Drug Information| Drug ID:   | NPD5168 |
| Drug Name:   | Clocortolone |
| Molecular Formula:   | C22H28ClFO4 |
| Canonical SMILES:   | OCC(=O)[C@H]1[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)Cl |
| Standard InCHI:   | "InChI=1S/C22H28ClFO4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-21(15,3)22(14,23)18(28)9-20(13,2)19(11)17(27)10-25/h4-5,7,11,13-14,16,18-19,25,28H,6,8-10H2,1-3H3/t11-,13+,14+,16+,18+,19-,20+,21+,22+/m1/s1" |
| Standard InCHIKey:   | YMTMADLUXIRMGX-RFPWEZLHSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD5168Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5867 | NPC313528 |
| Molecular Weight   | 410.17 |
| ALogP   | 0.288 |
| MLogP   | 3.22 |
| XLogP   | 2.355 |
| HDA   | 4 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 74.6 |
| RO5 Violation   | 0 |