NPASS drugs

Drug Information

Drug ID:	NPD4690
Drug Name:	Norgestrel
Molecular Formula:	C21H28O2
Canonical SMILES:	C#CC1(O)CC[C@@H]2[C@]1(CC)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
Standard InCHI:	"InChI=1S/C21H28O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,13,16-19,23H,3,5-12H2,1H3/t16-,17+,18+,19-,20-,21?/m0/s1"
Standard InCHIKey:	WWYNJERNGUHSAO-CULCCENASA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4690

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	72556
0.1-0.2	129217
0.2-0.3	9605
0.3-0.4	332
0.4-0.5	27
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5893	NPC321187
Remote Similarity	0.5893	NPC599870
Remote Similarity	0.5614	NPC28159

Drug Structure

NPD4690 OpenBabel08211705262D 24 27 0 0 1 0 0 0 0 0999 V2000 1.7309 -0.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7228 -1.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8426 -0.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 -0.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5279 3.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0546 1.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6853 2.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2125 1.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5279 0.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8414 1.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6852 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8414 0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2126 3.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3705 2.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0546 2.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3705 1.9452 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5279 1.4588 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6853 1.9452 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8426 1.4588 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8426 0.4865 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 5.9227 3.4190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8417 -0.4859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7661 -0.1856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 4 3 0 0 0 0 3 20 1 0 0 0 0 4 21 1 0 0 0 0 5 7 1 0 0 0 0 5 14 1 0 0 0 0 6 8 1 0 0 0 0 6 15 1 0 0 0 0 9 11 1 0 0 0 0 10 12 1 0 0 0 0 10 19 1 0 0 0 0 11 20 1 0 0 0 0 12 21 1 0 0 0 0 13 14 2 0 0 0 0 13 15 1 0 0 0 0 14 16 1 0 0 0 0 15 22 2 0 0 0 0 16 8 1 6 0 0 0 16 17 1 0 0 0 0 17 9 1 1 0 0 0 17 18 1 0 0 0 0 18 7 1 6 0 0 0 18 19 1 0 0 0 0 19 20 1 1 0 0 0 20 21 1 6 0 0 0 21 23 1 0 0 0 0 23 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	312.21
ALogP	0.6153
MLogP	3.55
XLogP	3.813
HDA	2
HBD	1
Rotatable Bonds	3
TPSA	37.3
RO5 Violation	0