NPASS Compound

Natural Product: NPC99411

Natural Product ID	NPC99411
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Ganoderic Acid T-Q
IUPAC Name	(Z,6R)-6-[(5R,10S,13R,14R,17R)-15-acetyloxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid
Synonyms	Ganoderic Acid T-Q
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL466999
PubChem CID	44566902
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 86 0 0 0 0 0 0 0 0999 V2000 3.6276 1.7667 -0.4030 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3257 0.8110 0.6812 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9712 -0.5493 0.4303 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5001 -0.2613 0.3677 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2453 -1.4749 0.1382 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0580 -1.7588 -0.8263 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7430 -3.1201 -0.8707 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3692 -0.8277 -1.8887 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9042 0.3024 -1.9766 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2637 -1.1997 -2.9164 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9480 0.7089 1.1938 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5046 2.0401 1.7422 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1096 2.2444 1.1056 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3557 0.8471 1.0497 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6194 0.3055 2.4409 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4921 0.5026 0.2209 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2986 1.3776 -0.3267 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4574 0.9380 -1.1696 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0428 -0.2881 -0.4875 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3948 -0.6423 -0.9790 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9508 0.2965 -2.0125 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3687 -0.5955 0.2079 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4170 -2.0388 -1.4657 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9716 -2.3372 -2.5325 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7701 -3.0904 -0.6696 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5538 -2.6152 0.1077 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0227 -1.3884 -0.5966 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7598 -1.7759 -2.0382 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7406 -0.9074 -0.0369 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7411 -1.7436 0.2405 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5695 -1.3377 0.7789 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8631 0.1335 0.4233 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8106 0.2486 -1.0411 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6558 3.0962 1.9424 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1232 4.3360 1.6162 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8405 4.7581 0.4501 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9167 5.2202 2.4829 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8466 2.5332 -0.5847 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5443 2.3956 -0.1725 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9408 1.2244 -1.3294 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9169 1.1815 1.5874 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7541 -1.2426 1.2548 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7279 -0.9733 -0.5406 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5874 0.4610 -0.4382 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7257 0.2143 1.3655 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1110 -2.2929 0.8905 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1076 -3.8104 -0.3061 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7668 -2.9948 -0.4601 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7722 -3.3953 -1.9394 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7689 -0.4397 -3.3955 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0482 0.0516 2.1285 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1781 2.8682 1.4714 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3506 2.0739 2.8186 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2502 2.7092 0.1314 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2597 0.1772 3.0616 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2824 1.0333 2.9820 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1679 -0.6552 2.3934 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1567 2.4284 -0.1972 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2036 1.7477 -1.1474 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1941 0.7309 -2.2075 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0649 -0.0123 0.6096 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2962 1.2471 -1.5481 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2886 0.4364 -2.8789 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8870 -0.1915 -2.4088 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4669 -1.6104 0.6762 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9312 0.0574 1.0057 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3546 -0.1927 -0.0905 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5103 -3.5732 0.0290 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 -3.9280 -1.3753 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8061 -2.3782 1.1530 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8009 -3.4181 0.0042 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7157 -1.5236 -2.3539 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4467 -1.2769 -2.7417 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8521 -2.8716 -2.1752 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8867 -2.7911 0.0618 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6954 -1.5216 1.8508 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3515 -1.9209 0.2438 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6423 0.7195 -1.5600 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5140 -0.7282 -1.5355 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0704 0.9075 -1.3183 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4699 6.2515 2.3671 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8569 4.9790 3.5587 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9708 5.3322 2.1351 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 6 8 1 0 8 9 2 0 8 10 1 0 2 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 1 14 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 2 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 27 29 1 0 29 30 2 0 30 31 1 0 31 32 1 0 32 33 1 6 13 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 32 11 1 0 32 14 1 0 29 16 1 0 27 19 1 0 1 38 1 0 1 39 1 0 1 40 1 0 2 41 1 1 3 42 1 0 3 43 1 0 4 44 1 0 4 45 1 0 5 46 1 0 7 47 1 0 7 48 1 0 7 49 1 0 10 50 1 0 11 51 1 1 12 52 1 0 12 53 1 0 13 54 1 0 15 55 1 0 15 56 1 0 15 57 1 0 17 58 1 0 18 59 1 0 18 60 1 0 19 61 1 1 21 62 1 0 21 63 1 0 21 64 1 0 22 65 1 0 22 66 1 0 22 67 1 0 25 68 1 0 25 69 1 0 26 70 1 0 26 71 1 0 28 72 1 0 28 73 1 0 28 74 1 0 30 75 1 0 31 76 1 0 31 77 1 0 33 78 1 0 33 79 1 0 33 80 1 0 37 81 1 0 37 82 1 0 37 83 1 0 M END

Standard InCHIKey	JVABUELIHJXLKP-RRIGXFHTSA-N
Standard InCHI	InChI=1S/C32H46O5/c1-19(10-9-11-20(2)28(35)36)24-18-27(37-21(3)33)32(8)23-12-13-25-29(4,5)26(34)15-16-30(25,6)22(23)14-17-31(24,32)7/h11-12,14,19,24-25,27H,9-10,13,15-18H2,1-8H3,(H,35,36)/b20-11-/t19-,24-,25+,27?,30-,31-,32-/m1/s1
SMILES	C[C@H](CC/C=C(/C)C(=O)O)[C@H]1CC([C@@]2(C)C3=CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)C3=CC[C@]12C)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	510.33	Volume:	555.935 ? Van der Waals volume.
Dense:	0.918	LogP:	4.773 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.431 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.357 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	24.0
TPSA:	80.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	1.0	Rings:	4.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.305	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.056	Fsp³:	0.719
MCE-18:	82.836 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.871	Fluc inhibitor:	0.024 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.046 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.003 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.473	Promiscuous compounds:	0.137

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.986	MDCK Permeability:	-4.746
Pgp-inhibitor:	0.736	Pgp-substrate:	0.0
PAMPA:	0.797 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.369	30% Bioavailability (F30%):	0.219
50% Bioavailability (F50%):	0.95

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.005	MRP1:	0.999
Plasma Protein Binding (PPB):	89.777%	Volume Distribution (VD):	-0.026
Fu:	9.783% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.063
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.374	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.846	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.018	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.004
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.002
CYP2B6-substrate:	0.003	CYP2C8-inhibitor:	1.0
HLM stability:	0.399 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.922

Half-life (T1/2):

0.666

ADMET: Toxicity

hERG Blockers:	0.04	hERG Blockers (10um):	0.086
Human Hepatotoxicity (H-HT):	0.671	Drug-induced Liver Injury (DILI):	0.798
AMES Toxicity:	0.133	Rat Oral Acute Toxicity:	0.413
Maximum Recommended Daily Dose:	0.513	Skin Sensitization:	0.852
Carcinogencity:	0.538	Eye Corrosion:	0.01
Eye Irritation:	0.165	Respiratory Toxicity:	0.397
Drug-induced Neurotoxicity:	0.421	Ototoxicity:	0.667
Hematotoxicity:	0.585	Drug-induced Nephrotoxicity:	0.751
Genotoxicity:	0.969	RPMI-8226 Immunitoxicity:	0.052
A549 Cytotoxicity:	0.052	Hek293 Cytotoxicity:	0.215
BCF:	0.49 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.414 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.08 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.218 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.phytochem.2005.10.025]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	fruit body	n.a.	PMID[11520245]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12045343]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[14695801]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1791484]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	spore	n.a.	PMID[18827358]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	fruiting bodies	Nagano, Japan	2008-MAY	PMID[20039640]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20384295]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	fruiting bodies	n.a.	n.a.	PMID[20702092]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	fruiting bodies	n.a.	n.a.	PMID[21924611]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22014750]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	fruit body	n.a.	PMID[22044278]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	fruiting body	n.a.	n.a.	PMID[22047696]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26222905]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	fruit body	n.a.	PMID[9635497]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO25269	Ganoderma lucidum	Species	Ganodermataceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	5
IC50	2

Activity Type	# Activity
Cell line	2
Others	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT80	Cell line	Raji	Homo sapiens	Activity	=	70.0	%	DOI[10.6019/CHEMBL1201861]
NPT165	Cell line	HeLa	Homo sapiens	IC50	>	300000.0	nM	DrugMatrix in vitro pharmacology data
NPT2	Others	Unspecified	n.a.	Activity	=	0.0	%	PMID[26922225]
NPT2	Others	Unspecified	n.a.	Activity	=	26.4	%	PMID[22206869]
NPT2	Others	Unspecified	n.a.	Activity	=	74.6	%	PMID[20553004]
NPT2	Others	Unspecified	n.a.	Activity	=	95.3	%	Open TG-GATES in vivo data: Biochemistry
NPT2	Others	Unspecified	n.a.	IC50	=	281.0	molar ratio	PMID[21663319]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC99411 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22115
0.1-0.2	23754
0.2-0.3	3637
0.3-0.4	251
0.4-0.5	66
0.5-0.6	17
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC137552
0.7857	Intermediate Similarity	NPC136044
0.7778	Intermediate Similarity	NPC92022
0.7746	Intermediate Similarity	NPC39082
0.7746	Intermediate Similarity	NPC610107
0.7027	Intermediate Similarity	NPC489802
0.6901	Remote Similarity	NPC87552
0.65	Remote Similarity	NPC198442
0.6447	Remote Similarity	NPC285702
0.6447	Remote Similarity	NPC166745
0.6447	Remote Similarity	NPC235464
0.6234	Remote Similarity	NPC478312
0.6104	Remote Similarity	NPC478313
0.6104	Remote Similarity	NPC489790
0.6026	Remote Similarity	NPC85742
0.6026	Remote Similarity	NPC22421
0.5949	Remote Similarity	NPC58410
0.5732	Remote Similarity	NPC94393
0.5663	Remote Similarity	NPC166120
0.561	Remote Similarity	NPC478299
0.557	Remote Similarity	NPC478308
0.55	Remote Similarity	NPC489801
0.5385	Remote Similarity	NPC212948
0.5349	Remote Similarity	NPC489806
0.5316	Remote Similarity	NPC138536
0.5301	Remote Similarity	NPC489803
0.5301	Remote Similarity	NPC489804
0.5244	Remote Similarity	NPC489789
0.5233	Remote Similarity	NPC489805
0.5176	Remote Similarity	NPC478303
0.5128	Remote Similarity	NPC142253
0.5128	Remote Similarity	NPC3511
0.5114	Remote Similarity	NPC478310

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC99411 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6518
0.1-0.2	2542
0.2-0.3	87
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data