NPASS drugs

Drug Information

Drug ID:	NPD5280
Drug Name:	megestrol
Molecular Formula:	C22H30O3
Canonical SMILES:	O=C1CC[C@]2(C(=C1)C(=C[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(O)C(=O)C)C)C)C
Standard InCHI:	"InChI=1S/C22H30O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h11-12,16-18,25H,5-10H2,1-4H3/t16-,17+,18+,20-,21+,22+/m1/s1"
Standard InCHIKey:	VXIMPSPISRVBPZ-NWUMPJBXSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5280

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	77227
0.1-0.2	124820
0.2-0.3	9346
0.3-0.4	328
0.4-0.5	11
0.5-0.6	8
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5893	NPC144258
Remote Similarity	0.5893	NPC611417
Remote Similarity	0.5789	NPC507316
Remote Similarity	0.5082	NPC310010
Remote Similarity	0.5082	NPC326627
Remote Similarity	0.5082	NPC600483
Remote Similarity	0.5079	NPC135731
Remote Similarity	0.5079	NPC548726

Drug Structure

NPD5280 OpenBabel08211706322D 26 29 0 0 1 0 0 0 0 0999 V2000 2.5244 -4.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9223 1.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3645 -0.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8409 0.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0457 -1.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5233 -0.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8395 -1.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2051 -1.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6821 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8397 -0.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6829 -2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2057 -3.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5241 -3.3976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 0.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0460 -2.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6827 -1.9412 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5236 -1.4554 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8415 -1.4559 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3651 -2.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3648 -1.9407 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8412 -0.4853 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7214 1.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9141 -3.4121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8403 0.4848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7629 0.1847 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 13 1 0 0 0 0 2 14 1 0 0 0 0 4 21 1 0 0 0 0 5 8 1 0 0 0 0 5 15 1 0 0 0 0 6 9 1 0 0 0 0 6 17 1 0 0 0 0 7 10 1 0 0 0 0 7 18 1 0 0 0 0 8 20 1 0 0 0 0 9 21 1 0 0 0 0 10 22 1 0 0 0 0 11 13 2 0 0 0 0 12 15 1 0 0 0 0 12 19 2 0 0 0 0 13 19 1 0 0 0 0 14 23 2 0 0 0 0 15 24 2 0 0 0 0 16 11 1 1 0 0 0 16 17 1 0 0 0 0 16 18 1 0 0 0 0 17 20 1 6 0 0 0 18 21 1 6 0 0 0 19 20 1 0 0 0 0 20 3 1 6 0 0 0 21 22 1 1 0 0 0 22 14 1 6 0 0 0 22 25 1 0 0 0 0 25 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000861
DrugBank
ChEMBL
IUPHAR/BPS	9128
PharmaGKB
KEGG Drug
PubChem CID	19090
ChEBI
CAS Number

Drug Properties

Molecular Weight	342.22
ALogP	1.1847
MLogP	3.55
XLogP	3.309
HDA	3
HBD	1
Rotatable Bonds	6
TPSA	54.37
RO5 Violation	0