NPASS Compound

Natural Product: NPC478299

Natural Product ID	NPC478299
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UVAQIPOTFIONBQ-YZQFCQQCSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	127032431
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 91 94 0 0 0 0 0 0 0 0999 V2000 -7.1919 -0.4175 1.2341 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6935 0.9900 1.0207 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9236 1.3167 0.0044 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4939 0.3391 -0.9912 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9433 0.2695 -1.1118 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3146 -0.1087 0.1604 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7424 -1.5004 0.6547 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9396 0.2451 0.4944 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7089 -0.3313 1.9154 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2000 -0.3250 2.1151 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3081 0.2615 0.8465 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3025 1.7587 1.0369 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6756 -0.1490 0.4657 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0244 0.1319 -0.7827 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0800 0.7920 -1.6593 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3622 0.4722 -1.4673 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7396 -0.1791 -0.1770 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5311 -1.6614 -0.3461 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3773 -0.1850 -1.3180 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2683 -1.4177 -2.1497 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9383 0.9708 -2.1566 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1351 0.4325 -2.9021 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0478 -0.2593 -1.9483 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1040 -0.6615 -2.3996 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7435 -0.4734 -0.5307 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2306 -1.8769 -0.1472 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6300 0.4846 0.2765 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3204 -0.3110 -0.1423 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7942 -1.3892 0.7453 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5435 -0.8215 1.4370 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1375 0.5620 3.1906 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8368 0.1879 4.3023 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2216 -0.9991 4.4227 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1339 1.1925 5.3569 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5971 -0.4269 -2.2653 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1683 0.1575 -3.4406 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1249 1.4082 -3.3657 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7952 -0.5849 -4.6663 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0771 2.0378 1.9788 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8048 1.7498 2.9474 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6347 3.3129 1.8003 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0242 -0.3422 1.9699 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4043 -1.0753 1.6307 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5995 -0.8524 0.2958 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6098 2.3458 -0.0789 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9646 -0.6093 -0.8471 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8913 0.7256 -1.9828 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7289 1.3429 -1.3002 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9299 0.5304 0.9162 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9753 -2.2577 0.4179 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6698 -1.7423 0.1025 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0295 -1.4946 1.7231 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8624 1.3593 0.6752 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0216 -1.3853 1.9810 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2138 0.3229 2.6459 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1938 -1.3197 2.3015 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1566 2.0647 2.0249 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1670 2.3423 0.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3534 2.0999 1.1239 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3882 0.5747 -2.7337 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1850 1.9199 -1.6232 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9925 1.3754 -1.6910 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5851 -0.2140 -2.3442 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5909 -2.2415 0.5687 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5188 -1.8283 -0.7337 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1790 -2.0677 -1.1496 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6860 -2.2126 -1.6642 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2410 -1.8571 -2.4461 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6983 -1.1431 -3.0723 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2200 1.3922 -2.8557 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3254 1.7370 -1.4305 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8240 -0.2306 -3.7150 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7400 1.2717 -3.3449 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5026 -2.6476 -0.4258 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1881 -2.0505 -0.6825 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4757 -1.9009 0.9460 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1434 0.6132 1.2751 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6253 1.4875 -0.2041 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6638 0.1063 0.3543 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2195 0.6570 0.4268 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5191 -1.6974 1.5326 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4569 -2.3001 0.2168 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0792 -1.7007 1.9361 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9085 -0.0703 2.1660 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3444 1.2210 6.1304 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1678 2.1876 4.8886 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1221 0.9326 5.8009 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9686 0.0469 -5.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4731 -1.4609 -4.7370 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7564 -0.9611 -4.6458 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8634 4.0123 2.5197 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 6 14 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 23 25 1 0 25 26 1 0 25 27 1 0 25 28 1 0 28 29 1 0 29 30 1 0 10 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 5 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 2 39 1 0 39 40 2 0 39 41 1 0 17 8 1 0 28 19 1 0 17 11 1 0 30 13 1 0 1 42 1 0 1 43 1 0 1 44 1 0 3 45 1 0 4 46 1 0 4 47 1 0 5 48 1 6 6 49 1 1 7 50 1 0 7 51 1 0 7 52 1 0 8 53 1 1 9 54 1 0 9 55 1 0 10 56 1 1 12 57 1 0 12 58 1 0 12 59 1 0 15 60 1 0 15 61 1 0 16 62 1 0 16 63 1 0 18 64 1 0 18 65 1 0 18 66 1 0 20 67 1 0 20 68 1 0 20 69 1 0 21 70 1 0 21 71 1 0 22 72 1 0 22 73 1 0 26 74 1 0 26 75 1 0 26 76 1 0 27 77 1 0 27 78 1 0 27 79 1 0 28 80 1 1 29 81 1 0 29 82 1 0 30 83 1 0 30 84 1 0 34 85 1 0 34 86 1 0 34 87 1 0 38 88 1 0 38 89 1 0 38 90 1 0 41 91 1 0 M END

Standard InCHIKey	UVAQIPOTFIONBQ-YZQFCQQCSA-N
Standard InCHI	InChI=1S/C34H50O7/c1-19(30(38)39)10-12-26(40-21(3)35)20(2)25-18-29(41-22(4)36)34(9)24-11-13-27-31(5,6)28(37)15-16-32(27,7)23(24)14-17-33(25,34)8/h10,20,25-27,29H,11-18H2,1-9H3,(H,38,39)/b19-10+/t20-,25+,26-,27-,29-,32+,33+,34+/m0/s1
SMILES	C/C(=CC[C@@H]([C@@H](C)[C@H]1C[C@@H]([C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3)OC(=O)C)OC(=O)C)/C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	570.36	Volume:	608.107 ? Van der Waals volume.
Dense:	0.938	LogP:	2.841 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.726 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.075 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	25.0
TPSA:	106.97 ? Topological Polar Surface Area.	H-Bond Acceptor:	7.0
H-Bond Donor:	1.0	Rings:	4.0
Heavy Atoms:	7.0

MedChem Properties

QED Drug-Likeness Score:	0.203	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.2	Fsp³:	0.765
MCE-18:	88.8 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.955	Fluc inhibitor:	0.006 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.018 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.39	Promiscuous compounds:	0.31

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.356	MDCK Permeability:	-5.01
Pgp-inhibitor:	0.991	Pgp-substrate:	0.001
PAMPA:	0.905 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.24	30% Bioavailability (F30%):	0.504
50% Bioavailability (F50%):	0.92

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.992
Plasma Protein Binding (PPB):	87.939%	Volume Distribution (VD):	-0.48
Fu:	7.971% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.003
BSEP inhibitor:	0.998

ADMET: Metabolism

CYP1A2-inhibitor:	0.071	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.206	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.014	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.014
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.159
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.792 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.03

Half-life (T1/2):

0.617

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.013
Human Hepatotoxicity (H-HT):	0.807	Drug-induced Liver Injury (DILI):	0.921
AMES Toxicity:	0.151	Rat Oral Acute Toxicity:	0.135
Maximum Recommended Daily Dose:	0.325	Skin Sensitization:	0.991
Carcinogencity:	0.75	Eye Corrosion:	0.028
Eye Irritation:	0.186	Respiratory Toxicity:	0.393
Drug-induced Neurotoxicity:	0.043	Ototoxicity:	0.749
Hematotoxicity:	0.783	Drug-induced Nephrotoxicity:	0.961
Genotoxicity:	0.853	RPMI-8226 Immunitoxicity:	0.038
A549 Cytotoxicity:	0.041	Hek293 Cytotoxicity:	0.038
BCF:	0.488 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.591 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.482 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.629 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40141	Ganoderma sp. BCC 16642	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26716912]
NPO40519	Ganoderma orbiforme BCC 22325	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28504879]
NPO40520	Ganoderma sp. BCC 60695	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28504879]
NPO40518	Ganoderma australe BCC 22314	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28504879]
NPO40141	Ganoderma sp. BCC 16642	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	2
IC50	2

Activity Type	# Activity
Cell line	2
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT189	Cell line	Vero	Chlorocebus aethiops	IC50	=	86000.0	nM	PMID[26716912]
NPT189	Cell line	Vero	Chlorocebus aethiops	IC50	=	86000.0	nM	PMID[28504879]
NPT115	Organism	Mycobacterium tuberculosis H37Ra	Mycobacterium tuberculosis H37Ra	MIC	>	50.0	ug.mL-1	PMID[26716912]
NPT88	Organism	Mycobacterium tuberculosis	Mycobacterium tuberculosis	MIC	>	50.0	ug.mL-1	PMID[28504879]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478299 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22229
0.1-0.2	24073
0.2-0.3	3239
0.3-0.4	235
0.4-0.5	41
0.5-0.6	24
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7857	Intermediate Similarity	NPC478300
0.7746	Intermediate Similarity	NPC489802
0.7746	Intermediate Similarity	NPC478301
0.7714	Intermediate Similarity	NPC69982
0.7703	Intermediate Similarity	NPC489805
0.75	Intermediate Similarity	NPC478310
0.7067	Intermediate Similarity	NPC92022
0.6579	Remote Similarity	NPC478297
0.6538	Remote Similarity	NPC478311
0.625	Remote Similarity	NPC478309
0.6203	Remote Similarity	NPC478305
0.6203	Remote Similarity	NPC52776
0.6125	Remote Similarity	NPC610168
0.6049	Remote Similarity	NPC478304
0.6049	Remote Similarity	NPC231673
0.6026	Remote Similarity	NPC478312
0.5976	Remote Similarity	NPC76162
0.5974	Remote Similarity	NPC478308
0.5904	Remote Similarity	NPC198442
0.5897	Remote Similarity	NPC42042
0.5897	Remote Similarity	NPC489801
0.5625	Remote Similarity	NPC85742
0.5625	Remote Similarity	NPC22421
0.561	Remote Similarity	NPC137552
0.561	Remote Similarity	NPC99411
0.5556	Remote Similarity	NPC489807
0.5556	Remote Similarity	NPC58410
0.5556	Remote Similarity	NPC478298
0.5476	Remote Similarity	NPC166120
0.5422	Remote Similarity	NPC489788
0.5422	Remote Similarity	NPC299325
0.5395	Remote Similarity	NPC482576
0.5366	Remote Similarity	NPC489808
0.5366	Remote Similarity	NPC489800
0.5325	Remote Similarity	NPC142253
0.5325	Remote Similarity	NPC3511
0.5176	Remote Similarity	NPC482571
0.5176	Remote Similarity	NPC480124
0.5176	Remote Similarity	NPC489795
0.5125	Remote Similarity	NPC489792

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478299 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6361
0.1-0.2	2688
0.2-0.3	100
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data