NPASS Compound

Natural Product: NPC478298

Natural Product ID	NPC478298
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FPSBBGUSAFEFFR-MVRGKCHRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	127032430
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 91 94 0 0 0 0 0 0 0 0999 V2000 7.3623 2.4222 -0.2765 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6513 1.3534 0.6977 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6621 0.6488 1.1820 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2184 0.9117 0.7588 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7618 -0.3617 0.1421 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3978 -0.4497 -0.4175 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2705 -1.8862 -1.0008 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2458 -0.2935 0.5101 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2727 1.0598 1.2294 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8256 1.5775 1.2476 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0629 0.2830 1.0318 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2423 -0.5591 2.2651 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3111 0.4741 0.6327 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8487 -0.2440 -0.3643 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1209 -1.2505 -1.1144 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3132 -1.4679 -0.6813 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8868 -0.2360 -0.1470 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8624 0.8234 -1.2371 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2662 0.0441 -0.6668 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3442 1.4066 -1.2977 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8489 -1.0086 -1.5886 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3087 -0.8070 -1.8208 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0145 0.0301 -0.8105 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4468 -0.2617 0.5549 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7658 -1.7285 0.8528 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2552 0.5482 1.5758 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9899 -0.0021 0.6838 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6331 1.2170 1.4995 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1928 1.4591 1.2985 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6585 2.5197 1.6893 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3898 -0.3313 -0.7766 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4048 0.6018 -0.9377 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0571 1.7976 -1.1178 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8480 0.2128 -0.9003 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7737 -0.7594 -0.7677 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6270 -1.8168 -0.5388 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5296 -2.4763 0.5215 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6755 -2.1859 -1.5534 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0371 1.0909 1.1129 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9948 1.7544 0.6606 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3261 0.0896 2.0280 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8671 1.9966 -1.1730 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2955 2.8836 -0.6089 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6916 3.2119 0.1479 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8569 -0.1285 1.8914 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7544 1.1587 1.7420 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1697 1.8000 0.1315 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8237 -1.1313 0.9845 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3133 0.2292 -1.2791 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0540 -1.8658 -2.0691 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2843 -2.4023 -0.9475 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6335 -2.5238 -0.3842 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2011 -1.0614 1.2899 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8262 1.7672 0.6228 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6085 0.9215 2.2810 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6333 2.3193 0.4749 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6247 2.0099 2.2380 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0341 -0.1876 2.9318 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7102 -0.4649 2.8521 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4061 -1.6179 2.0755 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1290 -0.9145 -2.1936 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6336 -2.2439 -1.1468 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3086 -2.3511 -0.0257 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8489 -1.7638 -1.6283 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0611 1.4281 -1.2111 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7247 1.5054 -1.1906 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8512 0.3153 -2.2453 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9594 1.3754 -2.2471 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3691 1.8165 -1.6301 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7681 2.1826 -0.6129 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6534 -2.0204 -1.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3208 -0.9134 -2.5597 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5324 -0.3655 -2.8310 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8001 -1.8161 -1.8377 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9745 1.1092 -0.9775 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4466 -2.1664 0.1001 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2599 -1.8548 1.8345 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7938 -2.2756 0.9140 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8268 0.3041 2.5661 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2836 0.0850 1.5536 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2726 1.6116 1.3393 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5340 -0.8790 1.2293 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2803 2.0775 1.3517 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7738 0.9098 2.5783 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0393 -0.7106 -1.4767 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2274 0.1627 0.1372 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4104 1.0209 -1.4120 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1209 -1.2239 -1.8917 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1582 -2.7049 -2.3664 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4347 -2.7839 -1.0239 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2407 -0.0309 2.4489 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 6 14 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 24 27 1 0 27 28 1 0 28 29 1 0 29 30 2 0 23 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 5 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 2 39 1 0 39 40 2 0 39 41 1 0 17 8 1 0 27 19 1 0 17 11 1 0 29 13 1 0 1 42 1 0 1 43 1 0 1 44 1 0 3 45 1 0 4 46 1 0 4 47 1 0 5 48 1 1 6 49 1 6 7 50 1 0 7 51 1 0 7 52 1 0 8 53 1 1 9 54 1 0 9 55 1 0 10 56 1 0 10 57 1 0 12 58 1 0 12 59 1 0 12 60 1 0 15 61 1 0 15 62 1 0 16 63 1 0 16 64 1 0 18 65 1 0 18 66 1 0 18 67 1 0 20 68 1 0 20 69 1 0 20 70 1 0 21 71 1 0 21 72 1 0 22 73 1 0 22 74 1 0 23 75 1 6 25 76 1 0 25 77 1 0 25 78 1 0 26 79 1 0 26 80 1 0 26 81 1 0 27 82 1 1 28 83 1 0 28 84 1 0 34 85 1 0 34 86 1 0 34 87 1 0 38 88 1 0 38 89 1 0 38 90 1 0 41 91 1 0 M END

Standard InCHIKey	FPSBBGUSAFEFFR-MVRGKCHRSA-N
Standard InCHI	InChI=1S/C34H50O7/c1-19(30(38)39)10-11-26(40-21(3)35)20(2)23-12-17-34(9)29-24(13-16-33(23,34)8)32(7)15-14-28(41-22(4)36)31(5,6)27(32)18-25(29)37/h10,20,23,26-28H,11-18H2,1-9H3,(H,38,39)/b19-10+/t20-,23+,26-,27-,28+,32+,33+,34-/m0/s1
SMILES	C/C(=CC[C@@H]([C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](C(C)(C)[C@@H]1CC3=O)OC(=O)C)OC(=O)C)/C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	570.36	Volume:	608.107 ? Van der Waals volume.
Dense:	0.938	LogP:	2.762 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.732 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.168 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	25.0
TPSA:	106.97 ? Topological Polar Surface Area.	H-Bond Acceptor:	7.0
H-Bond Donor:	1.0	Rings:	4.0
Heavy Atoms:	7.0

MedChem Properties

QED Drug-Likeness Score:	0.264	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.046	Fsp³:	0.765
MCE-18:	88.8 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.943	Fluc inhibitor:	0.002 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.017 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.424	Promiscuous compounds:	0.273

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.268	MDCK Permeability:	-4.974
Pgp-inhibitor:	0.999	Pgp-substrate:	0.001
PAMPA:	0.357 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.024
20% Bioavailability (F20%):	0.745	30% Bioavailability (F30%):	0.969
50% Bioavailability (F50%):	0.991

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.908
Plasma Protein Binding (PPB):	82.83%	Volume Distribution (VD):	-0.566
Fu:	12.021% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.002
BSEP inhibitor:	0.997

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.206
CYP2C19-inhibitor:	0.784	CYP2C19-substrate:	0.053
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.002
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.821	CYP3A4-substrate:	0.104
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.998
HLM stability:	0.916 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.925

Half-life (T1/2):

0.621

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.007
Human Hepatotoxicity (H-HT):	0.738	Drug-induced Liver Injury (DILI):	0.751
AMES Toxicity:	0.112	Rat Oral Acute Toxicity:	0.038
Maximum Recommended Daily Dose:	0.103	Skin Sensitization:	0.997
Carcinogencity:	0.6	Eye Corrosion:	0.047
Eye Irritation:	0.617	Respiratory Toxicity:	0.224
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.705
Hematotoxicity:	0.619	Drug-induced Nephrotoxicity:	0.895
Genotoxicity:	0.598	RPMI-8226 Immunitoxicity:	0.016
A549 Cytotoxicity:	0.044	Hek293 Cytotoxicity:	0.065
BCF:	0.675 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.854 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.873 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.019 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40141	Ganoderma sp. BCC 16642	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26716912]
NPO40519	Ganoderma orbiforme BCC 22325	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28504879]
NPO40520	Ganoderma sp. BCC 60695	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28504879]
NPO40518	Ganoderma australe BCC 22314	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28504879]
NPO40141	Ganoderma sp. BCC 16642	Strain	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	2
IC50	2

Activity Type	# Activity
Cell line	2
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT189	Cell line	Vero	Chlorocebus aethiops	IC50	=	33000.0	nM	PMID[26716912]
NPT189	Cell line	Vero	Chlorocebus aethiops	IC50	=	33000.0	nM	PMID[28504879]
NPT115	Organism	Mycobacterium tuberculosis H37Ra	Mycobacterium tuberculosis H37Ra	MIC	>	50.0	ug.mL-1	PMID[26716912]
NPT88	Organism	Mycobacterium tuberculosis	Mycobacterium tuberculosis	MIC	>	50.0	ug.mL-1	PMID[28504879]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478298 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21475
0.1-0.2	24285
0.2-0.3	3763
0.3-0.4	227
0.4-0.5	66
0.5-0.6	23
0.6-0.7	11
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC489807
0.7714	Intermediate Similarity	NPC478297
0.7714	Intermediate Similarity	NPC489808
0.7714	Intermediate Similarity	NPC489800
0.726	Intermediate Similarity	NPC489788
0.726	Intermediate Similarity	NPC299325
0.7162	Intermediate Similarity	NPC489795
0.6712	Remote Similarity	NPC276127
0.6712	Remote Similarity	NPC478307
0.6622	Remote Similarity	NPC478300
0.6267	Remote Similarity	NPC69982
0.6154	Remote Similarity	NPC478305
0.6154	Remote Similarity	NPC52776
0.6076	Remote Similarity	NPC610168
0.6	Remote Similarity	NPC489797
0.6	Remote Similarity	NPC478304
0.6	Remote Similarity	NPC489799
0.6	Remote Similarity	NPC231673
0.5875	Remote Similarity	NPC478311
0.5854	Remote Similarity	NPC489794
0.5802	Remote Similarity	NPC478309
0.5783	Remote Similarity	NPC489809
0.5769	Remote Similarity	NPC85742
0.5769	Remote Similarity	NPC22421
0.5679	Remote Similarity	NPC482571
0.5584	Remote Similarity	NPC601194
0.5556	Remote Similarity	NPC478299
0.5556	Remote Similarity	NPC478302
0.5542	Remote Similarity	NPC482565
0.55	Remote Similarity	NPC478301
0.5375	Remote Similarity	NPC478312
0.5357	Remote Similarity	NPC482566
0.5325	Remote Similarity	NPC8571
0.5294	Remote Similarity	NPC241221
0.5294	Remote Similarity	NPC482570
0.525	Remote Similarity	NPC141401
0.525	Remote Similarity	NPC478313
0.525	Remote Similarity	NPC489790
0.5176	Remote Similarity	NPC489805
0.5125	Remote Similarity	NPC478308
0.5057	Remote Similarity	NPC478310

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478298 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6170
0.1-0.2	2898
0.2-0.3	79
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data