	InChI=1S/C23H38O5/c1-5-6-15-23(2,3)21(26)14-13-18-17(19(24)16-20(18)25)11-9-7-8-10-12-22(27)28-4/h10,12-14,17-18,20-21,25-26H,5-9,11,15-16H2,1-4H3/b12-10+,14-13+/t17-,18-,20-,21-/m1/s1
Standard InCHIKey:	KYBOHGVERHWSSV-VNIVIJDLSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD5785

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	124
0.1-0.2	725
0.2-0.3	3063
0.3-0.4	6669
0.4-0.5	9743
0.5-0.6	5055
0.6-0.7	4302
0.7-0.8	1180
0.8-0.85	24
0.85-0.9	4
0.9-0.95	1
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9048	NPC7414
High Similarity	0.8929	NPC47031
High Similarity	0.881	NPC115418
High Similarity	0.869	NPC201225
High Similarity	0.869	NPC164308
Intermediate Similarity	0.8495	NPC476488
Intermediate Similarity	0.8495	NPC476487
Intermediate Similarity	0.8462	NPC145666
Intermediate Similarity	0.8353	NPC192006
Intermediate Similarity	0.8333	NPC279537

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD5785 OpenBabel08211708292D 30 30 0 0 1 0 0 0 0 0999 V2000 -1.6215 -3.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2756 -3.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4666 -4.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1191 7.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2147 -2.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2202 -2.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7248 2.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9328 3.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4680 2.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1896 4.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2601 1.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3975 5.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5878 -0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1810 -1.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3676 -3.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 0.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3090 0.9511 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5000 1.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7688 -2.5316 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6544 6.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3621 -3.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 2.5388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 -0.8090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7634 -2.4271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2967 5.8929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8623 7.1801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5823 -0.7045 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3511 -3.2361 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 5 1 0 0 0 0 2 23 1 0 0 0 0 3 23 1 0 0 0 0 4 28 1 0 0 0 0 5 6 1 0 0 0 0 6 15 1 0 0 0 0 7 8 1 0 0 0 0 7 9 1 0 0 0 0 8 10 1 0 0 0 0 9 11 1 0 0 0 0 10 12 2 0 0 0 0 12 22 1 0 0 0 0 13 14 2 0 0 0 0 15 23 1 0 0 0 0 16 19 1 0 0 0 0 16 20 1 0 0 0 0 17 11 1 6 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 18 13 1 1 0 0 0 18 20 1 0 0 0 0 19 24 2 0 0 0 0 20 25 1 6 0 0 0 21 14 1 1 0 0 0 21 23 1 0 0 0 0 21 26 1 0 0 0 0 22 27 2 0 0 0 0 22 28 1 0 0 0 0 25 29 1 0 0 0 0 26 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001574
DrugBank	DB08964
ChEMBL	CHEMBL1908315
IUPHAR/BPS
PharmaGKB
KEGG Drug	D02073
PubChem CID	5282237
ChEBI	135626
CAS Number	64318-79-2

Drug Properties

Molecular Weight	394.27
ALogP	-0.474
MLogP	3.44
XLogP	4.208
HDA	5
HBD	2
Rotatable Bonds	19
TPSA	83.83
RO5 Violation	1