Drug Information| Drug ID:   | NPD6050 |
| Drug Name:   | Megestrol Acetate |
| Molecular Formula:   | C24H32O4 |
| Canonical SMILES:   | O=C1CC[C@]2(C(=C1)C(=C[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(OC(=O)C)C(=O)C)C)C)C |
| Standard InCHI:   | "InChI=1S/C24H32O4/c1-14-12-18-19(22(4)9-6-17(27)13-21(14)22)7-10-23(5)20(18)8-11-24(23,15(2)25)28-16(3)26/h12-13,18-20H,6-11H2,1-5H3/t18-,19+,20+,22-,23+,24+/m1/s1" |
| Standard InCHIKey:   | RQZAXGRLVPAYTJ-GQFGMJRRSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6050Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6102 | NPC317959 |
| Remote Similarity | 0.6102 | NPC600298 |
| Remote Similarity | 0.5152 | NPC305039 |
| Remote Similarity | 0.5152 | NPC612001 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 384.23 |
| ALogP   | 1.5638 |
| MLogP   | 3.66 |
| XLogP   | 4.049 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 8 |
| TPSA   | 60.44 |
| RO5 Violation   | 0 |