NPASS drugs

Drug Information

Drug ID:	NPD5329
Drug Name:	medroxyprogesterone
Molecular Formula:	C22H32O3
Canonical SMILES:	O=C1CC[C@]2(C(=C1)[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(O)C(=O)C)C)C
Standard InCHI:	"InChI=1S/C22H32O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h12-13,16-18,25H,5-11H2,1-4H3/t13-,16+,17-,18-,20+,21-,22-/m0/s1"
Standard InCHIKey:	FRQMUZJSZHZSGN-HBNHAYAOSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5329

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	77344
0.1-0.2	123576
0.2-0.3	10411
0.3-0.4	370
0.4-0.5	30
0.5-0.6	6
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC507316
Remote Similarity	0.6792	NPC144258
Remote Similarity	0.6792	NPC611417
Remote Similarity	0.5862	NPC310010
Remote Similarity	0.5862	NPC326627
Remote Similarity	0.5862	NPC600483
Remote Similarity	0.5333	NPC317959
Remote Similarity	0.5333	NPC600298
Remote Similarity	0.5254	NPC106675

Drug Structure

NPD5329 OpenBabel08211706322D 26 29 0 0 1 0 0 0 0 0999 V2000 2.5244 -4.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9223 1.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3645 -0.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8409 0.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0457 -1.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5233 -0.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8395 -1.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2051 -1.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6821 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8397 -0.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6829 -2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2057 -3.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5241 -3.3976 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0003 0.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0460 -2.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6827 -1.9412 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5236 -1.4554 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8415 -1.4559 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3651 -2.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3648 -1.9407 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8412 -0.4853 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7214 1.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9141 -3.4121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8403 0.4848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7629 0.1847 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 14 1 0 0 0 0 4 21 1 0 0 0 0 5 8 1 0 0 0 0 5 15 1 0 0 0 0 6 9 1 0 0 0 0 6 17 1 0 0 0 0 7 10 1 0 0 0 0 7 18 1 0 0 0 0 8 20 1 0 0 0 0 9 21 1 0 0 0 0 10 22 1 0 0 0 0 11 13 1 0 0 0 0 12 15 1 0 0 0 0 12 19 2 0 0 0 0 13 1 1 1 0 0 0 13 19 1 0 0 0 0 14 23 2 0 0 0 0 15 24 2 0 0 0 0 16 11 1 1 0 0 0 16 17 1 0 0 0 0 16 18 1 0 0 0 0 17 20 1 6 0 0 0 18 21 1 6 0 0 0 19 20 1 0 0 0 0 20 3 1 6 0 0 0 21 22 1 1 0 0 0 22 14 1 6 0 0 0 22 25 1 0 0 0 0 25 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001211
DrugBank
ChEMBL
IUPHAR/BPS	2879
PharmaGKB
KEGG Drug
PubChem CID	10631
ChEBI
CAS Number

Drug Properties

Molecular Weight	344.24
ALogP	0.1945
MLogP	3.55
XLogP	3.539
HDA	3
HBD	1
Rotatable Bonds	6
TPSA	54.37
RO5 Violation	0