Drug Information| Drug ID:   | NPD6673 |
| Drug Name:   | Gestonorone Caproate |
| Molecular Formula:   | C26H38O4 |
| Canonical SMILES:   | CCCCCC(=O)O[C@@]1(CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12)C(=O)C |
| Standard InCHI:   | "InChI=1S/C26H38O4/c1-4-5-6-7-24(29)30-26(17(2)27)15-13-23-22-10-8-18-16-19(28)9-11-20(18)21(22)12-14-25(23,26)3/h16,20-23H,4-15H2,1-3H3/t20-,21+,22+,23-,25-,26-/m0/s1" |
| Standard InCHIKey:   | XURCMZMFZXXQDJ-UKNJCJGYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6673Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7333 | NPC305039 |
| Intermediate Similarity | 0.7333 | NPC612001 |
| Remote Similarity | 0.6 | NPC612035 |
| Remote Similarity | 0.5079 | NPC321187 |
| Remote Similarity | 0.5079 | NPC599870 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 414.28 |
| ALogP   | -0.4771 |
| MLogP   | 3.88 |
| XLogP   | 5.323 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 10 |
| TPSA   | 60.44 |
| RO5 Violation   | 1 |